summaryrefslogtreecommitdiff
path: root/vendor/github.com/jackc
diff options
context:
space:
mode:
Diffstat (limited to 'vendor/github.com/jackc')
-rw-r--r--vendor/github.com/jackc/chunkreader/v2/.travis.yml9
-rw-r--r--vendor/github.com/jackc/chunkreader/v2/README.md8
-rw-r--r--vendor/github.com/jackc/chunkreader/v2/chunkreader.go104
-rw-r--r--vendor/github.com/jackc/pgconn/.gitignore3
-rw-r--r--vendor/github.com/jackc/pgconn/CHANGELOG.md161
-rw-r--r--vendor/github.com/jackc/pgconn/LICENSE22
-rw-r--r--vendor/github.com/jackc/pgconn/README.md62
-rw-r--r--vendor/github.com/jackc/pgconn/doc.go29
-rw-r--r--vendor/github.com/jackc/pgconn/stmtcache/lru.go169
-rw-r--r--vendor/github.com/jackc/pgconn/stmtcache/stmtcache.go58
-rw-r--r--vendor/github.com/jackc/pgio/.travis.yml9
-rw-r--r--vendor/github.com/jackc/pgio/LICENSE22
-rw-r--r--vendor/github.com/jackc/pgio/README.md11
-rw-r--r--vendor/github.com/jackc/pgproto3/v2/.travis.yml9
-rw-r--r--vendor/github.com/jackc/pgproto3/v2/LICENSE22
-rw-r--r--vendor/github.com/jackc/pgproto3/v2/README.md18
-rw-r--r--vendor/github.com/jackc/pgproto3/v2/chunkreader.go19
-rw-r--r--vendor/github.com/jackc/pgproto3/v2/doc.go4
-rw-r--r--vendor/github.com/jackc/pgproto3/v2/frontend.go206
-rw-r--r--vendor/github.com/jackc/pgproto3/v2/pgproto3.go65
-rw-r--r--vendor/github.com/jackc/pgservicefile/.travis.yml9
-rw-r--r--vendor/github.com/jackc/pgservicefile/README.md5
-rw-r--r--vendor/github.com/jackc/pgservicefile/pgservicefile.go4
-rw-r--r--vendor/github.com/jackc/pgtype/CHANGELOG.md164
-rw-r--r--vendor/github.com/jackc/pgtype/README.md14
-rw-r--r--vendor/github.com/jackc/pgtype/aclitem.go138
-rw-r--r--vendor/github.com/jackc/pgtype/aclitem_array.go428
-rw-r--r--vendor/github.com/jackc/pgtype/array_type.go353
-rw-r--r--vendor/github.com/jackc/pgtype/bit.go45
-rw-r--r--vendor/github.com/jackc/pgtype/bool.go217
-rw-r--r--vendor/github.com/jackc/pgtype/bool_array.go517
-rw-r--r--vendor/github.com/jackc/pgtype/box.go165
-rw-r--r--vendor/github.com/jackc/pgtype/bpchar.go93
-rw-r--r--vendor/github.com/jackc/pgtype/bpchar_array.go517
-rw-r--r--vendor/github.com/jackc/pgtype/bytea.go163
-rw-r--r--vendor/github.com/jackc/pgtype/bytea_array.go489
-rw-r--r--vendor/github.com/jackc/pgtype/cid.go61
-rw-r--r--vendor/github.com/jackc/pgtype/cidr.go43
-rw-r--r--vendor/github.com/jackc/pgtype/cidr_array.go546
-rw-r--r--vendor/github.com/jackc/pgtype/circle.go150
-rw-r--r--vendor/github.com/jackc/pgtype/composite_fields.go107
-rw-r--r--vendor/github.com/jackc/pgtype/composite_type.go682
-rw-r--r--vendor/github.com/jackc/pgtype/convert.go476
-rw-r--r--vendor/github.com/jackc/pgtype/database_sql.go41
-rw-r--r--vendor/github.com/jackc/pgtype/date.go324
-rw-r--r--vendor/github.com/jackc/pgtype/date_array.go518
-rw-r--r--vendor/github.com/jackc/pgtype/daterange.go267
-rw-r--r--vendor/github.com/jackc/pgtype/enum_array.go428
-rw-r--r--vendor/github.com/jackc/pgtype/enum_type.go168
-rw-r--r--vendor/github.com/jackc/pgtype/float4.go282
-rw-r--r--vendor/github.com/jackc/pgtype/float4_array.go517
-rw-r--r--vendor/github.com/jackc/pgtype/float8.go272
-rw-r--r--vendor/github.com/jackc/pgtype/float8_array.go517
-rw-r--r--vendor/github.com/jackc/pgtype/generic_binary.go39
-rw-r--r--vendor/github.com/jackc/pgtype/generic_text.go39
-rw-r--r--vendor/github.com/jackc/pgtype/hstore.go465
-rw-r--r--vendor/github.com/jackc/pgtype/hstore_array.go489
-rw-r--r--vendor/github.com/jackc/pgtype/inet.go304
-rw-r--r--vendor/github.com/jackc/pgtype/inet_array.go546
-rw-r--r--vendor/github.com/jackc/pgtype/int2.go321
-rw-r--r--vendor/github.com/jackc/pgtype/int2_array.go909
-rw-r--r--vendor/github.com/jackc/pgtype/int4.go312
-rw-r--r--vendor/github.com/jackc/pgtype/int4_array.go909
-rw-r--r--vendor/github.com/jackc/pgtype/int4_multirange.go239
-rw-r--r--vendor/github.com/jackc/pgtype/int4range.go267
-rw-r--r--vendor/github.com/jackc/pgtype/int8.go298
-rw-r--r--vendor/github.com/jackc/pgtype/int8_array.go909
-rw-r--r--vendor/github.com/jackc/pgtype/int8_multirange.go239
-rw-r--r--vendor/github.com/jackc/pgtype/int8range.go267
-rw-r--r--vendor/github.com/jackc/pgtype/interval.go257
-rw-r--r--vendor/github.com/jackc/pgtype/json.go209
-rw-r--r--vendor/github.com/jackc/pgtype/json_array.go546
-rw-r--r--vendor/github.com/jackc/pgtype/jsonb.go85
-rw-r--r--vendor/github.com/jackc/pgtype/jsonb_array.go546
-rw-r--r--vendor/github.com/jackc/pgtype/line.go148
-rw-r--r--vendor/github.com/jackc/pgtype/lseg.go165
-rw-r--r--vendor/github.com/jackc/pgtype/ltree.go72
-rw-r--r--vendor/github.com/jackc/pgtype/macaddr.go173
-rw-r--r--vendor/github.com/jackc/pgtype/macaddr_array.go518
-rw-r--r--vendor/github.com/jackc/pgtype/multirange.go83
-rw-r--r--vendor/github.com/jackc/pgtype/name.go58
-rw-r--r--vendor/github.com/jackc/pgtype/num_multirange.go239
-rw-r--r--vendor/github.com/jackc/pgtype/numeric.go853
-rw-r--r--vendor/github.com/jackc/pgtype/numeric_array.go685
-rw-r--r--vendor/github.com/jackc/pgtype/numrange.go267
-rw-r--r--vendor/github.com/jackc/pgtype/oid.go81
-rw-r--r--vendor/github.com/jackc/pgtype/oid_value.go55
-rw-r--r--vendor/github.com/jackc/pgtype/path.go195
-rw-r--r--vendor/github.com/jackc/pgtype/pgtype.go1001
-rw-r--r--vendor/github.com/jackc/pgtype/pguint32.go162
-rw-r--r--vendor/github.com/jackc/pgtype/point.go214
-rw-r--r--vendor/github.com/jackc/pgtype/polygon.go226
-rw-r--r--vendor/github.com/jackc/pgtype/qchar.go152
-rw-r--r--vendor/github.com/jackc/pgtype/record.go126
-rw-r--r--vendor/github.com/jackc/pgtype/record_array.go318
-rw-r--r--vendor/github.com/jackc/pgtype/text.go212
-rw-r--r--vendor/github.com/jackc/pgtype/text_array.go517
-rw-r--r--vendor/github.com/jackc/pgtype/tid.go156
-rw-r--r--vendor/github.com/jackc/pgtype/time.go231
-rw-r--r--vendor/github.com/jackc/pgtype/timestamp.go261
-rw-r--r--vendor/github.com/jackc/pgtype/timestamp_array.go518
-rw-r--r--vendor/github.com/jackc/pgtype/timestamptz.go322
-rw-r--r--vendor/github.com/jackc/pgtype/timestamptz_array.go518
-rw-r--r--vendor/github.com/jackc/pgtype/tsrange.go267
-rw-r--r--vendor/github.com/jackc/pgtype/tsrange_array.go470
-rw-r--r--vendor/github.com/jackc/pgtype/tstzrange.go267
-rw-r--r--vendor/github.com/jackc/pgtype/tstzrange_array.go470
-rw-r--r--vendor/github.com/jackc/pgtype/typed_array.go.erb512
-rw-r--r--vendor/github.com/jackc/pgtype/typed_array_gen.sh31
-rw-r--r--vendor/github.com/jackc/pgtype/typed_multirange.go.erb239
-rw-r--r--vendor/github.com/jackc/pgtype/typed_multirange_gen.sh8
-rw-r--r--vendor/github.com/jackc/pgtype/typed_range.go.erb269
-rw-r--r--vendor/github.com/jackc/pgtype/typed_range_gen.sh7
-rw-r--r--vendor/github.com/jackc/pgtype/unknown.go44
-rw-r--r--vendor/github.com/jackc/pgtype/uuid.go231
-rw-r--r--vendor/github.com/jackc/pgtype/uuid_array.go573
-rw-r--r--vendor/github.com/jackc/pgtype/varbit.go133
-rw-r--r--vendor/github.com/jackc/pgtype/varchar.go66
-rw-r--r--vendor/github.com/jackc/pgtype/varchar_array.go517
-rw-r--r--vendor/github.com/jackc/pgtype/xid.go64
-rw-r--r--vendor/github.com/jackc/pgx/v4/CHANGELOG.md268
-rw-r--r--vendor/github.com/jackc/pgx/v4/LICENSE22
-rw-r--r--vendor/github.com/jackc/pgx/v4/README.md196
-rw-r--r--vendor/github.com/jackc/pgx/v4/batch.go228
-rw-r--r--vendor/github.com/jackc/pgx/v4/conn.go857
-rw-r--r--vendor/github.com/jackc/pgx/v4/doc.go340
-rw-r--r--vendor/github.com/jackc/pgx/v4/extended_query_builder.go161
-rw-r--r--vendor/github.com/jackc/pgx/v4/go_stdlib.go61
-rw-r--r--vendor/github.com/jackc/pgx/v4/logger.go107
-rw-r--r--vendor/github.com/jackc/pgx/v4/messages.go23
-rw-r--r--vendor/github.com/jackc/pgx/v4/rows.go351
-rw-r--r--vendor/github.com/jackc/pgx/v4/values.go280
-rw-r--r--vendor/github.com/jackc/pgx/v5/.gitignore (renamed from vendor/github.com/jackc/pgx/v4/.gitignore)3
-rw-r--r--vendor/github.com/jackc/pgx/v5/CHANGELOG.md434
-rw-r--r--vendor/github.com/jackc/pgx/v5/CONTRIBUTING.md121
-rw-r--r--vendor/github.com/jackc/pgx/v5/LICENSE (renamed from vendor/github.com/jackc/pgtype/LICENSE)0
-rw-r--r--vendor/github.com/jackc/pgx/v5/README.md174
-rw-r--r--vendor/github.com/jackc/pgx/v5/Rakefile18
-rw-r--r--vendor/github.com/jackc/pgx/v5/batch.go443
-rw-r--r--vendor/github.com/jackc/pgx/v5/conn.go1444
-rw-r--r--vendor/github.com/jackc/pgx/v5/copy_from.go (renamed from vendor/github.com/jackc/pgx/v4/copy_from.go)127
-rw-r--r--vendor/github.com/jackc/pgx/v5/derived_types.go262
-rw-r--r--vendor/github.com/jackc/pgx/v5/doc.go194
-rw-r--r--vendor/github.com/jackc/pgx/v5/extended_query_builder.go146
-rw-r--r--vendor/github.com/jackc/pgx/v5/internal/iobufpool/iobufpool.go70
-rw-r--r--vendor/github.com/jackc/pgx/v5/internal/pgio/README.md6
-rw-r--r--vendor/github.com/jackc/pgx/v5/internal/pgio/doc.go (renamed from vendor/github.com/jackc/pgio/doc.go)0
-rw-r--r--vendor/github.com/jackc/pgx/v5/internal/pgio/write.go (renamed from vendor/github.com/jackc/pgio/write.go)0
-rw-r--r--vendor/github.com/jackc/pgx/v5/internal/sanitize/sanitize.go (renamed from vendor/github.com/jackc/pgx/v4/internal/sanitize/sanitize.go)15
-rw-r--r--vendor/github.com/jackc/pgx/v5/internal/stmtcache/lru_cache.go112
-rw-r--r--vendor/github.com/jackc/pgx/v5/internal/stmtcache/stmtcache.go45
-rw-r--r--vendor/github.com/jackc/pgx/v5/internal/stmtcache/unlimited_cache.go77
-rw-r--r--vendor/github.com/jackc/pgx/v5/large_objects.go (renamed from vendor/github.com/jackc/pgx/v4/large_objects.go)76
-rw-r--r--vendor/github.com/jackc/pgx/v5/named_args.go295
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgconn/README.md29
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgconn/auth_scram.go (renamed from vendor/github.com/jackc/pgconn/auth_scram.go)12
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgconn/config.go (renamed from vendor/github.com/jackc/pgconn/config.go)271
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgconn/ctxwatch/context_watcher.go (renamed from vendor/github.com/jackc/pgconn/internal/ctxwatch/context_watcher.go)25
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgconn/defaults.go (renamed from vendor/github.com/jackc/pgconn/defaults.go)2
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgconn/defaults_windows.go (renamed from vendor/github.com/jackc/pgconn/defaults_windows.go)2
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgconn/doc.go38
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgconn/errors.go (renamed from vendor/github.com/jackc/pgconn/errors.go)134
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgconn/internal/bgreader/bgreader.go139
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgconn/krb5.go (renamed from vendor/github.com/jackc/pgconn/krb5.go)5
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgconn/pgconn.go (renamed from vendor/github.com/jackc/pgconn/pgconn.go)1400
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/README.md7
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/authentication_cleartext_password.go (renamed from vendor/github.com/jackc/pgproto3/v2/authentication_cleartext_password.go)9
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/authentication_gss.go (renamed from vendor/github.com/jackc/pgproto3/v2/authentication_gss.go)10
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/authentication_gss_continue.go (renamed from vendor/github.com/jackc/pgproto3/v2/authentication_gss_continue.go)10
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/authentication_md5_password.go (renamed from vendor/github.com/jackc/pgproto3/v2/authentication_md5_password.go)9
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/authentication_ok.go (renamed from vendor/github.com/jackc/pgproto3/v2/authentication_ok.go)9
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/authentication_sasl.go (renamed from vendor/github.com/jackc/pgproto3/v2/authentication_sasl.go)19
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/authentication_sasl_continue.go (renamed from vendor/github.com/jackc/pgproto3/v2/authentication_sasl_continue.go)14
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/authentication_sasl_final.go (renamed from vendor/github.com/jackc/pgproto3/v2/authentication_sasl_final.go)14
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/backend.go (renamed from vendor/github.com/jackc/pgproto3/v2/backend.go)120
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/backend_key_data.go (renamed from vendor/github.com/jackc/pgproto3/v2/backend_key_data.go)9
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/big_endian.go (renamed from vendor/github.com/jackc/pgproto3/v2/big_endian.go)0
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/bind.go (renamed from vendor/github.com/jackc/pgproto3/v2/bind.go)23
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/bind_complete.go (renamed from vendor/github.com/jackc/pgproto3/v2/bind_complete.go)4
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/cancel_request.go (renamed from vendor/github.com/jackc/pgproto3/v2/cancel_request.go)6
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/chunkreader.go90
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/close.go (renamed from vendor/github.com/jackc/pgproto3/v2/close.go)14
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/close_complete.go (renamed from vendor/github.com/jackc/pgproto3/v2/close_complete.go)4
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/command_complete.go (renamed from vendor/github.com/jackc/pgproto3/v2/command_complete.go)19
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/copy_both_response.go (renamed from vendor/github.com/jackc/pgproto3/v2/copy_both_response.go)16
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/copy_data.go (renamed from vendor/github.com/jackc/pgproto3/v2/copy_data.go)9
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/copy_done.go (renamed from vendor/github.com/jackc/pgproto3/v2/copy_done.go)4
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/copy_fail.go (renamed from vendor/github.com/jackc/pgproto3/v2/copy_fail.go)14
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/copy_in_response.go (renamed from vendor/github.com/jackc/pgproto3/v2/copy_in_response.go)16
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/copy_out_response.go (renamed from vendor/github.com/jackc/pgproto3/v2/copy_out_response.go)16
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/data_row.go (renamed from vendor/github.com/jackc/pgproto3/v2/data_row.go)27
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/describe.go (renamed from vendor/github.com/jackc/pgproto3/v2/describe.go)14
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/doc.go11
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/empty_query_response.go (renamed from vendor/github.com/jackc/pgproto3/v2/empty_query_response.go)4
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/error_response.go (renamed from vendor/github.com/jackc/pgproto3/v2/error_response.go)136
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/execute.go (renamed from vendor/github.com/jackc/pgproto3/v2/execute.go)15
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/flush.go (renamed from vendor/github.com/jackc/pgproto3/v2/flush.go)4
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/frontend.go468
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/function_call.go (renamed from vendor/github.com/jackc/pgproto3/v2/function_call.go)22
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/function_call_response.go (renamed from vendor/github.com/jackc/pgproto3/v2/function_call_response.go)12
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/gss_enc_request.go (renamed from vendor/github.com/jackc/pgproto3/v2/gss_enc_request.go)6
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/gss_response.go (renamed from vendor/github.com/jackc/pgproto3/v2/gss_response.go)8
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/no_data.go (renamed from vendor/github.com/jackc/pgproto3/v2/no_data.go)4
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/notice_response.go (renamed from vendor/github.com/jackc/pgproto3/v2/notice_response.go)6
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/notification_response.go (renamed from vendor/github.com/jackc/pgproto3/v2/notification_response.go)18
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/parameter_description.go (renamed from vendor/github.com/jackc/pgproto3/v2/parameter_description.go)17
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/parameter_status.go (renamed from vendor/github.com/jackc/pgproto3/v2/parameter_status.go)14
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/parse.go (renamed from vendor/github.com/jackc/pgproto3/v2/parse.go)17
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/parse_complete.go (renamed from vendor/github.com/jackc/pgproto3/v2/parse_complete.go)4
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/password_message.go (renamed from vendor/github.com/jackc/pgproto3/v2/password_message.go)11
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/pgproto3.go120
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/portal_suspended.go (renamed from vendor/github.com/jackc/pgproto3/v2/portal_suspended.go)4
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/query.go (renamed from vendor/github.com/jackc/pgproto3/v2/query.go)11
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/ready_for_query.go (renamed from vendor/github.com/jackc/pgproto3/v2/ready_for_query.go)4
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/row_description.go (renamed from vendor/github.com/jackc/pgproto3/v2/row_description.go)17
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/sasl_initial_response.go (renamed from vendor/github.com/jackc/pgproto3/v2/sasl_initial_response.go)21
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/sasl_response.go (renamed from vendor/github.com/jackc/pgproto3/v2/sasl_response.go)20
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/ssl_request.go (renamed from vendor/github.com/jackc/pgproto3/v2/ssl_request.go)6
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/startup_message.go (renamed from vendor/github.com/jackc/pgproto3/v2/startup_message.go)12
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/sync.go (renamed from vendor/github.com/jackc/pgproto3/v2/sync.go)4
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/terminate.go (renamed from vendor/github.com/jackc/pgproto3/v2/terminate.go)4
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgproto3/trace.go416
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/array.go (renamed from vendor/github.com/jackc/pgtype/array.go)177
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/array_codec.go405
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/bits.go210
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/bool.go343
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/box.go238
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/builtin_wrappers.go952
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/bytea.go255
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/circle.go222
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/composite.go602
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/convert.go108
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/date.go351
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/doc.go191
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/enum_codec.go109
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/float4.go319
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/float8.go365
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/hstore.go486
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/inet.go200
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/int.go1980
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/int.go.erb548
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/int_test.go.erb93
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/integration_benchmark_test.go.erb62
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/integration_benchmark_test_gen.sh2
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/interval.go297
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/json.go239
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/jsonb.go129
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/line.go225
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/lseg.go238
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/ltree.go122
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/macaddr.go162
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/multirange.go443
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/numeric.go823
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/path.go272
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/pgtype.go2104
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/pgtype_default.go231
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/point.go266
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/polygon.go253
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/qchar.go141
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/range.go (renamed from vendor/github.com/jackc/pgtype/range.go)71
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/range_codec.go379
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/record_codec.go125
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/register_default_pg_types.go35
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/register_default_pg_types_disabled.go6
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/text.go223
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/text_format_only_codec.go13
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/tid.go241
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/time.go274
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/timestamp.go355
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/timestamptz.go366
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/uint32.go325
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/uint64.go322
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/uuid.go289
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgtype/xml.go198
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgxpool/batch_results.go52
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgxpool/conn.go134
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgxpool/doc.go27
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgxpool/pool.go717
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgxpool/rows.go116
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgxpool/stat.go84
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgxpool/tracer.go33
-rw-r--r--vendor/github.com/jackc/pgx/v5/pgxpool/tx.go83
-rw-r--r--vendor/github.com/jackc/pgx/v5/rows.go856
-rw-r--r--vendor/github.com/jackc/pgx/v5/stdlib/sql.go (renamed from vendor/github.com/jackc/pgx/v4/stdlib/sql.go)386
-rw-r--r--vendor/github.com/jackc/pgx/v5/tracer.go107
-rw-r--r--vendor/github.com/jackc/pgx/v5/tx.go (renamed from vendor/github.com/jackc/pgx/v4/tx.go)235
-rw-r--r--vendor/github.com/jackc/pgx/v5/values.go63
-rw-r--r--vendor/github.com/jackc/puddle/v2/CHANGELOG.md79
-rw-r--r--vendor/github.com/jackc/puddle/v2/LICENSE (renamed from vendor/github.com/jackc/chunkreader/v2/LICENSE)2
-rw-r--r--vendor/github.com/jackc/puddle/v2/README.md80
-rw-r--r--vendor/github.com/jackc/puddle/v2/context.go24
-rw-r--r--vendor/github.com/jackc/puddle/v2/doc.go11
-rw-r--r--vendor/github.com/jackc/puddle/v2/internal/genstack/gen_stack.go85
-rw-r--r--vendor/github.com/jackc/puddle/v2/internal/genstack/stack.go39
-rw-r--r--vendor/github.com/jackc/puddle/v2/log.go32
-rw-r--r--vendor/github.com/jackc/puddle/v2/nanotime.go16
-rw-r--r--vendor/github.com/jackc/puddle/v2/pool.go710
-rw-r--r--vendor/github.com/jackc/puddle/v2/resource_list.go28
298 files changed, 27998 insertions, 34940 deletions
diff --git a/vendor/github.com/jackc/chunkreader/v2/.travis.yml b/vendor/github.com/jackc/chunkreader/v2/.travis.yml
deleted file mode 100644
index e176228..0000000
--- a/vendor/github.com/jackc/chunkreader/v2/.travis.yml
+++ /dev/null
@@ -1,9 +0,0 @@
-language: go
-
-go:
- - 1.x
- - tip
-
-matrix:
- allow_failures:
- - go: tip
diff --git a/vendor/github.com/jackc/chunkreader/v2/README.md b/vendor/github.com/jackc/chunkreader/v2/README.md
deleted file mode 100644
index 01209bf..0000000
--- a/vendor/github.com/jackc/chunkreader/v2/README.md
+++ /dev/null
@@ -1,8 +0,0 @@
-[![](https://godoc.org/github.com/jackc/chunkreader?status.svg)](https://godoc.org/github.com/jackc/chunkreader)
-[![Build Status](https://travis-ci.org/jackc/chunkreader.svg)](https://travis-ci.org/jackc/chunkreader)
-
-# chunkreader
-
-Package chunkreader provides an io.Reader wrapper that minimizes IO reads and memory allocations.
-
-Extracted from original implementation in https://github.com/jackc/pgx.
diff --git a/vendor/github.com/jackc/chunkreader/v2/chunkreader.go b/vendor/github.com/jackc/chunkreader/v2/chunkreader.go
deleted file mode 100644
index afea1c5..0000000
--- a/vendor/github.com/jackc/chunkreader/v2/chunkreader.go
+++ /dev/null
@@ -1,104 +0,0 @@
-// Package chunkreader provides an io.Reader wrapper that minimizes IO reads and memory allocations.
-package chunkreader
-
-import (
- "io"
-)
-
-// ChunkReader is a io.Reader wrapper that minimizes IO reads and memory allocations. It allocates memory in chunks and
-// will read as much as will fit in the current buffer in a single call regardless of how large a read is actually
-// requested. The memory returned via Next is owned by the caller. This avoids the need for an additional copy.
-//
-// The downside of this approach is that a large buffer can be pinned in memory even if only a small slice is
-// referenced. For example, an entire 4096 byte block could be pinned in memory by even a 1 byte slice. In these rare
-// cases it would be advantageous to copy the bytes to another slice.
-type ChunkReader struct {
- r io.Reader
-
- buf []byte
- rp, wp int // buf read position and write position
-
- config Config
-}
-
-// Config contains configuration parameters for ChunkReader.
-type Config struct {
- MinBufLen int // Minimum buffer length
-}
-
-// New creates and returns a new ChunkReader for r with default configuration.
-func New(r io.Reader) *ChunkReader {
- cr, err := NewConfig(r, Config{})
- if err != nil {
- panic("default config can't be bad")
- }
-
- return cr
-}
-
-// NewConfig creates and a new ChunkReader for r configured by config.
-func NewConfig(r io.Reader, config Config) (*ChunkReader, error) {
- if config.MinBufLen == 0 {
- // By historical reasons Postgres currently has 8KB send buffer inside,
- // so here we want to have at least the same size buffer.
- // @see https://github.com/postgres/postgres/blob/249d64999615802752940e017ee5166e726bc7cd/src/backend/libpq/pqcomm.c#L134
- // @see https://www.postgresql.org/message-id/0cdc5485-cb3c-5e16-4a46-e3b2f7a41322%40ya.ru
- config.MinBufLen = 8192
- }
-
- return &ChunkReader{
- r: r,
- buf: make([]byte, config.MinBufLen),
- config: config,
- }, nil
-}
-
-// Next returns buf filled with the next n bytes. The caller gains ownership of buf. It is not necessary to make a copy
-// of buf. If an error occurs, buf will be nil.
-func (r *ChunkReader) Next(n int) (buf []byte, err error) {
- // n bytes already in buf
- if (r.wp - r.rp) >= n {
- buf = r.buf[r.rp : r.rp+n]
- r.rp += n
- return buf, err
- }
-
- // available space in buf is less than n
- if len(r.buf) < n {
- r.copyBufContents(r.newBuf(n))
- }
-
- // buf is large enough, but need to shift filled area to start to make enough contiguous space
- minReadCount := n - (r.wp - r.rp)
- if (len(r.buf) - r.wp) < minReadCount {
- newBuf := r.newBuf(n)
- r.copyBufContents(newBuf)
- }
-
- if err := r.appendAtLeast(minReadCount); err != nil {
- return nil, err
- }
-
- buf = r.buf[r.rp : r.rp+n]
- r.rp += n
- return buf, nil
-}
-
-func (r *ChunkReader) appendAtLeast(fillLen int) error {
- n, err := io.ReadAtLeast(r.r, r.buf[r.wp:], fillLen)
- r.wp += n
- return err
-}
-
-func (r *ChunkReader) newBuf(size int) []byte {
- if size < r.config.MinBufLen {
- size = r.config.MinBufLen
- }
- return make([]byte, size)
-}
-
-func (r *ChunkReader) copyBufContents(dest []byte) {
- r.wp = copy(dest, r.buf[r.rp:r.wp])
- r.rp = 0
- r.buf = dest
-}
diff --git a/vendor/github.com/jackc/pgconn/.gitignore b/vendor/github.com/jackc/pgconn/.gitignore
deleted file mode 100644
index e980f55..0000000
--- a/vendor/github.com/jackc/pgconn/.gitignore
+++ /dev/null
@@ -1,3 +0,0 @@
-.envrc
-vendor/
-.vscode
diff --git a/vendor/github.com/jackc/pgconn/CHANGELOG.md b/vendor/github.com/jackc/pgconn/CHANGELOG.md
deleted file mode 100644
index 3550b43..0000000
--- a/vendor/github.com/jackc/pgconn/CHANGELOG.md
+++ /dev/null
@@ -1,161 +0,0 @@
-# 1.14.0 (February 11, 2023)
-
-* Fix: each connection attempt to new node gets own timeout (Nathan Giardina)
-* Set SNI for SSL connections (Stas Kelvich)
-* Fix: CopyFrom I/O race (Tommy Reilly)
-* Minor dependency upgrades
-
-# 1.13.0 (August 6, 2022)
-
-* Add sslpassword support (Eric McCormack and yun.xu)
-* Add prefer-standby target_session_attrs support (sergey.bashilov)
-* Fix GSS ErrorResponse handling (Oliver Tan)
-
-# 1.12.1 (May 7, 2022)
-
-* Fix: setting krbspn and krbsrvname in connection string (sireax)
-* Add support for Unix sockets on Windows (Eno Compton)
-* Stop ignoring ErrorResponse during SCRAM auth (Rafi Shamim)
-
-# 1.12.0 (April 21, 2022)
-
-* Add pluggable GSSAPI support (Oliver Tan)
-* Fix: Consider any "0A000" error a possible cached plan changed error due to locale
-* Better match psql fallback behavior with multiple hosts
-
-# 1.11.0 (February 7, 2022)
-
-* Support port in ip from LookupFunc to override config (James Hartig)
-* Fix TLS connection timeout (Blake Embrey)
-* Add support for read-only, primary, standby, prefer-standby target_session_attributes (Oscar)
-* Fix connect when receiving NoticeResponse
-
-# 1.10.1 (November 20, 2021)
-
-* Close without waiting for response (Kei Kamikawa)
-* Save waiting for network round-trip in CopyFrom (Rueian)
-* Fix concurrency issue with ContextWatcher
-* LRU.Get always checks context for cancellation / expiration (Georges Varouchas)
-
-# 1.10.0 (July 24, 2021)
-
-* net.Timeout errors are no longer returned when a query is canceled via context. A wrapped context error is returned.
-
-# 1.9.0 (July 10, 2021)
-
-* pgconn.Timeout only is true for errors originating in pgconn (Michael Darr)
-* Add defaults for sslcert, sslkey, and sslrootcert (Joshua Brindle)
-* Solve issue with 'sslmode=verify-full' when there are multiple hosts (mgoddard)
-* Fix default host when parsing URL without host but with port
-* Allow dbname query parameter in URL conn string
-* Update underlying dependencies
-
-# 1.8.1 (March 25, 2021)
-
-* Better connection string sanitization (ip.novikov)
-* Use proper pgpass location on Windows (Moshe Katz)
-* Use errors instead of golang.org/x/xerrors
-* Resume fallback on server error in Connect (Andrey Borodin)
-
-# 1.8.0 (December 3, 2020)
-
-* Add StatementErrored method to stmtcache.Cache. This allows the cache to purge invalidated prepared statements. (Ethan Pailes)
-
-# 1.7.2 (November 3, 2020)
-
-* Fix data value slices into work buffer with capacities larger than length.
-
-# 1.7.1 (October 31, 2020)
-
-* Do not asyncClose after receiving FATAL error from PostgreSQL server
-
-# 1.7.0 (September 26, 2020)
-
-* Exec(Params|Prepared) return ResultReader with FieldDescriptions loaded
-* Add ReceiveResults (Sebastiaan Mannem)
-* Fix parsing DSN connection with bad backslash
-* Add PgConn.CleanupDone so connection pools can determine when async close is complete
-
-# 1.6.4 (July 29, 2020)
-
-* Fix deadlock on error after CommandComplete but before ReadyForQuery
-* Fix panic on parsing DSN with trailing '='
-
-# 1.6.3 (July 22, 2020)
-
-* Fix error message after AppendCertsFromPEM failure (vahid-sohrabloo)
-
-# 1.6.2 (July 14, 2020)
-
-* Update pgservicefile library
-
-# 1.6.1 (June 27, 2020)
-
-* Update golang.org/x/crypto to latest
-* Update golang.org/x/text to 0.3.3
-* Fix error handling for bad PGSERVICE definition
-* Redact passwords in ParseConfig errors (Lukas Vogel)
-
-# 1.6.0 (June 6, 2020)
-
-* Fix panic when closing conn during cancellable query
-* Fix behavior of sslmode=require with sslrootcert present (Petr Jediný)
-* Fix field descriptions available after command concluded (Tobias Salzmann)
-* Support connect_timeout (georgysavva)
-* Handle IPv6 in connection URLs (Lukas Vogel)
-* Fix ValidateConnect with cancelable context
-* Improve CopyFrom performance
-* Add Config.Copy (georgysavva)
-
-# 1.5.0 (March 30, 2020)
-
-* Update golang.org/x/crypto for security fix
-* Implement "verify-ca" SSL mode (Greg Curtis)
-
-# 1.4.0 (March 7, 2020)
-
-* Fix ExecParams and ExecPrepared handling of empty query.
-* Support reading config from PostgreSQL service files.
-
-# 1.3.2 (February 14, 2020)
-
-* Update chunkreader to v2.0.1 for optimized default buffer size.
-
-# 1.3.1 (February 5, 2020)
-
-* Fix CopyFrom deadlock when multiple NoticeResponse received during copy
-
-# 1.3.0 (January 23, 2020)
-
-* Add Hijack and Construct.
-* Update pgproto3 to v2.0.1.
-
-# 1.2.1 (January 13, 2020)
-
-* Fix data race in context cancellation introduced in v1.2.0.
-
-# 1.2.0 (January 11, 2020)
-
-## Features
-
-* Add Insert(), Update(), Delete(), and Select() statement type query methods to CommandTag.
-* Add PgError.SQLState method. This could be used for compatibility with other drivers and databases.
-
-## Performance
-
-* Improve performance when context.Background() is used. (bakape)
-* CommandTag.RowsAffected is faster and does not allocate.
-
-## Fixes
-
-* Try to cancel any in-progress query when a conn is closed by ctx cancel.
-* Handle NoticeResponse during CopyFrom.
-* Ignore errors sending Terminate message while closing connection. This mimics the behavior of libpq PGfinish.
-
-# 1.1.0 (October 12, 2019)
-
-* Add PgConn.IsBusy() method.
-
-# 1.0.1 (September 19, 2019)
-
-* Fix statement cache not properly cleaning discarded statements.
diff --git a/vendor/github.com/jackc/pgconn/LICENSE b/vendor/github.com/jackc/pgconn/LICENSE
deleted file mode 100644
index aebadd6..0000000
--- a/vendor/github.com/jackc/pgconn/LICENSE
+++ /dev/null
@@ -1,22 +0,0 @@
-Copyright (c) 2019-2021 Jack Christensen
-
-MIT License
-
-Permission is hereby granted, free of charge, to any person obtaining
-a copy of this software and associated documentation files (the
-"Software"), to deal in the Software without restriction, including
-without limitation the rights to use, copy, modify, merge, publish,
-distribute, sublicense, and/or sell copies of the Software, and to
-permit persons to whom the Software is furnished to do so, subject to
-the following conditions:
-
-The above copyright notice and this permission notice shall be
-included in all copies or substantial portions of the Software.
-
-THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
-EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
-MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
-NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
-LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
-OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
-WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/vendor/github.com/jackc/pgconn/README.md b/vendor/github.com/jackc/pgconn/README.md
deleted file mode 100644
index 9af04fe..0000000
--- a/vendor/github.com/jackc/pgconn/README.md
+++ /dev/null
@@ -1,62 +0,0 @@
-[![](https://godoc.org/github.com/jackc/pgconn?status.svg)](https://godoc.org/github.com/jackc/pgconn)
-![CI](https://github.com/jackc/pgconn/workflows/CI/badge.svg)
-
----
-
-This version is used with pgx `v4`. In pgx `v5` it is part of the https://github.com/jackc/pgx repository.
-
----
-
-# pgconn
-
-Package pgconn is a low-level PostgreSQL database driver. It operates at nearly the same level as the C library libpq.
-It is primarily intended to serve as the foundation for higher level libraries such as https://github.com/jackc/pgx.
-Applications should handle normal queries with a higher level library and only use pgconn directly when required for
-low-level access to PostgreSQL functionality.
-
-## Example Usage
-
-```go
-pgConn, err := pgconn.Connect(context.Background(), os.Getenv("DATABASE_URL"))
-if err != nil {
- log.Fatalln("pgconn failed to connect:", err)
-}
-defer pgConn.Close(context.Background())
-
-result := pgConn.ExecParams(context.Background(), "SELECT email FROM users WHERE id=$1", [][]byte{[]byte("123")}, nil, nil, nil)
-for result.NextRow() {
- fmt.Println("User 123 has email:", string(result.Values()[0]))
-}
-_, err = result.Close()
-if err != nil {
- log.Fatalln("failed reading result:", err)
-}
-```
-
-## Testing
-
-The pgconn tests require a PostgreSQL database. It will connect to the database specified in the `PGX_TEST_CONN_STRING`
-environment variable. The `PGX_TEST_CONN_STRING` environment variable can be a URL or DSN. In addition, the standard `PG*`
-environment variables will be respected. Consider using [direnv](https://github.com/direnv/direnv) to simplify
-environment variable handling.
-
-### Example Test Environment
-
-Connect to your PostgreSQL server and run:
-
-```
-create database pgx_test;
-```
-
-Now you can run the tests:
-
-```bash
-PGX_TEST_CONN_STRING="host=/var/run/postgresql dbname=pgx_test" go test ./...
-```
-
-### Connection and Authentication Tests
-
-Pgconn supports multiple connection types and means of authentication. These tests are optional. They
-will only run if the appropriate environment variable is set. Run `go test -v | grep SKIP` to see if any tests are being
-skipped. Most developers will not need to enable these tests. See `ci/setup_test.bash` for an example set up if you need change
-authentication code.
diff --git a/vendor/github.com/jackc/pgconn/doc.go b/vendor/github.com/jackc/pgconn/doc.go
deleted file mode 100644
index cde58cd..0000000
--- a/vendor/github.com/jackc/pgconn/doc.go
+++ /dev/null
@@ -1,29 +0,0 @@
-// Package pgconn is a low-level PostgreSQL database driver.
-/*
-pgconn provides lower level access to a PostgreSQL connection than a database/sql or pgx connection. It operates at
-nearly the same level is the C library libpq.
-
-Establishing a Connection
-
-Use Connect to establish a connection. It accepts a connection string in URL or DSN and will read the environment for
-libpq style environment variables.
-
-Executing a Query
-
-ExecParams and ExecPrepared execute a single query. They return readers that iterate over each row. The Read method
-reads all rows into memory.
-
-Executing Multiple Queries in a Single Round Trip
-
-Exec and ExecBatch can execute multiple queries in a single round trip. They return readers that iterate over each query
-result. The ReadAll method reads all query results into memory.
-
-Context Support
-
-All potentially blocking operations take a context.Context. If a context is canceled while the method is in progress the
-method immediately returns. In most circumstances, this will close the underlying connection.
-
-The CancelRequest method may be used to request the PostgreSQL server cancel an in-progress query without forcing the
-client to abort.
-*/
-package pgconn
diff --git a/vendor/github.com/jackc/pgconn/stmtcache/lru.go b/vendor/github.com/jackc/pgconn/stmtcache/lru.go
deleted file mode 100644
index f0fb53b..0000000
--- a/vendor/github.com/jackc/pgconn/stmtcache/lru.go
+++ /dev/null
@@ -1,169 +0,0 @@
-package stmtcache
-
-import (
- "container/list"
- "context"
- "fmt"
- "sync/atomic"
-
- "github.com/jackc/pgconn"
-)
-
-var lruCount uint64
-
-// LRU implements Cache with a Least Recently Used (LRU) cache.
-type LRU struct {
- conn *pgconn.PgConn
- mode int
- cap int
- prepareCount int
- m map[string]*list.Element
- l *list.List
- psNamePrefix string
- stmtsToClear []string
-}
-
-// NewLRU creates a new LRU. mode is either ModePrepare or ModeDescribe. cap is the maximum size of the cache.
-func NewLRU(conn *pgconn.PgConn, mode int, cap int) *LRU {
- mustBeValidMode(mode)
- mustBeValidCap(cap)
-
- n := atomic.AddUint64(&lruCount, 1)
-
- return &LRU{
- conn: conn,
- mode: mode,
- cap: cap,
- m: make(map[string]*list.Element),
- l: list.New(),
- psNamePrefix: fmt.Sprintf("lrupsc_%d", n),
- }
-}
-
-// Get returns the prepared statement description for sql preparing or describing the sql on the server as needed.
-func (c *LRU) Get(ctx context.Context, sql string) (*pgconn.StatementDescription, error) {
- if ctx != context.Background() {
- select {
- case <-ctx.Done():
- return nil, ctx.Err()
- default:
- }
- }
-
- // flush an outstanding bad statements
- txStatus := c.conn.TxStatus()
- if (txStatus == 'I' || txStatus == 'T') && len(c.stmtsToClear) > 0 {
- for _, stmt := range c.stmtsToClear {
- err := c.clearStmt(ctx, stmt)
- if err != nil {
- return nil, err
- }
- }
- }
-
- if el, ok := c.m[sql]; ok {
- c.l.MoveToFront(el)
- return el.Value.(*pgconn.StatementDescription), nil
- }
-
- if c.l.Len() == c.cap {
- err := c.removeOldest(ctx)
- if err != nil {
- return nil, err
- }
- }
-
- psd, err := c.prepare(ctx, sql)
- if err != nil {
- return nil, err
- }
-
- el := c.l.PushFront(psd)
- c.m[sql] = el
-
- return psd, nil
-}
-
-// Clear removes all entries in the cache. Any prepared statements will be deallocated from the PostgreSQL session.
-func (c *LRU) Clear(ctx context.Context) error {
- for c.l.Len() > 0 {
- err := c.removeOldest(ctx)
- if err != nil {
- return err
- }
- }
-
- return nil
-}
-
-func (c *LRU) StatementErrored(sql string, err error) {
- pgErr, ok := err.(*pgconn.PgError)
- if !ok {
- return
- }
-
- // https://github.com/jackc/pgx/issues/1162
- //
- // We used to look for the message "cached plan must not change result type". However, that message can be localized.
- // Unfortunately, error code "0A000" - "FEATURE NOT SUPPORTED" is used for many different errors and the only way to
- // tell the difference is by the message. But all that happens is we clear a statement that we otherwise wouldn't
- // have so it should be safe.
- possibleInvalidCachedPlanError := pgErr.Code == "0A000"
- if possibleInvalidCachedPlanError {
- c.stmtsToClear = append(c.stmtsToClear, sql)
- }
-}
-
-func (c *LRU) clearStmt(ctx context.Context, sql string) error {
- elem, inMap := c.m[sql]
- if !inMap {
- // The statement probably fell off the back of the list. In that case, we've
- // ensured that it isn't in the cache, so we can declare victory.
- return nil
- }
-
- c.l.Remove(elem)
-
- psd := elem.Value.(*pgconn.StatementDescription)
- delete(c.m, psd.SQL)
- if c.mode == ModePrepare {
- return c.conn.Exec(ctx, fmt.Sprintf("deallocate %s", psd.Name)).Close()
- }
- return nil
-}
-
-// Len returns the number of cached prepared statement descriptions.
-func (c *LRU) Len() int {
- return c.l.Len()
-}
-
-// Cap returns the maximum number of cached prepared statement descriptions.
-func (c *LRU) Cap() int {
- return c.cap
-}
-
-// Mode returns the mode of the cache (ModePrepare or ModeDescribe)
-func (c *LRU) Mode() int {
- return c.mode
-}
-
-func (c *LRU) prepare(ctx context.Context, sql string) (*pgconn.StatementDescription, error) {
- var name string
- if c.mode == ModePrepare {
- name = fmt.Sprintf("%s_%d", c.psNamePrefix, c.prepareCount)
- c.prepareCount += 1
- }
-
- return c.conn.Prepare(ctx, name, sql, nil)
-}
-
-func (c *LRU) removeOldest(ctx context.Context) error {
- oldest := c.l.Back()
- c.l.Remove(oldest)
- psd := oldest.Value.(*pgconn.StatementDescription)
- delete(c.m, psd.SQL)
- if c.mode == ModePrepare {
- return c.conn.Exec(ctx, fmt.Sprintf("deallocate %s", psd.Name)).Close()
- }
- return nil
-}
diff --git a/vendor/github.com/jackc/pgconn/stmtcache/stmtcache.go b/vendor/github.com/jackc/pgconn/stmtcache/stmtcache.go
deleted file mode 100644
index d083e1b..0000000
--- a/vendor/github.com/jackc/pgconn/stmtcache/stmtcache.go
+++ /dev/null
@@ -1,58 +0,0 @@
-// Package stmtcache is a cache that can be used to implement lazy prepared statements.
-package stmtcache
-
-import (
- "context"
-
- "github.com/jackc/pgconn"
-)
-
-const (
- ModePrepare = iota // Cache should prepare named statements.
- ModeDescribe // Cache should prepare the anonymous prepared statement to only fetch the description of the statement.
-)
-
-// Cache prepares and caches prepared statement descriptions.
-type Cache interface {
- // Get returns the prepared statement description for sql preparing or describing the sql on the server as needed.
- Get(ctx context.Context, sql string) (*pgconn.StatementDescription, error)
-
- // Clear removes all entries in the cache. Any prepared statements will be deallocated from the PostgreSQL session.
- Clear(ctx context.Context) error
-
- // StatementErrored informs the cache that the given statement resulted in an error when it
- // was last used against the database. In some cases, this will cause the cache to maer that
- // statement as bad. The bad statement will instead be flushed during the next call to Get
- // that occurs outside of a failed transaction.
- StatementErrored(sql string, err error)
-
- // Len returns the number of cached prepared statement descriptions.
- Len() int
-
- // Cap returns the maximum number of cached prepared statement descriptions.
- Cap() int
-
- // Mode returns the mode of the cache (ModePrepare or ModeDescribe)
- Mode() int
-}
-
-// New returns the preferred cache implementation for mode and cap. mode is either ModePrepare or ModeDescribe. cap is
-// the maximum size of the cache.
-func New(conn *pgconn.PgConn, mode int, cap int) Cache {
- mustBeValidMode(mode)
- mustBeValidCap(cap)
-
- return NewLRU(conn, mode, cap)
-}
-
-func mustBeValidMode(mode int) {
- if mode != ModePrepare && mode != ModeDescribe {
- panic("mode must be ModePrepare or ModeDescribe")
- }
-}
-
-func mustBeValidCap(cap int) {
- if cap < 1 {
- panic("cache must have cap of >= 1")
- }
-}
diff --git a/vendor/github.com/jackc/pgio/.travis.yml b/vendor/github.com/jackc/pgio/.travis.yml
deleted file mode 100644
index e176228..0000000
--- a/vendor/github.com/jackc/pgio/.travis.yml
+++ /dev/null
@@ -1,9 +0,0 @@
-language: go
-
-go:
- - 1.x
- - tip
-
-matrix:
- allow_failures:
- - go: tip
diff --git a/vendor/github.com/jackc/pgio/LICENSE b/vendor/github.com/jackc/pgio/LICENSE
deleted file mode 100644
index c1c4f50..0000000
--- a/vendor/github.com/jackc/pgio/LICENSE
+++ /dev/null
@@ -1,22 +0,0 @@
-Copyright (c) 2019 Jack Christensen
-
-MIT License
-
-Permission is hereby granted, free of charge, to any person obtaining
-a copy of this software and associated documentation files (the
-"Software"), to deal in the Software without restriction, including
-without limitation the rights to use, copy, modify, merge, publish,
-distribute, sublicense, and/or sell copies of the Software, and to
-permit persons to whom the Software is furnished to do so, subject to
-the following conditions:
-
-The above copyright notice and this permission notice shall be
-included in all copies or substantial portions of the Software.
-
-THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
-EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
-MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
-NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
-LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
-OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
-WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/vendor/github.com/jackc/pgio/README.md b/vendor/github.com/jackc/pgio/README.md
deleted file mode 100644
index 1952ed8..0000000
--- a/vendor/github.com/jackc/pgio/README.md
+++ /dev/null
@@ -1,11 +0,0 @@
-[![](https://godoc.org/github.com/jackc/pgio?status.svg)](https://godoc.org/github.com/jackc/pgio)
-[![Build Status](https://travis-ci.org/jackc/pgio.svg)](https://travis-ci.org/jackc/pgio)
-
-# pgio
-
-Package pgio is a low-level toolkit building messages in the PostgreSQL wire protocol.
-
-pgio provides functions for appending integers to a []byte while doing byte
-order conversion.
-
-Extracted from original implementation in https://github.com/jackc/pgx.
diff --git a/vendor/github.com/jackc/pgproto3/v2/.travis.yml b/vendor/github.com/jackc/pgproto3/v2/.travis.yml
deleted file mode 100644
index e176228..0000000
--- a/vendor/github.com/jackc/pgproto3/v2/.travis.yml
+++ /dev/null
@@ -1,9 +0,0 @@
-language: go
-
-go:
- - 1.x
- - tip
-
-matrix:
- allow_failures:
- - go: tip
diff --git a/vendor/github.com/jackc/pgproto3/v2/LICENSE b/vendor/github.com/jackc/pgproto3/v2/LICENSE
deleted file mode 100644
index c1c4f50..0000000
--- a/vendor/github.com/jackc/pgproto3/v2/LICENSE
+++ /dev/null
@@ -1,22 +0,0 @@
-Copyright (c) 2019 Jack Christensen
-
-MIT License
-
-Permission is hereby granted, free of charge, to any person obtaining
-a copy of this software and associated documentation files (the
-"Software"), to deal in the Software without restriction, including
-without limitation the rights to use, copy, modify, merge, publish,
-distribute, sublicense, and/or sell copies of the Software, and to
-permit persons to whom the Software is furnished to do so, subject to
-the following conditions:
-
-The above copyright notice and this permission notice shall be
-included in all copies or substantial portions of the Software.
-
-THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
-EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
-MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
-NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
-LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
-OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
-WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/vendor/github.com/jackc/pgproto3/v2/README.md b/vendor/github.com/jackc/pgproto3/v2/README.md
deleted file mode 100644
index 77a3170..0000000
--- a/vendor/github.com/jackc/pgproto3/v2/README.md
+++ /dev/null
@@ -1,18 +0,0 @@
-[![](https://godoc.org/github.com/jackc/pgproto3?status.svg)](https://godoc.org/github.com/jackc/pgproto3)
-[![Build Status](https://travis-ci.org/jackc/pgproto3.svg)](https://travis-ci.org/jackc/pgproto3)
-
----
-
-This version is used with pgx `v4`. In pgx `v5` it is part of the https://github.com/jackc/pgx repository.
-
----
-
-# pgproto3
-
-Package pgproto3 is a encoder and decoder of the PostgreSQL wire protocol version 3.
-
-pgproto3 can be used as a foundation for PostgreSQL drivers, proxies, mock servers, load balancers and more.
-
-See example/pgfortune for a playful example of a fake PostgreSQL server.
-
-Extracted from original implementation in https://github.com/jackc/pgx.
diff --git a/vendor/github.com/jackc/pgproto3/v2/chunkreader.go b/vendor/github.com/jackc/pgproto3/v2/chunkreader.go
deleted file mode 100644
index 92206f3..0000000
--- a/vendor/github.com/jackc/pgproto3/v2/chunkreader.go
+++ /dev/null
@@ -1,19 +0,0 @@
-package pgproto3
-
-import (
- "io"
-
- "github.com/jackc/chunkreader/v2"
-)
-
-// ChunkReader is an interface to decouple github.com/jackc/chunkreader from this package.
-type ChunkReader interface {
- // Next returns buf filled with the next n bytes. If an error (including a partial read) occurs,
- // buf must be nil. Next must preserve any partially read data. Next must not reuse buf.
- Next(n int) (buf []byte, err error)
-}
-
-// NewChunkReader creates and returns a new default ChunkReader.
-func NewChunkReader(r io.Reader) ChunkReader {
- return chunkreader.New(r)
-}
diff --git a/vendor/github.com/jackc/pgproto3/v2/doc.go b/vendor/github.com/jackc/pgproto3/v2/doc.go
deleted file mode 100644
index 8226dc9..0000000
--- a/vendor/github.com/jackc/pgproto3/v2/doc.go
+++ /dev/null
@@ -1,4 +0,0 @@
-// Package pgproto3 is a encoder and decoder of the PostgreSQL wire protocol version 3.
-//
-// See https://www.postgresql.org/docs/current/protocol-message-formats.html for meanings of the different messages.
-package pgproto3
diff --git a/vendor/github.com/jackc/pgproto3/v2/frontend.go b/vendor/github.com/jackc/pgproto3/v2/frontend.go
deleted file mode 100644
index 5be8de8..0000000
--- a/vendor/github.com/jackc/pgproto3/v2/frontend.go
+++ /dev/null
@@ -1,206 +0,0 @@
-package pgproto3
-
-import (
- "encoding/binary"
- "errors"
- "fmt"
- "io"
-)
-
-// Frontend acts as a client for the PostgreSQL wire protocol version 3.
-type Frontend struct {
- cr ChunkReader
- w io.Writer
-
- // Backend message flyweights
- authenticationOk AuthenticationOk
- authenticationCleartextPassword AuthenticationCleartextPassword
- authenticationMD5Password AuthenticationMD5Password
- authenticationGSS AuthenticationGSS
- authenticationGSSContinue AuthenticationGSSContinue
- authenticationSASL AuthenticationSASL
- authenticationSASLContinue AuthenticationSASLContinue
- authenticationSASLFinal AuthenticationSASLFinal
- backendKeyData BackendKeyData
- bindComplete BindComplete
- closeComplete CloseComplete
- commandComplete CommandComplete
- copyBothResponse CopyBothResponse
- copyData CopyData
- copyInResponse CopyInResponse
- copyOutResponse CopyOutResponse
- copyDone CopyDone
- dataRow DataRow
- emptyQueryResponse EmptyQueryResponse
- errorResponse ErrorResponse
- functionCallResponse FunctionCallResponse
- noData NoData
- noticeResponse NoticeResponse
- notificationResponse NotificationResponse
- parameterDescription ParameterDescription
- parameterStatus ParameterStatus
- parseComplete ParseComplete
- readyForQuery ReadyForQuery
- rowDescription RowDescription
- portalSuspended PortalSuspended
-
- bodyLen int
- msgType byte
- partialMsg bool
- authType uint32
-}
-
-// NewFrontend creates a new Frontend.
-func NewFrontend(cr ChunkReader, w io.Writer) *Frontend {
- return &Frontend{cr: cr, w: w}
-}
-
-// Send sends a message to the backend.
-func (f *Frontend) Send(msg FrontendMessage) error {
- _, err := f.w.Write(msg.Encode(nil))
- return err
-}
-
-func translateEOFtoErrUnexpectedEOF(err error) error {
- if err == io.EOF {
- return io.ErrUnexpectedEOF
- }
- return err
-}
-
-// Receive receives a message from the backend. The returned message is only valid until the next call to Receive.
-func (f *Frontend) Receive() (BackendMessage, error) {
- if !f.partialMsg {
- header, err := f.cr.Next(5)
- if err != nil {
- return nil, translateEOFtoErrUnexpectedEOF(err)
- }
-
- f.msgType = header[0]
- f.bodyLen = int(binary.BigEndian.Uint32(header[1:])) - 4
- f.partialMsg = true
- if f.bodyLen < 0 {
- return nil, errors.New("invalid message with negative body length received")
- }
- }
-
- msgBody, err := f.cr.Next(f.bodyLen)
- if err != nil {
- return nil, translateEOFtoErrUnexpectedEOF(err)
- }
-
- f.partialMsg = false
-
- var msg BackendMessage
- switch f.msgType {
- case '1':
- msg = &f.parseComplete
- case '2':
- msg = &f.bindComplete
- case '3':
- msg = &f.closeComplete
- case 'A':
- msg = &f.notificationResponse
- case 'c':
- msg = &f.copyDone
- case 'C':
- msg = &f.commandComplete
- case 'd':
- msg = &f.copyData
- case 'D':
- msg = &f.dataRow
- case 'E':
- msg = &f.errorResponse
- case 'G':
- msg = &f.copyInResponse
- case 'H':
- msg = &f.copyOutResponse
- case 'I':
- msg = &f.emptyQueryResponse
- case 'K':
- msg = &f.backendKeyData
- case 'n':
- msg = &f.noData
- case 'N':
- msg = &f.noticeResponse
- case 'R':
- var err error
- msg, err = f.findAuthenticationMessageType(msgBody)
- if err != nil {
- return nil, err
- }
- case 's':
- msg = &f.portalSuspended
- case 'S':
- msg = &f.parameterStatus
- case 't':
- msg = &f.parameterDescription
- case 'T':
- msg = &f.rowDescription
- case 'V':
- msg = &f.functionCallResponse
- case 'W':
- msg = &f.copyBothResponse
- case 'Z':
- msg = &f.readyForQuery
- default:
- return nil, fmt.Errorf("unknown message type: %c", f.msgType)
- }
-
- err = msg.Decode(msgBody)
- return msg, err
-}
-
-// Authentication message type constants.
-// See src/include/libpq/pqcomm.h for all
-// constants.
-const (
- AuthTypeOk = 0
- AuthTypeCleartextPassword = 3
- AuthTypeMD5Password = 5
- AuthTypeSCMCreds = 6
- AuthTypeGSS = 7
- AuthTypeGSSCont = 8
- AuthTypeSSPI = 9
- AuthTypeSASL = 10
- AuthTypeSASLContinue = 11
- AuthTypeSASLFinal = 12
-)
-
-func (f *Frontend) findAuthenticationMessageType(src []byte) (BackendMessage, error) {
- if len(src) < 4 {
- return nil, errors.New("authentication message too short")
- }
- f.authType = binary.BigEndian.Uint32(src[:4])
-
- switch f.authType {
- case AuthTypeOk:
- return &f.authenticationOk, nil
- case AuthTypeCleartextPassword:
- return &f.authenticationCleartextPassword, nil
- case AuthTypeMD5Password:
- return &f.authenticationMD5Password, nil
- case AuthTypeSCMCreds:
- return nil, errors.New("AuthTypeSCMCreds is unimplemented")
- case AuthTypeGSS:
- return &f.authenticationGSS, nil
- case AuthTypeGSSCont:
- return &f.authenticationGSSContinue, nil
- case AuthTypeSSPI:
- return nil, errors.New("AuthTypeSSPI is unimplemented")
- case AuthTypeSASL:
- return &f.authenticationSASL, nil
- case AuthTypeSASLContinue:
- return &f.authenticationSASLContinue, nil
- case AuthTypeSASLFinal:
- return &f.authenticationSASLFinal, nil
- default:
- return nil, fmt.Errorf("unknown authentication type: %d", f.authType)
- }
-}
-
-// GetAuthType returns the authType used in the current state of the frontend.
-// See SetAuthType for more information.
-func (f *Frontend) GetAuthType() uint32 {
- return f.authType
-}
diff --git a/vendor/github.com/jackc/pgproto3/v2/pgproto3.go b/vendor/github.com/jackc/pgproto3/v2/pgproto3.go
deleted file mode 100644
index 70c825e..0000000
--- a/vendor/github.com/jackc/pgproto3/v2/pgproto3.go
+++ /dev/null
@@ -1,65 +0,0 @@
-package pgproto3
-
-import (
- "encoding/hex"
- "errors"
- "fmt"
-)
-
-// Message is the interface implemented by an object that can decode and encode
-// a particular PostgreSQL message.
-type Message interface {
- // Decode is allowed and expected to retain a reference to data after
- // returning (unlike encoding.BinaryUnmarshaler).
- Decode(data []byte) error
-
- // Encode appends itself to dst and returns the new buffer.
- Encode(dst []byte) []byte
-}
-
-type FrontendMessage interface {
- Message
- Frontend() // no-op method to distinguish frontend from backend methods
-}
-
-type BackendMessage interface {
- Message
- Backend() // no-op method to distinguish frontend from backend methods
-}
-
-type AuthenticationResponseMessage interface {
- BackendMessage
- AuthenticationResponse() // no-op method to distinguish authentication responses
-}
-
-type invalidMessageLenErr struct {
- messageType string
- expectedLen int
- actualLen int
-}
-
-func (e *invalidMessageLenErr) Error() string {
- return fmt.Sprintf("%s body must have length of %d, but it is %d", e.messageType, e.expectedLen, e.actualLen)
-}
-
-type invalidMessageFormatErr struct {
- messageType string
-}
-
-func (e *invalidMessageFormatErr) Error() string {
- return fmt.Sprintf("%s body is invalid", e.messageType)
-}
-
-// getValueFromJSON gets the value from a protocol message representation in JSON.
-func getValueFromJSON(v map[string]string) ([]byte, error) {
- if v == nil {
- return nil, nil
- }
- if text, ok := v["text"]; ok {
- return []byte(text), nil
- }
- if binary, ok := v["binary"]; ok {
- return hex.DecodeString(binary)
- }
- return nil, errors.New("unknown protocol representation")
-}
diff --git a/vendor/github.com/jackc/pgservicefile/.travis.yml b/vendor/github.com/jackc/pgservicefile/.travis.yml
deleted file mode 100644
index e176228..0000000
--- a/vendor/github.com/jackc/pgservicefile/.travis.yml
+++ /dev/null
@@ -1,9 +0,0 @@
-language: go
-
-go:
- - 1.x
- - tip
-
-matrix:
- allow_failures:
- - go: tip
diff --git a/vendor/github.com/jackc/pgservicefile/README.md b/vendor/github.com/jackc/pgservicefile/README.md
index e50ca12..2fc7e01 100644
--- a/vendor/github.com/jackc/pgservicefile/README.md
+++ b/vendor/github.com/jackc/pgservicefile/README.md
@@ -1,5 +1,6 @@
-[![](https://godoc.org/github.com/jackc/pgservicefile?status.svg)](https://godoc.org/github.com/jackc/pgservicefile)
-[![Build Status](https://travis-ci.org/jackc/pgservicefile.svg)](https://travis-ci.org/jackc/pgservicefile)
+[![Go Reference](https://pkg.go.dev/badge/github.com/jackc/pgservicefile.svg)](https://pkg.go.dev/github.com/jackc/pgservicefile)
+[![Build Status](https://github.com/jackc/pgservicefile/actions/workflows/ci.yml/badge.svg)](https://github.com/jackc/pgservicefile/actions/workflows/ci.yml)
+
# pgservicefile
diff --git a/vendor/github.com/jackc/pgservicefile/pgservicefile.go b/vendor/github.com/jackc/pgservicefile/pgservicefile.go
index 797bbab..c62caa7 100644
--- a/vendor/github.com/jackc/pgservicefile/pgservicefile.go
+++ b/vendor/github.com/jackc/pgservicefile/pgservicefile.go
@@ -57,7 +57,7 @@ func ParseServicefile(r io.Reader) (*Servicefile, error) {
} else if strings.HasPrefix(line, "[") && strings.HasSuffix(line, "]") {
service = &Service{Name: line[1 : len(line)-1], Settings: make(map[string]string)}
servicefile.Services = append(servicefile.Services, service)
- } else {
+ } else if service != nil {
parts := strings.SplitN(line, "=", 2)
if len(parts) != 2 {
return nil, fmt.Errorf("unable to parse line %d", lineNum)
@@ -67,6 +67,8 @@ func ParseServicefile(r io.Reader) (*Servicefile, error) {
value := strings.TrimSpace(parts[1])
service.Settings[key] = value
+ } else {
+ return nil, fmt.Errorf("line %d is not in a section", lineNum)
}
}
diff --git a/vendor/github.com/jackc/pgtype/CHANGELOG.md b/vendor/github.com/jackc/pgtype/CHANGELOG.md
deleted file mode 100644
index a362a1d..0000000
--- a/vendor/github.com/jackc/pgtype/CHANGELOG.md
+++ /dev/null
@@ -1,164 +0,0 @@
-# 1.14.0 (February 11, 2023)
-
-* Fix: BC timestamp text format support (jozeflami)
-* Add Scanner and Valuer interfaces to CIDR (Yurii Popivniak)
-* Fix crash when nilifying pointer to sql.Scanner
-
-# 1.13.0 (December 1, 2022)
-
-* Fix: Reset jsonb before unmarshal (Tomas Odinas)
-* Fix: return correct zero value when UUID conversion fails (ndrpnt)
-* Fix: EncodeText for Lseg includes [ and ]
-* Support sql Value and Scan for custom date type (Hubert Krauze)
-* Support Ltree binary encoding (AmineChikhaoui)
-* Fix: dates with "BC" (jozeflami)
-
-# 1.12.0 (August 6, 2022)
-
-* Add JSONArray (Jakob Ackermann)
-* Support Inet from fmt.Stringer and encoding.TextMarshaler (Ville Skyttä)
-* Support UUID from fmt.Stringer interface (Lasse Hyldahl Jensen)
-* Fix: shopspring-numeric extension does not panic on NaN
-* Numeric can be assigned to string
-* Fix: Do not send IPv4 networks as IPv4-mapped IPv6 (William Storey)
-* Fix: PlanScan for interface{}(nil) (James Hartig)
-* Fix: *sql.Scanner for NULL handling (James Hartig)
-* Timestamp[tz].Set() supports string (Harmen)
-* Fix: Hstore AssignTo with map of *string (Diego Becciolini)
-
-# 1.11.0 (April 21, 2022)
-
-* Add multirange for numeric, int4, and int8 (Vu)
-* JSONBArray now supports json.RawMessage (Jens Emil Schulz Østergaard)
-* Add RecordArray (WGH)
-* Add UnmarshalJSON to pgtype.Int2
-* Hstore.Set accepts map[string]Text
-
-# 1.10.0 (February 7, 2022)
-
-* Normalize UTC timestamps to comply with stdlib (Torkel Rogstad)
-* Assign Numeric to *big.Rat (Oleg Lomaka)
-* Fix typo in float8 error message (Pinank Solanki)
-* Scan type aliases for floating point types (Collin Forsyth)
-
-# 1.9.1 (November 28, 2021)
-
-* Fix: binary timestamp is assumed to be in UTC (restored behavior changed in v1.9.0)
-
-# 1.9.0 (November 20, 2021)
-
-* Fix binary hstore null decoding
-* Add shopspring/decimal.NullDecimal support to integration (Eli Treuherz)
-* Inet.Set supports bare IP address (Carl Dunham)
-* Add zeronull.Float8
-* Fix NULL being lost when scanning unknown OID into sql.Scanner
-* Fix BPChar.AssignTo **rune
-* Add support for fmt.Stringer and driver.Valuer in String fields encoding (Jan Dubsky)
-* Fix really big timestamp(tz)s binary format parsing (e.g. year 294276) (Jim Tsao)
-* Support `map[string]*string` as hstore (Adrian Sieger)
-* Fix parsing text array with negative bounds
-* Add infinity support for numeric (Jim Tsao)
-
-# 1.8.1 (July 24, 2021)
-
-* Cleaned up Go module dependency chain
-
-# 1.8.0 (July 10, 2021)
-
-* Maintain host bits for inet types (Cameron Daniel)
-* Support pointers of wrapping structs (Ivan Daunis)
-* Register JSONBArray at NewConnInfo() (Rueian)
-* CompositeTextScanner handles backslash escapes
-
-# 1.7.0 (March 25, 2021)
-
-* Fix scanning int into **sql.Scanner implementor
-* Add tsrange array type (Vasilii Novikov)
-* Fix: escaped strings when they start or end with a newline char (Stephane Martin)
-* Accept nil *time.Time in Time.Set
-* Fix numeric NaN support
-* Use Go 1.13 errors instead of xerrors
-
-# 1.6.2 (December 3, 2020)
-
-* Fix panic on assigning empty array to non-slice or array
-* Fix text array parsing disambiguates NULL and "NULL"
-* Fix Timestamptz.DecodeText with too short text
-
-# 1.6.1 (October 31, 2020)
-
-* Fix simple protocol empty array support
-
-# 1.6.0 (October 24, 2020)
-
-* Fix AssignTo pointer to pointer to slice and named types.
-* Fix zero length array assignment (Simo Haasanen)
-* Add float64, float32 convert to int2, int4, int8 (lqu3j)
-* Support setting infinite timestamps (Erik Agsjö)
-* Polygon improvements (duohedron)
-* Fix Inet.Set with nil (Tomas Volf)
-
-# 1.5.0 (September 26, 2020)
-
-* Add slice of slice mapping to multi-dimensional arrays (Simo Haasanen)
-* Fix JSONBArray
-* Fix selecting empty array
-* Text formatted values except bytea can be directly scanned to []byte
-* Add JSON marshalling for UUID (bakmataliev)
-* Improve point type conversions (bakmataliev)
-
-# 1.4.2 (July 22, 2020)
-
-* Fix encoding of a large composite data type (Yaz Saito)
-
-# 1.4.1 (July 14, 2020)
-
-* Fix ArrayType DecodeBinary empty array breaks future reads
-
-# 1.4.0 (June 27, 2020)
-
-* Add JSON support to ext/gofrs-uuid
-* Performance improvements in Scan path
-* Improved ext/shopspring-numeric binary decoding performance
-* Add composite type support (Maxim Ivanov and Jack Christensen)
-* Add better generic enum type support
-* Add generic array type support
-* Clarify and normalize Value semantics
-* Fix hstore with empty string values
-* Numeric supports NaN values (leighhopcroft)
-* Add slice of pointer support to array types (megaturbo)
-* Add jsonb array type (tserakhau)
-* Allow converting intervals with months and days to duration
-
-# 1.3.0 (March 30, 2020)
-
-* Get implemented on T instead of *T
-* Set will call Get on src if possible
-* Range types Set method supports its own type, string, and nil
-* Date.Set parses string
-* Fix correct format verb for unknown type error (Robert Welin)
-* Truncate nanoseconds in EncodeText for Timestamptz and Timestamp
-
-# 1.2.0 (February 5, 2020)
-
-* Add zeronull package for easier NULL <-> zero conversion
-* Add JSON marshalling for shopspring-numeric extension
-* Add JSON marshalling for Bool, Date, JSON/B, Timestamptz (Jeffrey Stiles)
-* Fix null status in UnmarshalJSON for some types (Jeffrey Stiles)
-
-# 1.1.0 (January 11, 2020)
-
-* Add PostgreSQL time type support
-* Add more automatic conversions of integer arrays of different types (Jean-Philippe Quéméner)
-
-# 1.0.3 (November 16, 2019)
-
-* Support initializing Array types from a slice of the value (Alex Gaynor)
-
-# 1.0.2 (October 22, 2019)
-
-* Fix scan into null into pointer to pointer implementing Decode* interface. (Jeremy Altavilla)
-
-# 1.0.1 (September 19, 2019)
-
-* Fix daterange OID
diff --git a/vendor/github.com/jackc/pgtype/README.md b/vendor/github.com/jackc/pgtype/README.md
deleted file mode 100644
index 72dadcf..0000000
--- a/vendor/github.com/jackc/pgtype/README.md
+++ /dev/null
@@ -1,14 +0,0 @@
-[![](https://godoc.org/github.com/jackc/pgtype?status.svg)](https://godoc.org/github.com/jackc/pgtype)
-![CI](https://github.com/jackc/pgtype/workflows/CI/badge.svg)
-
----
-
-This version is used with pgx `v4`. In pgx `v5` it is part of the https://github.com/jackc/pgx repository.
-
----
-
-# pgtype
-
-pgtype implements Go types for over 70 PostgreSQL types. pgtype is the type system underlying the
-https://github.com/jackc/pgx PostgreSQL driver. These types support the binary format for enhanced performance with pgx.
-They also support the database/sql `Scan` and `Value` interfaces and can be used with https://github.com/lib/pq.
diff --git a/vendor/github.com/jackc/pgtype/aclitem.go b/vendor/github.com/jackc/pgtype/aclitem.go
deleted file mode 100644
index 9f6587b..0000000
--- a/vendor/github.com/jackc/pgtype/aclitem.go
+++ /dev/null
@@ -1,138 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "fmt"
-)
-
-// ACLItem is used for PostgreSQL's aclitem data type. A sample aclitem
-// might look like this:
-//
-// postgres=arwdDxt/postgres
-//
-// Note, however, that because the user/role name part of an aclitem is
-// an identifier, it follows all the usual formatting rules for SQL
-// identifiers: if it contains spaces and other special characters,
-// it should appear in double-quotes:
-//
-// postgres=arwdDxt/"role with spaces"
-//
-type ACLItem struct {
- String string
- Status Status
-}
-
-func (dst *ACLItem) Set(src interface{}) error {
- if src == nil {
- *dst = ACLItem{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- switch value := src.(type) {
- case string:
- *dst = ACLItem{String: value, Status: Present}
- case *string:
- if value == nil {
- *dst = ACLItem{Status: Null}
- } else {
- *dst = ACLItem{String: *value, Status: Present}
- }
- default:
- if originalSrc, ok := underlyingStringType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to ACLItem", value)
- }
-
- return nil
-}
-
-func (dst ACLItem) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst.String
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *ACLItem) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- switch v := dst.(type) {
- case *string:
- *v = src.String
- return nil
- default:
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
- return fmt.Errorf("unable to assign to %T", dst)
- }
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (dst *ACLItem) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = ACLItem{Status: Null}
- return nil
- }
-
- *dst = ACLItem{String: string(src), Status: Present}
- return nil
-}
-
-func (src ACLItem) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- return append(buf, src.String...), nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *ACLItem) Scan(src interface{}) error {
- if src == nil {
- *dst = ACLItem{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src ACLItem) Value() (driver.Value, error) {
- switch src.Status {
- case Present:
- return src.String, nil
- case Null:
- return nil, nil
- default:
- return nil, errUndefined
- }
-}
diff --git a/vendor/github.com/jackc/pgtype/aclitem_array.go b/vendor/github.com/jackc/pgtype/aclitem_array.go
deleted file mode 100644
index 4e3be3b..0000000
--- a/vendor/github.com/jackc/pgtype/aclitem_array.go
+++ /dev/null
@@ -1,428 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "fmt"
- "reflect"
-)
-
-type ACLItemArray struct {
- Elements []ACLItem
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *ACLItemArray) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = ACLItemArray{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []string:
- if value == nil {
- *dst = ACLItemArray{Status: Null}
- } else if len(value) == 0 {
- *dst = ACLItemArray{Status: Present}
- } else {
- elements := make([]ACLItem, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = ACLItemArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*string:
- if value == nil {
- *dst = ACLItemArray{Status: Null}
- } else if len(value) == 0 {
- *dst = ACLItemArray{Status: Present}
- } else {
- elements := make([]ACLItem, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = ACLItemArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []ACLItem:
- if value == nil {
- *dst = ACLItemArray{Status: Null}
- } else if len(value) == 0 {
- *dst = ACLItemArray{Status: Present}
- } else {
- *dst = ACLItemArray{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = ACLItemArray{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for ACLItemArray", src)
- }
- if elementsLength == 0 {
- *dst = ACLItemArray{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to ACLItemArray", src)
- }
-
- *dst = ACLItemArray{
- Elements: make([]ACLItem, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]ACLItem, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to ACLItemArray, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *ACLItemArray) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to ACLItemArray")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in ACLItemArray", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst ACLItemArray) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *ACLItemArray) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]string:
- *v = make([]string, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*string:
- *v = make([]*string, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *ACLItemArray) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from ACLItemArray")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from ACLItemArray")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *ACLItemArray) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = ACLItemArray{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []ACLItem
-
- if len(uta.Elements) > 0 {
- elements = make([]ACLItem, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem ACLItem
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = ACLItemArray{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (src ACLItemArray) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *ACLItemArray) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src ACLItemArray) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/array_type.go b/vendor/github.com/jackc/pgtype/array_type.go
deleted file mode 100644
index 7146655..0000000
--- a/vendor/github.com/jackc/pgtype/array_type.go
+++ /dev/null
@@ -1,353 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "reflect"
-
- "github.com/jackc/pgio"
-)
-
-// ArrayType represents an array type. While it implements Value, this is only in service of its type conversion duties
-// when registered as a data type in a ConnType. It should not be used directly as a Value. ArrayType is a convenience
-// type for types that do not have a concrete array type.
-type ArrayType struct {
- elements []ValueTranscoder
- dimensions []ArrayDimension
-
- typeName string
- newElement func() ValueTranscoder
-
- elementOID uint32
- status Status
-}
-
-func NewArrayType(typeName string, elementOID uint32, newElement func() ValueTranscoder) *ArrayType {
- return &ArrayType{typeName: typeName, elementOID: elementOID, newElement: newElement}
-}
-
-func (at *ArrayType) NewTypeValue() Value {
- return &ArrayType{
- elements: at.elements,
- dimensions: at.dimensions,
- status: at.status,
-
- typeName: at.typeName,
- elementOID: at.elementOID,
- newElement: at.newElement,
- }
-}
-
-func (at *ArrayType) TypeName() string {
- return at.typeName
-}
-
-func (dst *ArrayType) setNil() {
- dst.elements = nil
- dst.dimensions = nil
- dst.status = Null
-}
-
-func (dst *ArrayType) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- dst.setNil()
- return nil
- }
-
- sliceVal := reflect.ValueOf(src)
- if sliceVal.Kind() != reflect.Slice {
- return fmt.Errorf("cannot set non-slice")
- }
-
- if sliceVal.IsNil() {
- dst.setNil()
- return nil
- }
-
- dst.elements = make([]ValueTranscoder, sliceVal.Len())
- for i := range dst.elements {
- v := dst.newElement()
- err := v.Set(sliceVal.Index(i).Interface())
- if err != nil {
- return err
- }
-
- dst.elements[i] = v
- }
- dst.dimensions = []ArrayDimension{{Length: int32(len(dst.elements)), LowerBound: 1}}
- dst.status = Present
-
- return nil
-}
-
-func (dst ArrayType) Get() interface{} {
- switch dst.status {
- case Present:
- elementValues := make([]interface{}, len(dst.elements))
- for i := range dst.elements {
- elementValues[i] = dst.elements[i].Get()
- }
- return elementValues
- case Null:
- return nil
- default:
- return dst.status
- }
-}
-
-func (src *ArrayType) AssignTo(dst interface{}) error {
- ptrSlice := reflect.ValueOf(dst)
- if ptrSlice.Kind() != reflect.Ptr {
- return fmt.Errorf("cannot assign to non-pointer")
- }
-
- sliceVal := ptrSlice.Elem()
- sliceType := sliceVal.Type()
-
- if sliceType.Kind() != reflect.Slice {
- return fmt.Errorf("cannot assign to pointer to non-slice")
- }
-
- switch src.status {
- case Present:
- slice := reflect.MakeSlice(sliceType, len(src.elements), len(src.elements))
- elemType := sliceType.Elem()
-
- for i := range src.elements {
- ptrElem := reflect.New(elemType)
- err := src.elements[i].AssignTo(ptrElem.Interface())
- if err != nil {
- return err
- }
-
- slice.Index(i).Set(ptrElem.Elem())
- }
-
- sliceVal.Set(slice)
- return nil
- case Null:
- sliceVal.Set(reflect.Zero(sliceType))
- return nil
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (dst *ArrayType) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- dst.setNil()
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []ValueTranscoder
-
- if len(uta.Elements) > 0 {
- elements = make([]ValueTranscoder, len(uta.Elements))
-
- for i, s := range uta.Elements {
- elem := dst.newElement()
- var elemSrc []byte
- if s != "NULL" {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- dst.elements = elements
- dst.dimensions = uta.Dimensions
- dst.status = Present
-
- return nil
-}
-
-func (dst *ArrayType) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- dst.setNil()
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- var elements []ValueTranscoder
-
- if len(arrayHeader.Dimensions) == 0 {
- dst.elements = elements
- dst.dimensions = arrayHeader.Dimensions
- dst.status = Present
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements = make([]ValueTranscoder, elementCount)
-
- for i := range elements {
- elem := dst.newElement()
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elem.DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
-
- dst.elements = elements
- dst.dimensions = arrayHeader.Dimensions
- dst.status = Present
-
- return nil
-}
-
-func (src ArrayType) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.dimensions))
- dimElemCounts[len(src.dimensions)-1] = int(src.dimensions[len(src.dimensions)-1].Length)
- for i := len(src.dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src ArrayType) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.dimensions,
- ElementOID: int32(src.elementOID),
- }
-
- for i := range src.elements {
- if src.elements[i].Get() == nil {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *ArrayType) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src ArrayType) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/bit.go b/vendor/github.com/jackc/pgtype/bit.go
deleted file mode 100644
index c1709e6..0000000
--- a/vendor/github.com/jackc/pgtype/bit.go
+++ /dev/null
@@ -1,45 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
-)
-
-type Bit Varbit
-
-func (dst *Bit) Set(src interface{}) error {
- return (*Varbit)(dst).Set(src)
-}
-
-func (dst Bit) Get() interface{} {
- return (Varbit)(dst).Get()
-}
-
-func (src *Bit) AssignTo(dst interface{}) error {
- return (*Varbit)(src).AssignTo(dst)
-}
-
-func (dst *Bit) DecodeBinary(ci *ConnInfo, src []byte) error {
- return (*Varbit)(dst).DecodeBinary(ci, src)
-}
-
-func (src Bit) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- return (Varbit)(src).EncodeBinary(ci, buf)
-}
-
-func (dst *Bit) DecodeText(ci *ConnInfo, src []byte) error {
- return (*Varbit)(dst).DecodeText(ci, src)
-}
-
-func (src Bit) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- return (Varbit)(src).EncodeText(ci, buf)
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Bit) Scan(src interface{}) error {
- return (*Varbit)(dst).Scan(src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Bit) Value() (driver.Value, error) {
- return (Varbit)(src).Value()
-}
diff --git a/vendor/github.com/jackc/pgtype/bool.go b/vendor/github.com/jackc/pgtype/bool.go
deleted file mode 100644
index 676c8e5..0000000
--- a/vendor/github.com/jackc/pgtype/bool.go
+++ /dev/null
@@ -1,217 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/json"
- "fmt"
- "strconv"
-)
-
-type Bool struct {
- Bool bool
- Status Status
-}
-
-func (dst *Bool) Set(src interface{}) error {
- if src == nil {
- *dst = Bool{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- switch value := src.(type) {
- case bool:
- *dst = Bool{Bool: value, Status: Present}
- case string:
- bb, err := strconv.ParseBool(value)
- if err != nil {
- return err
- }
- *dst = Bool{Bool: bb, Status: Present}
- case *bool:
- if value == nil {
- *dst = Bool{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *string:
- if value == nil {
- *dst = Bool{Status: Null}
- } else {
- return dst.Set(*value)
- }
- default:
- if originalSrc, ok := underlyingBoolType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to Bool", value)
- }
-
- return nil
-}
-
-func (dst Bool) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst.Bool
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Bool) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- switch v := dst.(type) {
- case *bool:
- *v = src.Bool
- return nil
- default:
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
- return fmt.Errorf("unable to assign to %T", dst)
- }
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (dst *Bool) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Bool{Status: Null}
- return nil
- }
-
- if len(src) != 1 {
- return fmt.Errorf("invalid length for bool: %v", len(src))
- }
-
- *dst = Bool{Bool: src[0] == 't', Status: Present}
- return nil
-}
-
-func (dst *Bool) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Bool{Status: Null}
- return nil
- }
-
- if len(src) != 1 {
- return fmt.Errorf("invalid length for bool: %v", len(src))
- }
-
- *dst = Bool{Bool: src[0] == 1, Status: Present}
- return nil
-}
-
-func (src Bool) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if src.Bool {
- buf = append(buf, 't')
- } else {
- buf = append(buf, 'f')
- }
-
- return buf, nil
-}
-
-func (src Bool) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if src.Bool {
- buf = append(buf, 1)
- } else {
- buf = append(buf, 0)
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Bool) Scan(src interface{}) error {
- if src == nil {
- *dst = Bool{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case bool:
- *dst = Bool{Bool: src, Status: Present}
- return nil
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Bool) Value() (driver.Value, error) {
- switch src.Status {
- case Present:
- return src.Bool, nil
- case Null:
- return nil, nil
- default:
- return nil, errUndefined
- }
-}
-
-func (src Bool) MarshalJSON() ([]byte, error) {
- switch src.Status {
- case Present:
- if src.Bool {
- return []byte("true"), nil
- } else {
- return []byte("false"), nil
- }
- case Null:
- return []byte("null"), nil
- case Undefined:
- return nil, errUndefined
- }
-
- return nil, errBadStatus
-}
-
-func (dst *Bool) UnmarshalJSON(b []byte) error {
- var v *bool
- err := json.Unmarshal(b, &v)
- if err != nil {
- return err
- }
-
- if v == nil {
- *dst = Bool{Status: Null}
- } else {
- *dst = Bool{Bool: *v, Status: Present}
- }
-
- return nil
-}
diff --git a/vendor/github.com/jackc/pgtype/bool_array.go b/vendor/github.com/jackc/pgtype/bool_array.go
deleted file mode 100644
index 6558d97..0000000
--- a/vendor/github.com/jackc/pgtype/bool_array.go
+++ /dev/null
@@ -1,517 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "reflect"
-
- "github.com/jackc/pgio"
-)
-
-type BoolArray struct {
- Elements []Bool
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *BoolArray) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = BoolArray{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []bool:
- if value == nil {
- *dst = BoolArray{Status: Null}
- } else if len(value) == 0 {
- *dst = BoolArray{Status: Present}
- } else {
- elements := make([]Bool, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = BoolArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*bool:
- if value == nil {
- *dst = BoolArray{Status: Null}
- } else if len(value) == 0 {
- *dst = BoolArray{Status: Present}
- } else {
- elements := make([]Bool, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = BoolArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []Bool:
- if value == nil {
- *dst = BoolArray{Status: Null}
- } else if len(value) == 0 {
- *dst = BoolArray{Status: Present}
- } else {
- *dst = BoolArray{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = BoolArray{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for BoolArray", src)
- }
- if elementsLength == 0 {
- *dst = BoolArray{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to BoolArray", src)
- }
-
- *dst = BoolArray{
- Elements: make([]Bool, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]Bool, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to BoolArray, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *BoolArray) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to BoolArray")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in BoolArray", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst BoolArray) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *BoolArray) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]bool:
- *v = make([]bool, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*bool:
- *v = make([]*bool, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *BoolArray) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from BoolArray")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from BoolArray")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *BoolArray) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = BoolArray{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []Bool
-
- if len(uta.Elements) > 0 {
- elements = make([]Bool, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem Bool
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = BoolArray{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *BoolArray) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = BoolArray{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = BoolArray{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]Bool, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = BoolArray{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src BoolArray) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src BoolArray) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("bool"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "bool")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *BoolArray) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src BoolArray) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/box.go b/vendor/github.com/jackc/pgtype/box.go
deleted file mode 100644
index 27fb829..0000000
--- a/vendor/github.com/jackc/pgtype/box.go
+++ /dev/null
@@ -1,165 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "math"
- "strconv"
- "strings"
-
- "github.com/jackc/pgio"
-)
-
-type Box struct {
- P [2]Vec2
- Status Status
-}
-
-func (dst *Box) Set(src interface{}) error {
- return fmt.Errorf("cannot convert %v to Box", src)
-}
-
-func (dst Box) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Box) AssignTo(dst interface{}) error {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
-}
-
-func (dst *Box) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Box{Status: Null}
- return nil
- }
-
- if len(src) < 11 {
- return fmt.Errorf("invalid length for Box: %v", len(src))
- }
-
- str := string(src[1:])
-
- var end int
- end = strings.IndexByte(str, ',')
-
- x1, err := strconv.ParseFloat(str[:end], 64)
- if err != nil {
- return err
- }
-
- str = str[end+1:]
- end = strings.IndexByte(str, ')')
-
- y1, err := strconv.ParseFloat(str[:end], 64)
- if err != nil {
- return err
- }
-
- str = str[end+3:]
- end = strings.IndexByte(str, ',')
-
- x2, err := strconv.ParseFloat(str[:end], 64)
- if err != nil {
- return err
- }
-
- str = str[end+1 : len(str)-1]
-
- y2, err := strconv.ParseFloat(str, 64)
- if err != nil {
- return err
- }
-
- *dst = Box{P: [2]Vec2{{x1, y1}, {x2, y2}}, Status: Present}
- return nil
-}
-
-func (dst *Box) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Box{Status: Null}
- return nil
- }
-
- if len(src) != 32 {
- return fmt.Errorf("invalid length for Box: %v", len(src))
- }
-
- x1 := binary.BigEndian.Uint64(src)
- y1 := binary.BigEndian.Uint64(src[8:])
- x2 := binary.BigEndian.Uint64(src[16:])
- y2 := binary.BigEndian.Uint64(src[24:])
-
- *dst = Box{
- P: [2]Vec2{
- {math.Float64frombits(x1), math.Float64frombits(y1)},
- {math.Float64frombits(x2), math.Float64frombits(y2)},
- },
- Status: Present,
- }
- return nil
-}
-
-func (src Box) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = append(buf, fmt.Sprintf(`(%s,%s),(%s,%s)`,
- strconv.FormatFloat(src.P[0].X, 'f', -1, 64),
- strconv.FormatFloat(src.P[0].Y, 'f', -1, 64),
- strconv.FormatFloat(src.P[1].X, 'f', -1, 64),
- strconv.FormatFloat(src.P[1].Y, 'f', -1, 64),
- )...)
- return buf, nil
-}
-
-func (src Box) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = pgio.AppendUint64(buf, math.Float64bits(src.P[0].X))
- buf = pgio.AppendUint64(buf, math.Float64bits(src.P[0].Y))
- buf = pgio.AppendUint64(buf, math.Float64bits(src.P[1].X))
- buf = pgio.AppendUint64(buf, math.Float64bits(src.P[1].Y))
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Box) Scan(src interface{}) error {
- if src == nil {
- *dst = Box{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Box) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/bpchar.go b/vendor/github.com/jackc/pgtype/bpchar.go
deleted file mode 100644
index c5fa42e..0000000
--- a/vendor/github.com/jackc/pgtype/bpchar.go
+++ /dev/null
@@ -1,93 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "fmt"
-)
-
-// BPChar is fixed-length, blank padded char type
-// character(n), char(n)
-type BPChar Text
-
-// Set converts from src to dst.
-func (dst *BPChar) Set(src interface{}) error {
- return (*Text)(dst).Set(src)
-}
-
-// Get returns underlying value
-func (dst BPChar) Get() interface{} {
- return (Text)(dst).Get()
-}
-
-// AssignTo assigns from src to dst.
-func (src *BPChar) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- switch v := dst.(type) {
- case *rune:
- runes := []rune(src.String)
- if len(runes) == 1 {
- *v = runes[0]
- return nil
- }
- case *string:
- *v = src.String
- return nil
- case *[]byte:
- *v = make([]byte, len(src.String))
- copy(*v, src.String)
- return nil
- default:
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
- return fmt.Errorf("unable to assign to %T", dst)
- }
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (BPChar) PreferredResultFormat() int16 {
- return TextFormatCode
-}
-
-func (dst *BPChar) DecodeText(ci *ConnInfo, src []byte) error {
- return (*Text)(dst).DecodeText(ci, src)
-}
-
-func (dst *BPChar) DecodeBinary(ci *ConnInfo, src []byte) error {
- return (*Text)(dst).DecodeBinary(ci, src)
-}
-
-func (BPChar) PreferredParamFormat() int16 {
- return TextFormatCode
-}
-
-func (src BPChar) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- return (Text)(src).EncodeText(ci, buf)
-}
-
-func (src BPChar) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- return (Text)(src).EncodeBinary(ci, buf)
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *BPChar) Scan(src interface{}) error {
- return (*Text)(dst).Scan(src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src BPChar) Value() (driver.Value, error) {
- return (Text)(src).Value()
-}
-
-func (src BPChar) MarshalJSON() ([]byte, error) {
- return (Text)(src).MarshalJSON()
-}
-
-func (dst *BPChar) UnmarshalJSON(b []byte) error {
- return (*Text)(dst).UnmarshalJSON(b)
-}
diff --git a/vendor/github.com/jackc/pgtype/bpchar_array.go b/vendor/github.com/jackc/pgtype/bpchar_array.go
deleted file mode 100644
index 8e79221..0000000
--- a/vendor/github.com/jackc/pgtype/bpchar_array.go
+++ /dev/null
@@ -1,517 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "reflect"
-
- "github.com/jackc/pgio"
-)
-
-type BPCharArray struct {
- Elements []BPChar
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *BPCharArray) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = BPCharArray{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []string:
- if value == nil {
- *dst = BPCharArray{Status: Null}
- } else if len(value) == 0 {
- *dst = BPCharArray{Status: Present}
- } else {
- elements := make([]BPChar, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = BPCharArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*string:
- if value == nil {
- *dst = BPCharArray{Status: Null}
- } else if len(value) == 0 {
- *dst = BPCharArray{Status: Present}
- } else {
- elements := make([]BPChar, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = BPCharArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []BPChar:
- if value == nil {
- *dst = BPCharArray{Status: Null}
- } else if len(value) == 0 {
- *dst = BPCharArray{Status: Present}
- } else {
- *dst = BPCharArray{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = BPCharArray{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for BPCharArray", src)
- }
- if elementsLength == 0 {
- *dst = BPCharArray{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to BPCharArray", src)
- }
-
- *dst = BPCharArray{
- Elements: make([]BPChar, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]BPChar, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to BPCharArray, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *BPCharArray) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to BPCharArray")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in BPCharArray", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst BPCharArray) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *BPCharArray) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]string:
- *v = make([]string, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*string:
- *v = make([]*string, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *BPCharArray) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from BPCharArray")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from BPCharArray")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *BPCharArray) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = BPCharArray{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []BPChar
-
- if len(uta.Elements) > 0 {
- elements = make([]BPChar, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem BPChar
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = BPCharArray{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *BPCharArray) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = BPCharArray{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = BPCharArray{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]BPChar, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = BPCharArray{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src BPCharArray) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src BPCharArray) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("bpchar"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "bpchar")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *BPCharArray) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src BPCharArray) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/bytea.go b/vendor/github.com/jackc/pgtype/bytea.go
deleted file mode 100644
index 67eba35..0000000
--- a/vendor/github.com/jackc/pgtype/bytea.go
+++ /dev/null
@@ -1,163 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/hex"
- "fmt"
-)
-
-type Bytea struct {
- Bytes []byte
- Status Status
-}
-
-func (dst *Bytea) Set(src interface{}) error {
- if src == nil {
- *dst = Bytea{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- switch value := src.(type) {
- case []byte:
- if value != nil {
- *dst = Bytea{Bytes: value, Status: Present}
- } else {
- *dst = Bytea{Status: Null}
- }
- default:
- if originalSrc, ok := underlyingBytesType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to Bytea", value)
- }
-
- return nil
-}
-
-func (dst Bytea) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst.Bytes
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Bytea) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- switch v := dst.(type) {
- case *[]byte:
- buf := make([]byte, len(src.Bytes))
- copy(buf, src.Bytes)
- *v = buf
- return nil
- default:
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
- return fmt.Errorf("unable to assign to %T", dst)
- }
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-// DecodeText only supports the hex format. This has been the default since
-// PostgreSQL 9.0.
-func (dst *Bytea) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Bytea{Status: Null}
- return nil
- }
-
- if len(src) < 2 || src[0] != '\\' || src[1] != 'x' {
- return fmt.Errorf("invalid hex format")
- }
-
- buf := make([]byte, (len(src)-2)/2)
- _, err := hex.Decode(buf, src[2:])
- if err != nil {
- return err
- }
-
- *dst = Bytea{Bytes: buf, Status: Present}
- return nil
-}
-
-func (dst *Bytea) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Bytea{Status: Null}
- return nil
- }
-
- *dst = Bytea{Bytes: src, Status: Present}
- return nil
-}
-
-func (src Bytea) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = append(buf, `\x`...)
- buf = append(buf, hex.EncodeToString(src.Bytes)...)
- return buf, nil
-}
-
-func (src Bytea) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- return append(buf, src.Bytes...), nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Bytea) Scan(src interface{}) error {
- if src == nil {
- *dst = Bytea{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- buf := make([]byte, len(src))
- copy(buf, src)
- *dst = Bytea{Bytes: buf, Status: Present}
- return nil
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Bytea) Value() (driver.Value, error) {
- switch src.Status {
- case Present:
- return src.Bytes, nil
- case Null:
- return nil, nil
- default:
- return nil, errUndefined
- }
-}
diff --git a/vendor/github.com/jackc/pgtype/bytea_array.go b/vendor/github.com/jackc/pgtype/bytea_array.go
deleted file mode 100644
index 69d1ceb..0000000
--- a/vendor/github.com/jackc/pgtype/bytea_array.go
+++ /dev/null
@@ -1,489 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "reflect"
-
- "github.com/jackc/pgio"
-)
-
-type ByteaArray struct {
- Elements []Bytea
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *ByteaArray) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = ByteaArray{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case [][]byte:
- if value == nil {
- *dst = ByteaArray{Status: Null}
- } else if len(value) == 0 {
- *dst = ByteaArray{Status: Present}
- } else {
- elements := make([]Bytea, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = ByteaArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []Bytea:
- if value == nil {
- *dst = ByteaArray{Status: Null}
- } else if len(value) == 0 {
- *dst = ByteaArray{Status: Present}
- } else {
- *dst = ByteaArray{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = ByteaArray{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for ByteaArray", src)
- }
- if elementsLength == 0 {
- *dst = ByteaArray{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to ByteaArray", src)
- }
-
- *dst = ByteaArray{
- Elements: make([]Bytea, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]Bytea, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to ByteaArray, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *ByteaArray) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to ByteaArray")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in ByteaArray", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst ByteaArray) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *ByteaArray) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[][]byte:
- *v = make([][]byte, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *ByteaArray) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from ByteaArray")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from ByteaArray")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *ByteaArray) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = ByteaArray{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []Bytea
-
- if len(uta.Elements) > 0 {
- elements = make([]Bytea, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem Bytea
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = ByteaArray{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *ByteaArray) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = ByteaArray{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = ByteaArray{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]Bytea, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = ByteaArray{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src ByteaArray) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src ByteaArray) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("bytea"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "bytea")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *ByteaArray) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src ByteaArray) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/cid.go b/vendor/github.com/jackc/pgtype/cid.go
deleted file mode 100644
index b944748..0000000
--- a/vendor/github.com/jackc/pgtype/cid.go
+++ /dev/null
@@ -1,61 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
-)
-
-// CID is PostgreSQL's Command Identifier type.
-//
-// When one does
-//
-// select cmin, cmax, * from some_table;
-//
-// it is the data type of the cmin and cmax hidden system columns.
-//
-// It is currently implemented as an unsigned four byte integer.
-// Its definition can be found in src/include/c.h as CommandId
-// in the PostgreSQL sources.
-type CID pguint32
-
-// Set converts from src to dst. Note that as CID is not a general
-// number type Set does not do automatic type conversion as other number
-// types do.
-func (dst *CID) Set(src interface{}) error {
- return (*pguint32)(dst).Set(src)
-}
-
-func (dst CID) Get() interface{} {
- return (pguint32)(dst).Get()
-}
-
-// AssignTo assigns from src to dst. Note that as CID is not a general number
-// type AssignTo does not do automatic type conversion as other number types do.
-func (src *CID) AssignTo(dst interface{}) error {
- return (*pguint32)(src).AssignTo(dst)
-}
-
-func (dst *CID) DecodeText(ci *ConnInfo, src []byte) error {
- return (*pguint32)(dst).DecodeText(ci, src)
-}
-
-func (dst *CID) DecodeBinary(ci *ConnInfo, src []byte) error {
- return (*pguint32)(dst).DecodeBinary(ci, src)
-}
-
-func (src CID) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- return (pguint32)(src).EncodeText(ci, buf)
-}
-
-func (src CID) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- return (pguint32)(src).EncodeBinary(ci, buf)
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *CID) Scan(src interface{}) error {
- return (*pguint32)(dst).Scan(src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src CID) Value() (driver.Value, error) {
- return (pguint32)(src).Value()
-}
diff --git a/vendor/github.com/jackc/pgtype/cidr.go b/vendor/github.com/jackc/pgtype/cidr.go
deleted file mode 100644
index 7c562cf..0000000
--- a/vendor/github.com/jackc/pgtype/cidr.go
+++ /dev/null
@@ -1,43 +0,0 @@
-package pgtype
-
-import "database/sql/driver"
-
-type CIDR Inet
-
-func (dst *CIDR) Set(src interface{}) error {
- return (*Inet)(dst).Set(src)
-}
-
-func (dst CIDR) Get() interface{} {
- return (Inet)(dst).Get()
-}
-
-func (src *CIDR) AssignTo(dst interface{}) error {
- return (*Inet)(src).AssignTo(dst)
-}
-
-func (dst *CIDR) DecodeText(ci *ConnInfo, src []byte) error {
- return (*Inet)(dst).DecodeText(ci, src)
-}
-
-func (dst *CIDR) DecodeBinary(ci *ConnInfo, src []byte) error {
- return (*Inet)(dst).DecodeBinary(ci, src)
-}
-
-func (src CIDR) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- return (Inet)(src).EncodeText(ci, buf)
-}
-
-func (src CIDR) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- return (Inet)(src).EncodeBinary(ci, buf)
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *CIDR) Scan(src interface{}) error {
- return (*Inet)(dst).Scan(src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src CIDR) Value() (driver.Value, error) {
- return (Inet)(src).Value()
-}
diff --git a/vendor/github.com/jackc/pgtype/cidr_array.go b/vendor/github.com/jackc/pgtype/cidr_array.go
deleted file mode 100644
index 783c599..0000000
--- a/vendor/github.com/jackc/pgtype/cidr_array.go
+++ /dev/null
@@ -1,546 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "net"
- "reflect"
-
- "github.com/jackc/pgio"
-)
-
-type CIDRArray struct {
- Elements []CIDR
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *CIDRArray) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = CIDRArray{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []*net.IPNet:
- if value == nil {
- *dst = CIDRArray{Status: Null}
- } else if len(value) == 0 {
- *dst = CIDRArray{Status: Present}
- } else {
- elements := make([]CIDR, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = CIDRArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []net.IP:
- if value == nil {
- *dst = CIDRArray{Status: Null}
- } else if len(value) == 0 {
- *dst = CIDRArray{Status: Present}
- } else {
- elements := make([]CIDR, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = CIDRArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*net.IP:
- if value == nil {
- *dst = CIDRArray{Status: Null}
- } else if len(value) == 0 {
- *dst = CIDRArray{Status: Present}
- } else {
- elements := make([]CIDR, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = CIDRArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []CIDR:
- if value == nil {
- *dst = CIDRArray{Status: Null}
- } else if len(value) == 0 {
- *dst = CIDRArray{Status: Present}
- } else {
- *dst = CIDRArray{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = CIDRArray{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for CIDRArray", src)
- }
- if elementsLength == 0 {
- *dst = CIDRArray{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to CIDRArray", src)
- }
-
- *dst = CIDRArray{
- Elements: make([]CIDR, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]CIDR, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to CIDRArray, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *CIDRArray) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to CIDRArray")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in CIDRArray", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst CIDRArray) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *CIDRArray) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]*net.IPNet:
- *v = make([]*net.IPNet, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]net.IP:
- *v = make([]net.IP, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*net.IP:
- *v = make([]*net.IP, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *CIDRArray) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from CIDRArray")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from CIDRArray")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *CIDRArray) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = CIDRArray{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []CIDR
-
- if len(uta.Elements) > 0 {
- elements = make([]CIDR, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem CIDR
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = CIDRArray{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *CIDRArray) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = CIDRArray{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = CIDRArray{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]CIDR, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = CIDRArray{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src CIDRArray) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src CIDRArray) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("cidr"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "cidr")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *CIDRArray) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src CIDRArray) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/circle.go b/vendor/github.com/jackc/pgtype/circle.go
deleted file mode 100644
index 4279650..0000000
--- a/vendor/github.com/jackc/pgtype/circle.go
+++ /dev/null
@@ -1,150 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "math"
- "strconv"
- "strings"
-
- "github.com/jackc/pgio"
-)
-
-type Circle struct {
- P Vec2
- R float64
- Status Status
-}
-
-func (dst *Circle) Set(src interface{}) error {
- return fmt.Errorf("cannot convert %v to Circle", src)
-}
-
-func (dst Circle) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Circle) AssignTo(dst interface{}) error {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
-}
-
-func (dst *Circle) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Circle{Status: Null}
- return nil
- }
-
- if len(src) < 9 {
- return fmt.Errorf("invalid length for Circle: %v", len(src))
- }
-
- str := string(src[2:])
- end := strings.IndexByte(str, ',')
- x, err := strconv.ParseFloat(str[:end], 64)
- if err != nil {
- return err
- }
-
- str = str[end+1:]
- end = strings.IndexByte(str, ')')
-
- y, err := strconv.ParseFloat(str[:end], 64)
- if err != nil {
- return err
- }
-
- str = str[end+2 : len(str)-1]
-
- r, err := strconv.ParseFloat(str, 64)
- if err != nil {
- return err
- }
-
- *dst = Circle{P: Vec2{x, y}, R: r, Status: Present}
- return nil
-}
-
-func (dst *Circle) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Circle{Status: Null}
- return nil
- }
-
- if len(src) != 24 {
- return fmt.Errorf("invalid length for Circle: %v", len(src))
- }
-
- x := binary.BigEndian.Uint64(src)
- y := binary.BigEndian.Uint64(src[8:])
- r := binary.BigEndian.Uint64(src[16:])
-
- *dst = Circle{
- P: Vec2{math.Float64frombits(x), math.Float64frombits(y)},
- R: math.Float64frombits(r),
- Status: Present,
- }
- return nil
-}
-
-func (src Circle) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = append(buf, fmt.Sprintf(`<(%s,%s),%s>`,
- strconv.FormatFloat(src.P.X, 'f', -1, 64),
- strconv.FormatFloat(src.P.Y, 'f', -1, 64),
- strconv.FormatFloat(src.R, 'f', -1, 64),
- )...)
-
- return buf, nil
-}
-
-func (src Circle) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = pgio.AppendUint64(buf, math.Float64bits(src.P.X))
- buf = pgio.AppendUint64(buf, math.Float64bits(src.P.Y))
- buf = pgio.AppendUint64(buf, math.Float64bits(src.R))
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Circle) Scan(src interface{}) error {
- if src == nil {
- *dst = Circle{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Circle) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/composite_fields.go b/vendor/github.com/jackc/pgtype/composite_fields.go
deleted file mode 100644
index b6d09fc..0000000
--- a/vendor/github.com/jackc/pgtype/composite_fields.go
+++ /dev/null
@@ -1,107 +0,0 @@
-package pgtype
-
-import "fmt"
-
-// CompositeFields scans the fields of a composite type into the elements of the CompositeFields value. To scan a
-// nullable value use a *CompositeFields. It will be set to nil in case of null.
-//
-// CompositeFields implements EncodeBinary and EncodeText. However, functionality is limited due to CompositeFields not
-// knowing the PostgreSQL schema of the composite type. Prefer using a registered CompositeType.
-type CompositeFields []interface{}
-
-func (cf CompositeFields) DecodeBinary(ci *ConnInfo, src []byte) error {
- if len(cf) == 0 {
- return fmt.Errorf("cannot decode into empty CompositeFields")
- }
-
- if src == nil {
- return fmt.Errorf("cannot decode unexpected null into CompositeFields")
- }
-
- scanner := NewCompositeBinaryScanner(ci, src)
-
- for _, f := range cf {
- scanner.ScanValue(f)
- }
-
- if scanner.Err() != nil {
- return scanner.Err()
- }
-
- return nil
-}
-
-func (cf CompositeFields) DecodeText(ci *ConnInfo, src []byte) error {
- if len(cf) == 0 {
- return fmt.Errorf("cannot decode into empty CompositeFields")
- }
-
- if src == nil {
- return fmt.Errorf("cannot decode unexpected null into CompositeFields")
- }
-
- scanner := NewCompositeTextScanner(ci, src)
-
- for _, f := range cf {
- scanner.ScanValue(f)
- }
-
- if scanner.Err() != nil {
- return scanner.Err()
- }
-
- return nil
-}
-
-// EncodeText encodes composite fields into the text format. Prefer registering a CompositeType to using
-// CompositeFields to encode directly.
-func (cf CompositeFields) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- b := NewCompositeTextBuilder(ci, buf)
-
- for _, f := range cf {
- if textEncoder, ok := f.(TextEncoder); ok {
- b.AppendEncoder(textEncoder)
- } else {
- b.AppendValue(f)
- }
- }
-
- return b.Finish()
-}
-
-// EncodeBinary encodes composite fields into the binary format. Unlike CompositeType the schema of the destination is
-// unknown. Prefer registering a CompositeType to using CompositeFields to encode directly. Because the binary
-// composite format requires the OID of each field to be specified the only types that will work are those known to
-// ConnInfo.
-//
-// In particular:
-//
-// * Nil cannot be used because there is no way to determine what type it.
-// * Integer types must be exact matches. e.g. A Go int32 into a PostgreSQL bigint will fail.
-// * No dereferencing will be done. e.g. *Text must be used instead of Text.
-func (cf CompositeFields) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- b := NewCompositeBinaryBuilder(ci, buf)
-
- for _, f := range cf {
- dt, ok := ci.DataTypeForValue(f)
- if !ok {
- return nil, fmt.Errorf("Unknown OID for %#v", f)
- }
-
- if binaryEncoder, ok := f.(BinaryEncoder); ok {
- b.AppendEncoder(dt.OID, binaryEncoder)
- } else {
- err := dt.Value.Set(f)
- if err != nil {
- return nil, err
- }
- if binaryEncoder, ok := dt.Value.(BinaryEncoder); ok {
- b.AppendEncoder(dt.OID, binaryEncoder)
- } else {
- return nil, fmt.Errorf("Cannot encode binary format for %v", f)
- }
- }
- }
-
- return b.Finish()
-}
diff --git a/vendor/github.com/jackc/pgtype/composite_type.go b/vendor/github.com/jackc/pgtype/composite_type.go
deleted file mode 100644
index 32e0aa2..0000000
--- a/vendor/github.com/jackc/pgtype/composite_type.go
+++ /dev/null
@@ -1,682 +0,0 @@
-package pgtype
-
-import (
- "encoding/binary"
- "errors"
- "fmt"
- "reflect"
- "strings"
-
- "github.com/jackc/pgio"
-)
-
-type CompositeTypeField struct {
- Name string
- OID uint32
-}
-
-type CompositeType struct {
- status Status
-
- typeName string
-
- fields []CompositeTypeField
- valueTranscoders []ValueTranscoder
-}
-
-// NewCompositeType creates a CompositeType from fields and ci. ci is used to find the ValueTranscoders used
-// for fields. All field OIDs must be previously registered in ci.
-func NewCompositeType(typeName string, fields []CompositeTypeField, ci *ConnInfo) (*CompositeType, error) {
- valueTranscoders := make([]ValueTranscoder, len(fields))
-
- for i := range fields {
- dt, ok := ci.DataTypeForOID(fields[i].OID)
- if !ok {
- return nil, fmt.Errorf("no data type registered for oid: %d", fields[i].OID)
- }
-
- value := NewValue(dt.Value)
- valueTranscoder, ok := value.(ValueTranscoder)
- if !ok {
- return nil, fmt.Errorf("data type for oid does not implement ValueTranscoder: %d", fields[i].OID)
- }
-
- valueTranscoders[i] = valueTranscoder
- }
-
- return &CompositeType{typeName: typeName, fields: fields, valueTranscoders: valueTranscoders}, nil
-}
-
-// NewCompositeTypeValues creates a CompositeType from fields and values. fields and values must have the same length.
-// Prefer NewCompositeType unless overriding the transcoding of fields is required.
-func NewCompositeTypeValues(typeName string, fields []CompositeTypeField, values []ValueTranscoder) (*CompositeType, error) {
- if len(fields) != len(values) {
- return nil, errors.New("fields and valueTranscoders must have same length")
- }
-
- return &CompositeType{typeName: typeName, fields: fields, valueTranscoders: values}, nil
-}
-
-func (src CompositeType) Get() interface{} {
- switch src.status {
- case Present:
- results := make(map[string]interface{}, len(src.valueTranscoders))
- for i := range src.valueTranscoders {
- results[src.fields[i].Name] = src.valueTranscoders[i].Get()
- }
- return results
- case Null:
- return nil
- default:
- return src.status
- }
-}
-
-func (ct *CompositeType) NewTypeValue() Value {
- a := &CompositeType{
- typeName: ct.typeName,
- fields: ct.fields,
- valueTranscoders: make([]ValueTranscoder, len(ct.valueTranscoders)),
- }
-
- for i := range ct.valueTranscoders {
- a.valueTranscoders[i] = NewValue(ct.valueTranscoders[i]).(ValueTranscoder)
- }
-
- return a
-}
-
-func (ct *CompositeType) TypeName() string {
- return ct.typeName
-}
-
-func (ct *CompositeType) Fields() []CompositeTypeField {
- return ct.fields
-}
-
-func (dst *CompositeType) Set(src interface{}) error {
- if src == nil {
- dst.status = Null
- return nil
- }
-
- switch value := src.(type) {
- case []interface{}:
- if len(value) != len(dst.valueTranscoders) {
- return fmt.Errorf("Number of fields don't match. CompositeType has %d fields", len(dst.valueTranscoders))
- }
- for i, v := range value {
- if err := dst.valueTranscoders[i].Set(v); err != nil {
- return err
- }
- }
- dst.status = Present
- case *[]interface{}:
- if value == nil {
- dst.status = Null
- return nil
- }
- return dst.Set(*value)
- default:
- return fmt.Errorf("Can not convert %v to Composite", src)
- }
-
- return nil
-}
-
-// AssignTo should never be called on composite value directly
-func (src CompositeType) AssignTo(dst interface{}) error {
- switch src.status {
- case Present:
- switch v := dst.(type) {
- case []interface{}:
- if len(v) != len(src.valueTranscoders) {
- return fmt.Errorf("Number of fields don't match. CompositeType has %d fields", len(src.valueTranscoders))
- }
- for i := range src.valueTranscoders {
- if v[i] == nil {
- continue
- }
-
- err := assignToOrSet(src.valueTranscoders[i], v[i])
- if err != nil {
- return fmt.Errorf("unable to assign to dst[%d]: %v", i, err)
- }
- }
- return nil
- case *[]interface{}:
- return src.AssignTo(*v)
- default:
- if isPtrStruct, err := src.assignToPtrStruct(dst); isPtrStruct {
- return err
- }
-
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
- return fmt.Errorf("unable to assign to %T", dst)
- }
- case Null:
- return NullAssignTo(dst)
- }
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func assignToOrSet(src Value, dst interface{}) error {
- assignToErr := src.AssignTo(dst)
- if assignToErr != nil {
- // Try to use get / set instead -- this avoids every type having to be able to AssignTo type of self.
- setSucceeded := false
- if setter, ok := dst.(Value); ok {
- err := setter.Set(src.Get())
- setSucceeded = err == nil
- }
- if !setSucceeded {
- return assignToErr
- }
- }
-
- return nil
-}
-
-func (src CompositeType) assignToPtrStruct(dst interface{}) (bool, error) {
- dstValue := reflect.ValueOf(dst)
- if dstValue.Kind() != reflect.Ptr {
- return false, nil
- }
-
- if dstValue.IsNil() {
- return false, nil
- }
-
- dstElemValue := dstValue.Elem()
- dstElemType := dstElemValue.Type()
-
- if dstElemType.Kind() != reflect.Struct {
- return false, nil
- }
-
- exportedFields := make([]int, 0, dstElemType.NumField())
- for i := 0; i < dstElemType.NumField(); i++ {
- sf := dstElemType.Field(i)
- if sf.PkgPath == "" {
- exportedFields = append(exportedFields, i)
- }
- }
-
- if len(exportedFields) != len(src.valueTranscoders) {
- return false, nil
- }
-
- for i := range exportedFields {
- err := assignToOrSet(src.valueTranscoders[i], dstElemValue.Field(exportedFields[i]).Addr().Interface())
- if err != nil {
- return true, fmt.Errorf("unable to assign to field %s: %v", dstElemType.Field(exportedFields[i]).Name, err)
- }
- }
-
- return true, nil
-}
-
-func (src CompositeType) EncodeBinary(ci *ConnInfo, buf []byte) (newBuf []byte, err error) {
- switch src.status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- b := NewCompositeBinaryBuilder(ci, buf)
- for i := range src.valueTranscoders {
- b.AppendEncoder(src.fields[i].OID, src.valueTranscoders[i])
- }
-
- return b.Finish()
-}
-
-// DecodeBinary implements BinaryDecoder interface.
-// Opposite to Record, fields in a composite act as a "schema"
-// and decoding fails if SQL value can't be assigned due to
-// type mismatch
-func (dst *CompositeType) DecodeBinary(ci *ConnInfo, buf []byte) error {
- if buf == nil {
- dst.status = Null
- return nil
- }
-
- scanner := NewCompositeBinaryScanner(ci, buf)
-
- for _, f := range dst.valueTranscoders {
- scanner.ScanDecoder(f)
- }
-
- if scanner.Err() != nil {
- return scanner.Err()
- }
-
- dst.status = Present
-
- return nil
-}
-
-func (dst *CompositeType) DecodeText(ci *ConnInfo, buf []byte) error {
- if buf == nil {
- dst.status = Null
- return nil
- }
-
- scanner := NewCompositeTextScanner(ci, buf)
-
- for _, f := range dst.valueTranscoders {
- scanner.ScanDecoder(f)
- }
-
- if scanner.Err() != nil {
- return scanner.Err()
- }
-
- dst.status = Present
-
- return nil
-}
-
-func (src CompositeType) EncodeText(ci *ConnInfo, buf []byte) (newBuf []byte, err error) {
- switch src.status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- b := NewCompositeTextBuilder(ci, buf)
- for _, f := range src.valueTranscoders {
- b.AppendEncoder(f)
- }
-
- return b.Finish()
-}
-
-type CompositeBinaryScanner struct {
- ci *ConnInfo
- rp int
- src []byte
-
- fieldCount int32
- fieldBytes []byte
- fieldOID uint32
- err error
-}
-
-// NewCompositeBinaryScanner a scanner over a binary encoded composite balue.
-func NewCompositeBinaryScanner(ci *ConnInfo, src []byte) *CompositeBinaryScanner {
- rp := 0
- if len(src[rp:]) < 4 {
- return &CompositeBinaryScanner{err: fmt.Errorf("Record incomplete %v", src)}
- }
-
- fieldCount := int32(binary.BigEndian.Uint32(src[rp:]))
- rp += 4
-
- return &CompositeBinaryScanner{
- ci: ci,
- rp: rp,
- src: src,
- fieldCount: fieldCount,
- }
-}
-
-// ScanDecoder calls Next and decodes the result with d.
-func (cfs *CompositeBinaryScanner) ScanDecoder(d BinaryDecoder) {
- if cfs.err != nil {
- return
- }
-
- if cfs.Next() {
- cfs.err = d.DecodeBinary(cfs.ci, cfs.fieldBytes)
- } else {
- cfs.err = errors.New("read past end of composite")
- }
-}
-
-// ScanDecoder calls Next and scans the result into d.
-func (cfs *CompositeBinaryScanner) ScanValue(d interface{}) {
- if cfs.err != nil {
- return
- }
-
- if cfs.Next() {
- cfs.err = cfs.ci.Scan(cfs.OID(), BinaryFormatCode, cfs.Bytes(), d)
- } else {
- cfs.err = errors.New("read past end of composite")
- }
-}
-
-// Next advances the scanner to the next field. It returns false after the last field is read or an error occurs. After
-// Next returns false, the Err method can be called to check if any errors occurred.
-func (cfs *CompositeBinaryScanner) Next() bool {
- if cfs.err != nil {
- return false
- }
-
- if cfs.rp == len(cfs.src) {
- return false
- }
-
- if len(cfs.src[cfs.rp:]) < 8 {
- cfs.err = fmt.Errorf("Record incomplete %v", cfs.src)
- return false
- }
- cfs.fieldOID = binary.BigEndian.Uint32(cfs.src[cfs.rp:])
- cfs.rp += 4
-
- fieldLen := int(int32(binary.BigEndian.Uint32(cfs.src[cfs.rp:])))
- cfs.rp += 4
-
- if fieldLen >= 0 {
- if len(cfs.src[cfs.rp:]) < fieldLen {
- cfs.err = fmt.Errorf("Record incomplete rp=%d src=%v", cfs.rp, cfs.src)
- return false
- }
- cfs.fieldBytes = cfs.src[cfs.rp : cfs.rp+fieldLen]
- cfs.rp += fieldLen
- } else {
- cfs.fieldBytes = nil
- }
-
- return true
-}
-
-func (cfs *CompositeBinaryScanner) FieldCount() int {
- return int(cfs.fieldCount)
-}
-
-// Bytes returns the bytes of the field most recently read by Scan().
-func (cfs *CompositeBinaryScanner) Bytes() []byte {
- return cfs.fieldBytes
-}
-
-// OID returns the OID of the field most recently read by Scan().
-func (cfs *CompositeBinaryScanner) OID() uint32 {
- return cfs.fieldOID
-}
-
-// Err returns any error encountered by the scanner.
-func (cfs *CompositeBinaryScanner) Err() error {
- return cfs.err
-}
-
-type CompositeTextScanner struct {
- ci *ConnInfo
- rp int
- src []byte
-
- fieldBytes []byte
- err error
-}
-
-// NewCompositeTextScanner a scanner over a text encoded composite value.
-func NewCompositeTextScanner(ci *ConnInfo, src []byte) *CompositeTextScanner {
- if len(src) < 2 {
- return &CompositeTextScanner{err: fmt.Errorf("Record incomplete %v", src)}
- }
-
- if src[0] != '(' {
- return &CompositeTextScanner{err: fmt.Errorf("composite text format must start with '('")}
- }
-
- if src[len(src)-1] != ')' {
- return &CompositeTextScanner{err: fmt.Errorf("composite text format must end with ')'")}
- }
-
- return &CompositeTextScanner{
- ci: ci,
- rp: 1,
- src: src,
- }
-}
-
-// ScanDecoder calls Next and decodes the result with d.
-func (cfs *CompositeTextScanner) ScanDecoder(d TextDecoder) {
- if cfs.err != nil {
- return
- }
-
- if cfs.Next() {
- cfs.err = d.DecodeText(cfs.ci, cfs.fieldBytes)
- } else {
- cfs.err = errors.New("read past end of composite")
- }
-}
-
-// ScanDecoder calls Next and scans the result into d.
-func (cfs *CompositeTextScanner) ScanValue(d interface{}) {
- if cfs.err != nil {
- return
- }
-
- if cfs.Next() {
- cfs.err = cfs.ci.Scan(0, TextFormatCode, cfs.Bytes(), d)
- } else {
- cfs.err = errors.New("read past end of composite")
- }
-}
-
-// Next advances the scanner to the next field. It returns false after the last field is read or an error occurs. After
-// Next returns false, the Err method can be called to check if any errors occurred.
-func (cfs *CompositeTextScanner) Next() bool {
- if cfs.err != nil {
- return false
- }
-
- if cfs.rp == len(cfs.src) {
- return false
- }
-
- switch cfs.src[cfs.rp] {
- case ',', ')': // null
- cfs.rp++
- cfs.fieldBytes = nil
- return true
- case '"': // quoted value
- cfs.rp++
- cfs.fieldBytes = make([]byte, 0, 16)
- for {
- ch := cfs.src[cfs.rp]
-
- if ch == '"' {
- cfs.rp++
- if cfs.src[cfs.rp] == '"' {
- cfs.fieldBytes = append(cfs.fieldBytes, '"')
- cfs.rp++
- } else {
- break
- }
- } else if ch == '\\' {
- cfs.rp++
- cfs.fieldBytes = append(cfs.fieldBytes, cfs.src[cfs.rp])
- cfs.rp++
- } else {
- cfs.fieldBytes = append(cfs.fieldBytes, ch)
- cfs.rp++
- }
- }
- cfs.rp++
- return true
- default: // unquoted value
- start := cfs.rp
- for {
- ch := cfs.src[cfs.rp]
- if ch == ',' || ch == ')' {
- break
- }
- cfs.rp++
- }
- cfs.fieldBytes = cfs.src[start:cfs.rp]
- cfs.rp++
- return true
- }
-}
-
-// Bytes returns the bytes of the field most recently read by Scan().
-func (cfs *CompositeTextScanner) Bytes() []byte {
- return cfs.fieldBytes
-}
-
-// Err returns any error encountered by the scanner.
-func (cfs *CompositeTextScanner) Err() error {
- return cfs.err
-}
-
-type CompositeBinaryBuilder struct {
- ci *ConnInfo
- buf []byte
- startIdx int
- fieldCount uint32
- err error
-}
-
-func NewCompositeBinaryBuilder(ci *ConnInfo, buf []byte) *CompositeBinaryBuilder {
- startIdx := len(buf)
- buf = append(buf, 0, 0, 0, 0) // allocate room for number of fields
- return &CompositeBinaryBuilder{ci: ci, buf: buf, startIdx: startIdx}
-}
-
-func (b *CompositeBinaryBuilder) AppendValue(oid uint32, field interface{}) {
- if b.err != nil {
- return
- }
-
- dt, ok := b.ci.DataTypeForOID(oid)
- if !ok {
- b.err = fmt.Errorf("unknown data type for OID: %d", oid)
- return
- }
-
- err := dt.Value.Set(field)
- if err != nil {
- b.err = err
- return
- }
-
- binaryEncoder, ok := dt.Value.(BinaryEncoder)
- if !ok {
- b.err = fmt.Errorf("unable to encode binary for OID: %d", oid)
- return
- }
-
- b.AppendEncoder(oid, binaryEncoder)
-}
-
-func (b *CompositeBinaryBuilder) AppendEncoder(oid uint32, field BinaryEncoder) {
- if b.err != nil {
- return
- }
-
- b.buf = pgio.AppendUint32(b.buf, oid)
- lengthPos := len(b.buf)
- b.buf = pgio.AppendInt32(b.buf, -1)
- fieldBuf, err := field.EncodeBinary(b.ci, b.buf)
- if err != nil {
- b.err = err
- return
- }
- if fieldBuf != nil {
- binary.BigEndian.PutUint32(fieldBuf[lengthPos:], uint32(len(fieldBuf)-len(b.buf)))
- b.buf = fieldBuf
- }
-
- b.fieldCount++
-}
-
-func (b *CompositeBinaryBuilder) Finish() ([]byte, error) {
- if b.err != nil {
- return nil, b.err
- }
-
- binary.BigEndian.PutUint32(b.buf[b.startIdx:], b.fieldCount)
- return b.buf, nil
-}
-
-type CompositeTextBuilder struct {
- ci *ConnInfo
- buf []byte
- startIdx int
- fieldCount uint32
- err error
- fieldBuf [32]byte
-}
-
-func NewCompositeTextBuilder(ci *ConnInfo, buf []byte) *CompositeTextBuilder {
- buf = append(buf, '(') // allocate room for number of fields
- return &CompositeTextBuilder{ci: ci, buf: buf}
-}
-
-func (b *CompositeTextBuilder) AppendValue(field interface{}) {
- if b.err != nil {
- return
- }
-
- if field == nil {
- b.buf = append(b.buf, ',')
- return
- }
-
- dt, ok := b.ci.DataTypeForValue(field)
- if !ok {
- b.err = fmt.Errorf("unknown data type for field: %v", field)
- return
- }
-
- err := dt.Value.Set(field)
- if err != nil {
- b.err = err
- return
- }
-
- textEncoder, ok := dt.Value.(TextEncoder)
- if !ok {
- b.err = fmt.Errorf("unable to encode text for value: %v", field)
- return
- }
-
- b.AppendEncoder(textEncoder)
-}
-
-func (b *CompositeTextBuilder) AppendEncoder(field TextEncoder) {
- if b.err != nil {
- return
- }
-
- fieldBuf, err := field.EncodeText(b.ci, b.fieldBuf[0:0])
- if err != nil {
- b.err = err
- return
- }
- if fieldBuf != nil {
- b.buf = append(b.buf, quoteCompositeFieldIfNeeded(string(fieldBuf))...)
- }
-
- b.buf = append(b.buf, ',')
-}
-
-func (b *CompositeTextBuilder) Finish() ([]byte, error) {
- if b.err != nil {
- return nil, b.err
- }
-
- b.buf[len(b.buf)-1] = ')'
- return b.buf, nil
-}
-
-var quoteCompositeReplacer = strings.NewReplacer(`\`, `\\`, `"`, `\"`)
-
-func quoteCompositeField(src string) string {
- return `"` + quoteCompositeReplacer.Replace(src) + `"`
-}
-
-func quoteCompositeFieldIfNeeded(src string) string {
- if src == "" || src[0] == ' ' || src[len(src)-1] == ' ' || strings.ContainsAny(src, `(),"\`) {
- return quoteCompositeField(src)
- }
- return src
-}
diff --git a/vendor/github.com/jackc/pgtype/convert.go b/vendor/github.com/jackc/pgtype/convert.go
deleted file mode 100644
index 377fe3e..0000000
--- a/vendor/github.com/jackc/pgtype/convert.go
+++ /dev/null
@@ -1,476 +0,0 @@
-package pgtype
-
-import (
- "database/sql"
- "fmt"
- "math"
- "reflect"
- "time"
-)
-
-const (
- maxUint = ^uint(0)
- maxInt = int(maxUint >> 1)
- minInt = -maxInt - 1
-)
-
-// underlyingNumberType gets the underlying type that can be converted to Int2, Int4, Int8, Float4, or Float8
-func underlyingNumberType(val interface{}) (interface{}, bool) {
- refVal := reflect.ValueOf(val)
-
- switch refVal.Kind() {
- case reflect.Ptr:
- if refVal.IsNil() {
- return nil, false
- }
- convVal := refVal.Elem().Interface()
- return convVal, true
- case reflect.Int:
- convVal := int(refVal.Int())
- return convVal, reflect.TypeOf(convVal) != refVal.Type()
- case reflect.Int8:
- convVal := int8(refVal.Int())
- return convVal, reflect.TypeOf(convVal) != refVal.Type()
- case reflect.Int16:
- convVal := int16(refVal.Int())
- return convVal, reflect.TypeOf(convVal) != refVal.Type()
- case reflect.Int32:
- convVal := int32(refVal.Int())
- return convVal, reflect.TypeOf(convVal) != refVal.Type()
- case reflect.Int64:
- convVal := int64(refVal.Int())
- return convVal, reflect.TypeOf(convVal) != refVal.Type()
- case reflect.Uint:
- convVal := uint(refVal.Uint())
- return convVal, reflect.TypeOf(convVal) != refVal.Type()
- case reflect.Uint8:
- convVal := uint8(refVal.Uint())
- return convVal, reflect.TypeOf(convVal) != refVal.Type()
- case reflect.Uint16:
- convVal := uint16(refVal.Uint())
- return convVal, reflect.TypeOf(convVal) != refVal.Type()
- case reflect.Uint32:
- convVal := uint32(refVal.Uint())
- return convVal, reflect.TypeOf(convVal) != refVal.Type()
- case reflect.Uint64:
- convVal := uint64(refVal.Uint())
- return convVal, reflect.TypeOf(convVal) != refVal.Type()
- case reflect.Float32:
- convVal := float32(refVal.Float())
- return convVal, reflect.TypeOf(convVal) != refVal.Type()
- case reflect.Float64:
- convVal := refVal.Float()
- return convVal, reflect.TypeOf(convVal) != refVal.Type()
- case reflect.String:
- convVal := refVal.String()
- return convVal, reflect.TypeOf(convVal) != refVal.Type()
- }
-
- return nil, false
-}
-
-// underlyingBoolType gets the underlying type that can be converted to Bool
-func underlyingBoolType(val interface{}) (interface{}, bool) {
- refVal := reflect.ValueOf(val)
-
- switch refVal.Kind() {
- case reflect.Ptr:
- if refVal.IsNil() {
- return nil, false
- }
- convVal := refVal.Elem().Interface()
- return convVal, true
- case reflect.Bool:
- convVal := refVal.Bool()
- return convVal, reflect.TypeOf(convVal) != refVal.Type()
- }
-
- return nil, false
-}
-
-// underlyingBytesType gets the underlying type that can be converted to []byte
-func underlyingBytesType(val interface{}) (interface{}, bool) {
- refVal := reflect.ValueOf(val)
-
- switch refVal.Kind() {
- case reflect.Ptr:
- if refVal.IsNil() {
- return nil, false
- }
- convVal := refVal.Elem().Interface()
- return convVal, true
- case reflect.Slice:
- if refVal.Type().Elem().Kind() == reflect.Uint8 {
- convVal := refVal.Bytes()
- return convVal, reflect.TypeOf(convVal) != refVal.Type()
- }
- }
-
- return nil, false
-}
-
-// underlyingStringType gets the underlying type that can be converted to String
-func underlyingStringType(val interface{}) (interface{}, bool) {
- refVal := reflect.ValueOf(val)
-
- switch refVal.Kind() {
- case reflect.Ptr:
- if refVal.IsNil() {
- return nil, false
- }
- convVal := refVal.Elem().Interface()
- return convVal, true
- case reflect.String:
- convVal := refVal.String()
- return convVal, reflect.TypeOf(convVal) != refVal.Type()
- }
-
- return nil, false
-}
-
-// underlyingPtrType dereferences a pointer
-func underlyingPtrType(val interface{}) (interface{}, bool) {
- refVal := reflect.ValueOf(val)
-
- switch refVal.Kind() {
- case reflect.Ptr:
- if refVal.IsNil() {
- return nil, false
- }
- convVal := refVal.Elem().Interface()
- return convVal, true
- }
-
- return nil, false
-}
-
-// underlyingTimeType gets the underlying type that can be converted to time.Time
-func underlyingTimeType(val interface{}) (interface{}, bool) {
- refVal := reflect.ValueOf(val)
-
- switch refVal.Kind() {
- case reflect.Ptr:
- if refVal.IsNil() {
- return nil, false
- }
- convVal := refVal.Elem().Interface()
- return convVal, true
- }
-
- timeType := reflect.TypeOf(time.Time{})
- if refVal.Type().ConvertibleTo(timeType) {
- return refVal.Convert(timeType).Interface(), true
- }
-
- return nil, false
-}
-
-// underlyingUUIDType gets the underlying type that can be converted to [16]byte
-func underlyingUUIDType(val interface{}) (interface{}, bool) {
- refVal := reflect.ValueOf(val)
-
- switch refVal.Kind() {
- case reflect.Ptr:
- if refVal.IsNil() {
- return nil, false
- }
- convVal := refVal.Elem().Interface()
- return convVal, true
- }
-
- uuidType := reflect.TypeOf([16]byte{})
- if refVal.Type().ConvertibleTo(uuidType) {
- return refVal.Convert(uuidType).Interface(), true
- }
-
- return nil, false
-}
-
-// underlyingSliceType gets the underlying slice type
-func underlyingSliceType(val interface{}) (interface{}, bool) {
- refVal := reflect.ValueOf(val)
-
- switch refVal.Kind() {
- case reflect.Ptr:
- if refVal.IsNil() {
- return nil, false
- }
- convVal := refVal.Elem().Interface()
- return convVal, true
- case reflect.Slice:
- baseSliceType := reflect.SliceOf(refVal.Type().Elem())
- if refVal.Type().ConvertibleTo(baseSliceType) {
- convVal := refVal.Convert(baseSliceType)
- return convVal.Interface(), reflect.TypeOf(convVal.Interface()) != refVal.Type()
- }
- }
-
- return nil, false
-}
-
-func int64AssignTo(srcVal int64, srcStatus Status, dst interface{}) error {
- if srcStatus == Present {
- switch v := dst.(type) {
- case *int:
- if srcVal < int64(minInt) {
- return fmt.Errorf("%d is less than minimum value for int", srcVal)
- } else if srcVal > int64(maxInt) {
- return fmt.Errorf("%d is greater than maximum value for int", srcVal)
- }
- *v = int(srcVal)
- case *int8:
- if srcVal < math.MinInt8 {
- return fmt.Errorf("%d is less than minimum value for int8", srcVal)
- } else if srcVal > math.MaxInt8 {
- return fmt.Errorf("%d is greater than maximum value for int8", srcVal)
- }
- *v = int8(srcVal)
- case *int16:
- if srcVal < math.MinInt16 {
- return fmt.Errorf("%d is less than minimum value for int16", srcVal)
- } else if srcVal > math.MaxInt16 {
- return fmt.Errorf("%d is greater than maximum value for int16", srcVal)
- }
- *v = int16(srcVal)
- case *int32:
- if srcVal < math.MinInt32 {
- return fmt.Errorf("%d is less than minimum value for int32", srcVal)
- } else if srcVal > math.MaxInt32 {
- return fmt.Errorf("%d is greater than maximum value for int32", srcVal)
- }
- *v = int32(srcVal)
- case *int64:
- if srcVal < math.MinInt64 {
- return fmt.Errorf("%d is less than minimum value for int64", srcVal)
- } else if srcVal > math.MaxInt64 {
- return fmt.Errorf("%d is greater than maximum value for int64", srcVal)
- }
- *v = int64(srcVal)
- case *uint:
- if srcVal < 0 {
- return fmt.Errorf("%d is less than zero for uint", srcVal)
- } else if uint64(srcVal) > uint64(maxUint) {
- return fmt.Errorf("%d is greater than maximum value for uint", srcVal)
- }
- *v = uint(srcVal)
- case *uint8:
- if srcVal < 0 {
- return fmt.Errorf("%d is less than zero for uint8", srcVal)
- } else if srcVal > math.MaxUint8 {
- return fmt.Errorf("%d is greater than maximum value for uint8", srcVal)
- }
- *v = uint8(srcVal)
- case *uint16:
- if srcVal < 0 {
- return fmt.Errorf("%d is less than zero for uint32", srcVal)
- } else if srcVal > math.MaxUint16 {
- return fmt.Errorf("%d is greater than maximum value for uint16", srcVal)
- }
- *v = uint16(srcVal)
- case *uint32:
- if srcVal < 0 {
- return fmt.Errorf("%d is less than zero for uint32", srcVal)
- } else if srcVal > math.MaxUint32 {
- return fmt.Errorf("%d is greater than maximum value for uint32", srcVal)
- }
- *v = uint32(srcVal)
- case *uint64:
- if srcVal < 0 {
- return fmt.Errorf("%d is less than zero for uint64", srcVal)
- }
- *v = uint64(srcVal)
- case sql.Scanner:
- return v.Scan(srcVal)
- default:
- if v := reflect.ValueOf(dst); v.Kind() == reflect.Ptr {
- el := v.Elem()
- switch el.Kind() {
- // if dst is a pointer to pointer, strip the pointer and try again
- case reflect.Ptr:
- if el.IsNil() {
- // allocate destination
- el.Set(reflect.New(el.Type().Elem()))
- }
- return int64AssignTo(srcVal, srcStatus, el.Interface())
- case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64:
- if el.OverflowInt(int64(srcVal)) {
- return fmt.Errorf("cannot put %d into %T", srcVal, dst)
- }
- el.SetInt(int64(srcVal))
- return nil
- case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64:
- if srcVal < 0 {
- return fmt.Errorf("%d is less than zero for %T", srcVal, dst)
- }
- if el.OverflowUint(uint64(srcVal)) {
- return fmt.Errorf("cannot put %d into %T", srcVal, dst)
- }
- el.SetUint(uint64(srcVal))
- return nil
- }
- }
- return fmt.Errorf("cannot assign %v into %T", srcVal, dst)
- }
- return nil
- }
-
- // if dst is a pointer to pointer and srcStatus is not Present, nil it out
- if v := reflect.ValueOf(dst); v.Kind() == reflect.Ptr {
- el := v.Elem()
- if el.Kind() == reflect.Ptr {
- el.Set(reflect.Zero(el.Type()))
- return nil
- }
- }
-
- return fmt.Errorf("cannot assign %v %v into %T", srcVal, srcStatus, dst)
-}
-
-func float64AssignTo(srcVal float64, srcStatus Status, dst interface{}) error {
- if srcStatus == Present {
- switch v := dst.(type) {
- case *float32:
- *v = float32(srcVal)
- case *float64:
- *v = srcVal
- default:
- if v := reflect.ValueOf(dst); v.Kind() == reflect.Ptr {
- el := v.Elem()
- switch el.Kind() {
- // if dst is a type alias of a float32 or 64, set dst val
- case reflect.Float32, reflect.Float64:
- el.SetFloat(srcVal)
- return nil
- // if dst is a pointer to pointer, strip the pointer and try again
- case reflect.Ptr:
- if el.IsNil() {
- // allocate destination
- el.Set(reflect.New(el.Type().Elem()))
- }
- return float64AssignTo(srcVal, srcStatus, el.Interface())
- case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64, reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64:
- i64 := int64(srcVal)
- if float64(i64) == srcVal {
- return int64AssignTo(i64, srcStatus, dst)
- }
- }
- }
- return fmt.Errorf("cannot assign %v into %T", srcVal, dst)
- }
- return nil
- }
-
- // if dst is a pointer to pointer and srcStatus is not Present, nil it out
- if v := reflect.ValueOf(dst); v.Kind() == reflect.Ptr {
- el := v.Elem()
- if el.Kind() == reflect.Ptr {
- el.Set(reflect.Zero(el.Type()))
- return nil
- }
- }
-
- return fmt.Errorf("cannot assign %v %v into %T", srcVal, srcStatus, dst)
-}
-
-func NullAssignTo(dst interface{}) error {
- dstPtr := reflect.ValueOf(dst)
-
- // AssignTo dst must always be a pointer
- if dstPtr.Kind() != reflect.Ptr {
- return &nullAssignmentError{dst: dst}
- }
-
- dstVal := dstPtr.Elem()
-
- switch dstVal.Kind() {
- case reflect.Ptr, reflect.Slice, reflect.Map:
- dstVal.Set(reflect.Zero(dstVal.Type()))
- return nil
- }
-
- return &nullAssignmentError{dst: dst}
-}
-
-var kindTypes map[reflect.Kind]reflect.Type
-
-func toInterface(dst reflect.Value, t reflect.Type) (interface{}, bool) {
- nextDst := dst.Convert(t)
- return nextDst.Interface(), dst.Type() != nextDst.Type()
-}
-
-// GetAssignToDstType attempts to convert dst to something AssignTo can assign
-// to. If dst is a pointer to pointer it allocates a value and returns the
-// dereferences pointer. If dst is a named type such as *Foo where Foo is type
-// Foo int16, it converts dst to *int16.
-//
-// GetAssignToDstType returns the converted dst and a bool representing if any
-// change was made.
-func GetAssignToDstType(dst interface{}) (interface{}, bool) {
- dstPtr := reflect.ValueOf(dst)
-
- // AssignTo dst must always be a pointer
- if dstPtr.Kind() != reflect.Ptr {
- return nil, false
- }
-
- dstVal := dstPtr.Elem()
-
- // if dst is a pointer to pointer, allocate space try again with the dereferenced pointer
- if dstVal.Kind() == reflect.Ptr {
- dstVal.Set(reflect.New(dstVal.Type().Elem()))
- return dstVal.Interface(), true
- }
-
- // if dst is pointer to a base type that has been renamed
- if baseValType, ok := kindTypes[dstVal.Kind()]; ok {
- return toInterface(dstPtr, reflect.PtrTo(baseValType))
- }
-
- if dstVal.Kind() == reflect.Slice {
- if baseElemType, ok := kindTypes[dstVal.Type().Elem().Kind()]; ok {
- return toInterface(dstPtr, reflect.PtrTo(reflect.SliceOf(baseElemType)))
- }
- }
-
- if dstVal.Kind() == reflect.Array {
- if baseElemType, ok := kindTypes[dstVal.Type().Elem().Kind()]; ok {
- return toInterface(dstPtr, reflect.PtrTo(reflect.ArrayOf(dstVal.Len(), baseElemType)))
- }
- }
-
- if dstVal.Kind() == reflect.Struct {
- if dstVal.Type().NumField() == 1 && dstVal.Type().Field(0).Anonymous {
- dstPtr = dstVal.Field(0).Addr()
- nested := dstVal.Type().Field(0).Type
- if nested.Kind() == reflect.Array {
- if baseElemType, ok := kindTypes[nested.Elem().Kind()]; ok {
- return toInterface(dstPtr, reflect.PtrTo(reflect.ArrayOf(nested.Len(), baseElemType)))
- }
- }
- if _, ok := kindTypes[nested.Kind()]; ok && dstPtr.CanInterface() {
- return dstPtr.Interface(), true
- }
- }
- }
-
- return nil, false
-}
-
-func init() {
- kindTypes = map[reflect.Kind]reflect.Type{
- reflect.Bool: reflect.TypeOf(false),
- reflect.Float32: reflect.TypeOf(float32(0)),
- reflect.Float64: reflect.TypeOf(float64(0)),
- reflect.Int: reflect.TypeOf(int(0)),
- reflect.Int8: reflect.TypeOf(int8(0)),
- reflect.Int16: reflect.TypeOf(int16(0)),
- reflect.Int32: reflect.TypeOf(int32(0)),
- reflect.Int64: reflect.TypeOf(int64(0)),
- reflect.Uint: reflect.TypeOf(uint(0)),
- reflect.Uint8: reflect.TypeOf(uint8(0)),
- reflect.Uint16: reflect.TypeOf(uint16(0)),
- reflect.Uint32: reflect.TypeOf(uint32(0)),
- reflect.Uint64: reflect.TypeOf(uint64(0)),
- reflect.String: reflect.TypeOf(""),
- }
-}
diff --git a/vendor/github.com/jackc/pgtype/database_sql.go b/vendor/github.com/jackc/pgtype/database_sql.go
deleted file mode 100644
index 9d1cf82..0000000
--- a/vendor/github.com/jackc/pgtype/database_sql.go
+++ /dev/null
@@ -1,41 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "errors"
-)
-
-func DatabaseSQLValue(ci *ConnInfo, src Value) (interface{}, error) {
- if valuer, ok := src.(driver.Valuer); ok {
- return valuer.Value()
- }
-
- if textEncoder, ok := src.(TextEncoder); ok {
- buf, err := textEncoder.EncodeText(ci, nil)
- if err != nil {
- return nil, err
- }
- return string(buf), nil
- }
-
- if binaryEncoder, ok := src.(BinaryEncoder); ok {
- buf, err := binaryEncoder.EncodeBinary(ci, nil)
- if err != nil {
- return nil, err
- }
- return buf, nil
- }
-
- return nil, errors.New("cannot convert to database/sql compatible value")
-}
-
-func EncodeValueText(src TextEncoder) (interface{}, error) {
- buf, err := src.EncodeText(nil, make([]byte, 0, 32))
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
- return string(buf), err
-}
diff --git a/vendor/github.com/jackc/pgtype/date.go b/vendor/github.com/jackc/pgtype/date.go
deleted file mode 100644
index e68abf0..0000000
--- a/vendor/github.com/jackc/pgtype/date.go
+++ /dev/null
@@ -1,324 +0,0 @@
-package pgtype
-
-import (
- "database/sql"
- "database/sql/driver"
- "encoding/binary"
- "encoding/json"
- "fmt"
- "strings"
- "time"
-
- "github.com/jackc/pgio"
-)
-
-type Date struct {
- Time time.Time
- Status Status
- InfinityModifier InfinityModifier
-}
-
-const (
- negativeInfinityDayOffset = -2147483648
- infinityDayOffset = 2147483647
-)
-
-func (dst *Date) Set(src interface{}) error {
- if src == nil {
- *dst = Date{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- if value, ok := src.(interface{ Value() (driver.Value, error) }); ok {
- v, err := value.Value()
- if err != nil {
- return fmt.Errorf("cannot get value %v for Date: %v", value, err)
- }
- return dst.Set(v)
- }
-
- switch value := src.(type) {
- case time.Time:
- *dst = Date{Time: value, Status: Present}
- case *time.Time:
- if value == nil {
- *dst = Date{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case string:
- return dst.DecodeText(nil, []byte(value))
- case *string:
- if value == nil {
- *dst = Date{Status: Null}
- } else {
- return dst.Set(*value)
- }
- default:
- if originalSrc, ok := underlyingTimeType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to Date", value)
- }
-
- return nil
-}
-
-func (dst Date) Get() interface{} {
- switch dst.Status {
- case Present:
- if dst.InfinityModifier != None {
- return dst.InfinityModifier
- }
- return dst.Time
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Date) AssignTo(dst interface{}) error {
- if scanner, ok := dst.(sql.Scanner); ok {
- var err error
- switch src.Status {
- case Present:
- if src.InfinityModifier != None {
- err = scanner.Scan(src.InfinityModifier.String())
- } else {
- err = scanner.Scan(src.Time)
- }
- case Null:
- err = scanner.Scan(nil)
- }
- if err != nil {
- return fmt.Errorf("unable assign %v to %T: %s", src, dst, err)
- }
- return nil
- }
-
- switch src.Status {
- case Present:
- switch v := dst.(type) {
- case *time.Time:
- if src.InfinityModifier != None {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
- }
- *v = src.Time
- return nil
- default:
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
- return fmt.Errorf("unable to assign to %T", dst)
- }
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (dst *Date) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Date{Status: Null}
- return nil
- }
-
- sbuf := string(src)
- switch sbuf {
- case "infinity":
- *dst = Date{Status: Present, InfinityModifier: Infinity}
- case "-infinity":
- *dst = Date{Status: Present, InfinityModifier: -Infinity}
- default:
- if strings.HasSuffix(sbuf, " BC") {
- t, err := time.ParseInLocation("2006-01-02", strings.TrimRight(sbuf, " BC"), time.UTC)
- t2 := time.Date(1-t.Year(), t.Month(), t.Day(), t.Hour(), t.Minute(), t.Second(), t.Nanosecond(), t.Location())
- if err != nil {
- return err
- }
- *dst = Date{Time: t2, Status: Present}
- return nil
- }
- t, err := time.ParseInLocation("2006-01-02", sbuf, time.UTC)
- if err != nil {
- return err
- }
-
- *dst = Date{Time: t, Status: Present}
- }
-
- return nil
-}
-
-func (dst *Date) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Date{Status: Null}
- return nil
- }
-
- if len(src) != 4 {
- return fmt.Errorf("invalid length for date: %v", len(src))
- }
-
- dayOffset := int32(binary.BigEndian.Uint32(src))
-
- switch dayOffset {
- case infinityDayOffset:
- *dst = Date{Status: Present, InfinityModifier: Infinity}
- case negativeInfinityDayOffset:
- *dst = Date{Status: Present, InfinityModifier: -Infinity}
- default:
- t := time.Date(2000, 1, int(1+dayOffset), 0, 0, 0, 0, time.UTC)
- *dst = Date{Time: t, Status: Present}
- }
-
- return nil
-}
-
-func (src Date) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- var s string
-
- switch src.InfinityModifier {
- case None:
- s = src.Time.Format("2006-01-02")
- case Infinity:
- s = "infinity"
- case NegativeInfinity:
- s = "-infinity"
- }
-
- return append(buf, s...), nil
-}
-
-func (src Date) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- var daysSinceDateEpoch int32
- switch src.InfinityModifier {
- case None:
- tUnix := time.Date(src.Time.Year(), src.Time.Month(), src.Time.Day(), 0, 0, 0, 0, time.UTC).Unix()
- dateEpoch := time.Date(2000, 1, 1, 0, 0, 0, 0, time.UTC).Unix()
-
- secSinceDateEpoch := tUnix - dateEpoch
- daysSinceDateEpoch = int32(secSinceDateEpoch / 86400)
- case Infinity:
- daysSinceDateEpoch = infinityDayOffset
- case NegativeInfinity:
- daysSinceDateEpoch = negativeInfinityDayOffset
- }
-
- return pgio.AppendInt32(buf, daysSinceDateEpoch), nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Date) Scan(src interface{}) error {
- if src == nil {
- *dst = Date{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- case time.Time:
- *dst = Date{Time: src, Status: Present}
- return nil
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Date) Value() (driver.Value, error) {
- switch src.Status {
- case Present:
- if src.InfinityModifier != None {
- return src.InfinityModifier.String(), nil
- }
- return src.Time, nil
- case Null:
- return nil, nil
- default:
- return nil, errUndefined
- }
-}
-
-func (src Date) MarshalJSON() ([]byte, error) {
- switch src.Status {
- case Null:
- return []byte("null"), nil
- case Undefined:
- return nil, errUndefined
- }
-
- if src.Status != Present {
- return nil, errBadStatus
- }
-
- var s string
-
- switch src.InfinityModifier {
- case None:
- s = src.Time.Format("2006-01-02")
- case Infinity:
- s = "infinity"
- case NegativeInfinity:
- s = "-infinity"
- }
-
- return json.Marshal(s)
-}
-
-func (dst *Date) UnmarshalJSON(b []byte) error {
- var s *string
- err := json.Unmarshal(b, &s)
- if err != nil {
- return err
- }
-
- if s == nil {
- *dst = Date{Status: Null}
- return nil
- }
-
- switch *s {
- case "infinity":
- *dst = Date{Status: Present, InfinityModifier: Infinity}
- case "-infinity":
- *dst = Date{Status: Present, InfinityModifier: -Infinity}
- default:
- t, err := time.ParseInLocation("2006-01-02", *s, time.UTC)
- if err != nil {
- return err
- }
-
- *dst = Date{Time: t, Status: Present}
- }
-
- return nil
-}
diff --git a/vendor/github.com/jackc/pgtype/date_array.go b/vendor/github.com/jackc/pgtype/date_array.go
deleted file mode 100644
index 24152fa..0000000
--- a/vendor/github.com/jackc/pgtype/date_array.go
+++ /dev/null
@@ -1,518 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "reflect"
- "time"
-
- "github.com/jackc/pgio"
-)
-
-type DateArray struct {
- Elements []Date
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *DateArray) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = DateArray{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []time.Time:
- if value == nil {
- *dst = DateArray{Status: Null}
- } else if len(value) == 0 {
- *dst = DateArray{Status: Present}
- } else {
- elements := make([]Date, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = DateArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*time.Time:
- if value == nil {
- *dst = DateArray{Status: Null}
- } else if len(value) == 0 {
- *dst = DateArray{Status: Present}
- } else {
- elements := make([]Date, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = DateArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []Date:
- if value == nil {
- *dst = DateArray{Status: Null}
- } else if len(value) == 0 {
- *dst = DateArray{Status: Present}
- } else {
- *dst = DateArray{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = DateArray{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for DateArray", src)
- }
- if elementsLength == 0 {
- *dst = DateArray{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to DateArray", src)
- }
-
- *dst = DateArray{
- Elements: make([]Date, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]Date, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to DateArray, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *DateArray) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to DateArray")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in DateArray", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst DateArray) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *DateArray) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]time.Time:
- *v = make([]time.Time, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*time.Time:
- *v = make([]*time.Time, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *DateArray) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from DateArray")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from DateArray")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *DateArray) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = DateArray{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []Date
-
- if len(uta.Elements) > 0 {
- elements = make([]Date, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem Date
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = DateArray{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *DateArray) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = DateArray{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = DateArray{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]Date, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = DateArray{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src DateArray) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src DateArray) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("date"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "date")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *DateArray) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src DateArray) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/daterange.go b/vendor/github.com/jackc/pgtype/daterange.go
deleted file mode 100644
index 63164a5..0000000
--- a/vendor/github.com/jackc/pgtype/daterange.go
+++ /dev/null
@@ -1,267 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "fmt"
-
- "github.com/jackc/pgio"
-)
-
-type Daterange struct {
- Lower Date
- Upper Date
- LowerType BoundType
- UpperType BoundType
- Status Status
-}
-
-func (dst *Daterange) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = Daterange{Status: Null}
- return nil
- }
-
- switch value := src.(type) {
- case Daterange:
- *dst = value
- case *Daterange:
- *dst = *value
- case string:
- return dst.DecodeText(nil, []byte(value))
- default:
- return fmt.Errorf("cannot convert %v to Daterange", src)
- }
-
- return nil
-}
-
-func (dst Daterange) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Daterange) AssignTo(dst interface{}) error {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
-}
-
-func (dst *Daterange) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Daterange{Status: Null}
- return nil
- }
-
- utr, err := ParseUntypedTextRange(string(src))
- if err != nil {
- return err
- }
-
- *dst = Daterange{Status: Present}
-
- dst.LowerType = utr.LowerType
- dst.UpperType = utr.UpperType
-
- if dst.LowerType == Empty {
- return nil
- }
-
- if dst.LowerType == Inclusive || dst.LowerType == Exclusive {
- if err := dst.Lower.DecodeText(ci, []byte(utr.Lower)); err != nil {
- return err
- }
- }
-
- if dst.UpperType == Inclusive || dst.UpperType == Exclusive {
- if err := dst.Upper.DecodeText(ci, []byte(utr.Upper)); err != nil {
- return err
- }
- }
-
- return nil
-}
-
-func (dst *Daterange) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Daterange{Status: Null}
- return nil
- }
-
- ubr, err := ParseUntypedBinaryRange(src)
- if err != nil {
- return err
- }
-
- *dst = Daterange{Status: Present}
-
- dst.LowerType = ubr.LowerType
- dst.UpperType = ubr.UpperType
-
- if dst.LowerType == Empty {
- return nil
- }
-
- if dst.LowerType == Inclusive || dst.LowerType == Exclusive {
- if err := dst.Lower.DecodeBinary(ci, ubr.Lower); err != nil {
- return err
- }
- }
-
- if dst.UpperType == Inclusive || dst.UpperType == Exclusive {
- if err := dst.Upper.DecodeBinary(ci, ubr.Upper); err != nil {
- return err
- }
- }
-
- return nil
-}
-
-func (src Daterange) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- switch src.LowerType {
- case Exclusive, Unbounded:
- buf = append(buf, '(')
- case Inclusive:
- buf = append(buf, '[')
- case Empty:
- return append(buf, "empty"...), nil
- default:
- return nil, fmt.Errorf("unknown lower bound type %v", src.LowerType)
- }
-
- var err error
-
- if src.LowerType != Unbounded {
- buf, err = src.Lower.EncodeText(ci, buf)
- if err != nil {
- return nil, err
- } else if buf == nil {
- return nil, fmt.Errorf("Lower cannot be null unless LowerType is Unbounded")
- }
- }
-
- buf = append(buf, ',')
-
- if src.UpperType != Unbounded {
- buf, err = src.Upper.EncodeText(ci, buf)
- if err != nil {
- return nil, err
- } else if buf == nil {
- return nil, fmt.Errorf("Upper cannot be null unless UpperType is Unbounded")
- }
- }
-
- switch src.UpperType {
- case Exclusive, Unbounded:
- buf = append(buf, ')')
- case Inclusive:
- buf = append(buf, ']')
- default:
- return nil, fmt.Errorf("unknown upper bound type %v", src.UpperType)
- }
-
- return buf, nil
-}
-
-func (src Daterange) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- var rangeType byte
- switch src.LowerType {
- case Inclusive:
- rangeType |= lowerInclusiveMask
- case Unbounded:
- rangeType |= lowerUnboundedMask
- case Exclusive:
- case Empty:
- return append(buf, emptyMask), nil
- default:
- return nil, fmt.Errorf("unknown LowerType: %v", src.LowerType)
- }
-
- switch src.UpperType {
- case Inclusive:
- rangeType |= upperInclusiveMask
- case Unbounded:
- rangeType |= upperUnboundedMask
- case Exclusive:
- default:
- return nil, fmt.Errorf("unknown UpperType: %v", src.UpperType)
- }
-
- buf = append(buf, rangeType)
-
- var err error
-
- if src.LowerType != Unbounded {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- buf, err = src.Lower.EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, fmt.Errorf("Lower cannot be null unless LowerType is Unbounded")
- }
-
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
-
- if src.UpperType != Unbounded {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- buf, err = src.Upper.EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, fmt.Errorf("Upper cannot be null unless UpperType is Unbounded")
- }
-
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Daterange) Scan(src interface{}) error {
- if src == nil {
- *dst = Daterange{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Daterange) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/enum_array.go b/vendor/github.com/jackc/pgtype/enum_array.go
deleted file mode 100644
index 59b5a3e..0000000
--- a/vendor/github.com/jackc/pgtype/enum_array.go
+++ /dev/null
@@ -1,428 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "fmt"
- "reflect"
-)
-
-type EnumArray struct {
- Elements []GenericText
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *EnumArray) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = EnumArray{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []string:
- if value == nil {
- *dst = EnumArray{Status: Null}
- } else if len(value) == 0 {
- *dst = EnumArray{Status: Present}
- } else {
- elements := make([]GenericText, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = EnumArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*string:
- if value == nil {
- *dst = EnumArray{Status: Null}
- } else if len(value) == 0 {
- *dst = EnumArray{Status: Present}
- } else {
- elements := make([]GenericText, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = EnumArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []GenericText:
- if value == nil {
- *dst = EnumArray{Status: Null}
- } else if len(value) == 0 {
- *dst = EnumArray{Status: Present}
- } else {
- *dst = EnumArray{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = EnumArray{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for EnumArray", src)
- }
- if elementsLength == 0 {
- *dst = EnumArray{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to EnumArray", src)
- }
-
- *dst = EnumArray{
- Elements: make([]GenericText, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]GenericText, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to EnumArray, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *EnumArray) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to EnumArray")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in EnumArray", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst EnumArray) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *EnumArray) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]string:
- *v = make([]string, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*string:
- *v = make([]*string, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *EnumArray) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from EnumArray")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from EnumArray")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *EnumArray) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = EnumArray{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []GenericText
-
- if len(uta.Elements) > 0 {
- elements = make([]GenericText, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem GenericText
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = EnumArray{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (src EnumArray) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *EnumArray) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src EnumArray) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/enum_type.go b/vendor/github.com/jackc/pgtype/enum_type.go
deleted file mode 100644
index 5265782..0000000
--- a/vendor/github.com/jackc/pgtype/enum_type.go
+++ /dev/null
@@ -1,168 +0,0 @@
-package pgtype
-
-import "fmt"
-
-// EnumType represents an enum type. While it implements Value, this is only in service of its type conversion duties
-// when registered as a data type in a ConnType. It should not be used directly as a Value.
-type EnumType struct {
- value string
- status Status
-
- typeName string // PostgreSQL type name
- members []string // enum members
- membersMap map[string]string // map to quickly lookup member and reuse string instead of allocating
-}
-
-// NewEnumType initializes a new EnumType. It retains a read-only reference to members. members must not be changed.
-func NewEnumType(typeName string, members []string) *EnumType {
- et := &EnumType{typeName: typeName, members: members}
- et.membersMap = make(map[string]string, len(members))
- for _, m := range members {
- et.membersMap[m] = m
- }
- return et
-}
-
-func (et *EnumType) NewTypeValue() Value {
- return &EnumType{
- value: et.value,
- status: et.status,
-
- typeName: et.typeName,
- members: et.members,
- membersMap: et.membersMap,
- }
-}
-
-func (et *EnumType) TypeName() string {
- return et.typeName
-}
-
-func (et *EnumType) Members() []string {
- return et.members
-}
-
-// Set assigns src to dst. Set purposely does not check that src is a member. This allows continued error free
-// operation in the event the PostgreSQL enum type is modified during a connection.
-func (dst *EnumType) Set(src interface{}) error {
- if src == nil {
- dst.status = Null
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- switch value := src.(type) {
- case string:
- dst.value = value
- dst.status = Present
- case *string:
- if value == nil {
- dst.status = Null
- } else {
- dst.value = *value
- dst.status = Present
- }
- case []byte:
- if value == nil {
- dst.status = Null
- } else {
- dst.value = string(value)
- dst.status = Present
- }
- default:
- if originalSrc, ok := underlyingStringType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to enum %s", value, dst.typeName)
- }
-
- return nil
-}
-
-func (dst EnumType) Get() interface{} {
- switch dst.status {
- case Present:
- return dst.value
- case Null:
- return nil
- default:
- return dst.status
- }
-}
-
-func (src *EnumType) AssignTo(dst interface{}) error {
- switch src.status {
- case Present:
- switch v := dst.(type) {
- case *string:
- *v = src.value
- return nil
- case *[]byte:
- *v = make([]byte, len(src.value))
- copy(*v, src.value)
- return nil
- default:
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
- return fmt.Errorf("unable to assign to %T", dst)
- }
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (EnumType) PreferredResultFormat() int16 {
- return TextFormatCode
-}
-
-func (dst *EnumType) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- dst.status = Null
- return nil
- }
-
- // Lookup the string in membersMap to avoid an allocation.
- if s, found := dst.membersMap[string(src)]; found {
- dst.value = s
- } else {
- // If an enum type is modified after the initial connection it is possible to receive an unexpected value.
- // Gracefully handle this situation. Purposely NOT modifying members and membersMap to allow for sharing members
- // and membersMap between connections.
- dst.value = string(src)
- }
- dst.status = Present
-
- return nil
-}
-
-func (dst *EnumType) DecodeBinary(ci *ConnInfo, src []byte) error {
- return dst.DecodeText(ci, src)
-}
-
-func (EnumType) PreferredParamFormat() int16 {
- return TextFormatCode
-}
-
-func (src EnumType) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- return append(buf, src.value...), nil
-}
-
-func (src EnumType) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- return src.EncodeText(ci, buf)
-}
diff --git a/vendor/github.com/jackc/pgtype/float4.go b/vendor/github.com/jackc/pgtype/float4.go
deleted file mode 100644
index 89b9e8f..0000000
--- a/vendor/github.com/jackc/pgtype/float4.go
+++ /dev/null
@@ -1,282 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "math"
- "strconv"
-
- "github.com/jackc/pgio"
-)
-
-type Float4 struct {
- Float float32
- Status Status
-}
-
-func (dst *Float4) Set(src interface{}) error {
- if src == nil {
- *dst = Float4{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- switch value := src.(type) {
- case float32:
- *dst = Float4{Float: value, Status: Present}
- case float64:
- *dst = Float4{Float: float32(value), Status: Present}
- case int8:
- *dst = Float4{Float: float32(value), Status: Present}
- case uint8:
- *dst = Float4{Float: float32(value), Status: Present}
- case int16:
- *dst = Float4{Float: float32(value), Status: Present}
- case uint16:
- *dst = Float4{Float: float32(value), Status: Present}
- case int32:
- f32 := float32(value)
- if int32(f32) == value {
- *dst = Float4{Float: f32, Status: Present}
- } else {
- return fmt.Errorf("%v cannot be exactly represented as float32", value)
- }
- case uint32:
- f32 := float32(value)
- if uint32(f32) == value {
- *dst = Float4{Float: f32, Status: Present}
- } else {
- return fmt.Errorf("%v cannot be exactly represented as float32", value)
- }
- case int64:
- f32 := float32(value)
- if int64(f32) == value {
- *dst = Float4{Float: f32, Status: Present}
- } else {
- return fmt.Errorf("%v cannot be exactly represented as float32", value)
- }
- case uint64:
- f32 := float32(value)
- if uint64(f32) == value {
- *dst = Float4{Float: f32, Status: Present}
- } else {
- return fmt.Errorf("%v cannot be exactly represented as float32", value)
- }
- case int:
- f32 := float32(value)
- if int(f32) == value {
- *dst = Float4{Float: f32, Status: Present}
- } else {
- return fmt.Errorf("%v cannot be exactly represented as float32", value)
- }
- case uint:
- f32 := float32(value)
- if uint(f32) == value {
- *dst = Float4{Float: f32, Status: Present}
- } else {
- return fmt.Errorf("%v cannot be exactly represented as float32", value)
- }
- case string:
- num, err := strconv.ParseFloat(value, 32)
- if err != nil {
- return err
- }
- *dst = Float4{Float: float32(num), Status: Present}
- case *float64:
- if value == nil {
- *dst = Float4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *float32:
- if value == nil {
- *dst = Float4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int8:
- if value == nil {
- *dst = Float4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint8:
- if value == nil {
- *dst = Float4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int16:
- if value == nil {
- *dst = Float4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint16:
- if value == nil {
- *dst = Float4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int32:
- if value == nil {
- *dst = Float4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint32:
- if value == nil {
- *dst = Float4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int64:
- if value == nil {
- *dst = Float4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint64:
- if value == nil {
- *dst = Float4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int:
- if value == nil {
- *dst = Float4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint:
- if value == nil {
- *dst = Float4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *string:
- if value == nil {
- *dst = Float4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- default:
- if originalSrc, ok := underlyingNumberType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to Float8", value)
- }
-
- return nil
-}
-
-func (dst Float4) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst.Float
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Float4) AssignTo(dst interface{}) error {
- return float64AssignTo(float64(src.Float), src.Status, dst)
-}
-
-func (dst *Float4) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Float4{Status: Null}
- return nil
- }
-
- n, err := strconv.ParseFloat(string(src), 32)
- if err != nil {
- return err
- }
-
- *dst = Float4{Float: float32(n), Status: Present}
- return nil
-}
-
-func (dst *Float4) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Float4{Status: Null}
- return nil
- }
-
- if len(src) != 4 {
- return fmt.Errorf("invalid length for float4: %v", len(src))
- }
-
- n := int32(binary.BigEndian.Uint32(src))
-
- *dst = Float4{Float: math.Float32frombits(uint32(n)), Status: Present}
- return nil
-}
-
-func (src Float4) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = append(buf, strconv.FormatFloat(float64(src.Float), 'f', -1, 32)...)
- return buf, nil
-}
-
-func (src Float4) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = pgio.AppendUint32(buf, math.Float32bits(src.Float))
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Float4) Scan(src interface{}) error {
- if src == nil {
- *dst = Float4{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case float64:
- *dst = Float4{Float: float32(src), Status: Present}
- return nil
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Float4) Value() (driver.Value, error) {
- switch src.Status {
- case Present:
- return float64(src.Float), nil
- case Null:
- return nil, nil
- default:
- return nil, errUndefined
- }
-}
diff --git a/vendor/github.com/jackc/pgtype/float4_array.go b/vendor/github.com/jackc/pgtype/float4_array.go
deleted file mode 100644
index 41f2ec8..0000000
--- a/vendor/github.com/jackc/pgtype/float4_array.go
+++ /dev/null
@@ -1,517 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "reflect"
-
- "github.com/jackc/pgio"
-)
-
-type Float4Array struct {
- Elements []Float4
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *Float4Array) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = Float4Array{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []float32:
- if value == nil {
- *dst = Float4Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Float4Array{Status: Present}
- } else {
- elements := make([]Float4, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Float4Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*float32:
- if value == nil {
- *dst = Float4Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Float4Array{Status: Present}
- } else {
- elements := make([]Float4, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Float4Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []Float4:
- if value == nil {
- *dst = Float4Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Float4Array{Status: Present}
- } else {
- *dst = Float4Array{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = Float4Array{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for Float4Array", src)
- }
- if elementsLength == 0 {
- *dst = Float4Array{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to Float4Array", src)
- }
-
- *dst = Float4Array{
- Elements: make([]Float4, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]Float4, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to Float4Array, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *Float4Array) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to Float4Array")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in Float4Array", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst Float4Array) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Float4Array) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]float32:
- *v = make([]float32, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*float32:
- *v = make([]*float32, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *Float4Array) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from Float4Array")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from Float4Array")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *Float4Array) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Float4Array{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []Float4
-
- if len(uta.Elements) > 0 {
- elements = make([]Float4, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem Float4
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = Float4Array{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *Float4Array) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Float4Array{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = Float4Array{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]Float4, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = Float4Array{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src Float4Array) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src Float4Array) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("float4"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "float4")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Float4Array) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Float4Array) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/float8.go b/vendor/github.com/jackc/pgtype/float8.go
deleted file mode 100644
index 6297ab5..0000000
--- a/vendor/github.com/jackc/pgtype/float8.go
+++ /dev/null
@@ -1,272 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "math"
- "strconv"
-
- "github.com/jackc/pgio"
-)
-
-type Float8 struct {
- Float float64
- Status Status
-}
-
-func (dst *Float8) Set(src interface{}) error {
- if src == nil {
- *dst = Float8{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- switch value := src.(type) {
- case float32:
- *dst = Float8{Float: float64(value), Status: Present}
- case float64:
- *dst = Float8{Float: value, Status: Present}
- case int8:
- *dst = Float8{Float: float64(value), Status: Present}
- case uint8:
- *dst = Float8{Float: float64(value), Status: Present}
- case int16:
- *dst = Float8{Float: float64(value), Status: Present}
- case uint16:
- *dst = Float8{Float: float64(value), Status: Present}
- case int32:
- *dst = Float8{Float: float64(value), Status: Present}
- case uint32:
- *dst = Float8{Float: float64(value), Status: Present}
- case int64:
- f64 := float64(value)
- if int64(f64) == value {
- *dst = Float8{Float: f64, Status: Present}
- } else {
- return fmt.Errorf("%v cannot be exactly represented as float64", value)
- }
- case uint64:
- f64 := float64(value)
- if uint64(f64) == value {
- *dst = Float8{Float: f64, Status: Present}
- } else {
- return fmt.Errorf("%v cannot be exactly represented as float64", value)
- }
- case int:
- f64 := float64(value)
- if int(f64) == value {
- *dst = Float8{Float: f64, Status: Present}
- } else {
- return fmt.Errorf("%v cannot be exactly represented as float64", value)
- }
- case uint:
- f64 := float64(value)
- if uint(f64) == value {
- *dst = Float8{Float: f64, Status: Present}
- } else {
- return fmt.Errorf("%v cannot be exactly represented as float64", value)
- }
- case string:
- num, err := strconv.ParseFloat(value, 64)
- if err != nil {
- return err
- }
- *dst = Float8{Float: float64(num), Status: Present}
- case *float64:
- if value == nil {
- *dst = Float8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *float32:
- if value == nil {
- *dst = Float8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int8:
- if value == nil {
- *dst = Float8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint8:
- if value == nil {
- *dst = Float8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int16:
- if value == nil {
- *dst = Float8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint16:
- if value == nil {
- *dst = Float8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int32:
- if value == nil {
- *dst = Float8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint32:
- if value == nil {
- *dst = Float8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int64:
- if value == nil {
- *dst = Float8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint64:
- if value == nil {
- *dst = Float8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int:
- if value == nil {
- *dst = Float8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint:
- if value == nil {
- *dst = Float8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *string:
- if value == nil {
- *dst = Float8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- default:
- if originalSrc, ok := underlyingNumberType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to Float8", value)
- }
-
- return nil
-}
-
-func (dst Float8) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst.Float
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Float8) AssignTo(dst interface{}) error {
- return float64AssignTo(src.Float, src.Status, dst)
-}
-
-func (dst *Float8) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Float8{Status: Null}
- return nil
- }
-
- n, err := strconv.ParseFloat(string(src), 64)
- if err != nil {
- return err
- }
-
- *dst = Float8{Float: n, Status: Present}
- return nil
-}
-
-func (dst *Float8) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Float8{Status: Null}
- return nil
- }
-
- if len(src) != 8 {
- return fmt.Errorf("invalid length for float8: %v", len(src))
- }
-
- n := int64(binary.BigEndian.Uint64(src))
-
- *dst = Float8{Float: math.Float64frombits(uint64(n)), Status: Present}
- return nil
-}
-
-func (src Float8) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = append(buf, strconv.FormatFloat(float64(src.Float), 'f', -1, 64)...)
- return buf, nil
-}
-
-func (src Float8) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = pgio.AppendUint64(buf, math.Float64bits(src.Float))
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Float8) Scan(src interface{}) error {
- if src == nil {
- *dst = Float8{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case float64:
- *dst = Float8{Float: src, Status: Present}
- return nil
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Float8) Value() (driver.Value, error) {
- switch src.Status {
- case Present:
- return src.Float, nil
- case Null:
- return nil, nil
- default:
- return nil, errUndefined
- }
-}
diff --git a/vendor/github.com/jackc/pgtype/float8_array.go b/vendor/github.com/jackc/pgtype/float8_array.go
deleted file mode 100644
index 836ee19..0000000
--- a/vendor/github.com/jackc/pgtype/float8_array.go
+++ /dev/null
@@ -1,517 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "reflect"
-
- "github.com/jackc/pgio"
-)
-
-type Float8Array struct {
- Elements []Float8
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *Float8Array) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = Float8Array{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []float64:
- if value == nil {
- *dst = Float8Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Float8Array{Status: Present}
- } else {
- elements := make([]Float8, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Float8Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*float64:
- if value == nil {
- *dst = Float8Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Float8Array{Status: Present}
- } else {
- elements := make([]Float8, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Float8Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []Float8:
- if value == nil {
- *dst = Float8Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Float8Array{Status: Present}
- } else {
- *dst = Float8Array{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = Float8Array{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for Float8Array", src)
- }
- if elementsLength == 0 {
- *dst = Float8Array{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to Float8Array", src)
- }
-
- *dst = Float8Array{
- Elements: make([]Float8, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]Float8, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to Float8Array, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *Float8Array) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to Float8Array")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in Float8Array", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst Float8Array) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Float8Array) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]float64:
- *v = make([]float64, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*float64:
- *v = make([]*float64, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *Float8Array) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from Float8Array")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from Float8Array")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *Float8Array) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Float8Array{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []Float8
-
- if len(uta.Elements) > 0 {
- elements = make([]Float8, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem Float8
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = Float8Array{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *Float8Array) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Float8Array{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = Float8Array{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]Float8, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = Float8Array{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src Float8Array) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src Float8Array) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("float8"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "float8")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Float8Array) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Float8Array) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/generic_binary.go b/vendor/github.com/jackc/pgtype/generic_binary.go
deleted file mode 100644
index 76a1d35..0000000
--- a/vendor/github.com/jackc/pgtype/generic_binary.go
+++ /dev/null
@@ -1,39 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
-)
-
-// GenericBinary is a placeholder for binary format values that no other type exists
-// to handle.
-type GenericBinary Bytea
-
-func (dst *GenericBinary) Set(src interface{}) error {
- return (*Bytea)(dst).Set(src)
-}
-
-func (dst GenericBinary) Get() interface{} {
- return (Bytea)(dst).Get()
-}
-
-func (src *GenericBinary) AssignTo(dst interface{}) error {
- return (*Bytea)(src).AssignTo(dst)
-}
-
-func (dst *GenericBinary) DecodeBinary(ci *ConnInfo, src []byte) error {
- return (*Bytea)(dst).DecodeBinary(ci, src)
-}
-
-func (src GenericBinary) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- return (Bytea)(src).EncodeBinary(ci, buf)
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *GenericBinary) Scan(src interface{}) error {
- return (*Bytea)(dst).Scan(src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src GenericBinary) Value() (driver.Value, error) {
- return (Bytea)(src).Value()
-}
diff --git a/vendor/github.com/jackc/pgtype/generic_text.go b/vendor/github.com/jackc/pgtype/generic_text.go
deleted file mode 100644
index dbf5b47..0000000
--- a/vendor/github.com/jackc/pgtype/generic_text.go
+++ /dev/null
@@ -1,39 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
-)
-
-// GenericText is a placeholder for text format values that no other type exists
-// to handle.
-type GenericText Text
-
-func (dst *GenericText) Set(src interface{}) error {
- return (*Text)(dst).Set(src)
-}
-
-func (dst GenericText) Get() interface{} {
- return (Text)(dst).Get()
-}
-
-func (src *GenericText) AssignTo(dst interface{}) error {
- return (*Text)(src).AssignTo(dst)
-}
-
-func (dst *GenericText) DecodeText(ci *ConnInfo, src []byte) error {
- return (*Text)(dst).DecodeText(ci, src)
-}
-
-func (src GenericText) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- return (Text)(src).EncodeText(ci, buf)
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *GenericText) Scan(src interface{}) error {
- return (*Text)(dst).Scan(src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src GenericText) Value() (driver.Value, error) {
- return (Text)(src).Value()
-}
diff --git a/vendor/github.com/jackc/pgtype/hstore.go b/vendor/github.com/jackc/pgtype/hstore.go
deleted file mode 100644
index e42b755..0000000
--- a/vendor/github.com/jackc/pgtype/hstore.go
+++ /dev/null
@@ -1,465 +0,0 @@
-package pgtype
-
-import (
- "bytes"
- "database/sql/driver"
- "encoding/binary"
- "errors"
- "fmt"
- "strings"
- "unicode"
- "unicode/utf8"
-
- "github.com/jackc/pgio"
-)
-
-// Hstore represents an hstore column that can be null or have null values
-// associated with its keys.
-type Hstore struct {
- Map map[string]Text
- Status Status
-}
-
-func (dst *Hstore) Set(src interface{}) error {
- if src == nil {
- *dst = Hstore{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- switch value := src.(type) {
- case map[string]string:
- m := make(map[string]Text, len(value))
- for k, v := range value {
- m[k] = Text{String: v, Status: Present}
- }
- *dst = Hstore{Map: m, Status: Present}
- case map[string]*string:
- m := make(map[string]Text, len(value))
- for k, v := range value {
- if v == nil {
- m[k] = Text{Status: Null}
- } else {
- m[k] = Text{String: *v, Status: Present}
- }
- }
- *dst = Hstore{Map: m, Status: Present}
- case map[string]Text:
- *dst = Hstore{Map: value, Status: Present}
- default:
- return fmt.Errorf("cannot convert %v to Hstore", src)
- }
-
- return nil
-}
-
-func (dst Hstore) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst.Map
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Hstore) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- switch v := dst.(type) {
- case *map[string]string:
- *v = make(map[string]string, len(src.Map))
- for k, val := range src.Map {
- if val.Status != Present {
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
- }
- (*v)[k] = val.String
- }
- return nil
- case *map[string]*string:
- *v = make(map[string]*string, len(src.Map))
- for k, val := range src.Map {
- switch val.Status {
- case Null:
- (*v)[k] = nil
- case Present:
- str := val.String
- (*v)[k] = &str
- default:
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
- }
- }
- return nil
- default:
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
- return fmt.Errorf("unable to assign to %T", dst)
- }
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (dst *Hstore) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Hstore{Status: Null}
- return nil
- }
-
- keys, values, err := parseHstore(string(src))
- if err != nil {
- return err
- }
-
- m := make(map[string]Text, len(keys))
- for i := range keys {
- m[keys[i]] = values[i]
- }
-
- *dst = Hstore{Map: m, Status: Present}
- return nil
-}
-
-func (dst *Hstore) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Hstore{Status: Null}
- return nil
- }
-
- rp := 0
-
- if len(src[rp:]) < 4 {
- return fmt.Errorf("hstore incomplete %v", src)
- }
- pairCount := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
-
- m := make(map[string]Text, pairCount)
-
- for i := 0; i < pairCount; i++ {
- if len(src[rp:]) < 4 {
- return fmt.Errorf("hstore incomplete %v", src)
- }
- keyLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
-
- if len(src[rp:]) < keyLen {
- return fmt.Errorf("hstore incomplete %v", src)
- }
- key := string(src[rp : rp+keyLen])
- rp += keyLen
-
- if len(src[rp:]) < 4 {
- return fmt.Errorf("hstore incomplete %v", src)
- }
- valueLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
-
- var valueBuf []byte
- if valueLen >= 0 {
- valueBuf = src[rp : rp+valueLen]
- rp += valueLen
- }
-
- var value Text
- err := value.DecodeBinary(ci, valueBuf)
- if err != nil {
- return err
- }
- m[key] = value
- }
-
- *dst = Hstore{Map: m, Status: Present}
-
- return nil
-}
-
-func (src Hstore) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- firstPair := true
-
- inElemBuf := make([]byte, 0, 32)
- for k, v := range src.Map {
- if firstPair {
- firstPair = false
- } else {
- buf = append(buf, ',')
- }
-
- buf = append(buf, quoteHstoreElementIfNeeded(k)...)
- buf = append(buf, "=>"...)
-
- elemBuf, err := v.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
-
- if elemBuf == nil {
- buf = append(buf, "NULL"...)
- } else {
- buf = append(buf, quoteHstoreElementIfNeeded(string(elemBuf))...)
- }
- }
-
- return buf, nil
-}
-
-func (src Hstore) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = pgio.AppendInt32(buf, int32(len(src.Map)))
-
- var err error
- for k, v := range src.Map {
- buf = pgio.AppendInt32(buf, int32(len(k)))
- buf = append(buf, k...)
-
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := v.EncodeText(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, err
-}
-
-var quoteHstoreReplacer = strings.NewReplacer(`\`, `\\`, `"`, `\"`)
-
-func quoteHstoreElement(src string) string {
- return `"` + quoteArrayReplacer.Replace(src) + `"`
-}
-
-func quoteHstoreElementIfNeeded(src string) string {
- if src == "" || (len(src) == 4 && strings.ToLower(src) == "null") || strings.ContainsAny(src, ` {},"\=>`) {
- return quoteArrayElement(src)
- }
- return src
-}
-
-const (
- hsPre = iota
- hsKey
- hsSep
- hsVal
- hsNul
- hsNext
-)
-
-type hstoreParser struct {
- str string
- pos int
-}
-
-func newHSP(in string) *hstoreParser {
- return &hstoreParser{
- pos: 0,
- str: in,
- }
-}
-
-func (p *hstoreParser) Consume() (r rune, end bool) {
- if p.pos >= len(p.str) {
- end = true
- return
- }
- r, w := utf8.DecodeRuneInString(p.str[p.pos:])
- p.pos += w
- return
-}
-
-func (p *hstoreParser) Peek() (r rune, end bool) {
- if p.pos >= len(p.str) {
- end = true
- return
- }
- r, _ = utf8.DecodeRuneInString(p.str[p.pos:])
- return
-}
-
-// parseHstore parses the string representation of an hstore column (the same
-// you would get from an ordinary SELECT) into two slices of keys and values. it
-// is used internally in the default parsing of hstores.
-func parseHstore(s string) (k []string, v []Text, err error) {
- if s == "" {
- return
- }
-
- buf := bytes.Buffer{}
- keys := []string{}
- values := []Text{}
- p := newHSP(s)
-
- r, end := p.Consume()
- state := hsPre
-
- for !end {
- switch state {
- case hsPre:
- if r == '"' {
- state = hsKey
- } else {
- err = errors.New("String does not begin with \"")
- }
- case hsKey:
- switch r {
- case '"': //End of the key
- keys = append(keys, buf.String())
- buf = bytes.Buffer{}
- state = hsSep
- case '\\': //Potential escaped character
- n, end := p.Consume()
- switch {
- case end:
- err = errors.New("Found EOS in key, expecting character or \"")
- case n == '"', n == '\\':
- buf.WriteRune(n)
- default:
- buf.WriteRune(r)
- buf.WriteRune(n)
- }
- default: //Any other character
- buf.WriteRune(r)
- }
- case hsSep:
- if r == '=' {
- r, end = p.Consume()
- switch {
- case end:
- err = errors.New("Found EOS after '=', expecting '>'")
- case r == '>':
- r, end = p.Consume()
- switch {
- case end:
- err = errors.New("Found EOS after '=>', expecting '\"' or 'NULL'")
- case r == '"':
- state = hsVal
- case r == 'N':
- state = hsNul
- default:
- err = fmt.Errorf("Invalid character '%c' after '=>', expecting '\"' or 'NULL'", r)
- }
- default:
- err = fmt.Errorf("Invalid character after '=', expecting '>'")
- }
- } else {
- err = fmt.Errorf("Invalid character '%c' after value, expecting '='", r)
- }
- case hsVal:
- switch r {
- case '"': //End of the value
- values = append(values, Text{String: buf.String(), Status: Present})
- buf = bytes.Buffer{}
- state = hsNext
- case '\\': //Potential escaped character
- n, end := p.Consume()
- switch {
- case end:
- err = errors.New("Found EOS in key, expecting character or \"")
- case n == '"', n == '\\':
- buf.WriteRune(n)
- default:
- buf.WriteRune(r)
- buf.WriteRune(n)
- }
- default: //Any other character
- buf.WriteRune(r)
- }
- case hsNul:
- nulBuf := make([]rune, 3)
- nulBuf[0] = r
- for i := 1; i < 3; i++ {
- r, end = p.Consume()
- if end {
- err = errors.New("Found EOS in NULL value")
- return
- }
- nulBuf[i] = r
- }
- if nulBuf[0] == 'U' && nulBuf[1] == 'L' && nulBuf[2] == 'L' {
- values = append(values, Text{Status: Null})
- state = hsNext
- } else {
- err = fmt.Errorf("Invalid NULL value: 'N%s'", string(nulBuf))
- }
- case hsNext:
- if r == ',' {
- r, end = p.Consume()
- switch {
- case end:
- err = errors.New("Found EOS after ',', expecting space")
- case (unicode.IsSpace(r)):
- r, end = p.Consume()
- state = hsKey
- default:
- err = fmt.Errorf("Invalid character '%c' after ', ', expecting \"", r)
- }
- } else {
- err = fmt.Errorf("Invalid character '%c' after value, expecting ','", r)
- }
- }
-
- if err != nil {
- return
- }
- r, end = p.Consume()
- }
- if state != hsNext {
- err = errors.New("Improperly formatted hstore")
- return
- }
- k = keys
- v = values
- return
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Hstore) Scan(src interface{}) error {
- if src == nil {
- *dst = Hstore{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Hstore) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/hstore_array.go b/vendor/github.com/jackc/pgtype/hstore_array.go
deleted file mode 100644
index 47b4b3f..0000000
--- a/vendor/github.com/jackc/pgtype/hstore_array.go
+++ /dev/null
@@ -1,489 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "reflect"
-
- "github.com/jackc/pgio"
-)
-
-type HstoreArray struct {
- Elements []Hstore
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *HstoreArray) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = HstoreArray{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []map[string]string:
- if value == nil {
- *dst = HstoreArray{Status: Null}
- } else if len(value) == 0 {
- *dst = HstoreArray{Status: Present}
- } else {
- elements := make([]Hstore, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = HstoreArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []Hstore:
- if value == nil {
- *dst = HstoreArray{Status: Null}
- } else if len(value) == 0 {
- *dst = HstoreArray{Status: Present}
- } else {
- *dst = HstoreArray{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = HstoreArray{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for HstoreArray", src)
- }
- if elementsLength == 0 {
- *dst = HstoreArray{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to HstoreArray", src)
- }
-
- *dst = HstoreArray{
- Elements: make([]Hstore, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]Hstore, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to HstoreArray, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *HstoreArray) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to HstoreArray")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in HstoreArray", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst HstoreArray) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *HstoreArray) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]map[string]string:
- *v = make([]map[string]string, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *HstoreArray) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from HstoreArray")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from HstoreArray")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *HstoreArray) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = HstoreArray{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []Hstore
-
- if len(uta.Elements) > 0 {
- elements = make([]Hstore, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem Hstore
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = HstoreArray{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *HstoreArray) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = HstoreArray{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = HstoreArray{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]Hstore, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = HstoreArray{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src HstoreArray) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src HstoreArray) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("hstore"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "hstore")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *HstoreArray) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src HstoreArray) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/inet.go b/vendor/github.com/jackc/pgtype/inet.go
deleted file mode 100644
index 976f0d7..0000000
--- a/vendor/github.com/jackc/pgtype/inet.go
+++ /dev/null
@@ -1,304 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding"
- "fmt"
- "net"
- "strings"
-)
-
-// Network address family is dependent on server socket.h value for AF_INET.
-// In practice, all platforms appear to have the same value. See
-// src/include/utils/inet.h for more information.
-const (
- defaultAFInet = 2
- defaultAFInet6 = 3
-)
-
-// Inet represents both inet and cidr PostgreSQL types.
-type Inet struct {
- IPNet *net.IPNet
- Status Status
-}
-
-func (dst *Inet) Set(src interface{}) error {
- if src == nil {
- *dst = Inet{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- switch value := src.(type) {
- case net.IPNet:
- *dst = Inet{IPNet: &value, Status: Present}
- case net.IP:
- if len(value) == 0 {
- *dst = Inet{Status: Null}
- } else {
- bitCount := len(value) * 8
- mask := net.CIDRMask(bitCount, bitCount)
- *dst = Inet{IPNet: &net.IPNet{Mask: mask, IP: value}, Status: Present}
- }
- case string:
- ip, ipnet, err := net.ParseCIDR(value)
- if err != nil {
- ip := net.ParseIP(value)
- if ip == nil {
- return fmt.Errorf("unable to parse inet address: %s", value)
- }
-
- if ipv4 := maybeGetIPv4(value, ip); ipv4 != nil {
- ipnet = &net.IPNet{IP: ipv4, Mask: net.CIDRMask(32, 32)}
- } else {
- ipnet = &net.IPNet{IP: ip, Mask: net.CIDRMask(128, 128)}
- }
- } else {
- ipnet.IP = ip
- if ipv4 := maybeGetIPv4(value, ipnet.IP); ipv4 != nil {
- ipnet.IP = ipv4
- if len(ipnet.Mask) == 16 {
- ipnet.Mask = ipnet.Mask[12:] // Not sure this is ever needed.
- }
- }
- }
-
- *dst = Inet{IPNet: ipnet, Status: Present}
- case *net.IPNet:
- if value == nil {
- *dst = Inet{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *net.IP:
- if value == nil {
- *dst = Inet{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *string:
- if value == nil {
- *dst = Inet{Status: Null}
- } else {
- return dst.Set(*value)
- }
- default:
- if tv, ok := src.(encoding.TextMarshaler); ok {
- text, err := tv.MarshalText()
- if err != nil {
- return fmt.Errorf("cannot marshal %v: %w", value, err)
- }
- return dst.Set(string(text))
- }
- if sv, ok := src.(fmt.Stringer); ok {
- return dst.Set(sv.String())
- }
- if originalSrc, ok := underlyingPtrType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to Inet", value)
- }
-
- return nil
-}
-
-// Convert the net.IP to IPv4, if appropriate.
-//
-// When parsing a string to a net.IP using net.ParseIP() and the like, we get a
-// 16 byte slice for IPv4 addresses as well as IPv6 addresses. This function
-// calls To4() to convert them to a 4 byte slice. This is useful as it allows
-// users of the net.IP check for IPv4 addresses based on the length and makes
-// it clear we are handling IPv4 as opposed to IPv6 or IPv4-mapped IPv6
-// addresses.
-func maybeGetIPv4(input string, ip net.IP) net.IP {
- // Do not do this if the provided input looks like IPv6. This is because
- // To4() on IPv4-mapped IPv6 addresses converts them to IPv4, which behave
- // different in some cases.
- if strings.Contains(input, ":") {
- return nil
- }
-
- return ip.To4()
-}
-
-func (dst Inet) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst.IPNet
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Inet) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- switch v := dst.(type) {
- case *net.IPNet:
- *v = net.IPNet{
- IP: make(net.IP, len(src.IPNet.IP)),
- Mask: make(net.IPMask, len(src.IPNet.Mask)),
- }
- copy(v.IP, src.IPNet.IP)
- copy(v.Mask, src.IPNet.Mask)
- return nil
- case *net.IP:
- if oneCount, bitCount := src.IPNet.Mask.Size(); oneCount != bitCount {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
- }
- *v = make(net.IP, len(src.IPNet.IP))
- copy(*v, src.IPNet.IP)
- return nil
- default:
- if tv, ok := dst.(encoding.TextUnmarshaler); ok {
- if err := tv.UnmarshalText([]byte(src.IPNet.String())); err != nil {
- return fmt.Errorf("cannot unmarshal %v to %T: %w", src, dst, err)
- }
- return nil
- }
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
- return fmt.Errorf("unable to assign to %T", dst)
- }
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (dst *Inet) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Inet{Status: Null}
- return nil
- }
-
- var ipnet *net.IPNet
- var err error
-
- if ip := net.ParseIP(string(src)); ip != nil {
- if ipv4 := ip.To4(); ipv4 != nil {
- ip = ipv4
- }
- bitCount := len(ip) * 8
- mask := net.CIDRMask(bitCount, bitCount)
- ipnet = &net.IPNet{Mask: mask, IP: ip}
- } else {
- ip, ipnet, err = net.ParseCIDR(string(src))
- if err != nil {
- return err
- }
- if ipv4 := ip.To4(); ipv4 != nil {
- ip = ipv4
- }
- ones, _ := ipnet.Mask.Size()
- *ipnet = net.IPNet{IP: ip, Mask: net.CIDRMask(ones, len(ip)*8)}
- }
-
- *dst = Inet{IPNet: ipnet, Status: Present}
- return nil
-}
-
-func (dst *Inet) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Inet{Status: Null}
- return nil
- }
-
- if len(src) != 8 && len(src) != 20 {
- return fmt.Errorf("Received an invalid size for an inet: %d", len(src))
- }
-
- // ignore family
- bits := src[1]
- // ignore is_cidr
- addressLength := src[3]
-
- var ipnet net.IPNet
- ipnet.IP = make(net.IP, int(addressLength))
- copy(ipnet.IP, src[4:])
- if ipv4 := ipnet.IP.To4(); ipv4 != nil {
- ipnet.IP = ipv4
- }
- ipnet.Mask = net.CIDRMask(int(bits), len(ipnet.IP)*8)
-
- *dst = Inet{IPNet: &ipnet, Status: Present}
-
- return nil
-}
-
-func (src Inet) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- return append(buf, src.IPNet.String()...), nil
-}
-
-// EncodeBinary encodes src into w.
-func (src Inet) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- var family byte
- switch len(src.IPNet.IP) {
- case net.IPv4len:
- family = defaultAFInet
- case net.IPv6len:
- family = defaultAFInet6
- default:
- return nil, fmt.Errorf("Unexpected IP length: %v", len(src.IPNet.IP))
- }
-
- buf = append(buf, family)
-
- ones, _ := src.IPNet.Mask.Size()
- buf = append(buf, byte(ones))
-
- // is_cidr is ignored on server
- buf = append(buf, 0)
-
- buf = append(buf, byte(len(src.IPNet.IP)))
-
- return append(buf, src.IPNet.IP...), nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Inet) Scan(src interface{}) error {
- if src == nil {
- *dst = Inet{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Inet) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/inet_array.go b/vendor/github.com/jackc/pgtype/inet_array.go
deleted file mode 100644
index 2460a1c..0000000
--- a/vendor/github.com/jackc/pgtype/inet_array.go
+++ /dev/null
@@ -1,546 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "net"
- "reflect"
-
- "github.com/jackc/pgio"
-)
-
-type InetArray struct {
- Elements []Inet
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *InetArray) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = InetArray{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []*net.IPNet:
- if value == nil {
- *dst = InetArray{Status: Null}
- } else if len(value) == 0 {
- *dst = InetArray{Status: Present}
- } else {
- elements := make([]Inet, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = InetArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []net.IP:
- if value == nil {
- *dst = InetArray{Status: Null}
- } else if len(value) == 0 {
- *dst = InetArray{Status: Present}
- } else {
- elements := make([]Inet, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = InetArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*net.IP:
- if value == nil {
- *dst = InetArray{Status: Null}
- } else if len(value) == 0 {
- *dst = InetArray{Status: Present}
- } else {
- elements := make([]Inet, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = InetArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []Inet:
- if value == nil {
- *dst = InetArray{Status: Null}
- } else if len(value) == 0 {
- *dst = InetArray{Status: Present}
- } else {
- *dst = InetArray{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = InetArray{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for InetArray", src)
- }
- if elementsLength == 0 {
- *dst = InetArray{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to InetArray", src)
- }
-
- *dst = InetArray{
- Elements: make([]Inet, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]Inet, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to InetArray, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *InetArray) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to InetArray")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in InetArray", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst InetArray) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *InetArray) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]*net.IPNet:
- *v = make([]*net.IPNet, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]net.IP:
- *v = make([]net.IP, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*net.IP:
- *v = make([]*net.IP, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *InetArray) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from InetArray")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from InetArray")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *InetArray) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = InetArray{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []Inet
-
- if len(uta.Elements) > 0 {
- elements = make([]Inet, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem Inet
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = InetArray{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *InetArray) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = InetArray{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = InetArray{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]Inet, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = InetArray{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src InetArray) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src InetArray) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("inet"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "inet")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *InetArray) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src InetArray) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/int2.go b/vendor/github.com/jackc/pgtype/int2.go
deleted file mode 100644
index 0775882..0000000
--- a/vendor/github.com/jackc/pgtype/int2.go
+++ /dev/null
@@ -1,321 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "encoding/json"
- "fmt"
- "math"
- "strconv"
-
- "github.com/jackc/pgio"
-)
-
-type Int2 struct {
- Int int16
- Status Status
-}
-
-func (dst *Int2) Set(src interface{}) error {
- if src == nil {
- *dst = Int2{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- switch value := src.(type) {
- case int8:
- *dst = Int2{Int: int16(value), Status: Present}
- case uint8:
- *dst = Int2{Int: int16(value), Status: Present}
- case int16:
- *dst = Int2{Int: int16(value), Status: Present}
- case uint16:
- if value > math.MaxInt16 {
- return fmt.Errorf("%d is greater than maximum value for Int2", value)
- }
- *dst = Int2{Int: int16(value), Status: Present}
- case int32:
- if value < math.MinInt16 {
- return fmt.Errorf("%d is greater than maximum value for Int2", value)
- }
- if value > math.MaxInt16 {
- return fmt.Errorf("%d is greater than maximum value for Int2", value)
- }
- *dst = Int2{Int: int16(value), Status: Present}
- case uint32:
- if value > math.MaxInt16 {
- return fmt.Errorf("%d is greater than maximum value for Int2", value)
- }
- *dst = Int2{Int: int16(value), Status: Present}
- case int64:
- if value < math.MinInt16 {
- return fmt.Errorf("%d is greater than maximum value for Int2", value)
- }
- if value > math.MaxInt16 {
- return fmt.Errorf("%d is greater than maximum value for Int2", value)
- }
- *dst = Int2{Int: int16(value), Status: Present}
- case uint64:
- if value > math.MaxInt16 {
- return fmt.Errorf("%d is greater than maximum value for Int2", value)
- }
- *dst = Int2{Int: int16(value), Status: Present}
- case int:
- if value < math.MinInt16 {
- return fmt.Errorf("%d is greater than maximum value for Int2", value)
- }
- if value > math.MaxInt16 {
- return fmt.Errorf("%d is greater than maximum value for Int2", value)
- }
- *dst = Int2{Int: int16(value), Status: Present}
- case uint:
- if value > math.MaxInt16 {
- return fmt.Errorf("%d is greater than maximum value for Int2", value)
- }
- *dst = Int2{Int: int16(value), Status: Present}
- case string:
- num, err := strconv.ParseInt(value, 10, 16)
- if err != nil {
- return err
- }
- *dst = Int2{Int: int16(num), Status: Present}
- case float32:
- if value > math.MaxInt16 {
- return fmt.Errorf("%f is greater than maximum value for Int2", value)
- }
- *dst = Int2{Int: int16(value), Status: Present}
- case float64:
- if value > math.MaxInt16 {
- return fmt.Errorf("%f is greater than maximum value for Int2", value)
- }
- *dst = Int2{Int: int16(value), Status: Present}
- case *int8:
- if value == nil {
- *dst = Int2{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint8:
- if value == nil {
- *dst = Int2{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int16:
- if value == nil {
- *dst = Int2{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint16:
- if value == nil {
- *dst = Int2{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int32:
- if value == nil {
- *dst = Int2{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint32:
- if value == nil {
- *dst = Int2{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int64:
- if value == nil {
- *dst = Int2{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint64:
- if value == nil {
- *dst = Int2{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int:
- if value == nil {
- *dst = Int2{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint:
- if value == nil {
- *dst = Int2{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *string:
- if value == nil {
- *dst = Int2{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *float32:
- if value == nil {
- *dst = Int2{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *float64:
- if value == nil {
- *dst = Int2{Status: Null}
- } else {
- return dst.Set(*value)
- }
- default:
- if originalSrc, ok := underlyingNumberType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to Int2", value)
- }
-
- return nil
-}
-
-func (dst Int2) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst.Int
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Int2) AssignTo(dst interface{}) error {
- return int64AssignTo(int64(src.Int), src.Status, dst)
-}
-
-func (dst *Int2) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Int2{Status: Null}
- return nil
- }
-
- n, err := strconv.ParseInt(string(src), 10, 16)
- if err != nil {
- return err
- }
-
- *dst = Int2{Int: int16(n), Status: Present}
- return nil
-}
-
-func (dst *Int2) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Int2{Status: Null}
- return nil
- }
-
- if len(src) != 2 {
- return fmt.Errorf("invalid length for int2: %v", len(src))
- }
-
- n := int16(binary.BigEndian.Uint16(src))
- *dst = Int2{Int: n, Status: Present}
- return nil
-}
-
-func (src Int2) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- return append(buf, strconv.FormatInt(int64(src.Int), 10)...), nil
-}
-
-func (src Int2) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- return pgio.AppendInt16(buf, src.Int), nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Int2) Scan(src interface{}) error {
- if src == nil {
- *dst = Int2{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case int64:
- if src < math.MinInt16 {
- return fmt.Errorf("%d is greater than maximum value for Int2", src)
- }
- if src > math.MaxInt16 {
- return fmt.Errorf("%d is greater than maximum value for Int2", src)
- }
- *dst = Int2{Int: int16(src), Status: Present}
- return nil
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Int2) Value() (driver.Value, error) {
- switch src.Status {
- case Present:
- return int64(src.Int), nil
- case Null:
- return nil, nil
- default:
- return nil, errUndefined
- }
-}
-
-func (src Int2) MarshalJSON() ([]byte, error) {
- switch src.Status {
- case Present:
- return []byte(strconv.FormatInt(int64(src.Int), 10)), nil
- case Null:
- return []byte("null"), nil
- case Undefined:
- return nil, errUndefined
- }
-
- return nil, errBadStatus
-}
-
-func (dst *Int2) UnmarshalJSON(b []byte) error {
- var n *int16
- err := json.Unmarshal(b, &n)
- if err != nil {
- return err
- }
-
- if n == nil {
- *dst = Int2{Status: Null}
- } else {
- *dst = Int2{Int: *n, Status: Present}
- }
-
- return nil
-}
diff --git a/vendor/github.com/jackc/pgtype/int2_array.go b/vendor/github.com/jackc/pgtype/int2_array.go
deleted file mode 100644
index a513384..0000000
--- a/vendor/github.com/jackc/pgtype/int2_array.go
+++ /dev/null
@@ -1,909 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "reflect"
-
- "github.com/jackc/pgio"
-)
-
-type Int2Array struct {
- Elements []Int2
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *Int2Array) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = Int2Array{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []int16:
- if value == nil {
- *dst = Int2Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int2Array{Status: Present}
- } else {
- elements := make([]Int2, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int2Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*int16:
- if value == nil {
- *dst = Int2Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int2Array{Status: Present}
- } else {
- elements := make([]Int2, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int2Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []uint16:
- if value == nil {
- *dst = Int2Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int2Array{Status: Present}
- } else {
- elements := make([]Int2, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int2Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*uint16:
- if value == nil {
- *dst = Int2Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int2Array{Status: Present}
- } else {
- elements := make([]Int2, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int2Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []int32:
- if value == nil {
- *dst = Int2Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int2Array{Status: Present}
- } else {
- elements := make([]Int2, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int2Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*int32:
- if value == nil {
- *dst = Int2Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int2Array{Status: Present}
- } else {
- elements := make([]Int2, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int2Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []uint32:
- if value == nil {
- *dst = Int2Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int2Array{Status: Present}
- } else {
- elements := make([]Int2, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int2Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*uint32:
- if value == nil {
- *dst = Int2Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int2Array{Status: Present}
- } else {
- elements := make([]Int2, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int2Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []int64:
- if value == nil {
- *dst = Int2Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int2Array{Status: Present}
- } else {
- elements := make([]Int2, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int2Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*int64:
- if value == nil {
- *dst = Int2Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int2Array{Status: Present}
- } else {
- elements := make([]Int2, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int2Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []uint64:
- if value == nil {
- *dst = Int2Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int2Array{Status: Present}
- } else {
- elements := make([]Int2, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int2Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*uint64:
- if value == nil {
- *dst = Int2Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int2Array{Status: Present}
- } else {
- elements := make([]Int2, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int2Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []int:
- if value == nil {
- *dst = Int2Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int2Array{Status: Present}
- } else {
- elements := make([]Int2, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int2Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*int:
- if value == nil {
- *dst = Int2Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int2Array{Status: Present}
- } else {
- elements := make([]Int2, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int2Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []uint:
- if value == nil {
- *dst = Int2Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int2Array{Status: Present}
- } else {
- elements := make([]Int2, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int2Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*uint:
- if value == nil {
- *dst = Int2Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int2Array{Status: Present}
- } else {
- elements := make([]Int2, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int2Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []Int2:
- if value == nil {
- *dst = Int2Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int2Array{Status: Present}
- } else {
- *dst = Int2Array{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = Int2Array{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for Int2Array", src)
- }
- if elementsLength == 0 {
- *dst = Int2Array{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to Int2Array", src)
- }
-
- *dst = Int2Array{
- Elements: make([]Int2, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]Int2, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to Int2Array, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *Int2Array) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to Int2Array")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in Int2Array", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst Int2Array) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Int2Array) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]int16:
- *v = make([]int16, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*int16:
- *v = make([]*int16, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]uint16:
- *v = make([]uint16, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*uint16:
- *v = make([]*uint16, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]int32:
- *v = make([]int32, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*int32:
- *v = make([]*int32, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]uint32:
- *v = make([]uint32, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*uint32:
- *v = make([]*uint32, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]int64:
- *v = make([]int64, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*int64:
- *v = make([]*int64, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]uint64:
- *v = make([]uint64, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*uint64:
- *v = make([]*uint64, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]int:
- *v = make([]int, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*int:
- *v = make([]*int, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]uint:
- *v = make([]uint, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*uint:
- *v = make([]*uint, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *Int2Array) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from Int2Array")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from Int2Array")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *Int2Array) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Int2Array{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []Int2
-
- if len(uta.Elements) > 0 {
- elements = make([]Int2, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem Int2
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = Int2Array{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *Int2Array) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Int2Array{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = Int2Array{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]Int2, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = Int2Array{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src Int2Array) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src Int2Array) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("int2"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "int2")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Int2Array) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Int2Array) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/int4.go b/vendor/github.com/jackc/pgtype/int4.go
deleted file mode 100644
index 22b48e5..0000000
--- a/vendor/github.com/jackc/pgtype/int4.go
+++ /dev/null
@@ -1,312 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "encoding/json"
- "fmt"
- "math"
- "strconv"
-
- "github.com/jackc/pgio"
-)
-
-type Int4 struct {
- Int int32
- Status Status
-}
-
-func (dst *Int4) Set(src interface{}) error {
- if src == nil {
- *dst = Int4{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- switch value := src.(type) {
- case int8:
- *dst = Int4{Int: int32(value), Status: Present}
- case uint8:
- *dst = Int4{Int: int32(value), Status: Present}
- case int16:
- *dst = Int4{Int: int32(value), Status: Present}
- case uint16:
- *dst = Int4{Int: int32(value), Status: Present}
- case int32:
- *dst = Int4{Int: int32(value), Status: Present}
- case uint32:
- if value > math.MaxInt32 {
- return fmt.Errorf("%d is greater than maximum value for Int4", value)
- }
- *dst = Int4{Int: int32(value), Status: Present}
- case int64:
- if value < math.MinInt32 {
- return fmt.Errorf("%d is greater than maximum value for Int4", value)
- }
- if value > math.MaxInt32 {
- return fmt.Errorf("%d is greater than maximum value for Int4", value)
- }
- *dst = Int4{Int: int32(value), Status: Present}
- case uint64:
- if value > math.MaxInt32 {
- return fmt.Errorf("%d is greater than maximum value for Int4", value)
- }
- *dst = Int4{Int: int32(value), Status: Present}
- case int:
- if value < math.MinInt32 {
- return fmt.Errorf("%d is greater than maximum value for Int4", value)
- }
- if value > math.MaxInt32 {
- return fmt.Errorf("%d is greater than maximum value for Int4", value)
- }
- *dst = Int4{Int: int32(value), Status: Present}
- case uint:
- if value > math.MaxInt32 {
- return fmt.Errorf("%d is greater than maximum value for Int4", value)
- }
- *dst = Int4{Int: int32(value), Status: Present}
- case string:
- num, err := strconv.ParseInt(value, 10, 32)
- if err != nil {
- return err
- }
- *dst = Int4{Int: int32(num), Status: Present}
- case float32:
- if value > math.MaxInt32 {
- return fmt.Errorf("%f is greater than maximum value for Int4", value)
- }
- *dst = Int4{Int: int32(value), Status: Present}
- case float64:
- if value > math.MaxInt32 {
- return fmt.Errorf("%f is greater than maximum value for Int4", value)
- }
- *dst = Int4{Int: int32(value), Status: Present}
- case *int8:
- if value == nil {
- *dst = Int4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint8:
- if value == nil {
- *dst = Int4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int16:
- if value == nil {
- *dst = Int4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint16:
- if value == nil {
- *dst = Int4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int32:
- if value == nil {
- *dst = Int4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint32:
- if value == nil {
- *dst = Int4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int64:
- if value == nil {
- *dst = Int4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint64:
- if value == nil {
- *dst = Int4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int:
- if value == nil {
- *dst = Int4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint:
- if value == nil {
- *dst = Int4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *string:
- if value == nil {
- *dst = Int4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *float32:
- if value == nil {
- *dst = Int4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *float64:
- if value == nil {
- *dst = Int4{Status: Null}
- } else {
- return dst.Set(*value)
- }
- default:
- if originalSrc, ok := underlyingNumberType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to Int4", value)
- }
-
- return nil
-}
-
-func (dst Int4) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst.Int
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Int4) AssignTo(dst interface{}) error {
- return int64AssignTo(int64(src.Int), src.Status, dst)
-}
-
-func (dst *Int4) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Int4{Status: Null}
- return nil
- }
-
- n, err := strconv.ParseInt(string(src), 10, 32)
- if err != nil {
- return err
- }
-
- *dst = Int4{Int: int32(n), Status: Present}
- return nil
-}
-
-func (dst *Int4) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Int4{Status: Null}
- return nil
- }
-
- if len(src) != 4 {
- return fmt.Errorf("invalid length for int4: %v", len(src))
- }
-
- n := int32(binary.BigEndian.Uint32(src))
- *dst = Int4{Int: n, Status: Present}
- return nil
-}
-
-func (src Int4) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- return append(buf, strconv.FormatInt(int64(src.Int), 10)...), nil
-}
-
-func (src Int4) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- return pgio.AppendInt32(buf, src.Int), nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Int4) Scan(src interface{}) error {
- if src == nil {
- *dst = Int4{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case int64:
- if src < math.MinInt32 {
- return fmt.Errorf("%d is greater than maximum value for Int4", src)
- }
- if src > math.MaxInt32 {
- return fmt.Errorf("%d is greater than maximum value for Int4", src)
- }
- *dst = Int4{Int: int32(src), Status: Present}
- return nil
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Int4) Value() (driver.Value, error) {
- switch src.Status {
- case Present:
- return int64(src.Int), nil
- case Null:
- return nil, nil
- default:
- return nil, errUndefined
- }
-}
-
-func (src Int4) MarshalJSON() ([]byte, error) {
- switch src.Status {
- case Present:
- return []byte(strconv.FormatInt(int64(src.Int), 10)), nil
- case Null:
- return []byte("null"), nil
- case Undefined:
- return nil, errUndefined
- }
-
- return nil, errBadStatus
-}
-
-func (dst *Int4) UnmarshalJSON(b []byte) error {
- var n *int32
- err := json.Unmarshal(b, &n)
- if err != nil {
- return err
- }
-
- if n == nil {
- *dst = Int4{Status: Null}
- } else {
- *dst = Int4{Int: *n, Status: Present}
- }
-
- return nil
-}
diff --git a/vendor/github.com/jackc/pgtype/int4_array.go b/vendor/github.com/jackc/pgtype/int4_array.go
deleted file mode 100644
index de26236..0000000
--- a/vendor/github.com/jackc/pgtype/int4_array.go
+++ /dev/null
@@ -1,909 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "reflect"
-
- "github.com/jackc/pgio"
-)
-
-type Int4Array struct {
- Elements []Int4
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *Int4Array) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = Int4Array{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []int16:
- if value == nil {
- *dst = Int4Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int4Array{Status: Present}
- } else {
- elements := make([]Int4, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int4Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*int16:
- if value == nil {
- *dst = Int4Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int4Array{Status: Present}
- } else {
- elements := make([]Int4, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int4Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []uint16:
- if value == nil {
- *dst = Int4Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int4Array{Status: Present}
- } else {
- elements := make([]Int4, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int4Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*uint16:
- if value == nil {
- *dst = Int4Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int4Array{Status: Present}
- } else {
- elements := make([]Int4, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int4Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []int32:
- if value == nil {
- *dst = Int4Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int4Array{Status: Present}
- } else {
- elements := make([]Int4, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int4Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*int32:
- if value == nil {
- *dst = Int4Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int4Array{Status: Present}
- } else {
- elements := make([]Int4, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int4Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []uint32:
- if value == nil {
- *dst = Int4Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int4Array{Status: Present}
- } else {
- elements := make([]Int4, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int4Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*uint32:
- if value == nil {
- *dst = Int4Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int4Array{Status: Present}
- } else {
- elements := make([]Int4, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int4Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []int64:
- if value == nil {
- *dst = Int4Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int4Array{Status: Present}
- } else {
- elements := make([]Int4, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int4Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*int64:
- if value == nil {
- *dst = Int4Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int4Array{Status: Present}
- } else {
- elements := make([]Int4, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int4Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []uint64:
- if value == nil {
- *dst = Int4Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int4Array{Status: Present}
- } else {
- elements := make([]Int4, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int4Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*uint64:
- if value == nil {
- *dst = Int4Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int4Array{Status: Present}
- } else {
- elements := make([]Int4, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int4Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []int:
- if value == nil {
- *dst = Int4Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int4Array{Status: Present}
- } else {
- elements := make([]Int4, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int4Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*int:
- if value == nil {
- *dst = Int4Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int4Array{Status: Present}
- } else {
- elements := make([]Int4, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int4Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []uint:
- if value == nil {
- *dst = Int4Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int4Array{Status: Present}
- } else {
- elements := make([]Int4, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int4Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*uint:
- if value == nil {
- *dst = Int4Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int4Array{Status: Present}
- } else {
- elements := make([]Int4, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int4Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []Int4:
- if value == nil {
- *dst = Int4Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int4Array{Status: Present}
- } else {
- *dst = Int4Array{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = Int4Array{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for Int4Array", src)
- }
- if elementsLength == 0 {
- *dst = Int4Array{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to Int4Array", src)
- }
-
- *dst = Int4Array{
- Elements: make([]Int4, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]Int4, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to Int4Array, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *Int4Array) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to Int4Array")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in Int4Array", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst Int4Array) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Int4Array) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]int16:
- *v = make([]int16, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*int16:
- *v = make([]*int16, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]uint16:
- *v = make([]uint16, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*uint16:
- *v = make([]*uint16, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]int32:
- *v = make([]int32, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*int32:
- *v = make([]*int32, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]uint32:
- *v = make([]uint32, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*uint32:
- *v = make([]*uint32, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]int64:
- *v = make([]int64, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*int64:
- *v = make([]*int64, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]uint64:
- *v = make([]uint64, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*uint64:
- *v = make([]*uint64, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]int:
- *v = make([]int, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*int:
- *v = make([]*int, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]uint:
- *v = make([]uint, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*uint:
- *v = make([]*uint, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *Int4Array) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from Int4Array")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from Int4Array")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *Int4Array) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Int4Array{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []Int4
-
- if len(uta.Elements) > 0 {
- elements = make([]Int4, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem Int4
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = Int4Array{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *Int4Array) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Int4Array{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = Int4Array{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]Int4, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = Int4Array{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src Int4Array) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src Int4Array) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("int4"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "int4")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Int4Array) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Int4Array) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/int4_multirange.go b/vendor/github.com/jackc/pgtype/int4_multirange.go
deleted file mode 100644
index c3432ce..0000000
--- a/vendor/github.com/jackc/pgtype/int4_multirange.go
+++ /dev/null
@@ -1,239 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
-
- "github.com/jackc/pgio"
-)
-
-type Int4multirange struct {
- Ranges []Int4range
- Status Status
-}
-
-func (dst *Int4multirange) Set(src interface{}) error {
- //untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = Int4multirange{Status: Null}
- return nil
- }
-
- switch value := src.(type) {
- case Int4multirange:
- *dst = value
- case *Int4multirange:
- *dst = *value
- case string:
- return dst.DecodeText(nil, []byte(value))
- case []Int4range:
- if value == nil {
- *dst = Int4multirange{Status: Null}
- } else if len(value) == 0 {
- *dst = Int4multirange{Status: Present}
- } else {
- elements := make([]Int4range, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int4multirange{
- Ranges: elements,
- Status: Present,
- }
- }
- case []*Int4range:
- if value == nil {
- *dst = Int4multirange{Status: Null}
- } else if len(value) == 0 {
- *dst = Int4multirange{Status: Present}
- } else {
- elements := make([]Int4range, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int4multirange{
- Ranges: elements,
- Status: Present,
- }
- }
- default:
- return fmt.Errorf("cannot convert %v to Int4multirange", src)
- }
-
- return nil
-
-}
-
-func (dst Int4multirange) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Int4multirange) AssignTo(dst interface{}) error {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
-}
-
-func (dst *Int4multirange) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Int4multirange{Status: Null}
- return nil
- }
-
- utmr, err := ParseUntypedTextMultirange(string(src))
- if err != nil {
- return err
- }
-
- var elements []Int4range
-
- if len(utmr.Elements) > 0 {
- elements = make([]Int4range, len(utmr.Elements))
-
- for i, s := range utmr.Elements {
- var elem Int4range
-
- elemSrc := []byte(s)
-
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = Int4multirange{Ranges: elements, Status: Present}
-
- return nil
-}
-
-func (dst *Int4multirange) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Int4multirange{Status: Null}
- return nil
- }
-
- rp := 0
-
- numElems := int(binary.BigEndian.Uint32(src[rp:]))
- rp += 4
-
- if numElems == 0 {
- *dst = Int4multirange{Status: Present}
- return nil
- }
-
- elements := make([]Int4range, numElems)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err := elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = Int4multirange{Ranges: elements, Status: Present}
- return nil
-}
-
-func (src Int4multirange) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = append(buf, '{')
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Ranges {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- return nil, fmt.Errorf("multi-range does not allow null range")
- } else {
- buf = append(buf, string(elemBuf)...)
- }
-
- }
-
- buf = append(buf, '}')
-
- return buf, nil
-}
-
-func (src Int4multirange) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = pgio.AppendInt32(buf, int32(len(src.Ranges)))
-
- for i := range src.Ranges {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Ranges[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Int4multirange) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Int4multirange) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/int4range.go b/vendor/github.com/jackc/pgtype/int4range.go
deleted file mode 100644
index c7f51fa..0000000
--- a/vendor/github.com/jackc/pgtype/int4range.go
+++ /dev/null
@@ -1,267 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "fmt"
-
- "github.com/jackc/pgio"
-)
-
-type Int4range struct {
- Lower Int4
- Upper Int4
- LowerType BoundType
- UpperType BoundType
- Status Status
-}
-
-func (dst *Int4range) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = Int4range{Status: Null}
- return nil
- }
-
- switch value := src.(type) {
- case Int4range:
- *dst = value
- case *Int4range:
- *dst = *value
- case string:
- return dst.DecodeText(nil, []byte(value))
- default:
- return fmt.Errorf("cannot convert %v to Int4range", src)
- }
-
- return nil
-}
-
-func (dst Int4range) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Int4range) AssignTo(dst interface{}) error {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
-}
-
-func (dst *Int4range) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Int4range{Status: Null}
- return nil
- }
-
- utr, err := ParseUntypedTextRange(string(src))
- if err != nil {
- return err
- }
-
- *dst = Int4range{Status: Present}
-
- dst.LowerType = utr.LowerType
- dst.UpperType = utr.UpperType
-
- if dst.LowerType == Empty {
- return nil
- }
-
- if dst.LowerType == Inclusive || dst.LowerType == Exclusive {
- if err := dst.Lower.DecodeText(ci, []byte(utr.Lower)); err != nil {
- return err
- }
- }
-
- if dst.UpperType == Inclusive || dst.UpperType == Exclusive {
- if err := dst.Upper.DecodeText(ci, []byte(utr.Upper)); err != nil {
- return err
- }
- }
-
- return nil
-}
-
-func (dst *Int4range) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Int4range{Status: Null}
- return nil
- }
-
- ubr, err := ParseUntypedBinaryRange(src)
- if err != nil {
- return err
- }
-
- *dst = Int4range{Status: Present}
-
- dst.LowerType = ubr.LowerType
- dst.UpperType = ubr.UpperType
-
- if dst.LowerType == Empty {
- return nil
- }
-
- if dst.LowerType == Inclusive || dst.LowerType == Exclusive {
- if err := dst.Lower.DecodeBinary(ci, ubr.Lower); err != nil {
- return err
- }
- }
-
- if dst.UpperType == Inclusive || dst.UpperType == Exclusive {
- if err := dst.Upper.DecodeBinary(ci, ubr.Upper); err != nil {
- return err
- }
- }
-
- return nil
-}
-
-func (src Int4range) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- switch src.LowerType {
- case Exclusive, Unbounded:
- buf = append(buf, '(')
- case Inclusive:
- buf = append(buf, '[')
- case Empty:
- return append(buf, "empty"...), nil
- default:
- return nil, fmt.Errorf("unknown lower bound type %v", src.LowerType)
- }
-
- var err error
-
- if src.LowerType != Unbounded {
- buf, err = src.Lower.EncodeText(ci, buf)
- if err != nil {
- return nil, err
- } else if buf == nil {
- return nil, fmt.Errorf("Lower cannot be null unless LowerType is Unbounded")
- }
- }
-
- buf = append(buf, ',')
-
- if src.UpperType != Unbounded {
- buf, err = src.Upper.EncodeText(ci, buf)
- if err != nil {
- return nil, err
- } else if buf == nil {
- return nil, fmt.Errorf("Upper cannot be null unless UpperType is Unbounded")
- }
- }
-
- switch src.UpperType {
- case Exclusive, Unbounded:
- buf = append(buf, ')')
- case Inclusive:
- buf = append(buf, ']')
- default:
- return nil, fmt.Errorf("unknown upper bound type %v", src.UpperType)
- }
-
- return buf, nil
-}
-
-func (src Int4range) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- var rangeType byte
- switch src.LowerType {
- case Inclusive:
- rangeType |= lowerInclusiveMask
- case Unbounded:
- rangeType |= lowerUnboundedMask
- case Exclusive:
- case Empty:
- return append(buf, emptyMask), nil
- default:
- return nil, fmt.Errorf("unknown LowerType: %v", src.LowerType)
- }
-
- switch src.UpperType {
- case Inclusive:
- rangeType |= upperInclusiveMask
- case Unbounded:
- rangeType |= upperUnboundedMask
- case Exclusive:
- default:
- return nil, fmt.Errorf("unknown UpperType: %v", src.UpperType)
- }
-
- buf = append(buf, rangeType)
-
- var err error
-
- if src.LowerType != Unbounded {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- buf, err = src.Lower.EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, fmt.Errorf("Lower cannot be null unless LowerType is Unbounded")
- }
-
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
-
- if src.UpperType != Unbounded {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- buf, err = src.Upper.EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, fmt.Errorf("Upper cannot be null unless UpperType is Unbounded")
- }
-
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Int4range) Scan(src interface{}) error {
- if src == nil {
- *dst = Int4range{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Int4range) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/int8.go b/vendor/github.com/jackc/pgtype/int8.go
deleted file mode 100644
index 0e08997..0000000
--- a/vendor/github.com/jackc/pgtype/int8.go
+++ /dev/null
@@ -1,298 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "encoding/json"
- "fmt"
- "math"
- "strconv"
-
- "github.com/jackc/pgio"
-)
-
-type Int8 struct {
- Int int64
- Status Status
-}
-
-func (dst *Int8) Set(src interface{}) error {
- if src == nil {
- *dst = Int8{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- switch value := src.(type) {
- case int8:
- *dst = Int8{Int: int64(value), Status: Present}
- case uint8:
- *dst = Int8{Int: int64(value), Status: Present}
- case int16:
- *dst = Int8{Int: int64(value), Status: Present}
- case uint16:
- *dst = Int8{Int: int64(value), Status: Present}
- case int32:
- *dst = Int8{Int: int64(value), Status: Present}
- case uint32:
- *dst = Int8{Int: int64(value), Status: Present}
- case int64:
- *dst = Int8{Int: int64(value), Status: Present}
- case uint64:
- if value > math.MaxInt64 {
- return fmt.Errorf("%d is greater than maximum value for Int8", value)
- }
- *dst = Int8{Int: int64(value), Status: Present}
- case int:
- if int64(value) < math.MinInt64 {
- return fmt.Errorf("%d is greater than maximum value for Int8", value)
- }
- if int64(value) > math.MaxInt64 {
- return fmt.Errorf("%d is greater than maximum value for Int8", value)
- }
- *dst = Int8{Int: int64(value), Status: Present}
- case uint:
- if uint64(value) > math.MaxInt64 {
- return fmt.Errorf("%d is greater than maximum value for Int8", value)
- }
- *dst = Int8{Int: int64(value), Status: Present}
- case string:
- num, err := strconv.ParseInt(value, 10, 64)
- if err != nil {
- return err
- }
- *dst = Int8{Int: num, Status: Present}
- case float32:
- if value > math.MaxInt64 {
- return fmt.Errorf("%f is greater than maximum value for Int8", value)
- }
- *dst = Int8{Int: int64(value), Status: Present}
- case float64:
- if value > math.MaxInt64 {
- return fmt.Errorf("%f is greater than maximum value for Int8", value)
- }
- *dst = Int8{Int: int64(value), Status: Present}
- case *int8:
- if value == nil {
- *dst = Int8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint8:
- if value == nil {
- *dst = Int8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int16:
- if value == nil {
- *dst = Int8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint16:
- if value == nil {
- *dst = Int8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int32:
- if value == nil {
- *dst = Int8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint32:
- if value == nil {
- *dst = Int8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int64:
- if value == nil {
- *dst = Int8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint64:
- if value == nil {
- *dst = Int8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int:
- if value == nil {
- *dst = Int8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint:
- if value == nil {
- *dst = Int8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *string:
- if value == nil {
- *dst = Int8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *float32:
- if value == nil {
- *dst = Int8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *float64:
- if value == nil {
- *dst = Int8{Status: Null}
- } else {
- return dst.Set(*value)
- }
- default:
- if originalSrc, ok := underlyingNumberType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to Int8", value)
- }
-
- return nil
-}
-
-func (dst Int8) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst.Int
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Int8) AssignTo(dst interface{}) error {
- return int64AssignTo(int64(src.Int), src.Status, dst)
-}
-
-func (dst *Int8) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Int8{Status: Null}
- return nil
- }
-
- n, err := strconv.ParseInt(string(src), 10, 64)
- if err != nil {
- return err
- }
-
- *dst = Int8{Int: n, Status: Present}
- return nil
-}
-
-func (dst *Int8) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Int8{Status: Null}
- return nil
- }
-
- if len(src) != 8 {
- return fmt.Errorf("invalid length for int8: %v", len(src))
- }
-
- n := int64(binary.BigEndian.Uint64(src))
-
- *dst = Int8{Int: n, Status: Present}
- return nil
-}
-
-func (src Int8) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- return append(buf, strconv.FormatInt(src.Int, 10)...), nil
-}
-
-func (src Int8) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- return pgio.AppendInt64(buf, src.Int), nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Int8) Scan(src interface{}) error {
- if src == nil {
- *dst = Int8{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case int64:
- *dst = Int8{Int: src, Status: Present}
- return nil
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Int8) Value() (driver.Value, error) {
- switch src.Status {
- case Present:
- return int64(src.Int), nil
- case Null:
- return nil, nil
- default:
- return nil, errUndefined
- }
-}
-
-func (src Int8) MarshalJSON() ([]byte, error) {
- switch src.Status {
- case Present:
- return []byte(strconv.FormatInt(src.Int, 10)), nil
- case Null:
- return []byte("null"), nil
- case Undefined:
- return nil, errUndefined
- }
-
- return nil, errBadStatus
-}
-
-func (dst *Int8) UnmarshalJSON(b []byte) error {
- var n *int64
- err := json.Unmarshal(b, &n)
- if err != nil {
- return err
- }
-
- if n == nil {
- *dst = Int8{Status: Null}
- } else {
- *dst = Int8{Int: *n, Status: Present}
- }
-
- return nil
-}
diff --git a/vendor/github.com/jackc/pgtype/int8_array.go b/vendor/github.com/jackc/pgtype/int8_array.go
deleted file mode 100644
index e405b32..0000000
--- a/vendor/github.com/jackc/pgtype/int8_array.go
+++ /dev/null
@@ -1,909 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "reflect"
-
- "github.com/jackc/pgio"
-)
-
-type Int8Array struct {
- Elements []Int8
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *Int8Array) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = Int8Array{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []int16:
- if value == nil {
- *dst = Int8Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int8Array{Status: Present}
- } else {
- elements := make([]Int8, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int8Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*int16:
- if value == nil {
- *dst = Int8Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int8Array{Status: Present}
- } else {
- elements := make([]Int8, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int8Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []uint16:
- if value == nil {
- *dst = Int8Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int8Array{Status: Present}
- } else {
- elements := make([]Int8, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int8Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*uint16:
- if value == nil {
- *dst = Int8Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int8Array{Status: Present}
- } else {
- elements := make([]Int8, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int8Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []int32:
- if value == nil {
- *dst = Int8Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int8Array{Status: Present}
- } else {
- elements := make([]Int8, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int8Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*int32:
- if value == nil {
- *dst = Int8Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int8Array{Status: Present}
- } else {
- elements := make([]Int8, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int8Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []uint32:
- if value == nil {
- *dst = Int8Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int8Array{Status: Present}
- } else {
- elements := make([]Int8, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int8Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*uint32:
- if value == nil {
- *dst = Int8Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int8Array{Status: Present}
- } else {
- elements := make([]Int8, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int8Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []int64:
- if value == nil {
- *dst = Int8Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int8Array{Status: Present}
- } else {
- elements := make([]Int8, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int8Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*int64:
- if value == nil {
- *dst = Int8Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int8Array{Status: Present}
- } else {
- elements := make([]Int8, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int8Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []uint64:
- if value == nil {
- *dst = Int8Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int8Array{Status: Present}
- } else {
- elements := make([]Int8, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int8Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*uint64:
- if value == nil {
- *dst = Int8Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int8Array{Status: Present}
- } else {
- elements := make([]Int8, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int8Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []int:
- if value == nil {
- *dst = Int8Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int8Array{Status: Present}
- } else {
- elements := make([]Int8, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int8Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*int:
- if value == nil {
- *dst = Int8Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int8Array{Status: Present}
- } else {
- elements := make([]Int8, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int8Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []uint:
- if value == nil {
- *dst = Int8Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int8Array{Status: Present}
- } else {
- elements := make([]Int8, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int8Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*uint:
- if value == nil {
- *dst = Int8Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int8Array{Status: Present}
- } else {
- elements := make([]Int8, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int8Array{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []Int8:
- if value == nil {
- *dst = Int8Array{Status: Null}
- } else if len(value) == 0 {
- *dst = Int8Array{Status: Present}
- } else {
- *dst = Int8Array{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = Int8Array{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for Int8Array", src)
- }
- if elementsLength == 0 {
- *dst = Int8Array{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to Int8Array", src)
- }
-
- *dst = Int8Array{
- Elements: make([]Int8, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]Int8, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to Int8Array, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *Int8Array) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to Int8Array")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in Int8Array", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst Int8Array) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Int8Array) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]int16:
- *v = make([]int16, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*int16:
- *v = make([]*int16, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]uint16:
- *v = make([]uint16, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*uint16:
- *v = make([]*uint16, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]int32:
- *v = make([]int32, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*int32:
- *v = make([]*int32, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]uint32:
- *v = make([]uint32, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*uint32:
- *v = make([]*uint32, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]int64:
- *v = make([]int64, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*int64:
- *v = make([]*int64, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]uint64:
- *v = make([]uint64, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*uint64:
- *v = make([]*uint64, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]int:
- *v = make([]int, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*int:
- *v = make([]*int, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]uint:
- *v = make([]uint, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*uint:
- *v = make([]*uint, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *Int8Array) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from Int8Array")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from Int8Array")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *Int8Array) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Int8Array{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []Int8
-
- if len(uta.Elements) > 0 {
- elements = make([]Int8, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem Int8
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = Int8Array{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *Int8Array) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Int8Array{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = Int8Array{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]Int8, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = Int8Array{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src Int8Array) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src Int8Array) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("int8"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "int8")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Int8Array) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Int8Array) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/int8_multirange.go b/vendor/github.com/jackc/pgtype/int8_multirange.go
deleted file mode 100644
index e097642..0000000
--- a/vendor/github.com/jackc/pgtype/int8_multirange.go
+++ /dev/null
@@ -1,239 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
-
- "github.com/jackc/pgio"
-)
-
-type Int8multirange struct {
- Ranges []Int8range
- Status Status
-}
-
-func (dst *Int8multirange) Set(src interface{}) error {
- //untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = Int8multirange{Status: Null}
- return nil
- }
-
- switch value := src.(type) {
- case Int8multirange:
- *dst = value
- case *Int8multirange:
- *dst = *value
- case string:
- return dst.DecodeText(nil, []byte(value))
- case []Int8range:
- if value == nil {
- *dst = Int8multirange{Status: Null}
- } else if len(value) == 0 {
- *dst = Int8multirange{Status: Present}
- } else {
- elements := make([]Int8range, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int8multirange{
- Ranges: elements,
- Status: Present,
- }
- }
- case []*Int8range:
- if value == nil {
- *dst = Int8multirange{Status: Null}
- } else if len(value) == 0 {
- *dst = Int8multirange{Status: Present}
- } else {
- elements := make([]Int8range, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Int8multirange{
- Ranges: elements,
- Status: Present,
- }
- }
- default:
- return fmt.Errorf("cannot convert %v to Int8multirange", src)
- }
-
- return nil
-
-}
-
-func (dst Int8multirange) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Int8multirange) AssignTo(dst interface{}) error {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
-}
-
-func (dst *Int8multirange) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Int8multirange{Status: Null}
- return nil
- }
-
- utmr, err := ParseUntypedTextMultirange(string(src))
- if err != nil {
- return err
- }
-
- var elements []Int8range
-
- if len(utmr.Elements) > 0 {
- elements = make([]Int8range, len(utmr.Elements))
-
- for i, s := range utmr.Elements {
- var elem Int8range
-
- elemSrc := []byte(s)
-
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = Int8multirange{Ranges: elements, Status: Present}
-
- return nil
-}
-
-func (dst *Int8multirange) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Int8multirange{Status: Null}
- return nil
- }
-
- rp := 0
-
- numElems := int(binary.BigEndian.Uint32(src[rp:]))
- rp += 4
-
- if numElems == 0 {
- *dst = Int8multirange{Status: Present}
- return nil
- }
-
- elements := make([]Int8range, numElems)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err := elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = Int8multirange{Ranges: elements, Status: Present}
- return nil
-}
-
-func (src Int8multirange) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = append(buf, '{')
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Ranges {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- return nil, fmt.Errorf("multi-range does not allow null range")
- } else {
- buf = append(buf, string(elemBuf)...)
- }
-
- }
-
- buf = append(buf, '}')
-
- return buf, nil
-}
-
-func (src Int8multirange) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = pgio.AppendInt32(buf, int32(len(src.Ranges)))
-
- for i := range src.Ranges {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Ranges[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Int8multirange) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Int8multirange) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/int8range.go b/vendor/github.com/jackc/pgtype/int8range.go
deleted file mode 100644
index 7136937..0000000
--- a/vendor/github.com/jackc/pgtype/int8range.go
+++ /dev/null
@@ -1,267 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "fmt"
-
- "github.com/jackc/pgio"
-)
-
-type Int8range struct {
- Lower Int8
- Upper Int8
- LowerType BoundType
- UpperType BoundType
- Status Status
-}
-
-func (dst *Int8range) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = Int8range{Status: Null}
- return nil
- }
-
- switch value := src.(type) {
- case Int8range:
- *dst = value
- case *Int8range:
- *dst = *value
- case string:
- return dst.DecodeText(nil, []byte(value))
- default:
- return fmt.Errorf("cannot convert %v to Int8range", src)
- }
-
- return nil
-}
-
-func (dst Int8range) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Int8range) AssignTo(dst interface{}) error {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
-}
-
-func (dst *Int8range) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Int8range{Status: Null}
- return nil
- }
-
- utr, err := ParseUntypedTextRange(string(src))
- if err != nil {
- return err
- }
-
- *dst = Int8range{Status: Present}
-
- dst.LowerType = utr.LowerType
- dst.UpperType = utr.UpperType
-
- if dst.LowerType == Empty {
- return nil
- }
-
- if dst.LowerType == Inclusive || dst.LowerType == Exclusive {
- if err := dst.Lower.DecodeText(ci, []byte(utr.Lower)); err != nil {
- return err
- }
- }
-
- if dst.UpperType == Inclusive || dst.UpperType == Exclusive {
- if err := dst.Upper.DecodeText(ci, []byte(utr.Upper)); err != nil {
- return err
- }
- }
-
- return nil
-}
-
-func (dst *Int8range) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Int8range{Status: Null}
- return nil
- }
-
- ubr, err := ParseUntypedBinaryRange(src)
- if err != nil {
- return err
- }
-
- *dst = Int8range{Status: Present}
-
- dst.LowerType = ubr.LowerType
- dst.UpperType = ubr.UpperType
-
- if dst.LowerType == Empty {
- return nil
- }
-
- if dst.LowerType == Inclusive || dst.LowerType == Exclusive {
- if err := dst.Lower.DecodeBinary(ci, ubr.Lower); err != nil {
- return err
- }
- }
-
- if dst.UpperType == Inclusive || dst.UpperType == Exclusive {
- if err := dst.Upper.DecodeBinary(ci, ubr.Upper); err != nil {
- return err
- }
- }
-
- return nil
-}
-
-func (src Int8range) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- switch src.LowerType {
- case Exclusive, Unbounded:
- buf = append(buf, '(')
- case Inclusive:
- buf = append(buf, '[')
- case Empty:
- return append(buf, "empty"...), nil
- default:
- return nil, fmt.Errorf("unknown lower bound type %v", src.LowerType)
- }
-
- var err error
-
- if src.LowerType != Unbounded {
- buf, err = src.Lower.EncodeText(ci, buf)
- if err != nil {
- return nil, err
- } else if buf == nil {
- return nil, fmt.Errorf("Lower cannot be null unless LowerType is Unbounded")
- }
- }
-
- buf = append(buf, ',')
-
- if src.UpperType != Unbounded {
- buf, err = src.Upper.EncodeText(ci, buf)
- if err != nil {
- return nil, err
- } else if buf == nil {
- return nil, fmt.Errorf("Upper cannot be null unless UpperType is Unbounded")
- }
- }
-
- switch src.UpperType {
- case Exclusive, Unbounded:
- buf = append(buf, ')')
- case Inclusive:
- buf = append(buf, ']')
- default:
- return nil, fmt.Errorf("unknown upper bound type %v", src.UpperType)
- }
-
- return buf, nil
-}
-
-func (src Int8range) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- var rangeType byte
- switch src.LowerType {
- case Inclusive:
- rangeType |= lowerInclusiveMask
- case Unbounded:
- rangeType |= lowerUnboundedMask
- case Exclusive:
- case Empty:
- return append(buf, emptyMask), nil
- default:
- return nil, fmt.Errorf("unknown LowerType: %v", src.LowerType)
- }
-
- switch src.UpperType {
- case Inclusive:
- rangeType |= upperInclusiveMask
- case Unbounded:
- rangeType |= upperUnboundedMask
- case Exclusive:
- default:
- return nil, fmt.Errorf("unknown UpperType: %v", src.UpperType)
- }
-
- buf = append(buf, rangeType)
-
- var err error
-
- if src.LowerType != Unbounded {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- buf, err = src.Lower.EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, fmt.Errorf("Lower cannot be null unless LowerType is Unbounded")
- }
-
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
-
- if src.UpperType != Unbounded {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- buf, err = src.Upper.EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, fmt.Errorf("Upper cannot be null unless UpperType is Unbounded")
- }
-
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Int8range) Scan(src interface{}) error {
- if src == nil {
- *dst = Int8range{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Int8range) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/interval.go b/vendor/github.com/jackc/pgtype/interval.go
deleted file mode 100644
index 00ec47c..0000000
--- a/vendor/github.com/jackc/pgtype/interval.go
+++ /dev/null
@@ -1,257 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "strconv"
- "strings"
- "time"
-
- "github.com/jackc/pgio"
-)
-
-const (
- microsecondsPerSecond = 1000000
- microsecondsPerMinute = 60 * microsecondsPerSecond
- microsecondsPerHour = 60 * microsecondsPerMinute
- microsecondsPerDay = 24 * microsecondsPerHour
- microsecondsPerMonth = 30 * microsecondsPerDay
-)
-
-type Interval struct {
- Microseconds int64
- Days int32
- Months int32
- Status Status
-}
-
-func (dst *Interval) Set(src interface{}) error {
- if src == nil {
- *dst = Interval{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- switch value := src.(type) {
- case time.Duration:
- *dst = Interval{Microseconds: int64(value) / 1000, Status: Present}
- default:
- if originalSrc, ok := underlyingPtrType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to Interval", value)
- }
-
- return nil
-}
-
-func (dst Interval) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Interval) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- switch v := dst.(type) {
- case *time.Duration:
- us := int64(src.Months)*microsecondsPerMonth + int64(src.Days)*microsecondsPerDay + src.Microseconds
- *v = time.Duration(us) * time.Microsecond
- return nil
- default:
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
- return fmt.Errorf("unable to assign to %T", dst)
- }
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (dst *Interval) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Interval{Status: Null}
- return nil
- }
-
- var microseconds int64
- var days int32
- var months int32
-
- parts := strings.Split(string(src), " ")
-
- for i := 0; i < len(parts)-1; i += 2 {
- scalar, err := strconv.ParseInt(parts[i], 10, 64)
- if err != nil {
- return fmt.Errorf("bad interval format")
- }
-
- switch parts[i+1] {
- case "year", "years":
- months += int32(scalar * 12)
- case "mon", "mons":
- months += int32(scalar)
- case "day", "days":
- days = int32(scalar)
- }
- }
-
- if len(parts)%2 == 1 {
- timeParts := strings.SplitN(parts[len(parts)-1], ":", 3)
- if len(timeParts) != 3 {
- return fmt.Errorf("bad interval format")
- }
-
- var negative bool
- if timeParts[0][0] == '-' {
- negative = true
- timeParts[0] = timeParts[0][1:]
- }
-
- hours, err := strconv.ParseInt(timeParts[0], 10, 64)
- if err != nil {
- return fmt.Errorf("bad interval hour format: %s", timeParts[0])
- }
-
- minutes, err := strconv.ParseInt(timeParts[1], 10, 64)
- if err != nil {
- return fmt.Errorf("bad interval minute format: %s", timeParts[1])
- }
-
- secondParts := strings.SplitN(timeParts[2], ".", 2)
-
- seconds, err := strconv.ParseInt(secondParts[0], 10, 64)
- if err != nil {
- return fmt.Errorf("bad interval second format: %s", secondParts[0])
- }
-
- var uSeconds int64
- if len(secondParts) == 2 {
- uSeconds, err = strconv.ParseInt(secondParts[1], 10, 64)
- if err != nil {
- return fmt.Errorf("bad interval decimal format: %s", secondParts[1])
- }
-
- for i := 0; i < 6-len(secondParts[1]); i++ {
- uSeconds *= 10
- }
- }
-
- microseconds = hours * microsecondsPerHour
- microseconds += minutes * microsecondsPerMinute
- microseconds += seconds * microsecondsPerSecond
- microseconds += uSeconds
-
- if negative {
- microseconds = -microseconds
- }
- }
-
- *dst = Interval{Months: months, Days: days, Microseconds: microseconds, Status: Present}
- return nil
-}
-
-func (dst *Interval) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Interval{Status: Null}
- return nil
- }
-
- if len(src) != 16 {
- return fmt.Errorf("Received an invalid size for an interval: %d", len(src))
- }
-
- microseconds := int64(binary.BigEndian.Uint64(src))
- days := int32(binary.BigEndian.Uint32(src[8:]))
- months := int32(binary.BigEndian.Uint32(src[12:]))
-
- *dst = Interval{Microseconds: microseconds, Days: days, Months: months, Status: Present}
- return nil
-}
-
-func (src Interval) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if src.Months != 0 {
- buf = append(buf, strconv.FormatInt(int64(src.Months), 10)...)
- buf = append(buf, " mon "...)
- }
-
- if src.Days != 0 {
- buf = append(buf, strconv.FormatInt(int64(src.Days), 10)...)
- buf = append(buf, " day "...)
- }
-
- absMicroseconds := src.Microseconds
- if absMicroseconds < 0 {
- absMicroseconds = -absMicroseconds
- buf = append(buf, '-')
- }
-
- hours := absMicroseconds / microsecondsPerHour
- minutes := (absMicroseconds % microsecondsPerHour) / microsecondsPerMinute
- seconds := (absMicroseconds % microsecondsPerMinute) / microsecondsPerSecond
- microseconds := absMicroseconds % microsecondsPerSecond
-
- timeStr := fmt.Sprintf("%02d:%02d:%02d.%06d", hours, minutes, seconds, microseconds)
- return append(buf, timeStr...), nil
-}
-
-// EncodeBinary encodes src into w.
-func (src Interval) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = pgio.AppendInt64(buf, src.Microseconds)
- buf = pgio.AppendInt32(buf, src.Days)
- return pgio.AppendInt32(buf, src.Months), nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Interval) Scan(src interface{}) error {
- if src == nil {
- *dst = Interval{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Interval) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/json.go b/vendor/github.com/jackc/pgtype/json.go
deleted file mode 100644
index a9508bd..0000000
--- a/vendor/github.com/jackc/pgtype/json.go
+++ /dev/null
@@ -1,209 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/json"
- "errors"
- "fmt"
- "reflect"
-)
-
-type JSON struct {
- Bytes []byte
- Status Status
-}
-
-func (dst *JSON) Set(src interface{}) error {
- if src == nil {
- *dst = JSON{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- switch value := src.(type) {
- case string:
- *dst = JSON{Bytes: []byte(value), Status: Present}
- case *string:
- if value == nil {
- *dst = JSON{Status: Null}
- } else {
- *dst = JSON{Bytes: []byte(*value), Status: Present}
- }
- case []byte:
- if value == nil {
- *dst = JSON{Status: Null}
- } else {
- *dst = JSON{Bytes: value, Status: Present}
- }
- // Encode* methods are defined on *JSON. If JSON is passed directly then the
- // struct itself would be encoded instead of Bytes. This is clearly a footgun
- // so detect and return an error. See https://github.com/jackc/pgx/issues/350.
- case JSON:
- return errors.New("use pointer to pgtype.JSON instead of value")
- // Same as above but for JSONB (because they share implementation)
- case JSONB:
- return errors.New("use pointer to pgtype.JSONB instead of value")
-
- default:
- buf, err := json.Marshal(value)
- if err != nil {
- return err
- }
- *dst = JSON{Bytes: buf, Status: Present}
- }
-
- return nil
-}
-
-func (dst JSON) Get() interface{} {
- switch dst.Status {
- case Present:
- var i interface{}
- err := json.Unmarshal(dst.Bytes, &i)
- if err != nil {
- return dst
- }
- return i
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *JSON) AssignTo(dst interface{}) error {
- switch v := dst.(type) {
- case *string:
- if src.Status == Present {
- *v = string(src.Bytes)
- } else {
- return fmt.Errorf("cannot assign non-present status to %T", dst)
- }
- case **string:
- if src.Status == Present {
- s := string(src.Bytes)
- *v = &s
- return nil
- } else {
- *v = nil
- return nil
- }
- case *[]byte:
- if src.Status != Present {
- *v = nil
- } else {
- buf := make([]byte, len(src.Bytes))
- copy(buf, src.Bytes)
- *v = buf
- }
- default:
- data := src.Bytes
- if data == nil || src.Status != Present {
- data = []byte("null")
- }
-
- p := reflect.ValueOf(dst).Elem()
- p.Set(reflect.Zero(p.Type()))
-
- return json.Unmarshal(data, dst)
- }
-
- return nil
-}
-
-func (JSON) PreferredResultFormat() int16 {
- return TextFormatCode
-}
-
-func (dst *JSON) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = JSON{Status: Null}
- return nil
- }
-
- *dst = JSON{Bytes: src, Status: Present}
- return nil
-}
-
-func (dst *JSON) DecodeBinary(ci *ConnInfo, src []byte) error {
- return dst.DecodeText(ci, src)
-}
-
-func (JSON) PreferredParamFormat() int16 {
- return TextFormatCode
-}
-
-func (src JSON) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- return append(buf, src.Bytes...), nil
-}
-
-func (src JSON) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- return src.EncodeText(ci, buf)
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *JSON) Scan(src interface{}) error {
- if src == nil {
- *dst = JSON{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src JSON) Value() (driver.Value, error) {
- switch src.Status {
- case Present:
- return src.Bytes, nil
- case Null:
- return nil, nil
- default:
- return nil, errUndefined
- }
-}
-
-func (src JSON) MarshalJSON() ([]byte, error) {
- switch src.Status {
- case Present:
- return src.Bytes, nil
- case Null:
- return []byte("null"), nil
- case Undefined:
- return nil, errUndefined
- }
-
- return nil, errBadStatus
-}
-
-func (dst *JSON) UnmarshalJSON(b []byte) error {
- if b == nil || string(b) == "null" {
- *dst = JSON{Status: Null}
- } else {
- *dst = JSON{Bytes: b, Status: Present}
- }
- return nil
-
-}
diff --git a/vendor/github.com/jackc/pgtype/json_array.go b/vendor/github.com/jackc/pgtype/json_array.go
deleted file mode 100644
index 8d68882..0000000
--- a/vendor/github.com/jackc/pgtype/json_array.go
+++ /dev/null
@@ -1,546 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "encoding/json"
- "fmt"
- "reflect"
-
- "github.com/jackc/pgio"
-)
-
-type JSONArray struct {
- Elements []JSON
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *JSONArray) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = JSONArray{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []string:
- if value == nil {
- *dst = JSONArray{Status: Null}
- } else if len(value) == 0 {
- *dst = JSONArray{Status: Present}
- } else {
- elements := make([]JSON, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = JSONArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case [][]byte:
- if value == nil {
- *dst = JSONArray{Status: Null}
- } else if len(value) == 0 {
- *dst = JSONArray{Status: Present}
- } else {
- elements := make([]JSON, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = JSONArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []json.RawMessage:
- if value == nil {
- *dst = JSONArray{Status: Null}
- } else if len(value) == 0 {
- *dst = JSONArray{Status: Present}
- } else {
- elements := make([]JSON, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = JSONArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []JSON:
- if value == nil {
- *dst = JSONArray{Status: Null}
- } else if len(value) == 0 {
- *dst = JSONArray{Status: Present}
- } else {
- *dst = JSONArray{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = JSONArray{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for JSONArray", src)
- }
- if elementsLength == 0 {
- *dst = JSONArray{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to JSONArray", src)
- }
-
- *dst = JSONArray{
- Elements: make([]JSON, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]JSON, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to JSONArray, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *JSONArray) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to JSONArray")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in JSONArray", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst JSONArray) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *JSONArray) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]string:
- *v = make([]string, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[][]byte:
- *v = make([][]byte, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]json.RawMessage:
- *v = make([]json.RawMessage, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *JSONArray) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from JSONArray")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from JSONArray")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *JSONArray) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = JSONArray{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []JSON
-
- if len(uta.Elements) > 0 {
- elements = make([]JSON, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem JSON
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = JSONArray{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *JSONArray) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = JSONArray{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = JSONArray{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]JSON, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = JSONArray{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src JSONArray) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src JSONArray) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("json"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "json")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *JSONArray) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src JSONArray) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/jsonb.go b/vendor/github.com/jackc/pgtype/jsonb.go
deleted file mode 100644
index c9dafc9..0000000
--- a/vendor/github.com/jackc/pgtype/jsonb.go
+++ /dev/null
@@ -1,85 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "fmt"
-)
-
-type JSONB JSON
-
-func (dst *JSONB) Set(src interface{}) error {
- return (*JSON)(dst).Set(src)
-}
-
-func (dst JSONB) Get() interface{} {
- return (JSON)(dst).Get()
-}
-
-func (src *JSONB) AssignTo(dst interface{}) error {
- return (*JSON)(src).AssignTo(dst)
-}
-
-func (JSONB) PreferredResultFormat() int16 {
- return TextFormatCode
-}
-
-func (dst *JSONB) DecodeText(ci *ConnInfo, src []byte) error {
- return (*JSON)(dst).DecodeText(ci, src)
-}
-
-func (dst *JSONB) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = JSONB{Status: Null}
- return nil
- }
-
- if len(src) == 0 {
- return fmt.Errorf("jsonb too short")
- }
-
- if src[0] != 1 {
- return fmt.Errorf("unknown jsonb version number %d", src[0])
- }
-
- *dst = JSONB{Bytes: src[1:], Status: Present}
- return nil
-
-}
-
-func (JSONB) PreferredParamFormat() int16 {
- return TextFormatCode
-}
-
-func (src JSONB) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- return (JSON)(src).EncodeText(ci, buf)
-}
-
-func (src JSONB) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = append(buf, 1)
- return append(buf, src.Bytes...), nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *JSONB) Scan(src interface{}) error {
- return (*JSON)(dst).Scan(src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src JSONB) Value() (driver.Value, error) {
- return (JSON)(src).Value()
-}
-
-func (src JSONB) MarshalJSON() ([]byte, error) {
- return (JSON)(src).MarshalJSON()
-}
-
-func (dst *JSONB) UnmarshalJSON(b []byte) error {
- return (*JSON)(dst).UnmarshalJSON(b)
-}
diff --git a/vendor/github.com/jackc/pgtype/jsonb_array.go b/vendor/github.com/jackc/pgtype/jsonb_array.go
deleted file mode 100644
index e78ad37..0000000
--- a/vendor/github.com/jackc/pgtype/jsonb_array.go
+++ /dev/null
@@ -1,546 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "encoding/json"
- "fmt"
- "reflect"
-
- "github.com/jackc/pgio"
-)
-
-type JSONBArray struct {
- Elements []JSONB
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *JSONBArray) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = JSONBArray{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []string:
- if value == nil {
- *dst = JSONBArray{Status: Null}
- } else if len(value) == 0 {
- *dst = JSONBArray{Status: Present}
- } else {
- elements := make([]JSONB, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = JSONBArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case [][]byte:
- if value == nil {
- *dst = JSONBArray{Status: Null}
- } else if len(value) == 0 {
- *dst = JSONBArray{Status: Present}
- } else {
- elements := make([]JSONB, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = JSONBArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []json.RawMessage:
- if value == nil {
- *dst = JSONBArray{Status: Null}
- } else if len(value) == 0 {
- *dst = JSONBArray{Status: Present}
- } else {
- elements := make([]JSONB, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = JSONBArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []JSONB:
- if value == nil {
- *dst = JSONBArray{Status: Null}
- } else if len(value) == 0 {
- *dst = JSONBArray{Status: Present}
- } else {
- *dst = JSONBArray{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = JSONBArray{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for JSONBArray", src)
- }
- if elementsLength == 0 {
- *dst = JSONBArray{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to JSONBArray", src)
- }
-
- *dst = JSONBArray{
- Elements: make([]JSONB, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]JSONB, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to JSONBArray, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *JSONBArray) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to JSONBArray")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in JSONBArray", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst JSONBArray) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *JSONBArray) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]string:
- *v = make([]string, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[][]byte:
- *v = make([][]byte, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]json.RawMessage:
- *v = make([]json.RawMessage, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *JSONBArray) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from JSONBArray")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from JSONBArray")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *JSONBArray) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = JSONBArray{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []JSONB
-
- if len(uta.Elements) > 0 {
- elements = make([]JSONB, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem JSONB
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = JSONBArray{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *JSONBArray) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = JSONBArray{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = JSONBArray{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]JSONB, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = JSONBArray{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src JSONBArray) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src JSONBArray) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("jsonb"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "jsonb")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *JSONBArray) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src JSONBArray) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/line.go b/vendor/github.com/jackc/pgtype/line.go
deleted file mode 100644
index 3564b17..0000000
--- a/vendor/github.com/jackc/pgtype/line.go
+++ /dev/null
@@ -1,148 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "math"
- "strconv"
- "strings"
-
- "github.com/jackc/pgio"
-)
-
-type Line struct {
- A, B, C float64
- Status Status
-}
-
-func (dst *Line) Set(src interface{}) error {
- return fmt.Errorf("cannot convert %v to Line", src)
-}
-
-func (dst Line) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Line) AssignTo(dst interface{}) error {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
-}
-
-func (dst *Line) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Line{Status: Null}
- return nil
- }
-
- if len(src) < 7 {
- return fmt.Errorf("invalid length for Line: %v", len(src))
- }
-
- parts := strings.SplitN(string(src[1:len(src)-1]), ",", 3)
- if len(parts) < 3 {
- return fmt.Errorf("invalid format for line")
- }
-
- a, err := strconv.ParseFloat(parts[0], 64)
- if err != nil {
- return err
- }
-
- b, err := strconv.ParseFloat(parts[1], 64)
- if err != nil {
- return err
- }
-
- c, err := strconv.ParseFloat(parts[2], 64)
- if err != nil {
- return err
- }
-
- *dst = Line{A: a, B: b, C: c, Status: Present}
- return nil
-}
-
-func (dst *Line) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Line{Status: Null}
- return nil
- }
-
- if len(src) != 24 {
- return fmt.Errorf("invalid length for Line: %v", len(src))
- }
-
- a := binary.BigEndian.Uint64(src)
- b := binary.BigEndian.Uint64(src[8:])
- c := binary.BigEndian.Uint64(src[16:])
-
- *dst = Line{
- A: math.Float64frombits(a),
- B: math.Float64frombits(b),
- C: math.Float64frombits(c),
- Status: Present,
- }
- return nil
-}
-
-func (src Line) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = append(buf, fmt.Sprintf(`{%s,%s,%s}`,
- strconv.FormatFloat(src.A, 'f', -1, 64),
- strconv.FormatFloat(src.B, 'f', -1, 64),
- strconv.FormatFloat(src.C, 'f', -1, 64),
- )...)
-
- return buf, nil
-}
-
-func (src Line) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = pgio.AppendUint64(buf, math.Float64bits(src.A))
- buf = pgio.AppendUint64(buf, math.Float64bits(src.B))
- buf = pgio.AppendUint64(buf, math.Float64bits(src.C))
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Line) Scan(src interface{}) error {
- if src == nil {
- *dst = Line{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Line) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/lseg.go b/vendor/github.com/jackc/pgtype/lseg.go
deleted file mode 100644
index 894dae8..0000000
--- a/vendor/github.com/jackc/pgtype/lseg.go
+++ /dev/null
@@ -1,165 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "math"
- "strconv"
- "strings"
-
- "github.com/jackc/pgio"
-)
-
-type Lseg struct {
- P [2]Vec2
- Status Status
-}
-
-func (dst *Lseg) Set(src interface{}) error {
- return fmt.Errorf("cannot convert %v to Lseg", src)
-}
-
-func (dst Lseg) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Lseg) AssignTo(dst interface{}) error {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
-}
-
-func (dst *Lseg) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Lseg{Status: Null}
- return nil
- }
-
- if len(src) < 11 {
- return fmt.Errorf("invalid length for Lseg: %v", len(src))
- }
-
- str := string(src[2:])
-
- var end int
- end = strings.IndexByte(str, ',')
-
- x1, err := strconv.ParseFloat(str[:end], 64)
- if err != nil {
- return err
- }
-
- str = str[end+1:]
- end = strings.IndexByte(str, ')')
-
- y1, err := strconv.ParseFloat(str[:end], 64)
- if err != nil {
- return err
- }
-
- str = str[end+3:]
- end = strings.IndexByte(str, ',')
-
- x2, err := strconv.ParseFloat(str[:end], 64)
- if err != nil {
- return err
- }
-
- str = str[end+1 : len(str)-2]
-
- y2, err := strconv.ParseFloat(str, 64)
- if err != nil {
- return err
- }
-
- *dst = Lseg{P: [2]Vec2{{x1, y1}, {x2, y2}}, Status: Present}
- return nil
-}
-
-func (dst *Lseg) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Lseg{Status: Null}
- return nil
- }
-
- if len(src) != 32 {
- return fmt.Errorf("invalid length for Lseg: %v", len(src))
- }
-
- x1 := binary.BigEndian.Uint64(src)
- y1 := binary.BigEndian.Uint64(src[8:])
- x2 := binary.BigEndian.Uint64(src[16:])
- y2 := binary.BigEndian.Uint64(src[24:])
-
- *dst = Lseg{
- P: [2]Vec2{
- {math.Float64frombits(x1), math.Float64frombits(y1)},
- {math.Float64frombits(x2), math.Float64frombits(y2)},
- },
- Status: Present,
- }
- return nil
-}
-
-func (src Lseg) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = append(buf, fmt.Sprintf(`[(%s,%s),(%s,%s)]`,
- strconv.FormatFloat(src.P[0].X, 'f', -1, 64),
- strconv.FormatFloat(src.P[0].Y, 'f', -1, 64),
- strconv.FormatFloat(src.P[1].X, 'f', -1, 64),
- strconv.FormatFloat(src.P[1].Y, 'f', -1, 64),
- )...)
-
- return buf, nil
-}
-
-func (src Lseg) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = pgio.AppendUint64(buf, math.Float64bits(src.P[0].X))
- buf = pgio.AppendUint64(buf, math.Float64bits(src.P[0].Y))
- buf = pgio.AppendUint64(buf, math.Float64bits(src.P[1].X))
- buf = pgio.AppendUint64(buf, math.Float64bits(src.P[1].Y))
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Lseg) Scan(src interface{}) error {
- if src == nil {
- *dst = Lseg{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Lseg) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/ltree.go b/vendor/github.com/jackc/pgtype/ltree.go
deleted file mode 100644
index 8c8d421..0000000
--- a/vendor/github.com/jackc/pgtype/ltree.go
+++ /dev/null
@@ -1,72 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "fmt"
-)
-
-type Ltree Text
-
-func (dst *Ltree) Set(src interface{}) error {
- return (*Text)(dst).Set(src)
-}
-
-func (dst Ltree) Get() interface{} {
- return (Text)(dst).Get()
-}
-
-func (src *Ltree) AssignTo(dst interface{}) error {
- return (*Text)(src).AssignTo(dst)
-}
-
-func (src Ltree) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- return (Text)(src).EncodeText(ci, buf)
-}
-
-func (src Ltree) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
- buf = append(buf, 1)
- return append(buf, src.String...), nil
-}
-
-func (Ltree) PreferredResultFormat() int16 {
- return TextFormatCode
-}
-
-func (dst *Ltree) DecodeText(ci *ConnInfo, src []byte) error {
- return (*Text)(dst).DecodeText(ci, src)
-}
-
-func (dst *Ltree) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Ltree{Status: Null}
- return nil
- }
-
- // Get Ltree version, only 1 is allowed
- version := src[0]
- if version != 1 {
- return fmt.Errorf("unsupported ltree version %d", version)
- }
-
- ltreeStr := string(src[1:])
- *dst = Ltree{String: ltreeStr, Status: Present}
- return nil
-}
-
-func (Ltree) PreferredParamFormat() int16 {
- return TextFormatCode
-}
-
-func (dst *Ltree) Scan(src interface{}) error {
- return (*Text)(dst).Scan(src)
-}
-
-func (src Ltree) Value() (driver.Value, error) {
- return (Text)(src).Value()
-}
diff --git a/vendor/github.com/jackc/pgtype/macaddr.go b/vendor/github.com/jackc/pgtype/macaddr.go
deleted file mode 100644
index 1d3cfe7..0000000
--- a/vendor/github.com/jackc/pgtype/macaddr.go
+++ /dev/null
@@ -1,173 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "fmt"
- "net"
-)
-
-type Macaddr struct {
- Addr net.HardwareAddr
- Status Status
-}
-
-func (dst *Macaddr) Set(src interface{}) error {
- if src == nil {
- *dst = Macaddr{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- switch value := src.(type) {
- case net.HardwareAddr:
- addr := make(net.HardwareAddr, len(value))
- copy(addr, value)
- *dst = Macaddr{Addr: addr, Status: Present}
- case string:
- addr, err := net.ParseMAC(value)
- if err != nil {
- return err
- }
- *dst = Macaddr{Addr: addr, Status: Present}
- case *net.HardwareAddr:
- if value == nil {
- *dst = Macaddr{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *string:
- if value == nil {
- *dst = Macaddr{Status: Null}
- } else {
- return dst.Set(*value)
- }
- default:
- if originalSrc, ok := underlyingPtrType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to Macaddr", value)
- }
-
- return nil
-}
-
-func (dst Macaddr) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst.Addr
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Macaddr) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- switch v := dst.(type) {
- case *net.HardwareAddr:
- *v = make(net.HardwareAddr, len(src.Addr))
- copy(*v, src.Addr)
- return nil
- case *string:
- *v = src.Addr.String()
- return nil
- default:
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
- return fmt.Errorf("unable to assign to %T", dst)
- }
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (dst *Macaddr) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Macaddr{Status: Null}
- return nil
- }
-
- addr, err := net.ParseMAC(string(src))
- if err != nil {
- return err
- }
-
- *dst = Macaddr{Addr: addr, Status: Present}
- return nil
-}
-
-func (dst *Macaddr) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Macaddr{Status: Null}
- return nil
- }
-
- if len(src) != 6 {
- return fmt.Errorf("Received an invalid size for a macaddr: %d", len(src))
- }
-
- addr := make(net.HardwareAddr, 6)
- copy(addr, src)
-
- *dst = Macaddr{Addr: addr, Status: Present}
-
- return nil
-}
-
-func (src Macaddr) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- return append(buf, src.Addr.String()...), nil
-}
-
-// EncodeBinary encodes src into w.
-func (src Macaddr) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- return append(buf, src.Addr...), nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Macaddr) Scan(src interface{}) error {
- if src == nil {
- *dst = Macaddr{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Macaddr) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/macaddr_array.go b/vendor/github.com/jackc/pgtype/macaddr_array.go
deleted file mode 100644
index bdb1f20..0000000
--- a/vendor/github.com/jackc/pgtype/macaddr_array.go
+++ /dev/null
@@ -1,518 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "net"
- "reflect"
-
- "github.com/jackc/pgio"
-)
-
-type MacaddrArray struct {
- Elements []Macaddr
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *MacaddrArray) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = MacaddrArray{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []net.HardwareAddr:
- if value == nil {
- *dst = MacaddrArray{Status: Null}
- } else if len(value) == 0 {
- *dst = MacaddrArray{Status: Present}
- } else {
- elements := make([]Macaddr, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = MacaddrArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*net.HardwareAddr:
- if value == nil {
- *dst = MacaddrArray{Status: Null}
- } else if len(value) == 0 {
- *dst = MacaddrArray{Status: Present}
- } else {
- elements := make([]Macaddr, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = MacaddrArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []Macaddr:
- if value == nil {
- *dst = MacaddrArray{Status: Null}
- } else if len(value) == 0 {
- *dst = MacaddrArray{Status: Present}
- } else {
- *dst = MacaddrArray{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = MacaddrArray{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for MacaddrArray", src)
- }
- if elementsLength == 0 {
- *dst = MacaddrArray{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to MacaddrArray", src)
- }
-
- *dst = MacaddrArray{
- Elements: make([]Macaddr, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]Macaddr, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to MacaddrArray, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *MacaddrArray) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to MacaddrArray")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in MacaddrArray", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst MacaddrArray) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *MacaddrArray) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]net.HardwareAddr:
- *v = make([]net.HardwareAddr, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*net.HardwareAddr:
- *v = make([]*net.HardwareAddr, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *MacaddrArray) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from MacaddrArray")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from MacaddrArray")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *MacaddrArray) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = MacaddrArray{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []Macaddr
-
- if len(uta.Elements) > 0 {
- elements = make([]Macaddr, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem Macaddr
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = MacaddrArray{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *MacaddrArray) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = MacaddrArray{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = MacaddrArray{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]Macaddr, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = MacaddrArray{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src MacaddrArray) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src MacaddrArray) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("macaddr"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "macaddr")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *MacaddrArray) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src MacaddrArray) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/multirange.go b/vendor/github.com/jackc/pgtype/multirange.go
deleted file mode 100644
index beb11f7..0000000
--- a/vendor/github.com/jackc/pgtype/multirange.go
+++ /dev/null
@@ -1,83 +0,0 @@
-package pgtype
-
-import (
- "bytes"
- "fmt"
-)
-
-type UntypedTextMultirange struct {
- Elements []string
-}
-
-func ParseUntypedTextMultirange(src string) (*UntypedTextMultirange, error) {
- utmr := &UntypedTextMultirange{}
- utmr.Elements = make([]string, 0)
-
- buf := bytes.NewBufferString(src)
-
- skipWhitespace(buf)
-
- r, _, err := buf.ReadRune()
- if err != nil {
- return nil, fmt.Errorf("invalid array: %v", err)
- }
-
- if r != '{' {
- return nil, fmt.Errorf("invalid multirange, expected '{': %v", err)
- }
-
-parseValueLoop:
- for {
- r, _, err = buf.ReadRune()
- if err != nil {
- return nil, fmt.Errorf("invalid multirange: %v", err)
- }
-
- switch r {
- case ',': // skip range separator
- case '}':
- break parseValueLoop
- default:
- buf.UnreadRune()
- value, err := parseRange(buf)
- if err != nil {
- return nil, fmt.Errorf("invalid multirange value: %v", err)
- }
- utmr.Elements = append(utmr.Elements, value)
- }
- }
-
- skipWhitespace(buf)
-
- if buf.Len() > 0 {
- return nil, fmt.Errorf("unexpected trailing data: %v", buf.String())
- }
-
- return utmr, nil
-
-}
-
-func parseRange(buf *bytes.Buffer) (string, error) {
-
- s := &bytes.Buffer{}
-
- boundSepRead := false
- for {
- r, _, err := buf.ReadRune()
- if err != nil {
- return "", err
- }
-
- switch r {
- case ',', '}':
- if r == ',' && !boundSepRead {
- boundSepRead = true
- break
- }
- buf.UnreadRune()
- return s.String(), nil
- }
-
- s.WriteRune(r)
- }
-}
diff --git a/vendor/github.com/jackc/pgtype/name.go b/vendor/github.com/jackc/pgtype/name.go
deleted file mode 100644
index 7ce8d25..0000000
--- a/vendor/github.com/jackc/pgtype/name.go
+++ /dev/null
@@ -1,58 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
-)
-
-// Name is a type used for PostgreSQL's special 63-byte
-// name data type, used for identifiers like table names.
-// The pg_class.relname column is a good example of where the
-// name data type is used.
-//
-// Note that the underlying Go data type of pgx.Name is string,
-// so there is no way to enforce the 63-byte length. Inputting
-// a longer name into PostgreSQL will result in silent truncation
-// to 63 bytes.
-//
-// Also, if you have custom-compiled PostgreSQL and set
-// NAMEDATALEN to a different value, obviously that number of
-// bytes applies, rather than the default 63.
-type Name Text
-
-func (dst *Name) Set(src interface{}) error {
- return (*Text)(dst).Set(src)
-}
-
-func (dst Name) Get() interface{} {
- return (Text)(dst).Get()
-}
-
-func (src *Name) AssignTo(dst interface{}) error {
- return (*Text)(src).AssignTo(dst)
-}
-
-func (dst *Name) DecodeText(ci *ConnInfo, src []byte) error {
- return (*Text)(dst).DecodeText(ci, src)
-}
-
-func (dst *Name) DecodeBinary(ci *ConnInfo, src []byte) error {
- return (*Text)(dst).DecodeBinary(ci, src)
-}
-
-func (src Name) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- return (Text)(src).EncodeText(ci, buf)
-}
-
-func (src Name) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- return (Text)(src).EncodeBinary(ci, buf)
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Name) Scan(src interface{}) error {
- return (*Text)(dst).Scan(src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Name) Value() (driver.Value, error) {
- return (Text)(src).Value()
-}
diff --git a/vendor/github.com/jackc/pgtype/num_multirange.go b/vendor/github.com/jackc/pgtype/num_multirange.go
deleted file mode 100644
index cbabc8a..0000000
--- a/vendor/github.com/jackc/pgtype/num_multirange.go
+++ /dev/null
@@ -1,239 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
-
- "github.com/jackc/pgio"
-)
-
-type Nummultirange struct {
- Ranges []Numrange
- Status Status
-}
-
-func (dst *Nummultirange) Set(src interface{}) error {
- //untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = Nummultirange{Status: Null}
- return nil
- }
-
- switch value := src.(type) {
- case Nummultirange:
- *dst = value
- case *Nummultirange:
- *dst = *value
- case string:
- return dst.DecodeText(nil, []byte(value))
- case []Numrange:
- if value == nil {
- *dst = Nummultirange{Status: Null}
- } else if len(value) == 0 {
- *dst = Nummultirange{Status: Present}
- } else {
- elements := make([]Numrange, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Nummultirange{
- Ranges: elements,
- Status: Present,
- }
- }
- case []*Numrange:
- if value == nil {
- *dst = Nummultirange{Status: Null}
- } else if len(value) == 0 {
- *dst = Nummultirange{Status: Present}
- } else {
- elements := make([]Numrange, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = Nummultirange{
- Ranges: elements,
- Status: Present,
- }
- }
- default:
- return fmt.Errorf("cannot convert %v to Nummultirange", src)
- }
-
- return nil
-
-}
-
-func (dst Nummultirange) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Nummultirange) AssignTo(dst interface{}) error {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
-}
-
-func (dst *Nummultirange) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Nummultirange{Status: Null}
- return nil
- }
-
- utmr, err := ParseUntypedTextMultirange(string(src))
- if err != nil {
- return err
- }
-
- var elements []Numrange
-
- if len(utmr.Elements) > 0 {
- elements = make([]Numrange, len(utmr.Elements))
-
- for i, s := range utmr.Elements {
- var elem Numrange
-
- elemSrc := []byte(s)
-
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = Nummultirange{Ranges: elements, Status: Present}
-
- return nil
-}
-
-func (dst *Nummultirange) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Nummultirange{Status: Null}
- return nil
- }
-
- rp := 0
-
- numElems := int(binary.BigEndian.Uint32(src[rp:]))
- rp += 4
-
- if numElems == 0 {
- *dst = Nummultirange{Status: Present}
- return nil
- }
-
- elements := make([]Numrange, numElems)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err := elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = Nummultirange{Ranges: elements, Status: Present}
- return nil
-}
-
-func (src Nummultirange) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = append(buf, '{')
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Ranges {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- return nil, fmt.Errorf("multi-range does not allow null range")
- } else {
- buf = append(buf, string(elemBuf)...)
- }
-
- }
-
- buf = append(buf, '}')
-
- return buf, nil
-}
-
-func (src Nummultirange) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = pgio.AppendInt32(buf, int32(len(src.Ranges)))
-
- for i := range src.Ranges {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Ranges[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Nummultirange) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Nummultirange) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/numeric.go b/vendor/github.com/jackc/pgtype/numeric.go
deleted file mode 100644
index 1f32b36..0000000
--- a/vendor/github.com/jackc/pgtype/numeric.go
+++ /dev/null
@@ -1,853 +0,0 @@
-package pgtype
-
-import (
- "bytes"
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "math"
- "math/big"
- "strconv"
- "strings"
-
- "github.com/jackc/pgio"
-)
-
-// PostgreSQL internal numeric storage uses 16-bit "digits" with base of 10,000
-const nbase = 10000
-
-const (
- pgNumericNaN = 0x00000000c0000000
- pgNumericNaNSign = 0xc000
-
- pgNumericPosInf = 0x00000000d0000000
- pgNumericPosInfSign = 0xd000
-
- pgNumericNegInf = 0x00000000f0000000
- pgNumericNegInfSign = 0xf000
-)
-
-var big0 *big.Int = big.NewInt(0)
-var big1 *big.Int = big.NewInt(1)
-var big10 *big.Int = big.NewInt(10)
-var big100 *big.Int = big.NewInt(100)
-var big1000 *big.Int = big.NewInt(1000)
-
-var bigMaxInt8 *big.Int = big.NewInt(math.MaxInt8)
-var bigMinInt8 *big.Int = big.NewInt(math.MinInt8)
-var bigMaxInt16 *big.Int = big.NewInt(math.MaxInt16)
-var bigMinInt16 *big.Int = big.NewInt(math.MinInt16)
-var bigMaxInt32 *big.Int = big.NewInt(math.MaxInt32)
-var bigMinInt32 *big.Int = big.NewInt(math.MinInt32)
-var bigMaxInt64 *big.Int = big.NewInt(math.MaxInt64)
-var bigMinInt64 *big.Int = big.NewInt(math.MinInt64)
-var bigMaxInt *big.Int = big.NewInt(int64(maxInt))
-var bigMinInt *big.Int = big.NewInt(int64(minInt))
-
-var bigMaxUint8 *big.Int = big.NewInt(math.MaxUint8)
-var bigMaxUint16 *big.Int = big.NewInt(math.MaxUint16)
-var bigMaxUint32 *big.Int = big.NewInt(math.MaxUint32)
-var bigMaxUint64 *big.Int = (&big.Int{}).SetUint64(uint64(math.MaxUint64))
-var bigMaxUint *big.Int = (&big.Int{}).SetUint64(uint64(maxUint))
-
-var bigNBase *big.Int = big.NewInt(nbase)
-var bigNBaseX2 *big.Int = big.NewInt(nbase * nbase)
-var bigNBaseX3 *big.Int = big.NewInt(nbase * nbase * nbase)
-var bigNBaseX4 *big.Int = big.NewInt(nbase * nbase * nbase * nbase)
-
-type Numeric struct {
- Int *big.Int
- Exp int32
- Status Status
- NaN bool
- InfinityModifier InfinityModifier
-}
-
-func (dst *Numeric) Set(src interface{}) error {
- if src == nil {
- *dst = Numeric{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- switch value := src.(type) {
- case float32:
- if math.IsNaN(float64(value)) {
- *dst = Numeric{Status: Present, NaN: true}
- return nil
- } else if math.IsInf(float64(value), 1) {
- *dst = Numeric{Status: Present, InfinityModifier: Infinity}
- return nil
- } else if math.IsInf(float64(value), -1) {
- *dst = Numeric{Status: Present, InfinityModifier: NegativeInfinity}
- return nil
- }
- num, exp, err := parseNumericString(strconv.FormatFloat(float64(value), 'f', -1, 64))
- if err != nil {
- return err
- }
- *dst = Numeric{Int: num, Exp: exp, Status: Present}
- case float64:
- if math.IsNaN(value) {
- *dst = Numeric{Status: Present, NaN: true}
- return nil
- } else if math.IsInf(value, 1) {
- *dst = Numeric{Status: Present, InfinityModifier: Infinity}
- return nil
- } else if math.IsInf(value, -1) {
- *dst = Numeric{Status: Present, InfinityModifier: NegativeInfinity}
- return nil
- }
- num, exp, err := parseNumericString(strconv.FormatFloat(value, 'f', -1, 64))
- if err != nil {
- return err
- }
- *dst = Numeric{Int: num, Exp: exp, Status: Present}
- case int8:
- *dst = Numeric{Int: big.NewInt(int64(value)), Status: Present}
- case uint8:
- *dst = Numeric{Int: big.NewInt(int64(value)), Status: Present}
- case int16:
- *dst = Numeric{Int: big.NewInt(int64(value)), Status: Present}
- case uint16:
- *dst = Numeric{Int: big.NewInt(int64(value)), Status: Present}
- case int32:
- *dst = Numeric{Int: big.NewInt(int64(value)), Status: Present}
- case uint32:
- *dst = Numeric{Int: big.NewInt(int64(value)), Status: Present}
- case int64:
- *dst = Numeric{Int: big.NewInt(value), Status: Present}
- case uint64:
- *dst = Numeric{Int: (&big.Int{}).SetUint64(value), Status: Present}
- case int:
- *dst = Numeric{Int: big.NewInt(int64(value)), Status: Present}
- case uint:
- *dst = Numeric{Int: (&big.Int{}).SetUint64(uint64(value)), Status: Present}
- case string:
- num, exp, err := parseNumericString(value)
- if err != nil {
- return err
- }
- *dst = Numeric{Int: num, Exp: exp, Status: Present}
- case *float64:
- if value == nil {
- *dst = Numeric{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *float32:
- if value == nil {
- *dst = Numeric{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int8:
- if value == nil {
- *dst = Numeric{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint8:
- if value == nil {
- *dst = Numeric{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int16:
- if value == nil {
- *dst = Numeric{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint16:
- if value == nil {
- *dst = Numeric{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int32:
- if value == nil {
- *dst = Numeric{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint32:
- if value == nil {
- *dst = Numeric{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int64:
- if value == nil {
- *dst = Numeric{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint64:
- if value == nil {
- *dst = Numeric{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *int:
- if value == nil {
- *dst = Numeric{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *uint:
- if value == nil {
- *dst = Numeric{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case *string:
- if value == nil {
- *dst = Numeric{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case InfinityModifier:
- *dst = Numeric{InfinityModifier: value, Status: Present}
- default:
- if originalSrc, ok := underlyingNumberType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to Numeric", value)
- }
-
- return nil
-}
-
-func (dst Numeric) Get() interface{} {
- switch dst.Status {
- case Present:
- if dst.InfinityModifier != None {
- return dst.InfinityModifier
- }
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Numeric) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- switch v := dst.(type) {
- case *float32:
- f, err := src.toFloat64()
- if err != nil {
- return err
- }
- return float64AssignTo(f, src.Status, dst)
- case *float64:
- f, err := src.toFloat64()
- if err != nil {
- return err
- }
- return float64AssignTo(f, src.Status, dst)
- case *int:
- normalizedInt, err := src.toBigInt()
- if err != nil {
- return err
- }
- if normalizedInt.Cmp(bigMaxInt) > 0 {
- return fmt.Errorf("%v is greater than maximum value for %T", normalizedInt, *v)
- }
- if normalizedInt.Cmp(bigMinInt) < 0 {
- return fmt.Errorf("%v is less than minimum value for %T", normalizedInt, *v)
- }
- *v = int(normalizedInt.Int64())
- case *int8:
- normalizedInt, err := src.toBigInt()
- if err != nil {
- return err
- }
- if normalizedInt.Cmp(bigMaxInt8) > 0 {
- return fmt.Errorf("%v is greater than maximum value for %T", normalizedInt, *v)
- }
- if normalizedInt.Cmp(bigMinInt8) < 0 {
- return fmt.Errorf("%v is less than minimum value for %T", normalizedInt, *v)
- }
- *v = int8(normalizedInt.Int64())
- case *int16:
- normalizedInt, err := src.toBigInt()
- if err != nil {
- return err
- }
- if normalizedInt.Cmp(bigMaxInt16) > 0 {
- return fmt.Errorf("%v is greater than maximum value for %T", normalizedInt, *v)
- }
- if normalizedInt.Cmp(bigMinInt16) < 0 {
- return fmt.Errorf("%v is less than minimum value for %T", normalizedInt, *v)
- }
- *v = int16(normalizedInt.Int64())
- case *int32:
- normalizedInt, err := src.toBigInt()
- if err != nil {
- return err
- }
- if normalizedInt.Cmp(bigMaxInt32) > 0 {
- return fmt.Errorf("%v is greater than maximum value for %T", normalizedInt, *v)
- }
- if normalizedInt.Cmp(bigMinInt32) < 0 {
- return fmt.Errorf("%v is less than minimum value for %T", normalizedInt, *v)
- }
- *v = int32(normalizedInt.Int64())
- case *int64:
- normalizedInt, err := src.toBigInt()
- if err != nil {
- return err
- }
- if normalizedInt.Cmp(bigMaxInt64) > 0 {
- return fmt.Errorf("%v is greater than maximum value for %T", normalizedInt, *v)
- }
- if normalizedInt.Cmp(bigMinInt64) < 0 {
- return fmt.Errorf("%v is less than minimum value for %T", normalizedInt, *v)
- }
- *v = normalizedInt.Int64()
- case *uint:
- normalizedInt, err := src.toBigInt()
- if err != nil {
- return err
- }
- if normalizedInt.Cmp(big0) < 0 {
- return fmt.Errorf("%d is less than zero for %T", normalizedInt, *v)
- } else if normalizedInt.Cmp(bigMaxUint) > 0 {
- return fmt.Errorf("%d is greater than maximum value for %T", normalizedInt, *v)
- }
- *v = uint(normalizedInt.Uint64())
- case *uint8:
- normalizedInt, err := src.toBigInt()
- if err != nil {
- return err
- }
- if normalizedInt.Cmp(big0) < 0 {
- return fmt.Errorf("%d is less than zero for %T", normalizedInt, *v)
- } else if normalizedInt.Cmp(bigMaxUint8) > 0 {
- return fmt.Errorf("%d is greater than maximum value for %T", normalizedInt, *v)
- }
- *v = uint8(normalizedInt.Uint64())
- case *uint16:
- normalizedInt, err := src.toBigInt()
- if err != nil {
- return err
- }
- if normalizedInt.Cmp(big0) < 0 {
- return fmt.Errorf("%d is less than zero for %T", normalizedInt, *v)
- } else if normalizedInt.Cmp(bigMaxUint16) > 0 {
- return fmt.Errorf("%d is greater than maximum value for %T", normalizedInt, *v)
- }
- *v = uint16(normalizedInt.Uint64())
- case *uint32:
- normalizedInt, err := src.toBigInt()
- if err != nil {
- return err
- }
- if normalizedInt.Cmp(big0) < 0 {
- return fmt.Errorf("%d is less than zero for %T", normalizedInt, *v)
- } else if normalizedInt.Cmp(bigMaxUint32) > 0 {
- return fmt.Errorf("%d is greater than maximum value for %T", normalizedInt, *v)
- }
- *v = uint32(normalizedInt.Uint64())
- case *uint64:
- normalizedInt, err := src.toBigInt()
- if err != nil {
- return err
- }
- if normalizedInt.Cmp(big0) < 0 {
- return fmt.Errorf("%d is less than zero for %T", normalizedInt, *v)
- } else if normalizedInt.Cmp(bigMaxUint64) > 0 {
- return fmt.Errorf("%d is greater than maximum value for %T", normalizedInt, *v)
- }
- *v = normalizedInt.Uint64()
- case *big.Rat:
- rat, err := src.toBigRat()
- if err != nil {
- return err
- }
- v.Set(rat)
- case *string:
- buf, err := encodeNumericText(*src, nil)
- if err != nil {
- return err
- }
- *v = string(buf)
- default:
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
- return fmt.Errorf("unable to assign to %T", dst)
- }
- case Null:
- return NullAssignTo(dst)
- }
-
- return nil
-}
-
-func (dst *Numeric) toBigInt() (*big.Int, error) {
- if dst.Exp == 0 {
- return dst.Int, nil
- }
-
- num := &big.Int{}
- num.Set(dst.Int)
- if dst.Exp > 0 {
- mul := &big.Int{}
- mul.Exp(big10, big.NewInt(int64(dst.Exp)), nil)
- num.Mul(num, mul)
- return num, nil
- }
-
- div := &big.Int{}
- div.Exp(big10, big.NewInt(int64(-dst.Exp)), nil)
- remainder := &big.Int{}
- num.DivMod(num, div, remainder)
- if remainder.Cmp(big0) != 0 {
- return nil, fmt.Errorf("cannot convert %v to integer", dst)
- }
- return num, nil
-}
-
-func (dst *Numeric) toBigRat() (*big.Rat, error) {
- if dst.NaN {
- return nil, fmt.Errorf("%v is not a number", dst)
- } else if dst.InfinityModifier == Infinity {
- return nil, fmt.Errorf("%v is infinity", dst)
- } else if dst.InfinityModifier == NegativeInfinity {
- return nil, fmt.Errorf("%v is -infinity", dst)
- }
-
- num := new(big.Rat).SetInt(dst.Int)
- if dst.Exp > 0 {
- mul := new(big.Int).Exp(big10, big.NewInt(int64(dst.Exp)), nil)
- num.Mul(num, new(big.Rat).SetInt(mul))
- } else if dst.Exp < 0 {
- mul := new(big.Int).Exp(big10, big.NewInt(int64(-dst.Exp)), nil)
- num.Quo(num, new(big.Rat).SetInt(mul))
- }
- return num, nil
-}
-
-func (src *Numeric) toFloat64() (float64, error) {
- if src.NaN {
- return math.NaN(), nil
- } else if src.InfinityModifier == Infinity {
- return math.Inf(1), nil
- } else if src.InfinityModifier == NegativeInfinity {
- return math.Inf(-1), nil
- }
-
- buf := make([]byte, 0, 32)
-
- buf = append(buf, src.Int.String()...)
- buf = append(buf, 'e')
- buf = append(buf, strconv.FormatInt(int64(src.Exp), 10)...)
-
- f, err := strconv.ParseFloat(string(buf), 64)
- if err != nil {
- return 0, err
- }
- return f, nil
-}
-
-func (dst *Numeric) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Numeric{Status: Null}
- return nil
- }
-
- if string(src) == "NaN" {
- *dst = Numeric{Status: Present, NaN: true}
- return nil
- } else if string(src) == "Infinity" {
- *dst = Numeric{Status: Present, InfinityModifier: Infinity}
- return nil
- } else if string(src) == "-Infinity" {
- *dst = Numeric{Status: Present, InfinityModifier: NegativeInfinity}
- return nil
- }
-
- num, exp, err := parseNumericString(string(src))
- if err != nil {
- return err
- }
-
- *dst = Numeric{Int: num, Exp: exp, Status: Present}
- return nil
-}
-
-func parseNumericString(str string) (n *big.Int, exp int32, err error) {
- parts := strings.SplitN(str, ".", 2)
- digits := strings.Join(parts, "")
-
- if len(parts) > 1 {
- exp = int32(-len(parts[1]))
- } else {
- for len(digits) > 1 && digits[len(digits)-1] == '0' && digits[len(digits)-2] != '-' {
- digits = digits[:len(digits)-1]
- exp++
- }
- }
-
- accum := &big.Int{}
- if _, ok := accum.SetString(digits, 10); !ok {
- return nil, 0, fmt.Errorf("%s is not a number", str)
- }
-
- return accum, exp, nil
-}
-
-func (dst *Numeric) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Numeric{Status: Null}
- return nil
- }
-
- if len(src) < 8 {
- return fmt.Errorf("numeric incomplete %v", src)
- }
-
- rp := 0
- ndigits := binary.BigEndian.Uint16(src[rp:])
- rp += 2
- weight := int16(binary.BigEndian.Uint16(src[rp:]))
- rp += 2
- sign := binary.BigEndian.Uint16(src[rp:])
- rp += 2
- dscale := int16(binary.BigEndian.Uint16(src[rp:]))
- rp += 2
-
- if sign == pgNumericNaNSign {
- *dst = Numeric{Status: Present, NaN: true}
- return nil
- } else if sign == pgNumericPosInfSign {
- *dst = Numeric{Status: Present, InfinityModifier: Infinity}
- return nil
- } else if sign == pgNumericNegInfSign {
- *dst = Numeric{Status: Present, InfinityModifier: NegativeInfinity}
- return nil
- }
-
- if ndigits == 0 {
- *dst = Numeric{Int: big.NewInt(0), Status: Present}
- return nil
- }
-
- if len(src[rp:]) < int(ndigits)*2 {
- return fmt.Errorf("numeric incomplete %v", src)
- }
-
- accum := &big.Int{}
-
- for i := 0; i < int(ndigits+3)/4; i++ {
- int64accum, bytesRead, digitsRead := nbaseDigitsToInt64(src[rp:])
- rp += bytesRead
-
- if i > 0 {
- var mul *big.Int
- switch digitsRead {
- case 1:
- mul = bigNBase
- case 2:
- mul = bigNBaseX2
- case 3:
- mul = bigNBaseX3
- case 4:
- mul = bigNBaseX4
- default:
- return fmt.Errorf("invalid digitsRead: %d (this can't happen)", digitsRead)
- }
- accum.Mul(accum, mul)
- }
-
- accum.Add(accum, big.NewInt(int64accum))
- }
-
- exp := (int32(weight) - int32(ndigits) + 1) * 4
-
- if dscale > 0 {
- fracNBaseDigits := int16(int32(ndigits) - int32(weight) - 1)
- fracDecimalDigits := fracNBaseDigits * 4
-
- if dscale > fracDecimalDigits {
- multCount := int(dscale - fracDecimalDigits)
- for i := 0; i < multCount; i++ {
- accum.Mul(accum, big10)
- exp--
- }
- } else if dscale < fracDecimalDigits {
- divCount := int(fracDecimalDigits - dscale)
- for i := 0; i < divCount; i++ {
- accum.Div(accum, big10)
- exp++
- }
- }
- }
-
- reduced := &big.Int{}
- remainder := &big.Int{}
- if exp >= 0 {
- for {
- reduced.DivMod(accum, big10, remainder)
- if remainder.Cmp(big0) != 0 {
- break
- }
- accum.Set(reduced)
- exp++
- }
- }
-
- if sign != 0 {
- accum.Neg(accum)
- }
-
- *dst = Numeric{Int: accum, Exp: exp, Status: Present}
-
- return nil
-
-}
-
-func nbaseDigitsToInt64(src []byte) (accum int64, bytesRead, digitsRead int) {
- digits := len(src) / 2
- if digits > 4 {
- digits = 4
- }
-
- rp := 0
-
- for i := 0; i < digits; i++ {
- if i > 0 {
- accum *= nbase
- }
- accum += int64(binary.BigEndian.Uint16(src[rp:]))
- rp += 2
- }
-
- return accum, rp, digits
-}
-
-func (src Numeric) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if src.NaN {
- buf = append(buf, "NaN"...)
- return buf, nil
- } else if src.InfinityModifier == Infinity {
- buf = append(buf, "Infinity"...)
- return buf, nil
- } else if src.InfinityModifier == NegativeInfinity {
- buf = append(buf, "-Infinity"...)
- return buf, nil
- }
-
- buf = append(buf, src.Int.String()...)
- buf = append(buf, 'e')
- buf = append(buf, strconv.FormatInt(int64(src.Exp), 10)...)
- return buf, nil
-}
-
-func (src Numeric) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if src.NaN {
- buf = pgio.AppendUint64(buf, pgNumericNaN)
- return buf, nil
- } else if src.InfinityModifier == Infinity {
- buf = pgio.AppendUint64(buf, pgNumericPosInf)
- return buf, nil
- } else if src.InfinityModifier == NegativeInfinity {
- buf = pgio.AppendUint64(buf, pgNumericNegInf)
- return buf, nil
- }
-
- var sign int16
- if src.Int.Cmp(big0) < 0 {
- sign = 16384
- }
-
- absInt := &big.Int{}
- wholePart := &big.Int{}
- fracPart := &big.Int{}
- remainder := &big.Int{}
- absInt.Abs(src.Int)
-
- // Normalize absInt and exp to where exp is always a multiple of 4. This makes
- // converting to 16-bit base 10,000 digits easier.
- var exp int32
- switch src.Exp % 4 {
- case 1, -3:
- exp = src.Exp - 1
- absInt.Mul(absInt, big10)
- case 2, -2:
- exp = src.Exp - 2
- absInt.Mul(absInt, big100)
- case 3, -1:
- exp = src.Exp - 3
- absInt.Mul(absInt, big1000)
- default:
- exp = src.Exp
- }
-
- if exp < 0 {
- divisor := &big.Int{}
- divisor.Exp(big10, big.NewInt(int64(-exp)), nil)
- wholePart.DivMod(absInt, divisor, fracPart)
- fracPart.Add(fracPart, divisor)
- } else {
- wholePart = absInt
- }
-
- var wholeDigits, fracDigits []int16
-
- for wholePart.Cmp(big0) != 0 {
- wholePart.DivMod(wholePart, bigNBase, remainder)
- wholeDigits = append(wholeDigits, int16(remainder.Int64()))
- }
-
- if fracPart.Cmp(big0) != 0 {
- for fracPart.Cmp(big1) != 0 {
- fracPart.DivMod(fracPart, bigNBase, remainder)
- fracDigits = append(fracDigits, int16(remainder.Int64()))
- }
- }
-
- buf = pgio.AppendInt16(buf, int16(len(wholeDigits)+len(fracDigits)))
-
- var weight int16
- if len(wholeDigits) > 0 {
- weight = int16(len(wholeDigits) - 1)
- if exp > 0 {
- weight += int16(exp / 4)
- }
- } else {
- weight = int16(exp/4) - 1 + int16(len(fracDigits))
- }
- buf = pgio.AppendInt16(buf, weight)
-
- buf = pgio.AppendInt16(buf, sign)
-
- var dscale int16
- if src.Exp < 0 {
- dscale = int16(-src.Exp)
- }
- buf = pgio.AppendInt16(buf, dscale)
-
- for i := len(wholeDigits) - 1; i >= 0; i-- {
- buf = pgio.AppendInt16(buf, wholeDigits[i])
- }
-
- for i := len(fracDigits) - 1; i >= 0; i-- {
- buf = pgio.AppendInt16(buf, fracDigits[i])
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Numeric) Scan(src interface{}) error {
- if src == nil {
- *dst = Numeric{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Numeric) Value() (driver.Value, error) {
- switch src.Status {
- case Present:
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
-
- return string(buf), nil
- case Null:
- return nil, nil
- default:
- return nil, errUndefined
- }
-}
-
-func encodeNumericText(n Numeric, buf []byte) (newBuf []byte, err error) {
- // if !n.Valid {
- // return nil, nil
- // }
-
- if n.NaN {
- buf = append(buf, "NaN"...)
- return buf, nil
- } else if n.InfinityModifier == Infinity {
- buf = append(buf, "Infinity"...)
- return buf, nil
- } else if n.InfinityModifier == NegativeInfinity {
- buf = append(buf, "-Infinity"...)
- return buf, nil
- }
-
- buf = append(buf, n.numberTextBytes()...)
-
- return buf, nil
-}
-
-// numberString returns a string of the number. undefined if NaN, infinite, or NULL
-func (n Numeric) numberTextBytes() []byte {
- intStr := n.Int.String()
- buf := &bytes.Buffer{}
- exp := int(n.Exp)
- if exp > 0 {
- buf.WriteString(intStr)
- for i := 0; i < exp; i++ {
- buf.WriteByte('0')
- }
- } else if exp < 0 {
- if len(intStr) <= -exp {
- buf.WriteString("0.")
- leadingZeros := -exp - len(intStr)
- for i := 0; i < leadingZeros; i++ {
- buf.WriteByte('0')
- }
- buf.WriteString(intStr)
- } else if len(intStr) > -exp {
- dpPos := len(intStr) + exp
- buf.WriteString(intStr[:dpPos])
- buf.WriteByte('.')
- buf.WriteString(intStr[dpPos:])
- }
- } else {
- buf.WriteString(intStr)
- }
-
- return buf.Bytes()
-}
diff --git a/vendor/github.com/jackc/pgtype/numeric_array.go b/vendor/github.com/jackc/pgtype/numeric_array.go
deleted file mode 100644
index 31899de..0000000
--- a/vendor/github.com/jackc/pgtype/numeric_array.go
+++ /dev/null
@@ -1,685 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "reflect"
-
- "github.com/jackc/pgio"
-)
-
-type NumericArray struct {
- Elements []Numeric
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *NumericArray) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = NumericArray{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []float32:
- if value == nil {
- *dst = NumericArray{Status: Null}
- } else if len(value) == 0 {
- *dst = NumericArray{Status: Present}
- } else {
- elements := make([]Numeric, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = NumericArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*float32:
- if value == nil {
- *dst = NumericArray{Status: Null}
- } else if len(value) == 0 {
- *dst = NumericArray{Status: Present}
- } else {
- elements := make([]Numeric, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = NumericArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []float64:
- if value == nil {
- *dst = NumericArray{Status: Null}
- } else if len(value) == 0 {
- *dst = NumericArray{Status: Present}
- } else {
- elements := make([]Numeric, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = NumericArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*float64:
- if value == nil {
- *dst = NumericArray{Status: Null}
- } else if len(value) == 0 {
- *dst = NumericArray{Status: Present}
- } else {
- elements := make([]Numeric, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = NumericArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []int64:
- if value == nil {
- *dst = NumericArray{Status: Null}
- } else if len(value) == 0 {
- *dst = NumericArray{Status: Present}
- } else {
- elements := make([]Numeric, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = NumericArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*int64:
- if value == nil {
- *dst = NumericArray{Status: Null}
- } else if len(value) == 0 {
- *dst = NumericArray{Status: Present}
- } else {
- elements := make([]Numeric, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = NumericArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []uint64:
- if value == nil {
- *dst = NumericArray{Status: Null}
- } else if len(value) == 0 {
- *dst = NumericArray{Status: Present}
- } else {
- elements := make([]Numeric, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = NumericArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*uint64:
- if value == nil {
- *dst = NumericArray{Status: Null}
- } else if len(value) == 0 {
- *dst = NumericArray{Status: Present}
- } else {
- elements := make([]Numeric, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = NumericArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []Numeric:
- if value == nil {
- *dst = NumericArray{Status: Null}
- } else if len(value) == 0 {
- *dst = NumericArray{Status: Present}
- } else {
- *dst = NumericArray{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = NumericArray{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for NumericArray", src)
- }
- if elementsLength == 0 {
- *dst = NumericArray{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to NumericArray", src)
- }
-
- *dst = NumericArray{
- Elements: make([]Numeric, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]Numeric, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to NumericArray, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *NumericArray) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to NumericArray")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in NumericArray", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst NumericArray) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *NumericArray) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]float32:
- *v = make([]float32, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*float32:
- *v = make([]*float32, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]float64:
- *v = make([]float64, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*float64:
- *v = make([]*float64, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]int64:
- *v = make([]int64, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*int64:
- *v = make([]*int64, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]uint64:
- *v = make([]uint64, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*uint64:
- *v = make([]*uint64, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *NumericArray) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from NumericArray")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from NumericArray")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *NumericArray) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = NumericArray{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []Numeric
-
- if len(uta.Elements) > 0 {
- elements = make([]Numeric, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem Numeric
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = NumericArray{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *NumericArray) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = NumericArray{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = NumericArray{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]Numeric, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = NumericArray{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src NumericArray) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src NumericArray) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("numeric"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "numeric")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *NumericArray) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src NumericArray) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/numrange.go b/vendor/github.com/jackc/pgtype/numrange.go
deleted file mode 100644
index 3d5951a..0000000
--- a/vendor/github.com/jackc/pgtype/numrange.go
+++ /dev/null
@@ -1,267 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "fmt"
-
- "github.com/jackc/pgio"
-)
-
-type Numrange struct {
- Lower Numeric
- Upper Numeric
- LowerType BoundType
- UpperType BoundType
- Status Status
-}
-
-func (dst *Numrange) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = Numrange{Status: Null}
- return nil
- }
-
- switch value := src.(type) {
- case Numrange:
- *dst = value
- case *Numrange:
- *dst = *value
- case string:
- return dst.DecodeText(nil, []byte(value))
- default:
- return fmt.Errorf("cannot convert %v to Numrange", src)
- }
-
- return nil
-}
-
-func (dst Numrange) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Numrange) AssignTo(dst interface{}) error {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
-}
-
-func (dst *Numrange) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Numrange{Status: Null}
- return nil
- }
-
- utr, err := ParseUntypedTextRange(string(src))
- if err != nil {
- return err
- }
-
- *dst = Numrange{Status: Present}
-
- dst.LowerType = utr.LowerType
- dst.UpperType = utr.UpperType
-
- if dst.LowerType == Empty {
- return nil
- }
-
- if dst.LowerType == Inclusive || dst.LowerType == Exclusive {
- if err := dst.Lower.DecodeText(ci, []byte(utr.Lower)); err != nil {
- return err
- }
- }
-
- if dst.UpperType == Inclusive || dst.UpperType == Exclusive {
- if err := dst.Upper.DecodeText(ci, []byte(utr.Upper)); err != nil {
- return err
- }
- }
-
- return nil
-}
-
-func (dst *Numrange) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Numrange{Status: Null}
- return nil
- }
-
- ubr, err := ParseUntypedBinaryRange(src)
- if err != nil {
- return err
- }
-
- *dst = Numrange{Status: Present}
-
- dst.LowerType = ubr.LowerType
- dst.UpperType = ubr.UpperType
-
- if dst.LowerType == Empty {
- return nil
- }
-
- if dst.LowerType == Inclusive || dst.LowerType == Exclusive {
- if err := dst.Lower.DecodeBinary(ci, ubr.Lower); err != nil {
- return err
- }
- }
-
- if dst.UpperType == Inclusive || dst.UpperType == Exclusive {
- if err := dst.Upper.DecodeBinary(ci, ubr.Upper); err != nil {
- return err
- }
- }
-
- return nil
-}
-
-func (src Numrange) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- switch src.LowerType {
- case Exclusive, Unbounded:
- buf = append(buf, '(')
- case Inclusive:
- buf = append(buf, '[')
- case Empty:
- return append(buf, "empty"...), nil
- default:
- return nil, fmt.Errorf("unknown lower bound type %v", src.LowerType)
- }
-
- var err error
-
- if src.LowerType != Unbounded {
- buf, err = src.Lower.EncodeText(ci, buf)
- if err != nil {
- return nil, err
- } else if buf == nil {
- return nil, fmt.Errorf("Lower cannot be null unless LowerType is Unbounded")
- }
- }
-
- buf = append(buf, ',')
-
- if src.UpperType != Unbounded {
- buf, err = src.Upper.EncodeText(ci, buf)
- if err != nil {
- return nil, err
- } else if buf == nil {
- return nil, fmt.Errorf("Upper cannot be null unless UpperType is Unbounded")
- }
- }
-
- switch src.UpperType {
- case Exclusive, Unbounded:
- buf = append(buf, ')')
- case Inclusive:
- buf = append(buf, ']')
- default:
- return nil, fmt.Errorf("unknown upper bound type %v", src.UpperType)
- }
-
- return buf, nil
-}
-
-func (src Numrange) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- var rangeType byte
- switch src.LowerType {
- case Inclusive:
- rangeType |= lowerInclusiveMask
- case Unbounded:
- rangeType |= lowerUnboundedMask
- case Exclusive:
- case Empty:
- return append(buf, emptyMask), nil
- default:
- return nil, fmt.Errorf("unknown LowerType: %v", src.LowerType)
- }
-
- switch src.UpperType {
- case Inclusive:
- rangeType |= upperInclusiveMask
- case Unbounded:
- rangeType |= upperUnboundedMask
- case Exclusive:
- default:
- return nil, fmt.Errorf("unknown UpperType: %v", src.UpperType)
- }
-
- buf = append(buf, rangeType)
-
- var err error
-
- if src.LowerType != Unbounded {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- buf, err = src.Lower.EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, fmt.Errorf("Lower cannot be null unless LowerType is Unbounded")
- }
-
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
-
- if src.UpperType != Unbounded {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- buf, err = src.Upper.EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, fmt.Errorf("Upper cannot be null unless UpperType is Unbounded")
- }
-
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Numrange) Scan(src interface{}) error {
- if src == nil {
- *dst = Numrange{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Numrange) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/oid.go b/vendor/github.com/jackc/pgtype/oid.go
deleted file mode 100644
index 31677e8..0000000
--- a/vendor/github.com/jackc/pgtype/oid.go
+++ /dev/null
@@ -1,81 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "strconv"
-
- "github.com/jackc/pgio"
-)
-
-// OID (Object Identifier Type) is, according to
-// https://www.postgresql.org/docs/current/static/datatype-oid.html, used
-// internally by PostgreSQL as a primary key for various system tables. It is
-// currently implemented as an unsigned four-byte integer. Its definition can be
-// found in src/include/postgres_ext.h in the PostgreSQL sources. Because it is
-// so frequently required to be in a NOT NULL condition OID cannot be NULL. To
-// allow for NULL OIDs use OIDValue.
-type OID uint32
-
-func (dst *OID) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- return fmt.Errorf("cannot decode nil into OID")
- }
-
- n, err := strconv.ParseUint(string(src), 10, 32)
- if err != nil {
- return err
- }
-
- *dst = OID(n)
- return nil
-}
-
-func (dst *OID) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- return fmt.Errorf("cannot decode nil into OID")
- }
-
- if len(src) != 4 {
- return fmt.Errorf("invalid length: %v", len(src))
- }
-
- n := binary.BigEndian.Uint32(src)
- *dst = OID(n)
- return nil
-}
-
-func (src OID) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- return append(buf, strconv.FormatUint(uint64(src), 10)...), nil
-}
-
-func (src OID) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- return pgio.AppendUint32(buf, uint32(src)), nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *OID) Scan(src interface{}) error {
- if src == nil {
- return fmt.Errorf("cannot scan NULL into %T", src)
- }
-
- switch src := src.(type) {
- case int64:
- *dst = OID(src)
- return nil
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src OID) Value() (driver.Value, error) {
- return int64(src), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/oid_value.go b/vendor/github.com/jackc/pgtype/oid_value.go
deleted file mode 100644
index 5dc9136..0000000
--- a/vendor/github.com/jackc/pgtype/oid_value.go
+++ /dev/null
@@ -1,55 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
-)
-
-// OIDValue (Object Identifier Type) is, according to
-// https://www.postgresql.org/docs/current/static/datatype-OIDValue.html, used
-// internally by PostgreSQL as a primary key for various system tables. It is
-// currently implemented as an unsigned four-byte integer. Its definition can be
-// found in src/include/postgres_ext.h in the PostgreSQL sources.
-type OIDValue pguint32
-
-// Set converts from src to dst. Note that as OIDValue is not a general
-// number type Set does not do automatic type conversion as other number
-// types do.
-func (dst *OIDValue) Set(src interface{}) error {
- return (*pguint32)(dst).Set(src)
-}
-
-func (dst OIDValue) Get() interface{} {
- return (pguint32)(dst).Get()
-}
-
-// AssignTo assigns from src to dst. Note that as OIDValue is not a general number
-// type AssignTo does not do automatic type conversion as other number types do.
-func (src *OIDValue) AssignTo(dst interface{}) error {
- return (*pguint32)(src).AssignTo(dst)
-}
-
-func (dst *OIDValue) DecodeText(ci *ConnInfo, src []byte) error {
- return (*pguint32)(dst).DecodeText(ci, src)
-}
-
-func (dst *OIDValue) DecodeBinary(ci *ConnInfo, src []byte) error {
- return (*pguint32)(dst).DecodeBinary(ci, src)
-}
-
-func (src OIDValue) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- return (pguint32)(src).EncodeText(ci, buf)
-}
-
-func (src OIDValue) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- return (pguint32)(src).EncodeBinary(ci, buf)
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *OIDValue) Scan(src interface{}) error {
- return (*pguint32)(dst).Scan(src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src OIDValue) Value() (driver.Value, error) {
- return (pguint32)(src).Value()
-}
diff --git a/vendor/github.com/jackc/pgtype/path.go b/vendor/github.com/jackc/pgtype/path.go
deleted file mode 100644
index 9f89969..0000000
--- a/vendor/github.com/jackc/pgtype/path.go
+++ /dev/null
@@ -1,195 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "math"
- "strconv"
- "strings"
-
- "github.com/jackc/pgio"
-)
-
-type Path struct {
- P []Vec2
- Closed bool
- Status Status
-}
-
-func (dst *Path) Set(src interface{}) error {
- return fmt.Errorf("cannot convert %v to Path", src)
-}
-
-func (dst Path) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Path) AssignTo(dst interface{}) error {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
-}
-
-func (dst *Path) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Path{Status: Null}
- return nil
- }
-
- if len(src) < 7 {
- return fmt.Errorf("invalid length for Path: %v", len(src))
- }
-
- closed := src[0] == '('
- points := make([]Vec2, 0)
-
- str := string(src[2:])
-
- for {
- end := strings.IndexByte(str, ',')
- x, err := strconv.ParseFloat(str[:end], 64)
- if err != nil {
- return err
- }
-
- str = str[end+1:]
- end = strings.IndexByte(str, ')')
-
- y, err := strconv.ParseFloat(str[:end], 64)
- if err != nil {
- return err
- }
-
- points = append(points, Vec2{x, y})
-
- if end+3 < len(str) {
- str = str[end+3:]
- } else {
- break
- }
- }
-
- *dst = Path{P: points, Closed: closed, Status: Present}
- return nil
-}
-
-func (dst *Path) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Path{Status: Null}
- return nil
- }
-
- if len(src) < 5 {
- return fmt.Errorf("invalid length for Path: %v", len(src))
- }
-
- closed := src[0] == 1
- pointCount := int(binary.BigEndian.Uint32(src[1:]))
-
- rp := 5
-
- if 5+pointCount*16 != len(src) {
- return fmt.Errorf("invalid length for Path with %d points: %v", pointCount, len(src))
- }
-
- points := make([]Vec2, pointCount)
- for i := 0; i < len(points); i++ {
- x := binary.BigEndian.Uint64(src[rp:])
- rp += 8
- y := binary.BigEndian.Uint64(src[rp:])
- rp += 8
- points[i] = Vec2{math.Float64frombits(x), math.Float64frombits(y)}
- }
-
- *dst = Path{
- P: points,
- Closed: closed,
- Status: Present,
- }
- return nil
-}
-
-func (src Path) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- var startByte, endByte byte
- if src.Closed {
- startByte = '('
- endByte = ')'
- } else {
- startByte = '['
- endByte = ']'
- }
- buf = append(buf, startByte)
-
- for i, p := range src.P {
- if i > 0 {
- buf = append(buf, ',')
- }
- buf = append(buf, fmt.Sprintf(`(%s,%s)`,
- strconv.FormatFloat(p.X, 'f', -1, 64),
- strconv.FormatFloat(p.Y, 'f', -1, 64),
- )...)
- }
-
- return append(buf, endByte), nil
-}
-
-func (src Path) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- var closeByte byte
- if src.Closed {
- closeByte = 1
- }
- buf = append(buf, closeByte)
-
- buf = pgio.AppendInt32(buf, int32(len(src.P)))
-
- for _, p := range src.P {
- buf = pgio.AppendUint64(buf, math.Float64bits(p.X))
- buf = pgio.AppendUint64(buf, math.Float64bits(p.Y))
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Path) Scan(src interface{}) error {
- if src == nil {
- *dst = Path{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Path) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/pgtype.go b/vendor/github.com/jackc/pgtype/pgtype.go
deleted file mode 100644
index a52740e..0000000
--- a/vendor/github.com/jackc/pgtype/pgtype.go
+++ /dev/null
@@ -1,1001 +0,0 @@
-package pgtype
-
-import (
- "database/sql"
- "encoding/binary"
- "errors"
- "fmt"
- "math"
- "net"
- "reflect"
- "time"
-)
-
-// PostgreSQL oids for common types
-const (
- BoolOID = 16
- ByteaOID = 17
- QCharOID = 18
- NameOID = 19
- Int8OID = 20
- Int2OID = 21
- Int4OID = 23
- TextOID = 25
- OIDOID = 26
- TIDOID = 27
- XIDOID = 28
- CIDOID = 29
- JSONOID = 114
- JSONArrayOID = 199
- PointOID = 600
- LsegOID = 601
- PathOID = 602
- BoxOID = 603
- PolygonOID = 604
- LineOID = 628
- CIDROID = 650
- CIDRArrayOID = 651
- Float4OID = 700
- Float8OID = 701
- CircleOID = 718
- UnknownOID = 705
- MacaddrOID = 829
- InetOID = 869
- BoolArrayOID = 1000
- Int2ArrayOID = 1005
- Int4ArrayOID = 1007
- TextArrayOID = 1009
- ByteaArrayOID = 1001
- BPCharArrayOID = 1014
- VarcharArrayOID = 1015
- Int8ArrayOID = 1016
- Float4ArrayOID = 1021
- Float8ArrayOID = 1022
- ACLItemOID = 1033
- ACLItemArrayOID = 1034
- InetArrayOID = 1041
- BPCharOID = 1042
- VarcharOID = 1043
- DateOID = 1082
- TimeOID = 1083
- TimestampOID = 1114
- TimestampArrayOID = 1115
- DateArrayOID = 1182
- TimestamptzOID = 1184
- TimestamptzArrayOID = 1185
- IntervalOID = 1186
- NumericArrayOID = 1231
- BitOID = 1560
- VarbitOID = 1562
- NumericOID = 1700
- RecordOID = 2249
- UUIDOID = 2950
- UUIDArrayOID = 2951
- JSONBOID = 3802
- JSONBArrayOID = 3807
- DaterangeOID = 3912
- Int4rangeOID = 3904
- Int4multirangeOID = 4451
- NumrangeOID = 3906
- NummultirangeOID = 4532
- TsrangeOID = 3908
- TsrangeArrayOID = 3909
- TstzrangeOID = 3910
- TstzrangeArrayOID = 3911
- Int8rangeOID = 3926
- Int8multirangeOID = 4536
-)
-
-type Status byte
-
-const (
- Undefined Status = iota
- Null
- Present
-)
-
-type InfinityModifier int8
-
-const (
- Infinity InfinityModifier = 1
- None InfinityModifier = 0
- NegativeInfinity InfinityModifier = -Infinity
-)
-
-func (im InfinityModifier) String() string {
- switch im {
- case None:
- return "none"
- case Infinity:
- return "infinity"
- case NegativeInfinity:
- return "-infinity"
- default:
- return "invalid"
- }
-}
-
-// PostgreSQL format codes
-const (
- TextFormatCode = 0
- BinaryFormatCode = 1
-)
-
-// Value translates values to and from an internal canonical representation for the type. To actually be usable a type
-// that implements Value should also implement some combination of BinaryDecoder, BinaryEncoder, TextDecoder,
-// and TextEncoder.
-//
-// Operations that update a Value (e.g. Set, DecodeText, DecodeBinary) should entirely replace the value. e.g. Internal
-// slices should be replaced not resized and reused. This allows Get and AssignTo to return a slice directly rather
-// than incur a usually unnecessary copy.
-type Value interface {
- // Set converts and assigns src to itself. Value takes ownership of src.
- Set(src interface{}) error
-
- // Get returns the simplest representation of Value. Get may return a pointer to an internal value but it must never
- // mutate that value. e.g. If Get returns a []byte Value must never change the contents of the []byte.
- Get() interface{}
-
- // AssignTo converts and assigns the Value to dst. AssignTo may a pointer to an internal value but it must never
- // mutate that value. e.g. If Get returns a []byte Value must never change the contents of the []byte.
- AssignTo(dst interface{}) error
-}
-
-// TypeValue is a Value where instances can represent different PostgreSQL types. This can be useful for
-// representing types such as enums, composites, and arrays.
-//
-// In general, instances of TypeValue should not be used to directly represent a value. It should only be used as an
-// encoder and decoder internal to ConnInfo.
-type TypeValue interface {
- Value
-
- // NewTypeValue creates a TypeValue including references to internal type information. e.g. the list of members
- // in an EnumType.
- NewTypeValue() Value
-
- // TypeName returns the PostgreSQL name of this type.
- TypeName() string
-}
-
-// ValueTranscoder is a value that implements the text and binary encoding and decoding interfaces.
-type ValueTranscoder interface {
- Value
- TextEncoder
- BinaryEncoder
- TextDecoder
- BinaryDecoder
-}
-
-// ResultFormatPreferrer allows a type to specify its preferred result format instead of it being inferred from
-// whether it is also a BinaryDecoder.
-type ResultFormatPreferrer interface {
- PreferredResultFormat() int16
-}
-
-// ParamFormatPreferrer allows a type to specify its preferred param format instead of it being inferred from
-// whether it is also a BinaryEncoder.
-type ParamFormatPreferrer interface {
- PreferredParamFormat() int16
-}
-
-type BinaryDecoder interface {
- // DecodeBinary decodes src into BinaryDecoder. If src is nil then the
- // original SQL value is NULL. BinaryDecoder takes ownership of src. The
- // caller MUST not use it again.
- DecodeBinary(ci *ConnInfo, src []byte) error
-}
-
-type TextDecoder interface {
- // DecodeText decodes src into TextDecoder. If src is nil then the original
- // SQL value is NULL. TextDecoder takes ownership of src. The caller MUST not
- // use it again.
- DecodeText(ci *ConnInfo, src []byte) error
-}
-
-// BinaryEncoder is implemented by types that can encode themselves into the
-// PostgreSQL binary wire format.
-type BinaryEncoder interface {
- // EncodeBinary should append the binary format of self to buf. If self is the
- // SQL value NULL then append nothing and return (nil, nil). The caller of
- // EncodeBinary is responsible for writing the correct NULL value or the
- // length of the data written.
- EncodeBinary(ci *ConnInfo, buf []byte) (newBuf []byte, err error)
-}
-
-// TextEncoder is implemented by types that can encode themselves into the
-// PostgreSQL text wire format.
-type TextEncoder interface {
- // EncodeText should append the text format of self to buf. If self is the
- // SQL value NULL then append nothing and return (nil, nil). The caller of
- // EncodeText is responsible for writing the correct NULL value or the
- // length of the data written.
- EncodeText(ci *ConnInfo, buf []byte) (newBuf []byte, err error)
-}
-
-var errUndefined = errors.New("cannot encode status undefined")
-var errBadStatus = errors.New("invalid status")
-
-type nullAssignmentError struct {
- dst interface{}
-}
-
-func (e *nullAssignmentError) Error() string {
- return fmt.Sprintf("cannot assign NULL to %T", e.dst)
-}
-
-type DataType struct {
- Value Value
-
- textDecoder TextDecoder
- binaryDecoder BinaryDecoder
-
- Name string
- OID uint32
-}
-
-type ConnInfo struct {
- oidToDataType map[uint32]*DataType
- nameToDataType map[string]*DataType
- reflectTypeToName map[reflect.Type]string
- oidToParamFormatCode map[uint32]int16
- oidToResultFormatCode map[uint32]int16
-
- reflectTypeToDataType map[reflect.Type]*DataType
-}
-
-func newConnInfo() *ConnInfo {
- return &ConnInfo{
- oidToDataType: make(map[uint32]*DataType),
- nameToDataType: make(map[string]*DataType),
- reflectTypeToName: make(map[reflect.Type]string),
- oidToParamFormatCode: make(map[uint32]int16),
- oidToResultFormatCode: make(map[uint32]int16),
- }
-}
-
-func NewConnInfo() *ConnInfo {
- ci := newConnInfo()
-
- ci.RegisterDataType(DataType{Value: &ACLItemArray{}, Name: "_aclitem", OID: ACLItemArrayOID})
- ci.RegisterDataType(DataType{Value: &BoolArray{}, Name: "_bool", OID: BoolArrayOID})
- ci.RegisterDataType(DataType{Value: &BPCharArray{}, Name: "_bpchar", OID: BPCharArrayOID})
- ci.RegisterDataType(DataType{Value: &ByteaArray{}, Name: "_bytea", OID: ByteaArrayOID})
- ci.RegisterDataType(DataType{Value: &CIDRArray{}, Name: "_cidr", OID: CIDRArrayOID})
- ci.RegisterDataType(DataType{Value: &DateArray{}, Name: "_date", OID: DateArrayOID})
- ci.RegisterDataType(DataType{Value: &Float4Array{}, Name: "_float4", OID: Float4ArrayOID})
- ci.RegisterDataType(DataType{Value: &Float8Array{}, Name: "_float8", OID: Float8ArrayOID})
- ci.RegisterDataType(DataType{Value: &InetArray{}, Name: "_inet", OID: InetArrayOID})
- ci.RegisterDataType(DataType{Value: &Int2Array{}, Name: "_int2", OID: Int2ArrayOID})
- ci.RegisterDataType(DataType{Value: &Int4Array{}, Name: "_int4", OID: Int4ArrayOID})
- ci.RegisterDataType(DataType{Value: &Int8Array{}, Name: "_int8", OID: Int8ArrayOID})
- ci.RegisterDataType(DataType{Value: &NumericArray{}, Name: "_numeric", OID: NumericArrayOID})
- ci.RegisterDataType(DataType{Value: &TextArray{}, Name: "_text", OID: TextArrayOID})
- ci.RegisterDataType(DataType{Value: &TimestampArray{}, Name: "_timestamp", OID: TimestampArrayOID})
- ci.RegisterDataType(DataType{Value: &TimestamptzArray{}, Name: "_timestamptz", OID: TimestamptzArrayOID})
- ci.RegisterDataType(DataType{Value: &UUIDArray{}, Name: "_uuid", OID: UUIDArrayOID})
- ci.RegisterDataType(DataType{Value: &VarcharArray{}, Name: "_varchar", OID: VarcharArrayOID})
- ci.RegisterDataType(DataType{Value: &ACLItem{}, Name: "aclitem", OID: ACLItemOID})
- ci.RegisterDataType(DataType{Value: &Bit{}, Name: "bit", OID: BitOID})
- ci.RegisterDataType(DataType{Value: &Bool{}, Name: "bool", OID: BoolOID})
- ci.RegisterDataType(DataType{Value: &Box{}, Name: "box", OID: BoxOID})
- ci.RegisterDataType(DataType{Value: &BPChar{}, Name: "bpchar", OID: BPCharOID})
- ci.RegisterDataType(DataType{Value: &Bytea{}, Name: "bytea", OID: ByteaOID})
- ci.RegisterDataType(DataType{Value: &QChar{}, Name: "char", OID: QCharOID})
- ci.RegisterDataType(DataType{Value: &CID{}, Name: "cid", OID: CIDOID})
- ci.RegisterDataType(DataType{Value: &CIDR{}, Name: "cidr", OID: CIDROID})
- ci.RegisterDataType(DataType{Value: &Circle{}, Name: "circle", OID: CircleOID})
- ci.RegisterDataType(DataType{Value: &Date{}, Name: "date", OID: DateOID})
- ci.RegisterDataType(DataType{Value: &Daterange{}, Name: "daterange", OID: DaterangeOID})
- ci.RegisterDataType(DataType{Value: &Float4{}, Name: "float4", OID: Float4OID})
- ci.RegisterDataType(DataType{Value: &Float8{}, Name: "float8", OID: Float8OID})
- ci.RegisterDataType(DataType{Value: &Inet{}, Name: "inet", OID: InetOID})
- ci.RegisterDataType(DataType{Value: &Int2{}, Name: "int2", OID: Int2OID})
- ci.RegisterDataType(DataType{Value: &Int4{}, Name: "int4", OID: Int4OID})
- ci.RegisterDataType(DataType{Value: &Int4range{}, Name: "int4range", OID: Int4rangeOID})
- ci.RegisterDataType(DataType{Value: &Int4multirange{}, Name: "int4multirange", OID: Int4multirangeOID})
- ci.RegisterDataType(DataType{Value: &Int8{}, Name: "int8", OID: Int8OID})
- ci.RegisterDataType(DataType{Value: &Int8range{}, Name: "int8range", OID: Int8rangeOID})
- ci.RegisterDataType(DataType{Value: &Int8multirange{}, Name: "int8multirange", OID: Int8multirangeOID})
- ci.RegisterDataType(DataType{Value: &Interval{}, Name: "interval", OID: IntervalOID})
- ci.RegisterDataType(DataType{Value: &JSON{}, Name: "json", OID: JSONOID})
- ci.RegisterDataType(DataType{Value: &JSONArray{}, Name: "_json", OID: JSONArrayOID})
- ci.RegisterDataType(DataType{Value: &JSONB{}, Name: "jsonb", OID: JSONBOID})
- ci.RegisterDataType(DataType{Value: &JSONBArray{}, Name: "_jsonb", OID: JSONBArrayOID})
- ci.RegisterDataType(DataType{Value: &Line{}, Name: "line", OID: LineOID})
- ci.RegisterDataType(DataType{Value: &Lseg{}, Name: "lseg", OID: LsegOID})
- ci.RegisterDataType(DataType{Value: &Macaddr{}, Name: "macaddr", OID: MacaddrOID})
- ci.RegisterDataType(DataType{Value: &Name{}, Name: "name", OID: NameOID})
- ci.RegisterDataType(DataType{Value: &Numeric{}, Name: "numeric", OID: NumericOID})
- ci.RegisterDataType(DataType{Value: &Numrange{}, Name: "numrange", OID: NumrangeOID})
- ci.RegisterDataType(DataType{Value: &Nummultirange{}, Name: "nummultirange", OID: NummultirangeOID})
- ci.RegisterDataType(DataType{Value: &OIDValue{}, Name: "oid", OID: OIDOID})
- ci.RegisterDataType(DataType{Value: &Path{}, Name: "path", OID: PathOID})
- ci.RegisterDataType(DataType{Value: &Point{}, Name: "point", OID: PointOID})
- ci.RegisterDataType(DataType{Value: &Polygon{}, Name: "polygon", OID: PolygonOID})
- ci.RegisterDataType(DataType{Value: &Record{}, Name: "record", OID: RecordOID})
- ci.RegisterDataType(DataType{Value: &Text{}, Name: "text", OID: TextOID})
- ci.RegisterDataType(DataType{Value: &TID{}, Name: "tid", OID: TIDOID})
- ci.RegisterDataType(DataType{Value: &Time{}, Name: "time", OID: TimeOID})
- ci.RegisterDataType(DataType{Value: &Timestamp{}, Name: "timestamp", OID: TimestampOID})
- ci.RegisterDataType(DataType{Value: &Timestamptz{}, Name: "timestamptz", OID: TimestamptzOID})
- ci.RegisterDataType(DataType{Value: &Tsrange{}, Name: "tsrange", OID: TsrangeOID})
- ci.RegisterDataType(DataType{Value: &TsrangeArray{}, Name: "_tsrange", OID: TsrangeArrayOID})
- ci.RegisterDataType(DataType{Value: &Tstzrange{}, Name: "tstzrange", OID: TstzrangeOID})
- ci.RegisterDataType(DataType{Value: &TstzrangeArray{}, Name: "_tstzrange", OID: TstzrangeArrayOID})
- ci.RegisterDataType(DataType{Value: &Unknown{}, Name: "unknown", OID: UnknownOID})
- ci.RegisterDataType(DataType{Value: &UUID{}, Name: "uuid", OID: UUIDOID})
- ci.RegisterDataType(DataType{Value: &Varbit{}, Name: "varbit", OID: VarbitOID})
- ci.RegisterDataType(DataType{Value: &Varchar{}, Name: "varchar", OID: VarcharOID})
- ci.RegisterDataType(DataType{Value: &XID{}, Name: "xid", OID: XIDOID})
-
- registerDefaultPgTypeVariants := func(name, arrayName string, value interface{}) {
- ci.RegisterDefaultPgType(value, name)
- valueType := reflect.TypeOf(value)
-
- ci.RegisterDefaultPgType(reflect.New(valueType).Interface(), name)
-
- sliceType := reflect.SliceOf(valueType)
- ci.RegisterDefaultPgType(reflect.MakeSlice(sliceType, 0, 0).Interface(), arrayName)
-
- ci.RegisterDefaultPgType(reflect.New(sliceType).Interface(), arrayName)
- }
-
- // Integer types that directly map to a PostgreSQL type
- registerDefaultPgTypeVariants("int2", "_int2", int16(0))
- registerDefaultPgTypeVariants("int4", "_int4", int32(0))
- registerDefaultPgTypeVariants("int8", "_int8", int64(0))
-
- // Integer types that do not have a direct match to a PostgreSQL type
- registerDefaultPgTypeVariants("int8", "_int8", uint16(0))
- registerDefaultPgTypeVariants("int8", "_int8", uint32(0))
- registerDefaultPgTypeVariants("int8", "_int8", uint64(0))
- registerDefaultPgTypeVariants("int8", "_int8", int(0))
- registerDefaultPgTypeVariants("int8", "_int8", uint(0))
-
- registerDefaultPgTypeVariants("float4", "_float4", float32(0))
- registerDefaultPgTypeVariants("float8", "_float8", float64(0))
-
- registerDefaultPgTypeVariants("bool", "_bool", false)
- registerDefaultPgTypeVariants("timestamptz", "_timestamptz", time.Time{})
- registerDefaultPgTypeVariants("text", "_text", "")
- registerDefaultPgTypeVariants("bytea", "_bytea", []byte(nil))
-
- registerDefaultPgTypeVariants("inet", "_inet", net.IP{})
- ci.RegisterDefaultPgType((*net.IPNet)(nil), "cidr")
- ci.RegisterDefaultPgType([]*net.IPNet(nil), "_cidr")
-
- return ci
-}
-
-func (ci *ConnInfo) InitializeDataTypes(nameOIDs map[string]uint32) {
- for name, oid := range nameOIDs {
- var value Value
- if t, ok := nameValues[name]; ok {
- value = reflect.New(reflect.ValueOf(t).Elem().Type()).Interface().(Value)
- } else {
- value = &GenericText{}
- }
- ci.RegisterDataType(DataType{Value: value, Name: name, OID: oid})
- }
-}
-
-func (ci *ConnInfo) RegisterDataType(t DataType) {
- t.Value = NewValue(t.Value)
-
- ci.oidToDataType[t.OID] = &t
- ci.nameToDataType[t.Name] = &t
-
- {
- var formatCode int16
- if pfp, ok := t.Value.(ParamFormatPreferrer); ok {
- formatCode = pfp.PreferredParamFormat()
- } else if _, ok := t.Value.(BinaryEncoder); ok {
- formatCode = BinaryFormatCode
- }
- ci.oidToParamFormatCode[t.OID] = formatCode
- }
-
- {
- var formatCode int16
- if rfp, ok := t.Value.(ResultFormatPreferrer); ok {
- formatCode = rfp.PreferredResultFormat()
- } else if _, ok := t.Value.(BinaryDecoder); ok {
- formatCode = BinaryFormatCode
- }
- ci.oidToResultFormatCode[t.OID] = formatCode
- }
-
- if d, ok := t.Value.(TextDecoder); ok {
- t.textDecoder = d
- }
-
- if d, ok := t.Value.(BinaryDecoder); ok {
- t.binaryDecoder = d
- }
-
- ci.reflectTypeToDataType = nil // Invalidated by type registration
-}
-
-// RegisterDefaultPgType registers a mapping of a Go type to a PostgreSQL type name. Typically the data type to be
-// encoded or decoded is determined by the PostgreSQL OID. But if the OID of a value to be encoded or decoded is
-// unknown, this additional mapping will be used by DataTypeForValue to determine a suitable data type.
-func (ci *ConnInfo) RegisterDefaultPgType(value interface{}, name string) {
- ci.reflectTypeToName[reflect.TypeOf(value)] = name
- ci.reflectTypeToDataType = nil // Invalidated by registering a default type
-}
-
-func (ci *ConnInfo) DataTypeForOID(oid uint32) (*DataType, bool) {
- dt, ok := ci.oidToDataType[oid]
- return dt, ok
-}
-
-func (ci *ConnInfo) DataTypeForName(name string) (*DataType, bool) {
- dt, ok := ci.nameToDataType[name]
- return dt, ok
-}
-
-func (ci *ConnInfo) buildReflectTypeToDataType() {
- ci.reflectTypeToDataType = make(map[reflect.Type]*DataType)
-
- for _, dt := range ci.oidToDataType {
- if _, is := dt.Value.(TypeValue); !is {
- ci.reflectTypeToDataType[reflect.ValueOf(dt.Value).Type()] = dt
- }
- }
-
- for reflectType, name := range ci.reflectTypeToName {
- if dt, ok := ci.nameToDataType[name]; ok {
- ci.reflectTypeToDataType[reflectType] = dt
- }
- }
-}
-
-// DataTypeForValue finds a data type suitable for v. Use RegisterDataType to register types that can encode and decode
-// themselves. Use RegisterDefaultPgType to register that can be handled by a registered data type.
-func (ci *ConnInfo) DataTypeForValue(v interface{}) (*DataType, bool) {
- if ci.reflectTypeToDataType == nil {
- ci.buildReflectTypeToDataType()
- }
-
- if tv, ok := v.(TypeValue); ok {
- dt, ok := ci.nameToDataType[tv.TypeName()]
- return dt, ok
- }
-
- dt, ok := ci.reflectTypeToDataType[reflect.TypeOf(v)]
- return dt, ok
-}
-
-func (ci *ConnInfo) ParamFormatCodeForOID(oid uint32) int16 {
- fc, ok := ci.oidToParamFormatCode[oid]
- if ok {
- return fc
- }
- return TextFormatCode
-}
-
-func (ci *ConnInfo) ResultFormatCodeForOID(oid uint32) int16 {
- fc, ok := ci.oidToResultFormatCode[oid]
- if ok {
- return fc
- }
- return TextFormatCode
-}
-
-// DeepCopy makes a deep copy of the ConnInfo.
-func (ci *ConnInfo) DeepCopy() *ConnInfo {
- ci2 := newConnInfo()
-
- for _, dt := range ci.oidToDataType {
- ci2.RegisterDataType(DataType{
- Value: NewValue(dt.Value),
- Name: dt.Name,
- OID: dt.OID,
- })
- }
-
- for t, n := range ci.reflectTypeToName {
- ci2.reflectTypeToName[t] = n
- }
-
- return ci2
-}
-
-// ScanPlan is a precompiled plan to scan into a type of destination.
-type ScanPlan interface {
- // Scan scans src into dst. If the dst type has changed in an incompatible way a ScanPlan should automatically
- // replan and scan.
- Scan(ci *ConnInfo, oid uint32, formatCode int16, src []byte, dst interface{}) error
-}
-
-type scanPlanDstBinaryDecoder struct{}
-
-func (scanPlanDstBinaryDecoder) Scan(ci *ConnInfo, oid uint32, formatCode int16, src []byte, dst interface{}) error {
- if d, ok := (dst).(BinaryDecoder); ok {
- return d.DecodeBinary(ci, src)
- }
-
- newPlan := ci.PlanScan(oid, formatCode, dst)
- return newPlan.Scan(ci, oid, formatCode, src, dst)
-}
-
-type scanPlanDstTextDecoder struct{}
-
-func (plan scanPlanDstTextDecoder) Scan(ci *ConnInfo, oid uint32, formatCode int16, src []byte, dst interface{}) error {
- if d, ok := (dst).(TextDecoder); ok {
- return d.DecodeText(ci, src)
- }
-
- newPlan := ci.PlanScan(oid, formatCode, dst)
- return newPlan.Scan(ci, oid, formatCode, src, dst)
-}
-
-type scanPlanDataTypeSQLScanner DataType
-
-func (plan *scanPlanDataTypeSQLScanner) Scan(ci *ConnInfo, oid uint32, formatCode int16, src []byte, dst interface{}) error {
- scanner, ok := dst.(sql.Scanner)
- if !ok {
- dv := reflect.ValueOf(dst)
- if dv.Kind() != reflect.Ptr || !dv.Type().Elem().Implements(scannerType) {
- newPlan := ci.PlanScan(oid, formatCode, dst)
- return newPlan.Scan(ci, oid, formatCode, src, dst)
- }
- if src == nil {
- // Ensure the pointer points to a zero version of the value
- dv.Elem().Set(reflect.Zero(dv.Type().Elem()))
- return nil
- }
- dv = dv.Elem()
- // If the pointer is to a nil pointer then set that before scanning
- if dv.Kind() == reflect.Ptr && dv.IsNil() {
- dv.Set(reflect.New(dv.Type().Elem()))
- }
- scanner = dv.Interface().(sql.Scanner)
- }
-
- dt := (*DataType)(plan)
- var err error
- switch formatCode {
- case BinaryFormatCode:
- err = dt.binaryDecoder.DecodeBinary(ci, src)
- case TextFormatCode:
- err = dt.textDecoder.DecodeText(ci, src)
- }
- if err != nil {
- return err
- }
-
- sqlSrc, err := DatabaseSQLValue(ci, dt.Value)
- if err != nil {
- return err
- }
- return scanner.Scan(sqlSrc)
-}
-
-type scanPlanDataTypeAssignTo DataType
-
-func (plan *scanPlanDataTypeAssignTo) Scan(ci *ConnInfo, oid uint32, formatCode int16, src []byte, dst interface{}) error {
- dt := (*DataType)(plan)
- var err error
- switch formatCode {
- case BinaryFormatCode:
- err = dt.binaryDecoder.DecodeBinary(ci, src)
- case TextFormatCode:
- err = dt.textDecoder.DecodeText(ci, src)
- }
- if err != nil {
- return err
- }
-
- assignToErr := dt.Value.AssignTo(dst)
- if assignToErr == nil {
- return nil
- }
-
- if dstPtr, ok := dst.(*interface{}); ok {
- *dstPtr = dt.Value.Get()
- return nil
- }
-
- // assignToErr might have failed because the type of destination has changed
- newPlan := ci.PlanScan(oid, formatCode, dst)
- if newPlan, sameType := newPlan.(*scanPlanDataTypeAssignTo); !sameType {
- return newPlan.Scan(ci, oid, formatCode, src, dst)
- }
-
- return assignToErr
-}
-
-type scanPlanSQLScanner struct{}
-
-func (scanPlanSQLScanner) Scan(ci *ConnInfo, oid uint32, formatCode int16, src []byte, dst interface{}) error {
- scanner, ok := dst.(sql.Scanner)
- if !ok {
- dv := reflect.ValueOf(dst)
- if dv.Kind() != reflect.Ptr || !dv.Type().Elem().Implements(scannerType) {
- newPlan := ci.PlanScan(oid, formatCode, dst)
- return newPlan.Scan(ci, oid, formatCode, src, dst)
- }
- if src == nil {
- // Ensure the pointer points to a zero version of the value
- dv.Elem().Set(reflect.Zero(dv.Elem().Type()))
- return nil
- }
- dv = dv.Elem()
- // If the pointer is to a nil pointer then set that before scanning
- if dv.Kind() == reflect.Ptr && dv.IsNil() {
- dv.Set(reflect.New(dv.Type().Elem()))
- }
- scanner = dv.Interface().(sql.Scanner)
- }
- if src == nil {
- // This is necessary because interface value []byte:nil does not equal nil:nil for the binary format path and the
- // text format path would be converted to empty string.
- return scanner.Scan(nil)
- } else if formatCode == BinaryFormatCode {
- return scanner.Scan(src)
- } else {
- return scanner.Scan(string(src))
- }
-}
-
-type scanPlanReflection struct{}
-
-func (scanPlanReflection) Scan(ci *ConnInfo, oid uint32, formatCode int16, src []byte, dst interface{}) error {
- // We might be given a pointer to something that implements the decoder interface(s),
- // even though the pointer itself doesn't.
- refVal := reflect.ValueOf(dst)
- if refVal.Kind() == reflect.Ptr && refVal.Type().Elem().Kind() == reflect.Ptr {
- // If the database returned NULL, then we set dest as nil to indicate that.
- if src == nil {
- nilPtr := reflect.Zero(refVal.Type().Elem())
- refVal.Elem().Set(nilPtr)
- return nil
- }
-
- // We need to allocate an element, and set the destination to it
- // Then we can retry as that element.
- elemPtr := reflect.New(refVal.Type().Elem().Elem())
- refVal.Elem().Set(elemPtr)
-
- plan := ci.PlanScan(oid, formatCode, elemPtr.Interface())
- return plan.Scan(ci, oid, formatCode, src, elemPtr.Interface())
- }
-
- return scanUnknownType(oid, formatCode, src, dst)
-}
-
-type scanPlanBinaryInt16 struct{}
-
-func (scanPlanBinaryInt16) Scan(ci *ConnInfo, oid uint32, formatCode int16, src []byte, dst interface{}) error {
- if src == nil {
- return fmt.Errorf("cannot scan null into %T", dst)
- }
-
- if len(src) != 2 {
- return fmt.Errorf("invalid length for int2: %v", len(src))
- }
-
- if p, ok := (dst).(*int16); ok {
- *p = int16(binary.BigEndian.Uint16(src))
- return nil
- }
-
- newPlan := ci.PlanScan(oid, formatCode, dst)
- return newPlan.Scan(ci, oid, formatCode, src, dst)
-}
-
-type scanPlanBinaryInt32 struct{}
-
-func (scanPlanBinaryInt32) Scan(ci *ConnInfo, oid uint32, formatCode int16, src []byte, dst interface{}) error {
- if src == nil {
- return fmt.Errorf("cannot scan null into %T", dst)
- }
-
- if len(src) != 4 {
- return fmt.Errorf("invalid length for int4: %v", len(src))
- }
-
- if p, ok := (dst).(*int32); ok {
- *p = int32(binary.BigEndian.Uint32(src))
- return nil
- }
-
- newPlan := ci.PlanScan(oid, formatCode, dst)
- return newPlan.Scan(ci, oid, formatCode, src, dst)
-}
-
-type scanPlanBinaryInt64 struct{}
-
-func (scanPlanBinaryInt64) Scan(ci *ConnInfo, oid uint32, formatCode int16, src []byte, dst interface{}) error {
- if src == nil {
- return fmt.Errorf("cannot scan null into %T", dst)
- }
-
- if len(src) != 8 {
- return fmt.Errorf("invalid length for int8: %v", len(src))
- }
-
- if p, ok := (dst).(*int64); ok {
- *p = int64(binary.BigEndian.Uint64(src))
- return nil
- }
-
- newPlan := ci.PlanScan(oid, formatCode, dst)
- return newPlan.Scan(ci, oid, formatCode, src, dst)
-}
-
-type scanPlanBinaryFloat32 struct{}
-
-func (scanPlanBinaryFloat32) Scan(ci *ConnInfo, oid uint32, formatCode int16, src []byte, dst interface{}) error {
- if src == nil {
- return fmt.Errorf("cannot scan null into %T", dst)
- }
-
- if len(src) != 4 {
- return fmt.Errorf("invalid length for int4: %v", len(src))
- }
-
- if p, ok := (dst).(*float32); ok {
- n := int32(binary.BigEndian.Uint32(src))
- *p = float32(math.Float32frombits(uint32(n)))
- return nil
- }
-
- newPlan := ci.PlanScan(oid, formatCode, dst)
- return newPlan.Scan(ci, oid, formatCode, src, dst)
-}
-
-type scanPlanBinaryFloat64 struct{}
-
-func (scanPlanBinaryFloat64) Scan(ci *ConnInfo, oid uint32, formatCode int16, src []byte, dst interface{}) error {
- if src == nil {
- return fmt.Errorf("cannot scan null into %T", dst)
- }
-
- if len(src) != 8 {
- return fmt.Errorf("invalid length for int8: %v", len(src))
- }
-
- if p, ok := (dst).(*float64); ok {
- n := int64(binary.BigEndian.Uint64(src))
- *p = float64(math.Float64frombits(uint64(n)))
- return nil
- }
-
- newPlan := ci.PlanScan(oid, formatCode, dst)
- return newPlan.Scan(ci, oid, formatCode, src, dst)
-}
-
-type scanPlanBinaryBytes struct{}
-
-func (scanPlanBinaryBytes) Scan(ci *ConnInfo, oid uint32, formatCode int16, src []byte, dst interface{}) error {
- if p, ok := (dst).(*[]byte); ok {
- *p = src
- return nil
- }
-
- newPlan := ci.PlanScan(oid, formatCode, dst)
- return newPlan.Scan(ci, oid, formatCode, src, dst)
-}
-
-type scanPlanString struct{}
-
-func (scanPlanString) Scan(ci *ConnInfo, oid uint32, formatCode int16, src []byte, dst interface{}) error {
- if src == nil {
- return fmt.Errorf("cannot scan null into %T", dst)
- }
-
- if p, ok := (dst).(*string); ok {
- *p = string(src)
- return nil
- }
-
- newPlan := ci.PlanScan(oid, formatCode, dst)
- return newPlan.Scan(ci, oid, formatCode, src, dst)
-}
-
-var scannerType = reflect.TypeOf((*sql.Scanner)(nil)).Elem()
-
-func isScanner(dst interface{}) bool {
- if _, ok := dst.(sql.Scanner); ok {
- return true
- }
- if t := reflect.TypeOf(dst); t != nil && t.Kind() == reflect.Ptr && t.Elem().Implements(scannerType) {
- return true
- }
- return false
-}
-
-// PlanScan prepares a plan to scan a value into dst.
-func (ci *ConnInfo) PlanScan(oid uint32, formatCode int16, dst interface{}) ScanPlan {
- switch formatCode {
- case BinaryFormatCode:
- switch dst.(type) {
- case *string:
- switch oid {
- case TextOID, VarcharOID:
- return scanPlanString{}
- }
- case *int16:
- if oid == Int2OID {
- return scanPlanBinaryInt16{}
- }
- case *int32:
- if oid == Int4OID {
- return scanPlanBinaryInt32{}
- }
- case *int64:
- if oid == Int8OID {
- return scanPlanBinaryInt64{}
- }
- case *float32:
- if oid == Float4OID {
- return scanPlanBinaryFloat32{}
- }
- case *float64:
- if oid == Float8OID {
- return scanPlanBinaryFloat64{}
- }
- case *[]byte:
- switch oid {
- case ByteaOID, TextOID, VarcharOID, JSONOID:
- return scanPlanBinaryBytes{}
- }
- case BinaryDecoder:
- return scanPlanDstBinaryDecoder{}
- }
- case TextFormatCode:
- switch dst.(type) {
- case *string:
- return scanPlanString{}
- case *[]byte:
- if oid != ByteaOID {
- return scanPlanBinaryBytes{}
- }
- case TextDecoder:
- return scanPlanDstTextDecoder{}
- }
- }
-
- var dt *DataType
-
- if oid == 0 {
- if dataType, ok := ci.DataTypeForValue(dst); ok {
- dt = dataType
- }
- } else {
- if dataType, ok := ci.DataTypeForOID(oid); ok {
- dt = dataType
- }
- }
-
- if dt != nil {
- if isScanner(dst) {
- return (*scanPlanDataTypeSQLScanner)(dt)
- }
- return (*scanPlanDataTypeAssignTo)(dt)
- }
-
- if isScanner(dst) {
- return scanPlanSQLScanner{}
- }
-
- return scanPlanReflection{}
-}
-
-func (ci *ConnInfo) Scan(oid uint32, formatCode int16, src []byte, dst interface{}) error {
- if dst == nil {
- return nil
- }
-
- plan := ci.PlanScan(oid, formatCode, dst)
- return plan.Scan(ci, oid, formatCode, src, dst)
-}
-
-func scanUnknownType(oid uint32, formatCode int16, buf []byte, dest interface{}) error {
- switch dest := dest.(type) {
- case *string:
- if formatCode == BinaryFormatCode {
- return fmt.Errorf("unknown oid %d in binary format cannot be scanned into %T", oid, dest)
- }
- *dest = string(buf)
- return nil
- case *[]byte:
- *dest = buf
- return nil
- default:
- if nextDst, retry := GetAssignToDstType(dest); retry {
- return scanUnknownType(oid, formatCode, buf, nextDst)
- }
- return fmt.Errorf("unknown oid %d cannot be scanned into %T", oid, dest)
- }
-}
-
-// NewValue returns a new instance of the same type as v.
-func NewValue(v Value) Value {
- if tv, ok := v.(TypeValue); ok {
- return tv.NewTypeValue()
- } else {
- return reflect.New(reflect.ValueOf(v).Elem().Type()).Interface().(Value)
- }
-}
-
-var nameValues map[string]Value
-
-func init() {
- nameValues = map[string]Value{
- "_aclitem": &ACLItemArray{},
- "_bool": &BoolArray{},
- "_bpchar": &BPCharArray{},
- "_bytea": &ByteaArray{},
- "_cidr": &CIDRArray{},
- "_date": &DateArray{},
- "_float4": &Float4Array{},
- "_float8": &Float8Array{},
- "_inet": &InetArray{},
- "_int2": &Int2Array{},
- "_int4": &Int4Array{},
- "_int8": &Int8Array{},
- "_numeric": &NumericArray{},
- "_text": &TextArray{},
- "_timestamp": &TimestampArray{},
- "_timestamptz": &TimestamptzArray{},
- "_uuid": &UUIDArray{},
- "_varchar": &VarcharArray{},
- "_json": &JSONArray{},
- "_jsonb": &JSONBArray{},
- "aclitem": &ACLItem{},
- "bit": &Bit{},
- "bool": &Bool{},
- "box": &Box{},
- "bpchar": &BPChar{},
- "bytea": &Bytea{},
- "char": &QChar{},
- "cid": &CID{},
- "cidr": &CIDR{},
- "circle": &Circle{},
- "date": &Date{},
- "daterange": &Daterange{},
- "float4": &Float4{},
- "float8": &Float8{},
- "hstore": &Hstore{},
- "inet": &Inet{},
- "int2": &Int2{},
- "int4": &Int4{},
- "int4range": &Int4range{},
- "int4multirange": &Int4multirange{},
- "int8": &Int8{},
- "int8range": &Int8range{},
- "int8multirange": &Int8multirange{},
- "interval": &Interval{},
- "json": &JSON{},
- "jsonb": &JSONB{},
- "line": &Line{},
- "lseg": &Lseg{},
- "ltree": &Ltree{},
- "macaddr": &Macaddr{},
- "name": &Name{},
- "numeric": &Numeric{},
- "numrange": &Numrange{},
- "nummultirange": &Nummultirange{},
- "oid": &OIDValue{},
- "path": &Path{},
- "point": &Point{},
- "polygon": &Polygon{},
- "record": &Record{},
- "text": &Text{},
- "tid": &TID{},
- "timestamp": &Timestamp{},
- "timestamptz": &Timestamptz{},
- "tsrange": &Tsrange{},
- "_tsrange": &TsrangeArray{},
- "tstzrange": &Tstzrange{},
- "_tstzrange": &TstzrangeArray{},
- "unknown": &Unknown{},
- "uuid": &UUID{},
- "varbit": &Varbit{},
- "varchar": &Varchar{},
- "xid": &XID{},
- }
-}
diff --git a/vendor/github.com/jackc/pgtype/pguint32.go b/vendor/github.com/jackc/pgtype/pguint32.go
deleted file mode 100644
index a0e88ca..0000000
--- a/vendor/github.com/jackc/pgtype/pguint32.go
+++ /dev/null
@@ -1,162 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "math"
- "strconv"
-
- "github.com/jackc/pgio"
-)
-
-// pguint32 is the core type that is used to implement PostgreSQL types such as
-// CID and XID.
-type pguint32 struct {
- Uint uint32
- Status Status
-}
-
-// Set converts from src to dst. Note that as pguint32 is not a general
-// number type Set does not do automatic type conversion as other number
-// types do.
-func (dst *pguint32) Set(src interface{}) error {
- switch value := src.(type) {
- case int64:
- if value < 0 {
- return fmt.Errorf("%d is less than minimum value for pguint32", value)
- }
- if value > math.MaxUint32 {
- return fmt.Errorf("%d is greater than maximum value for pguint32", value)
- }
- *dst = pguint32{Uint: uint32(value), Status: Present}
- case uint32:
- *dst = pguint32{Uint: value, Status: Present}
- default:
- return fmt.Errorf("cannot convert %v to pguint32", value)
- }
-
- return nil
-}
-
-func (dst pguint32) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst.Uint
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-// AssignTo assigns from src to dst. Note that as pguint32 is not a general number
-// type AssignTo does not do automatic type conversion as other number types do.
-func (src *pguint32) AssignTo(dst interface{}) error {
- switch v := dst.(type) {
- case *uint32:
- if src.Status == Present {
- *v = src.Uint
- } else {
- return fmt.Errorf("cannot assign %v into %T", src, dst)
- }
- case **uint32:
- if src.Status == Present {
- n := src.Uint
- *v = &n
- } else {
- *v = nil
- }
- }
-
- return nil
-}
-
-func (dst *pguint32) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = pguint32{Status: Null}
- return nil
- }
-
- n, err := strconv.ParseUint(string(src), 10, 32)
- if err != nil {
- return err
- }
-
- *dst = pguint32{Uint: uint32(n), Status: Present}
- return nil
-}
-
-func (dst *pguint32) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = pguint32{Status: Null}
- return nil
- }
-
- if len(src) != 4 {
- return fmt.Errorf("invalid length: %v", len(src))
- }
-
- n := binary.BigEndian.Uint32(src)
- *dst = pguint32{Uint: n, Status: Present}
- return nil
-}
-
-func (src pguint32) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- return append(buf, strconv.FormatUint(uint64(src.Uint), 10)...), nil
-}
-
-func (src pguint32) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- return pgio.AppendUint32(buf, src.Uint), nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *pguint32) Scan(src interface{}) error {
- if src == nil {
- *dst = pguint32{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case uint32:
- *dst = pguint32{Uint: src, Status: Present}
- return nil
- case int64:
- *dst = pguint32{Uint: uint32(src), Status: Present}
- return nil
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src pguint32) Value() (driver.Value, error) {
- switch src.Status {
- case Present:
- return int64(src.Uint), nil
- case Null:
- return nil, nil
- default:
- return nil, errUndefined
- }
-}
diff --git a/vendor/github.com/jackc/pgtype/point.go b/vendor/github.com/jackc/pgtype/point.go
deleted file mode 100644
index 0c79910..0000000
--- a/vendor/github.com/jackc/pgtype/point.go
+++ /dev/null
@@ -1,214 +0,0 @@
-package pgtype
-
-import (
- "bytes"
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "math"
- "strconv"
- "strings"
-
- "github.com/jackc/pgio"
-)
-
-type Vec2 struct {
- X float64
- Y float64
-}
-
-type Point struct {
- P Vec2
- Status Status
-}
-
-func (dst *Point) Set(src interface{}) error {
- if src == nil {
- dst.Status = Null
- return nil
- }
- err := fmt.Errorf("cannot convert %v to Point", src)
- var p *Point
- switch value := src.(type) {
- case string:
- p, err = parsePoint([]byte(value))
- case []byte:
- p, err = parsePoint(value)
- default:
- return err
- }
- if err != nil {
- return err
- }
- *dst = *p
- return nil
-}
-
-func parsePoint(src []byte) (*Point, error) {
- if src == nil || bytes.Compare(src, []byte("null")) == 0 {
- return &Point{Status: Null}, nil
- }
-
- if len(src) < 5 {
- return nil, fmt.Errorf("invalid length for point: %v", len(src))
- }
- if src[0] == '"' && src[len(src)-1] == '"' {
- src = src[1 : len(src)-1]
- }
- parts := strings.SplitN(string(src[1:len(src)-1]), ",", 2)
- if len(parts) < 2 {
- return nil, fmt.Errorf("invalid format for point")
- }
-
- x, err := strconv.ParseFloat(parts[0], 64)
- if err != nil {
- return nil, err
- }
-
- y, err := strconv.ParseFloat(parts[1], 64)
- if err != nil {
- return nil, err
- }
-
- return &Point{P: Vec2{x, y}, Status: Present}, nil
-}
-
-func (dst Point) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Point) AssignTo(dst interface{}) error {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
-}
-
-func (dst *Point) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Point{Status: Null}
- return nil
- }
-
- if len(src) < 5 {
- return fmt.Errorf("invalid length for point: %v", len(src))
- }
-
- parts := strings.SplitN(string(src[1:len(src)-1]), ",", 2)
- if len(parts) < 2 {
- return fmt.Errorf("invalid format for point")
- }
-
- x, err := strconv.ParseFloat(parts[0], 64)
- if err != nil {
- return err
- }
-
- y, err := strconv.ParseFloat(parts[1], 64)
- if err != nil {
- return err
- }
-
- *dst = Point{P: Vec2{x, y}, Status: Present}
- return nil
-}
-
-func (dst *Point) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Point{Status: Null}
- return nil
- }
-
- if len(src) != 16 {
- return fmt.Errorf("invalid length for point: %v", len(src))
- }
-
- x := binary.BigEndian.Uint64(src)
- y := binary.BigEndian.Uint64(src[8:])
-
- *dst = Point{
- P: Vec2{math.Float64frombits(x), math.Float64frombits(y)},
- Status: Present,
- }
- return nil
-}
-
-func (src Point) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- return append(buf, fmt.Sprintf(`(%s,%s)`,
- strconv.FormatFloat(src.P.X, 'f', -1, 64),
- strconv.FormatFloat(src.P.Y, 'f', -1, 64),
- )...), nil
-}
-
-func (src Point) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = pgio.AppendUint64(buf, math.Float64bits(src.P.X))
- buf = pgio.AppendUint64(buf, math.Float64bits(src.P.Y))
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Point) Scan(src interface{}) error {
- if src == nil {
- *dst = Point{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Point) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
-
-func (src Point) MarshalJSON() ([]byte, error) {
- switch src.Status {
- case Present:
- var buff bytes.Buffer
- buff.WriteByte('"')
- buff.WriteString(fmt.Sprintf("(%g,%g)", src.P.X, src.P.Y))
- buff.WriteByte('"')
- return buff.Bytes(), nil
- case Null:
- return []byte("null"), nil
- case Undefined:
- return nil, errUndefined
- }
- return nil, errBadStatus
-}
-
-func (dst *Point) UnmarshalJSON(point []byte) error {
- p, err := parsePoint(point)
- if err != nil {
- return err
- }
- *dst = *p
- return nil
-}
diff --git a/vendor/github.com/jackc/pgtype/polygon.go b/vendor/github.com/jackc/pgtype/polygon.go
deleted file mode 100644
index 207cadc..0000000
--- a/vendor/github.com/jackc/pgtype/polygon.go
+++ /dev/null
@@ -1,226 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "math"
- "strconv"
- "strings"
-
- "github.com/jackc/pgio"
-)
-
-type Polygon struct {
- P []Vec2
- Status Status
-}
-
-// Set converts src to dest.
-//
-// src can be nil, string, []float64, and []pgtype.Vec2.
-//
-// If src is string the format must be ((x1,y1),(x2,y2),...,(xn,yn)).
-// Important that there are no spaces in it.
-func (dst *Polygon) Set(src interface{}) error {
- if src == nil {
- dst.Status = Null
- return nil
- }
- err := fmt.Errorf("cannot convert %v to Polygon", src)
- var p *Polygon
- switch value := src.(type) {
- case string:
- p, err = stringToPolygon(value)
- case []Vec2:
- p = &Polygon{Status: Present, P: value}
- err = nil
- case []float64:
- p, err = float64ToPolygon(value)
- default:
- return err
- }
- if err != nil {
- return err
- }
- *dst = *p
- return nil
-}
-
-func stringToPolygon(src string) (*Polygon, error) {
- p := &Polygon{}
- err := p.DecodeText(nil, []byte(src))
- return p, err
-}
-
-func float64ToPolygon(src []float64) (*Polygon, error) {
- p := &Polygon{Status: Null}
- if len(src) == 0 {
- return p, nil
- }
- if len(src)%2 != 0 {
- p.Status = Undefined
- return p, fmt.Errorf("invalid length for polygon: %v", len(src))
- }
- p.Status = Present
- p.P = make([]Vec2, 0)
- for i := 0; i < len(src); i += 2 {
- p.P = append(p.P, Vec2{X: src[i], Y: src[i+1]})
- }
- return p, nil
-}
-
-func (dst Polygon) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Polygon) AssignTo(dst interface{}) error {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
-}
-
-func (dst *Polygon) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Polygon{Status: Null}
- return nil
- }
-
- if len(src) < 7 {
- return fmt.Errorf("invalid length for Polygon: %v", len(src))
- }
-
- points := make([]Vec2, 0)
-
- str := string(src[2:])
-
- for {
- end := strings.IndexByte(str, ',')
- x, err := strconv.ParseFloat(str[:end], 64)
- if err != nil {
- return err
- }
-
- str = str[end+1:]
- end = strings.IndexByte(str, ')')
-
- y, err := strconv.ParseFloat(str[:end], 64)
- if err != nil {
- return err
- }
-
- points = append(points, Vec2{x, y})
-
- if end+3 < len(str) {
- str = str[end+3:]
- } else {
- break
- }
- }
-
- *dst = Polygon{P: points, Status: Present}
- return nil
-}
-
-func (dst *Polygon) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Polygon{Status: Null}
- return nil
- }
-
- if len(src) < 5 {
- return fmt.Errorf("invalid length for Polygon: %v", len(src))
- }
-
- pointCount := int(binary.BigEndian.Uint32(src))
- rp := 4
-
- if 4+pointCount*16 != len(src) {
- return fmt.Errorf("invalid length for Polygon with %d points: %v", pointCount, len(src))
- }
-
- points := make([]Vec2, pointCount)
- for i := 0; i < len(points); i++ {
- x := binary.BigEndian.Uint64(src[rp:])
- rp += 8
- y := binary.BigEndian.Uint64(src[rp:])
- rp += 8
- points[i] = Vec2{math.Float64frombits(x), math.Float64frombits(y)}
- }
-
- *dst = Polygon{
- P: points,
- Status: Present,
- }
- return nil
-}
-
-func (src Polygon) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = append(buf, '(')
-
- for i, p := range src.P {
- if i > 0 {
- buf = append(buf, ',')
- }
- buf = append(buf, fmt.Sprintf(`(%s,%s)`,
- strconv.FormatFloat(p.X, 'f', -1, 64),
- strconv.FormatFloat(p.Y, 'f', -1, 64),
- )...)
- }
-
- return append(buf, ')'), nil
-}
-
-func (src Polygon) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = pgio.AppendInt32(buf, int32(len(src.P)))
-
- for _, p := range src.P {
- buf = pgio.AppendUint64(buf, math.Float64bits(p.X))
- buf = pgio.AppendUint64(buf, math.Float64bits(p.Y))
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Polygon) Scan(src interface{}) error {
- if src == nil {
- *dst = Polygon{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Polygon) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/qchar.go b/vendor/github.com/jackc/pgtype/qchar.go
deleted file mode 100644
index 574f606..0000000
--- a/vendor/github.com/jackc/pgtype/qchar.go
+++ /dev/null
@@ -1,152 +0,0 @@
-package pgtype
-
-import (
- "fmt"
- "math"
- "strconv"
-)
-
-// QChar is for PostgreSQL's special 8-bit-only "char" type more akin to the C
-// language's char type, or Go's byte type. (Note that the name in PostgreSQL
-// itself is "char", in double-quotes, and not char.) It gets used a lot in
-// PostgreSQL's system tables to hold a single ASCII character value (eg
-// pg_class.relkind). It is named Qchar for quoted char to disambiguate from SQL
-// standard type char.
-//
-// Not all possible values of QChar are representable in the text format.
-// Therefore, QChar does not implement TextEncoder and TextDecoder. In
-// addition, database/sql Scanner and database/sql/driver Value are not
-// implemented.
-type QChar struct {
- Int int8
- Status Status
-}
-
-func (dst *QChar) Set(src interface{}) error {
- if src == nil {
- *dst = QChar{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- switch value := src.(type) {
- case int8:
- *dst = QChar{Int: value, Status: Present}
- case uint8:
- if value > math.MaxInt8 {
- return fmt.Errorf("%d is greater than maximum value for QChar", value)
- }
- *dst = QChar{Int: int8(value), Status: Present}
- case int16:
- if value < math.MinInt8 {
- return fmt.Errorf("%d is greater than maximum value for QChar", value)
- }
- if value > math.MaxInt8 {
- return fmt.Errorf("%d is greater than maximum value for QChar", value)
- }
- *dst = QChar{Int: int8(value), Status: Present}
- case uint16:
- if value > math.MaxInt8 {
- return fmt.Errorf("%d is greater than maximum value for QChar", value)
- }
- *dst = QChar{Int: int8(value), Status: Present}
- case int32:
- if value < math.MinInt8 {
- return fmt.Errorf("%d is greater than maximum value for QChar", value)
- }
- if value > math.MaxInt8 {
- return fmt.Errorf("%d is greater than maximum value for QChar", value)
- }
- *dst = QChar{Int: int8(value), Status: Present}
- case uint32:
- if value > math.MaxInt8 {
- return fmt.Errorf("%d is greater than maximum value for QChar", value)
- }
- *dst = QChar{Int: int8(value), Status: Present}
- case int64:
- if value < math.MinInt8 {
- return fmt.Errorf("%d is greater than maximum value for QChar", value)
- }
- if value > math.MaxInt8 {
- return fmt.Errorf("%d is greater than maximum value for QChar", value)
- }
- *dst = QChar{Int: int8(value), Status: Present}
- case uint64:
- if value > math.MaxInt8 {
- return fmt.Errorf("%d is greater than maximum value for QChar", value)
- }
- *dst = QChar{Int: int8(value), Status: Present}
- case int:
- if value < math.MinInt8 {
- return fmt.Errorf("%d is greater than maximum value for QChar", value)
- }
- if value > math.MaxInt8 {
- return fmt.Errorf("%d is greater than maximum value for QChar", value)
- }
- *dst = QChar{Int: int8(value), Status: Present}
- case uint:
- if value > math.MaxInt8 {
- return fmt.Errorf("%d is greater than maximum value for QChar", value)
- }
- *dst = QChar{Int: int8(value), Status: Present}
- case string:
- num, err := strconv.ParseInt(value, 10, 8)
- if err != nil {
- return err
- }
- *dst = QChar{Int: int8(num), Status: Present}
- default:
- if originalSrc, ok := underlyingNumberType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to QChar", value)
- }
-
- return nil
-}
-
-func (dst QChar) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst.Int
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *QChar) AssignTo(dst interface{}) error {
- return int64AssignTo(int64(src.Int), src.Status, dst)
-}
-
-func (dst *QChar) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = QChar{Status: Null}
- return nil
- }
-
- if len(src) != 1 {
- return fmt.Errorf(`invalid length for "char": %v`, len(src))
- }
-
- *dst = QChar{Int: int8(src[0]), Status: Present}
- return nil
-}
-
-func (src QChar) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- return append(buf, byte(src.Int)), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/record.go b/vendor/github.com/jackc/pgtype/record.go
deleted file mode 100644
index 5cf2c93..0000000
--- a/vendor/github.com/jackc/pgtype/record.go
+++ /dev/null
@@ -1,126 +0,0 @@
-package pgtype
-
-import (
- "fmt"
- "reflect"
-)
-
-// Record is the generic PostgreSQL record type such as is created with the
-// "row" function. Record only implements BinaryDecoder and Value. The text
-// format output format from PostgreSQL does not include type information and is
-// therefore impossible to decode. No encoders are implemented because
-// PostgreSQL does not support input of generic records.
-type Record struct {
- Fields []Value
- Status Status
-}
-
-func (dst *Record) Set(src interface{}) error {
- if src == nil {
- *dst = Record{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- switch value := src.(type) {
- case []Value:
- *dst = Record{Fields: value, Status: Present}
- default:
- return fmt.Errorf("cannot convert %v to Record", src)
- }
-
- return nil
-}
-
-func (dst Record) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst.Fields
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Record) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- switch v := dst.(type) {
- case *[]Value:
- *v = make([]Value, len(src.Fields))
- copy(*v, src.Fields)
- return nil
- case *[]interface{}:
- *v = make([]interface{}, len(src.Fields))
- for i := range *v {
- (*v)[i] = src.Fields[i].Get()
- }
- return nil
- default:
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
- return fmt.Errorf("unable to assign to %T", dst)
- }
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func prepareNewBinaryDecoder(ci *ConnInfo, fieldOID uint32, v *Value) (BinaryDecoder, error) {
- var binaryDecoder BinaryDecoder
-
- if dt, ok := ci.DataTypeForOID(fieldOID); ok {
- binaryDecoder, _ = dt.Value.(BinaryDecoder)
- } else {
- return nil, fmt.Errorf("unknown oid while decoding record: %v", fieldOID)
- }
-
- if binaryDecoder == nil {
- return nil, fmt.Errorf("no binary decoder registered for: %v", fieldOID)
- }
-
- // Duplicate struct to scan into
- binaryDecoder = reflect.New(reflect.ValueOf(binaryDecoder).Elem().Type()).Interface().(BinaryDecoder)
- *v = binaryDecoder.(Value)
- return binaryDecoder, nil
-}
-
-func (dst *Record) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Record{Status: Null}
- return nil
- }
-
- scanner := NewCompositeBinaryScanner(ci, src)
-
- fields := make([]Value, scanner.FieldCount())
-
- for i := 0; scanner.Next(); i++ {
- binaryDecoder, err := prepareNewBinaryDecoder(ci, scanner.OID(), &fields[i])
- if err != nil {
- return err
- }
-
- if err = binaryDecoder.DecodeBinary(ci, scanner.Bytes()); err != nil {
- return err
- }
- }
-
- if scanner.Err() != nil {
- return scanner.Err()
- }
-
- *dst = Record{Fields: fields, Status: Present}
-
- return nil
-}
diff --git a/vendor/github.com/jackc/pgtype/record_array.go b/vendor/github.com/jackc/pgtype/record_array.go
deleted file mode 100644
index 2271717..0000000
--- a/vendor/github.com/jackc/pgtype/record_array.go
+++ /dev/null
@@ -1,318 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "encoding/binary"
- "fmt"
- "reflect"
-)
-
-type RecordArray struct {
- Elements []Record
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *RecordArray) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = RecordArray{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case [][]Value:
- if value == nil {
- *dst = RecordArray{Status: Null}
- } else if len(value) == 0 {
- *dst = RecordArray{Status: Present}
- } else {
- elements := make([]Record, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = RecordArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []Record:
- if value == nil {
- *dst = RecordArray{Status: Null}
- } else if len(value) == 0 {
- *dst = RecordArray{Status: Present}
- } else {
- *dst = RecordArray{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = RecordArray{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for RecordArray", src)
- }
- if elementsLength == 0 {
- *dst = RecordArray{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to RecordArray", src)
- }
-
- *dst = RecordArray{
- Elements: make([]Record, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]Record, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to RecordArray, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *RecordArray) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to RecordArray")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in RecordArray", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst RecordArray) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *RecordArray) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[][]Value:
- *v = make([][]Value, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *RecordArray) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from RecordArray")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from RecordArray")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *RecordArray) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = RecordArray{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = RecordArray{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]Record, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = RecordArray{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
diff --git a/vendor/github.com/jackc/pgtype/text.go b/vendor/github.com/jackc/pgtype/text.go
deleted file mode 100644
index a01815d..0000000
--- a/vendor/github.com/jackc/pgtype/text.go
+++ /dev/null
@@ -1,212 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/json"
- "fmt"
-)
-
-type Text struct {
- String string
- Status Status
-}
-
-func (dst *Text) Set(src interface{}) error {
- if src == nil {
- *dst = Text{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- switch value := src.(type) {
- case string:
- *dst = Text{String: value, Status: Present}
- case *string:
- if value == nil {
- *dst = Text{Status: Null}
- } else {
- *dst = Text{String: *value, Status: Present}
- }
- case []byte:
- if value == nil {
- *dst = Text{Status: Null}
- } else {
- *dst = Text{String: string(value), Status: Present}
- }
- case fmt.Stringer:
- if value == fmt.Stringer(nil) {
- *dst = Text{Status: Null}
- } else {
- *dst = Text{String: value.String(), Status: Present}
- }
- default:
- // Cannot be part of the switch: If Value() returns nil on
- // non-string, we should still try to checks the underlying type
- // using reflection.
- //
- // For example the struct might implement driver.Valuer with
- // pointer receiver and fmt.Stringer with value receiver.
- if value, ok := src.(driver.Valuer); ok {
- if value == driver.Valuer(nil) {
- *dst = Text{Status: Null}
- return nil
- } else {
- v, err := value.Value()
- if err != nil {
- return fmt.Errorf("driver.Valuer Value() method failed: %w", err)
- }
-
- // Handles also v == nil case.
- if s, ok := v.(string); ok {
- *dst = Text{String: s, Status: Present}
- return nil
- }
- }
- }
-
- if originalSrc, ok := underlyingStringType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to Text", value)
- }
-
- return nil
-}
-
-func (dst Text) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst.String
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Text) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- switch v := dst.(type) {
- case *string:
- *v = src.String
- return nil
- case *[]byte:
- *v = make([]byte, len(src.String))
- copy(*v, src.String)
- return nil
- default:
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
- return fmt.Errorf("unable to assign to %T", dst)
- }
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (Text) PreferredResultFormat() int16 {
- return TextFormatCode
-}
-
-func (dst *Text) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Text{Status: Null}
- return nil
- }
-
- *dst = Text{String: string(src), Status: Present}
- return nil
-}
-
-func (dst *Text) DecodeBinary(ci *ConnInfo, src []byte) error {
- return dst.DecodeText(ci, src)
-}
-
-func (Text) PreferredParamFormat() int16 {
- return TextFormatCode
-}
-
-func (src Text) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- return append(buf, src.String...), nil
-}
-
-func (src Text) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- return src.EncodeText(ci, buf)
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Text) Scan(src interface{}) error {
- if src == nil {
- *dst = Text{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Text) Value() (driver.Value, error) {
- switch src.Status {
- case Present:
- return src.String, nil
- case Null:
- return nil, nil
- default:
- return nil, errUndefined
- }
-}
-
-func (src Text) MarshalJSON() ([]byte, error) {
- switch src.Status {
- case Present:
- return json.Marshal(src.String)
- case Null:
- return []byte("null"), nil
- case Undefined:
- return nil, errUndefined
- }
-
- return nil, errBadStatus
-}
-
-func (dst *Text) UnmarshalJSON(b []byte) error {
- var s *string
- err := json.Unmarshal(b, &s)
- if err != nil {
- return err
- }
-
- if s == nil {
- *dst = Text{Status: Null}
- } else {
- *dst = Text{String: *s, Status: Present}
- }
-
- return nil
-}
diff --git a/vendor/github.com/jackc/pgtype/text_array.go b/vendor/github.com/jackc/pgtype/text_array.go
deleted file mode 100644
index 2461966..0000000
--- a/vendor/github.com/jackc/pgtype/text_array.go
+++ /dev/null
@@ -1,517 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "reflect"
-
- "github.com/jackc/pgio"
-)
-
-type TextArray struct {
- Elements []Text
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *TextArray) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = TextArray{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []string:
- if value == nil {
- *dst = TextArray{Status: Null}
- } else if len(value) == 0 {
- *dst = TextArray{Status: Present}
- } else {
- elements := make([]Text, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = TextArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*string:
- if value == nil {
- *dst = TextArray{Status: Null}
- } else if len(value) == 0 {
- *dst = TextArray{Status: Present}
- } else {
- elements := make([]Text, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = TextArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []Text:
- if value == nil {
- *dst = TextArray{Status: Null}
- } else if len(value) == 0 {
- *dst = TextArray{Status: Present}
- } else {
- *dst = TextArray{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = TextArray{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for TextArray", src)
- }
- if elementsLength == 0 {
- *dst = TextArray{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to TextArray", src)
- }
-
- *dst = TextArray{
- Elements: make([]Text, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]Text, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to TextArray, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *TextArray) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to TextArray")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in TextArray", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst TextArray) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *TextArray) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]string:
- *v = make([]string, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*string:
- *v = make([]*string, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *TextArray) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from TextArray")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from TextArray")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *TextArray) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = TextArray{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []Text
-
- if len(uta.Elements) > 0 {
- elements = make([]Text, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem Text
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = TextArray{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *TextArray) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = TextArray{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = TextArray{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]Text, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = TextArray{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src TextArray) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src TextArray) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("text"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "text")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *TextArray) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src TextArray) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/tid.go b/vendor/github.com/jackc/pgtype/tid.go
deleted file mode 100644
index 4bb57f6..0000000
--- a/vendor/github.com/jackc/pgtype/tid.go
+++ /dev/null
@@ -1,156 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "strconv"
- "strings"
-
- "github.com/jackc/pgio"
-)
-
-// TID is PostgreSQL's Tuple Identifier type.
-//
-// When one does
-//
-// select ctid, * from some_table;
-//
-// it is the data type of the ctid hidden system column.
-//
-// It is currently implemented as a pair unsigned two byte integers.
-// Its conversion functions can be found in src/backend/utils/adt/tid.c
-// in the PostgreSQL sources.
-type TID struct {
- BlockNumber uint32
- OffsetNumber uint16
- Status Status
-}
-
-func (dst *TID) Set(src interface{}) error {
- return fmt.Errorf("cannot convert %v to TID", src)
-}
-
-func (dst TID) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *TID) AssignTo(dst interface{}) error {
- if src.Status == Present {
- switch v := dst.(type) {
- case *string:
- *v = fmt.Sprintf(`(%d,%d)`, src.BlockNumber, src.OffsetNumber)
- return nil
- default:
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
- return fmt.Errorf("unable to assign to %T", dst)
- }
- }
-
- return fmt.Errorf("cannot assign %v to %T", src, dst)
-}
-
-func (dst *TID) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = TID{Status: Null}
- return nil
- }
-
- if len(src) < 5 {
- return fmt.Errorf("invalid length for tid: %v", len(src))
- }
-
- parts := strings.SplitN(string(src[1:len(src)-1]), ",", 2)
- if len(parts) < 2 {
- return fmt.Errorf("invalid format for tid")
- }
-
- blockNumber, err := strconv.ParseUint(parts[0], 10, 32)
- if err != nil {
- return err
- }
-
- offsetNumber, err := strconv.ParseUint(parts[1], 10, 16)
- if err != nil {
- return err
- }
-
- *dst = TID{BlockNumber: uint32(blockNumber), OffsetNumber: uint16(offsetNumber), Status: Present}
- return nil
-}
-
-func (dst *TID) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = TID{Status: Null}
- return nil
- }
-
- if len(src) != 6 {
- return fmt.Errorf("invalid length for tid: %v", len(src))
- }
-
- *dst = TID{
- BlockNumber: binary.BigEndian.Uint32(src),
- OffsetNumber: binary.BigEndian.Uint16(src[4:]),
- Status: Present,
- }
- return nil
-}
-
-func (src TID) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = append(buf, fmt.Sprintf(`(%d,%d)`, src.BlockNumber, src.OffsetNumber)...)
- return buf, nil
-}
-
-func (src TID) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = pgio.AppendUint32(buf, src.BlockNumber)
- buf = pgio.AppendUint16(buf, src.OffsetNumber)
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *TID) Scan(src interface{}) error {
- if src == nil {
- *dst = TID{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src TID) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/time.go b/vendor/github.com/jackc/pgtype/time.go
deleted file mode 100644
index f7a2887..0000000
--- a/vendor/github.com/jackc/pgtype/time.go
+++ /dev/null
@@ -1,231 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "strconv"
- "time"
-
- "github.com/jackc/pgio"
-)
-
-// Time represents the PostgreSQL time type. The PostgreSQL time is a time of day without time zone.
-//
-// Time is represented as the number of microseconds since midnight in the same way that PostgreSQL does. Other time
-// and date types in pgtype can use time.Time as the underlying representation. However, pgtype.Time type cannot due
-// to needing to handle 24:00:00. time.Time converts that to 00:00:00 on the following day.
-type Time struct {
- Microseconds int64 // Number of microseconds since midnight
- Status Status
-}
-
-// Set converts src into a Time and stores in dst.
-func (dst *Time) Set(src interface{}) error {
- if src == nil {
- *dst = Time{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- switch value := src.(type) {
- case time.Time:
- usec := int64(value.Hour())*microsecondsPerHour +
- int64(value.Minute())*microsecondsPerMinute +
- int64(value.Second())*microsecondsPerSecond +
- int64(value.Nanosecond())/1000
- *dst = Time{Microseconds: usec, Status: Present}
- case *time.Time:
- if value == nil {
- *dst = Time{Status: Null}
- } else {
- return dst.Set(*value)
- }
- default:
- if originalSrc, ok := underlyingTimeType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to Time", value)
- }
-
- return nil
-}
-
-func (dst Time) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst.Microseconds
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Time) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- switch v := dst.(type) {
- case *time.Time:
- // 24:00:00 is max allowed time in PostgreSQL, but time.Time will normalize that to 00:00:00 the next day.
- var maxRepresentableByTime int64 = 24*60*60*1000000 - 1
- if src.Microseconds > maxRepresentableByTime {
- return fmt.Errorf("%d microseconds cannot be represented as time.Time", src.Microseconds)
- }
-
- usec := src.Microseconds
- hours := usec / microsecondsPerHour
- usec -= hours * microsecondsPerHour
- minutes := usec / microsecondsPerMinute
- usec -= minutes * microsecondsPerMinute
- seconds := usec / microsecondsPerSecond
- usec -= seconds * microsecondsPerSecond
- ns := usec * 1000
- *v = time.Date(2000, 1, 1, int(hours), int(minutes), int(seconds), int(ns), time.UTC)
- return nil
- default:
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
- return fmt.Errorf("unable to assign to %T", dst)
- }
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-// DecodeText decodes from src into dst.
-func (dst *Time) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Time{Status: Null}
- return nil
- }
-
- s := string(src)
-
- if len(s) < 8 {
- return fmt.Errorf("cannot decode %v into Time", s)
- }
-
- hours, err := strconv.ParseInt(s[0:2], 10, 64)
- if err != nil {
- return fmt.Errorf("cannot decode %v into Time", s)
- }
- usec := hours * microsecondsPerHour
-
- minutes, err := strconv.ParseInt(s[3:5], 10, 64)
- if err != nil {
- return fmt.Errorf("cannot decode %v into Time", s)
- }
- usec += minutes * microsecondsPerMinute
-
- seconds, err := strconv.ParseInt(s[6:8], 10, 64)
- if err != nil {
- return fmt.Errorf("cannot decode %v into Time", s)
- }
- usec += seconds * microsecondsPerSecond
-
- if len(s) > 9 {
- fraction := s[9:]
- n, err := strconv.ParseInt(fraction, 10, 64)
- if err != nil {
- return fmt.Errorf("cannot decode %v into Time", s)
- }
-
- for i := len(fraction); i < 6; i++ {
- n *= 10
- }
-
- usec += n
- }
-
- *dst = Time{Microseconds: usec, Status: Present}
-
- return nil
-}
-
-// DecodeBinary decodes from src into dst.
-func (dst *Time) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Time{Status: Null}
- return nil
- }
-
- if len(src) != 8 {
- return fmt.Errorf("invalid length for time: %v", len(src))
- }
-
- usec := int64(binary.BigEndian.Uint64(src))
- *dst = Time{Microseconds: usec, Status: Present}
-
- return nil
-}
-
-// EncodeText writes the text encoding of src into w.
-func (src Time) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- usec := src.Microseconds
- hours := usec / microsecondsPerHour
- usec -= hours * microsecondsPerHour
- minutes := usec / microsecondsPerMinute
- usec -= minutes * microsecondsPerMinute
- seconds := usec / microsecondsPerSecond
- usec -= seconds * microsecondsPerSecond
-
- s := fmt.Sprintf("%02d:%02d:%02d.%06d", hours, minutes, seconds, usec)
-
- return append(buf, s...), nil
-}
-
-// EncodeBinary writes the binary encoding of src into w. If src.Time is not in
-// the UTC time zone it returns an error.
-func (src Time) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- return pgio.AppendInt64(buf, src.Microseconds), nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Time) Scan(src interface{}) error {
- if src == nil {
- *dst = Time{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- case time.Time:
- return dst.Set(src)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Time) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/timestamp.go b/vendor/github.com/jackc/pgtype/timestamp.go
deleted file mode 100644
index fce490c..0000000
--- a/vendor/github.com/jackc/pgtype/timestamp.go
+++ /dev/null
@@ -1,261 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "strings"
- "time"
-
- "github.com/jackc/pgio"
-)
-
-const pgTimestampFormat = "2006-01-02 15:04:05.999999999"
-
-// Timestamp represents the PostgreSQL timestamp type. The PostgreSQL
-// timestamp does not have a time zone. This presents a problem when
-// translating to and from time.Time which requires a time zone. It is highly
-// recommended to use timestamptz whenever possible. Timestamp methods either
-// convert to UTC or return an error on non-UTC times.
-type Timestamp struct {
- Time time.Time // Time must always be in UTC.
- Status Status
- InfinityModifier InfinityModifier
-}
-
-// Set converts src into a Timestamp and stores in dst. If src is a
-// time.Time in a non-UTC time zone, the time zone is discarded.
-func (dst *Timestamp) Set(src interface{}) error {
- if src == nil {
- *dst = Timestamp{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- switch value := src.(type) {
- case time.Time:
- *dst = Timestamp{Time: time.Date(value.Year(), value.Month(), value.Day(), value.Hour(), value.Minute(), value.Second(), value.Nanosecond(), time.UTC), Status: Present}
- case *time.Time:
- if value == nil {
- *dst = Timestamp{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case string:
- return dst.DecodeText(nil, []byte(value))
- case *string:
- if value == nil {
- *dst = Timestamp{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case InfinityModifier:
- *dst = Timestamp{InfinityModifier: value, Status: Present}
- default:
- if originalSrc, ok := underlyingTimeType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to Timestamp", value)
- }
-
- return nil
-}
-
-func (dst Timestamp) Get() interface{} {
- switch dst.Status {
- case Present:
- if dst.InfinityModifier != None {
- return dst.InfinityModifier
- }
- return dst.Time
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Timestamp) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- switch v := dst.(type) {
- case *time.Time:
- if src.InfinityModifier != None {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
- }
- *v = src.Time
- return nil
- default:
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
- return fmt.Errorf("unable to assign to %T", dst)
- }
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-// DecodeText decodes from src into dst. The decoded time is considered to
-// be in UTC.
-func (dst *Timestamp) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Timestamp{Status: Null}
- return nil
- }
-
- sbuf := string(src)
- switch sbuf {
- case "infinity":
- *dst = Timestamp{Status: Present, InfinityModifier: Infinity}
- case "-infinity":
- *dst = Timestamp{Status: Present, InfinityModifier: -Infinity}
- default:
- if strings.HasSuffix(sbuf, " BC") {
- t, err := time.Parse(pgTimestampFormat, strings.TrimRight(sbuf, " BC"))
- t2 := time.Date(1-t.Year(), t.Month(), t.Day(), t.Hour(), t.Minute(), t.Second(), t.Nanosecond(), t.Location())
- if err != nil {
- return err
- }
- *dst = Timestamp{Time: t2, Status: Present}
- return nil
- }
- tim, err := time.Parse(pgTimestampFormat, sbuf)
- if err != nil {
- return err
- }
-
- *dst = Timestamp{Time: tim, Status: Present}
- }
-
- return nil
-}
-
-// DecodeBinary decodes from src into dst. The decoded time is considered to
-// be in UTC.
-func (dst *Timestamp) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Timestamp{Status: Null}
- return nil
- }
-
- if len(src) != 8 {
- return fmt.Errorf("invalid length for timestamp: %v", len(src))
- }
-
- microsecSinceY2K := int64(binary.BigEndian.Uint64(src))
-
- switch microsecSinceY2K {
- case infinityMicrosecondOffset:
- *dst = Timestamp{Status: Present, InfinityModifier: Infinity}
- case negativeInfinityMicrosecondOffset:
- *dst = Timestamp{Status: Present, InfinityModifier: -Infinity}
- default:
- tim := time.Unix(
- microsecFromUnixEpochToY2K/1000000+microsecSinceY2K/1000000,
- (microsecFromUnixEpochToY2K%1000000*1000)+(microsecSinceY2K%1000000*1000),
- ).UTC()
- *dst = Timestamp{Time: tim, Status: Present}
- }
-
- return nil
-}
-
-// EncodeText writes the text encoding of src into w. If src.Time is not in
-// the UTC time zone it returns an error.
-func (src Timestamp) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
- if src.Time.Location() != time.UTC {
- return nil, fmt.Errorf("cannot encode non-UTC time into timestamp")
- }
-
- var s string
-
- switch src.InfinityModifier {
- case None:
- s = src.Time.Truncate(time.Microsecond).Format(pgTimestampFormat)
- case Infinity:
- s = "infinity"
- case NegativeInfinity:
- s = "-infinity"
- }
-
- return append(buf, s...), nil
-}
-
-// EncodeBinary writes the binary encoding of src into w. If src.Time is not in
-// the UTC time zone it returns an error.
-func (src Timestamp) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
- if src.Time.Location() != time.UTC {
- return nil, fmt.Errorf("cannot encode non-UTC time into timestamp")
- }
-
- var microsecSinceY2K int64
- switch src.InfinityModifier {
- case None:
- microsecSinceUnixEpoch := src.Time.Unix()*1000000 + int64(src.Time.Nanosecond())/1000
- microsecSinceY2K = microsecSinceUnixEpoch - microsecFromUnixEpochToY2K
- case Infinity:
- microsecSinceY2K = infinityMicrosecondOffset
- case NegativeInfinity:
- microsecSinceY2K = negativeInfinityMicrosecondOffset
- }
-
- return pgio.AppendInt64(buf, microsecSinceY2K), nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Timestamp) Scan(src interface{}) error {
- if src == nil {
- *dst = Timestamp{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- case time.Time:
- *dst = Timestamp{Time: src, Status: Present}
- return nil
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Timestamp) Value() (driver.Value, error) {
- switch src.Status {
- case Present:
- if src.InfinityModifier != None {
- return src.InfinityModifier.String(), nil
- }
- return src.Time, nil
- case Null:
- return nil, nil
- default:
- return nil, errUndefined
- }
-}
diff --git a/vendor/github.com/jackc/pgtype/timestamp_array.go b/vendor/github.com/jackc/pgtype/timestamp_array.go
deleted file mode 100644
index e12481e..0000000
--- a/vendor/github.com/jackc/pgtype/timestamp_array.go
+++ /dev/null
@@ -1,518 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "reflect"
- "time"
-
- "github.com/jackc/pgio"
-)
-
-type TimestampArray struct {
- Elements []Timestamp
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *TimestampArray) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = TimestampArray{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []time.Time:
- if value == nil {
- *dst = TimestampArray{Status: Null}
- } else if len(value) == 0 {
- *dst = TimestampArray{Status: Present}
- } else {
- elements := make([]Timestamp, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = TimestampArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*time.Time:
- if value == nil {
- *dst = TimestampArray{Status: Null}
- } else if len(value) == 0 {
- *dst = TimestampArray{Status: Present}
- } else {
- elements := make([]Timestamp, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = TimestampArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []Timestamp:
- if value == nil {
- *dst = TimestampArray{Status: Null}
- } else if len(value) == 0 {
- *dst = TimestampArray{Status: Present}
- } else {
- *dst = TimestampArray{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = TimestampArray{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for TimestampArray", src)
- }
- if elementsLength == 0 {
- *dst = TimestampArray{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to TimestampArray", src)
- }
-
- *dst = TimestampArray{
- Elements: make([]Timestamp, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]Timestamp, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to TimestampArray, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *TimestampArray) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to TimestampArray")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in TimestampArray", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst TimestampArray) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *TimestampArray) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]time.Time:
- *v = make([]time.Time, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*time.Time:
- *v = make([]*time.Time, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *TimestampArray) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from TimestampArray")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from TimestampArray")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *TimestampArray) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = TimestampArray{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []Timestamp
-
- if len(uta.Elements) > 0 {
- elements = make([]Timestamp, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem Timestamp
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = TimestampArray{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *TimestampArray) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = TimestampArray{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = TimestampArray{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]Timestamp, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = TimestampArray{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src TimestampArray) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src TimestampArray) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("timestamp"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "timestamp")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *TimestampArray) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src TimestampArray) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/timestamptz.go b/vendor/github.com/jackc/pgtype/timestamptz.go
deleted file mode 100644
index 72ae499..0000000
--- a/vendor/github.com/jackc/pgtype/timestamptz.go
+++ /dev/null
@@ -1,322 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "encoding/json"
- "fmt"
- "time"
-
- "github.com/jackc/pgio"
-)
-
-const pgTimestamptzHourFormat = "2006-01-02 15:04:05.999999999Z07"
-const pgTimestamptzMinuteFormat = "2006-01-02 15:04:05.999999999Z07:00"
-const pgTimestamptzSecondFormat = "2006-01-02 15:04:05.999999999Z07:00:00"
-const microsecFromUnixEpochToY2K = 946684800 * 1000000
-
-const (
- negativeInfinityMicrosecondOffset = -9223372036854775808
- infinityMicrosecondOffset = 9223372036854775807
-)
-
-type Timestamptz struct {
- Time time.Time
- Status Status
- InfinityModifier InfinityModifier
-}
-
-func (dst *Timestamptz) Set(src interface{}) error {
- if src == nil {
- *dst = Timestamptz{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- switch value := src.(type) {
- case time.Time:
- *dst = Timestamptz{Time: value, Status: Present}
- case *time.Time:
- if value == nil {
- *dst = Timestamptz{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case string:
- return dst.DecodeText(nil, []byte(value))
- case *string:
- if value == nil {
- *dst = Timestamptz{Status: Null}
- } else {
- return dst.Set(*value)
- }
- case InfinityModifier:
- *dst = Timestamptz{InfinityModifier: value, Status: Present}
- default:
- if originalSrc, ok := underlyingTimeType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to Timestamptz", value)
- }
-
- return nil
-}
-
-func (dst Timestamptz) Get() interface{} {
- switch dst.Status {
- case Present:
- if dst.InfinityModifier != None {
- return dst.InfinityModifier
- }
- return dst.Time
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Timestamptz) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- switch v := dst.(type) {
- case *time.Time:
- if src.InfinityModifier != None {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
- }
- *v = src.Time
- return nil
- default:
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
- return fmt.Errorf("unable to assign to %T", dst)
- }
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (dst *Timestamptz) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Timestamptz{Status: Null}
- return nil
- }
-
- sbuf := string(src)
- switch sbuf {
- case "infinity":
- *dst = Timestamptz{Status: Present, InfinityModifier: Infinity}
- case "-infinity":
- *dst = Timestamptz{Status: Present, InfinityModifier: -Infinity}
- default:
- var format string
- if len(sbuf) >= 9 && (sbuf[len(sbuf)-9] == '-' || sbuf[len(sbuf)-9] == '+') {
- format = pgTimestamptzSecondFormat
- } else if len(sbuf) >= 6 && (sbuf[len(sbuf)-6] == '-' || sbuf[len(sbuf)-6] == '+') {
- format = pgTimestamptzMinuteFormat
- } else {
- format = pgTimestamptzHourFormat
- }
-
- tim, err := time.Parse(format, sbuf)
- if err != nil {
- return err
- }
-
- *dst = Timestamptz{Time: normalizePotentialUTC(tim), Status: Present}
- }
-
- return nil
-}
-
-func (dst *Timestamptz) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Timestamptz{Status: Null}
- return nil
- }
-
- if len(src) != 8 {
- return fmt.Errorf("invalid length for timestamptz: %v", len(src))
- }
-
- microsecSinceY2K := int64(binary.BigEndian.Uint64(src))
-
- switch microsecSinceY2K {
- case infinityMicrosecondOffset:
- *dst = Timestamptz{Status: Present, InfinityModifier: Infinity}
- case negativeInfinityMicrosecondOffset:
- *dst = Timestamptz{Status: Present, InfinityModifier: -Infinity}
- default:
- tim := time.Unix(
- microsecFromUnixEpochToY2K/1000000+microsecSinceY2K/1000000,
- (microsecFromUnixEpochToY2K%1000000*1000)+(microsecSinceY2K%1000000*1000),
- )
- *dst = Timestamptz{Time: tim, Status: Present}
- }
-
- return nil
-}
-
-func (src Timestamptz) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- var s string
-
- switch src.InfinityModifier {
- case None:
- s = src.Time.UTC().Truncate(time.Microsecond).Format(pgTimestamptzSecondFormat)
- case Infinity:
- s = "infinity"
- case NegativeInfinity:
- s = "-infinity"
- }
-
- return append(buf, s...), nil
-}
-
-func (src Timestamptz) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- var microsecSinceY2K int64
- switch src.InfinityModifier {
- case None:
- microsecSinceUnixEpoch := src.Time.Unix()*1000000 + int64(src.Time.Nanosecond())/1000
- microsecSinceY2K = microsecSinceUnixEpoch - microsecFromUnixEpochToY2K
- case Infinity:
- microsecSinceY2K = infinityMicrosecondOffset
- case NegativeInfinity:
- microsecSinceY2K = negativeInfinityMicrosecondOffset
- }
-
- return pgio.AppendInt64(buf, microsecSinceY2K), nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Timestamptz) Scan(src interface{}) error {
- if src == nil {
- *dst = Timestamptz{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- case time.Time:
- *dst = Timestamptz{Time: src, Status: Present}
- return nil
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Timestamptz) Value() (driver.Value, error) {
- switch src.Status {
- case Present:
- if src.InfinityModifier != None {
- return src.InfinityModifier.String(), nil
- }
- if src.Time.Location().String() == time.UTC.String() {
- return src.Time.UTC(), nil
- }
- return src.Time, nil
- case Null:
- return nil, nil
- default:
- return nil, errUndefined
- }
-}
-
-func (src Timestamptz) MarshalJSON() ([]byte, error) {
- switch src.Status {
- case Null:
- return []byte("null"), nil
- case Undefined:
- return nil, errUndefined
- }
-
- if src.Status != Present {
- return nil, errBadStatus
- }
-
- var s string
-
- switch src.InfinityModifier {
- case None:
- s = src.Time.Format(time.RFC3339Nano)
- case Infinity:
- s = "infinity"
- case NegativeInfinity:
- s = "-infinity"
- }
-
- return json.Marshal(s)
-}
-
-func (dst *Timestamptz) UnmarshalJSON(b []byte) error {
- var s *string
- err := json.Unmarshal(b, &s)
- if err != nil {
- return err
- }
-
- if s == nil {
- *dst = Timestamptz{Status: Null}
- return nil
- }
-
- switch *s {
- case "infinity":
- *dst = Timestamptz{Status: Present, InfinityModifier: Infinity}
- case "-infinity":
- *dst = Timestamptz{Status: Present, InfinityModifier: -Infinity}
- default:
- // PostgreSQL uses ISO 8601 for to_json function and casting from a string to timestamptz
- tim, err := time.Parse(time.RFC3339Nano, *s)
- if err != nil {
- return err
- }
-
- *dst = Timestamptz{Time: normalizePotentialUTC(tim), Status: Present}
- }
-
- return nil
-}
-
-// Normalize timestamps in UTC location to behave similarly to how the Golang
-// standard library does it: UTC timestamps lack a .loc value.
-//
-// Reason for this: when comparing two timestamps with reflect.DeepEqual (generally
-// speaking not a good idea, but several testing libraries (for example testify)
-// does this), their location data needs to be equal for them to be considered
-// equal.
-func normalizePotentialUTC(timestamp time.Time) time.Time {
- if timestamp.Location().String() != time.UTC.String() {
- return timestamp
- }
-
- return timestamp.UTC()
-}
diff --git a/vendor/github.com/jackc/pgtype/timestamptz_array.go b/vendor/github.com/jackc/pgtype/timestamptz_array.go
deleted file mode 100644
index a3b4b26..0000000
--- a/vendor/github.com/jackc/pgtype/timestamptz_array.go
+++ /dev/null
@@ -1,518 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "reflect"
- "time"
-
- "github.com/jackc/pgio"
-)
-
-type TimestamptzArray struct {
- Elements []Timestamptz
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *TimestamptzArray) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = TimestamptzArray{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []time.Time:
- if value == nil {
- *dst = TimestamptzArray{Status: Null}
- } else if len(value) == 0 {
- *dst = TimestamptzArray{Status: Present}
- } else {
- elements := make([]Timestamptz, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = TimestamptzArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*time.Time:
- if value == nil {
- *dst = TimestamptzArray{Status: Null}
- } else if len(value) == 0 {
- *dst = TimestamptzArray{Status: Present}
- } else {
- elements := make([]Timestamptz, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = TimestamptzArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []Timestamptz:
- if value == nil {
- *dst = TimestamptzArray{Status: Null}
- } else if len(value) == 0 {
- *dst = TimestamptzArray{Status: Present}
- } else {
- *dst = TimestamptzArray{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = TimestamptzArray{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for TimestamptzArray", src)
- }
- if elementsLength == 0 {
- *dst = TimestamptzArray{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to TimestamptzArray", src)
- }
-
- *dst = TimestamptzArray{
- Elements: make([]Timestamptz, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]Timestamptz, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to TimestamptzArray, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *TimestamptzArray) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to TimestamptzArray")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in TimestamptzArray", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst TimestamptzArray) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *TimestamptzArray) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]time.Time:
- *v = make([]time.Time, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*time.Time:
- *v = make([]*time.Time, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *TimestamptzArray) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from TimestamptzArray")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from TimestamptzArray")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *TimestamptzArray) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = TimestamptzArray{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []Timestamptz
-
- if len(uta.Elements) > 0 {
- elements = make([]Timestamptz, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem Timestamptz
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = TimestamptzArray{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *TimestamptzArray) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = TimestamptzArray{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = TimestamptzArray{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]Timestamptz, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = TimestamptzArray{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src TimestamptzArray) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src TimestamptzArray) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("timestamptz"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "timestamptz")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *TimestamptzArray) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src TimestamptzArray) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/tsrange.go b/vendor/github.com/jackc/pgtype/tsrange.go
deleted file mode 100644
index 19ecf44..0000000
--- a/vendor/github.com/jackc/pgtype/tsrange.go
+++ /dev/null
@@ -1,267 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "fmt"
-
- "github.com/jackc/pgio"
-)
-
-type Tsrange struct {
- Lower Timestamp
- Upper Timestamp
- LowerType BoundType
- UpperType BoundType
- Status Status
-}
-
-func (dst *Tsrange) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = Tsrange{Status: Null}
- return nil
- }
-
- switch value := src.(type) {
- case Tsrange:
- *dst = value
- case *Tsrange:
- *dst = *value
- case string:
- return dst.DecodeText(nil, []byte(value))
- default:
- return fmt.Errorf("cannot convert %v to Tsrange", src)
- }
-
- return nil
-}
-
-func (dst Tsrange) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Tsrange) AssignTo(dst interface{}) error {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
-}
-
-func (dst *Tsrange) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Tsrange{Status: Null}
- return nil
- }
-
- utr, err := ParseUntypedTextRange(string(src))
- if err != nil {
- return err
- }
-
- *dst = Tsrange{Status: Present}
-
- dst.LowerType = utr.LowerType
- dst.UpperType = utr.UpperType
-
- if dst.LowerType == Empty {
- return nil
- }
-
- if dst.LowerType == Inclusive || dst.LowerType == Exclusive {
- if err := dst.Lower.DecodeText(ci, []byte(utr.Lower)); err != nil {
- return err
- }
- }
-
- if dst.UpperType == Inclusive || dst.UpperType == Exclusive {
- if err := dst.Upper.DecodeText(ci, []byte(utr.Upper)); err != nil {
- return err
- }
- }
-
- return nil
-}
-
-func (dst *Tsrange) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Tsrange{Status: Null}
- return nil
- }
-
- ubr, err := ParseUntypedBinaryRange(src)
- if err != nil {
- return err
- }
-
- *dst = Tsrange{Status: Present}
-
- dst.LowerType = ubr.LowerType
- dst.UpperType = ubr.UpperType
-
- if dst.LowerType == Empty {
- return nil
- }
-
- if dst.LowerType == Inclusive || dst.LowerType == Exclusive {
- if err := dst.Lower.DecodeBinary(ci, ubr.Lower); err != nil {
- return err
- }
- }
-
- if dst.UpperType == Inclusive || dst.UpperType == Exclusive {
- if err := dst.Upper.DecodeBinary(ci, ubr.Upper); err != nil {
- return err
- }
- }
-
- return nil
-}
-
-func (src Tsrange) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- switch src.LowerType {
- case Exclusive, Unbounded:
- buf = append(buf, '(')
- case Inclusive:
- buf = append(buf, '[')
- case Empty:
- return append(buf, "empty"...), nil
- default:
- return nil, fmt.Errorf("unknown lower bound type %v", src.LowerType)
- }
-
- var err error
-
- if src.LowerType != Unbounded {
- buf, err = src.Lower.EncodeText(ci, buf)
- if err != nil {
- return nil, err
- } else if buf == nil {
- return nil, fmt.Errorf("Lower cannot be null unless LowerType is Unbounded")
- }
- }
-
- buf = append(buf, ',')
-
- if src.UpperType != Unbounded {
- buf, err = src.Upper.EncodeText(ci, buf)
- if err != nil {
- return nil, err
- } else if buf == nil {
- return nil, fmt.Errorf("Upper cannot be null unless UpperType is Unbounded")
- }
- }
-
- switch src.UpperType {
- case Exclusive, Unbounded:
- buf = append(buf, ')')
- case Inclusive:
- buf = append(buf, ']')
- default:
- return nil, fmt.Errorf("unknown upper bound type %v", src.UpperType)
- }
-
- return buf, nil
-}
-
-func (src Tsrange) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- var rangeType byte
- switch src.LowerType {
- case Inclusive:
- rangeType |= lowerInclusiveMask
- case Unbounded:
- rangeType |= lowerUnboundedMask
- case Exclusive:
- case Empty:
- return append(buf, emptyMask), nil
- default:
- return nil, fmt.Errorf("unknown LowerType: %v", src.LowerType)
- }
-
- switch src.UpperType {
- case Inclusive:
- rangeType |= upperInclusiveMask
- case Unbounded:
- rangeType |= upperUnboundedMask
- case Exclusive:
- default:
- return nil, fmt.Errorf("unknown UpperType: %v", src.UpperType)
- }
-
- buf = append(buf, rangeType)
-
- var err error
-
- if src.LowerType != Unbounded {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- buf, err = src.Lower.EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, fmt.Errorf("Lower cannot be null unless LowerType is Unbounded")
- }
-
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
-
- if src.UpperType != Unbounded {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- buf, err = src.Upper.EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, fmt.Errorf("Upper cannot be null unless UpperType is Unbounded")
- }
-
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Tsrange) Scan(src interface{}) error {
- if src == nil {
- *dst = Tsrange{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Tsrange) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/tsrange_array.go b/vendor/github.com/jackc/pgtype/tsrange_array.go
deleted file mode 100644
index c64048e..0000000
--- a/vendor/github.com/jackc/pgtype/tsrange_array.go
+++ /dev/null
@@ -1,470 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "reflect"
-
- "github.com/jackc/pgio"
-)
-
-type TsrangeArray struct {
- Elements []Tsrange
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *TsrangeArray) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = TsrangeArray{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []Tsrange:
- if value == nil {
- *dst = TsrangeArray{Status: Null}
- } else if len(value) == 0 {
- *dst = TsrangeArray{Status: Present}
- } else {
- *dst = TsrangeArray{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = TsrangeArray{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for TsrangeArray", src)
- }
- if elementsLength == 0 {
- *dst = TsrangeArray{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to TsrangeArray", src)
- }
-
- *dst = TsrangeArray{
- Elements: make([]Tsrange, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]Tsrange, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to TsrangeArray, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *TsrangeArray) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to TsrangeArray")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in TsrangeArray", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst TsrangeArray) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *TsrangeArray) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]Tsrange:
- *v = make([]Tsrange, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *TsrangeArray) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from TsrangeArray")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from TsrangeArray")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *TsrangeArray) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = TsrangeArray{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []Tsrange
-
- if len(uta.Elements) > 0 {
- elements = make([]Tsrange, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem Tsrange
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = TsrangeArray{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *TsrangeArray) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = TsrangeArray{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = TsrangeArray{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]Tsrange, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = TsrangeArray{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src TsrangeArray) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src TsrangeArray) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("tsrange"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "tsrange")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *TsrangeArray) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src TsrangeArray) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/tstzrange.go b/vendor/github.com/jackc/pgtype/tstzrange.go
deleted file mode 100644
index 2557630..0000000
--- a/vendor/github.com/jackc/pgtype/tstzrange.go
+++ /dev/null
@@ -1,267 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "fmt"
-
- "github.com/jackc/pgio"
-)
-
-type Tstzrange struct {
- Lower Timestamptz
- Upper Timestamptz
- LowerType BoundType
- UpperType BoundType
- Status Status
-}
-
-func (dst *Tstzrange) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = Tstzrange{Status: Null}
- return nil
- }
-
- switch value := src.(type) {
- case Tstzrange:
- *dst = value
- case *Tstzrange:
- *dst = *value
- case string:
- return dst.DecodeText(nil, []byte(value))
- default:
- return fmt.Errorf("cannot convert %v to Tstzrange", src)
- }
-
- return nil
-}
-
-func (dst Tstzrange) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Tstzrange) AssignTo(dst interface{}) error {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
-}
-
-func (dst *Tstzrange) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Tstzrange{Status: Null}
- return nil
- }
-
- utr, err := ParseUntypedTextRange(string(src))
- if err != nil {
- return err
- }
-
- *dst = Tstzrange{Status: Present}
-
- dst.LowerType = utr.LowerType
- dst.UpperType = utr.UpperType
-
- if dst.LowerType == Empty {
- return nil
- }
-
- if dst.LowerType == Inclusive || dst.LowerType == Exclusive {
- if err := dst.Lower.DecodeText(ci, []byte(utr.Lower)); err != nil {
- return err
- }
- }
-
- if dst.UpperType == Inclusive || dst.UpperType == Exclusive {
- if err := dst.Upper.DecodeText(ci, []byte(utr.Upper)); err != nil {
- return err
- }
- }
-
- return nil
-}
-
-func (dst *Tstzrange) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Tstzrange{Status: Null}
- return nil
- }
-
- ubr, err := ParseUntypedBinaryRange(src)
- if err != nil {
- return err
- }
-
- *dst = Tstzrange{Status: Present}
-
- dst.LowerType = ubr.LowerType
- dst.UpperType = ubr.UpperType
-
- if dst.LowerType == Empty {
- return nil
- }
-
- if dst.LowerType == Inclusive || dst.LowerType == Exclusive {
- if err := dst.Lower.DecodeBinary(ci, ubr.Lower); err != nil {
- return err
- }
- }
-
- if dst.UpperType == Inclusive || dst.UpperType == Exclusive {
- if err := dst.Upper.DecodeBinary(ci, ubr.Upper); err != nil {
- return err
- }
- }
-
- return nil
-}
-
-func (src Tstzrange) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- switch src.LowerType {
- case Exclusive, Unbounded:
- buf = append(buf, '(')
- case Inclusive:
- buf = append(buf, '[')
- case Empty:
- return append(buf, "empty"...), nil
- default:
- return nil, fmt.Errorf("unknown lower bound type %v", src.LowerType)
- }
-
- var err error
-
- if src.LowerType != Unbounded {
- buf, err = src.Lower.EncodeText(ci, buf)
- if err != nil {
- return nil, err
- } else if buf == nil {
- return nil, fmt.Errorf("Lower cannot be null unless LowerType is Unbounded")
- }
- }
-
- buf = append(buf, ',')
-
- if src.UpperType != Unbounded {
- buf, err = src.Upper.EncodeText(ci, buf)
- if err != nil {
- return nil, err
- } else if buf == nil {
- return nil, fmt.Errorf("Upper cannot be null unless UpperType is Unbounded")
- }
- }
-
- switch src.UpperType {
- case Exclusive, Unbounded:
- buf = append(buf, ')')
- case Inclusive:
- buf = append(buf, ']')
- default:
- return nil, fmt.Errorf("unknown upper bound type %v", src.UpperType)
- }
-
- return buf, nil
-}
-
-func (src Tstzrange) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- var rangeType byte
- switch src.LowerType {
- case Inclusive:
- rangeType |= lowerInclusiveMask
- case Unbounded:
- rangeType |= lowerUnboundedMask
- case Exclusive:
- case Empty:
- return append(buf, emptyMask), nil
- default:
- return nil, fmt.Errorf("unknown LowerType: %v", src.LowerType)
- }
-
- switch src.UpperType {
- case Inclusive:
- rangeType |= upperInclusiveMask
- case Unbounded:
- rangeType |= upperUnboundedMask
- case Exclusive:
- default:
- return nil, fmt.Errorf("unknown UpperType: %v", src.UpperType)
- }
-
- buf = append(buf, rangeType)
-
- var err error
-
- if src.LowerType != Unbounded {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- buf, err = src.Lower.EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, fmt.Errorf("Lower cannot be null unless LowerType is Unbounded")
- }
-
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
-
- if src.UpperType != Unbounded {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- buf, err = src.Upper.EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, fmt.Errorf("Upper cannot be null unless UpperType is Unbounded")
- }
-
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Tstzrange) Scan(src interface{}) error {
- if src == nil {
- *dst = Tstzrange{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Tstzrange) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/tstzrange_array.go b/vendor/github.com/jackc/pgtype/tstzrange_array.go
deleted file mode 100644
index a216820..0000000
--- a/vendor/github.com/jackc/pgtype/tstzrange_array.go
+++ /dev/null
@@ -1,470 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "reflect"
-
- "github.com/jackc/pgio"
-)
-
-type TstzrangeArray struct {
- Elements []Tstzrange
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *TstzrangeArray) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = TstzrangeArray{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []Tstzrange:
- if value == nil {
- *dst = TstzrangeArray{Status: Null}
- } else if len(value) == 0 {
- *dst = TstzrangeArray{Status: Present}
- } else {
- *dst = TstzrangeArray{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = TstzrangeArray{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for TstzrangeArray", src)
- }
- if elementsLength == 0 {
- *dst = TstzrangeArray{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to TstzrangeArray", src)
- }
-
- *dst = TstzrangeArray{
- Elements: make([]Tstzrange, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]Tstzrange, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to TstzrangeArray, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *TstzrangeArray) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to TstzrangeArray")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in TstzrangeArray", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst TstzrangeArray) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *TstzrangeArray) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]Tstzrange:
- *v = make([]Tstzrange, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *TstzrangeArray) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from TstzrangeArray")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from TstzrangeArray")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *TstzrangeArray) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = TstzrangeArray{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []Tstzrange
-
- if len(uta.Elements) > 0 {
- elements = make([]Tstzrange, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem Tstzrange
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = TstzrangeArray{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *TstzrangeArray) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = TstzrangeArray{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = TstzrangeArray{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]Tstzrange, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = TstzrangeArray{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src TstzrangeArray) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src TstzrangeArray) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("tstzrange"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "tstzrange")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *TstzrangeArray) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src TstzrangeArray) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/typed_array.go.erb b/vendor/github.com/jackc/pgtype/typed_array.go.erb
deleted file mode 100644
index e8433c0..0000000
--- a/vendor/github.com/jackc/pgtype/typed_array.go.erb
+++ /dev/null
@@ -1,512 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-<%
- # defaults when not explicitly set on command line
-
- binary_format ||= "true"
- text_format ||= "true"
-
- text_null ||= "NULL"
-
- encode_binary ||= binary_format
- decode_binary ||= binary_format
-%>
-
-package pgtype
-
-import (
- "bytes"
- "fmt"
- "io"
-
- "github.com/jackc/pgio"
-)
-
-type <%= pgtype_array_type %> struct {
- Elements []<%= pgtype_element_type %>
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *<%= pgtype_array_type %>) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = <%= pgtype_array_type %>{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
- <% go_array_types.split(",").each do |t| %>
- <% if t != "[]#{pgtype_element_type}" %>
- case <%= t %>:
- if value == nil {
- *dst = <%= pgtype_array_type %>{Status: Null}
- } else if len(value) == 0 {
- *dst = <%= pgtype_array_type %>{Status: Present}
- } else {
- elements := make([]<%= pgtype_element_type %>, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = <%= pgtype_array_type %>{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
- <% end %>
- <% end %>
- case []<%= pgtype_element_type %>:
- if value == nil {
- *dst = <%= pgtype_array_type %>{Status: Null}
- } else if len(value) == 0 {
- *dst = <%= pgtype_array_type %>{Status: Present}
- } else {
- *dst = <%= pgtype_array_type %>{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status : Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = <%= pgtype_array_type %>{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for <%= pgtype_array_type %>", src)
- }
- if elementsLength == 0 {
- *dst = <%= pgtype_array_type %>{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to <%= pgtype_array_type %>", src)
- }
-
- *dst = <%= pgtype_array_type %> {
- Elements: make([]<%= pgtype_element_type %>, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]<%= pgtype_element_type %>, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to <%= pgtype_array_type %>, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *<%= pgtype_array_type %>) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to <%= pgtype_array_type %>")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in <%= pgtype_array_type %>", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst <%= pgtype_array_type %>) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *<%= pgtype_array_type %>) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1{
- // Attempt to match to select common types:
- switch v := dst.(type) {
- <% go_array_types.split(",").each do |t| %>
- case *<%= t %>:
- *v = make(<%= t %>, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
- <% end %>
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *<%= pgtype_array_type %>) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr(){
- return 0, fmt.Errorf("cannot assign all values from <%= pgtype_array_type %>")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from <%= pgtype_array_type %>")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-<% if text_format == "true" %>
-func (dst *<%= pgtype_array_type %>) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = <%= pgtype_array_type %>{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []<%= pgtype_element_type %>
-
- if len(uta.Elements) > 0 {
- elements = make([]<%= pgtype_element_type %>, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem <%= pgtype_element_type %>
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = <%= pgtype_array_type %>{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-<% end %>
-
-<% if decode_binary == "true" %>
-func (dst *<%= pgtype_array_type %>) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = <%= pgtype_array_type %>{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = <%= pgtype_array_type %>{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]<%= pgtype_element_type %>, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp:rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = <%= pgtype_array_type %>{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-<% end %>
-
-<% if text_format == "true" %>
-func (src <%= pgtype_array_type %>) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `<%= text_null %>`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-<% end %>
-
-<% if encode_binary == "true" %>
- func (src <%= pgtype_array_type %>) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("<%= element_type_name %>"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "<%= element_type_name %>")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
- }
-<% end %>
-
-<% if text_format == "true" %>
-// Scan implements the database/sql Scanner interface.
-func (dst *<%= pgtype_array_type %>) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src <%= pgtype_array_type %>) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
-<% end %>
diff --git a/vendor/github.com/jackc/pgtype/typed_array_gen.sh b/vendor/github.com/jackc/pgtype/typed_array_gen.sh
deleted file mode 100644
index 9ec768b..0000000
--- a/vendor/github.com/jackc/pgtype/typed_array_gen.sh
+++ /dev/null
@@ -1,31 +0,0 @@
-erb pgtype_array_type=Int2Array pgtype_element_type=Int2 go_array_types=[]int16,[]*int16,[]uint16,[]*uint16,[]int32,[]*int32,[]uint32,[]*uint32,[]int64,[]*int64,[]uint64,[]*uint64,[]int,[]*int,[]uint,[]*uint element_type_name=int2 typed_array.go.erb > int2_array.go
-erb pgtype_array_type=Int4Array pgtype_element_type=Int4 go_array_types=[]int16,[]*int16,[]uint16,[]*uint16,[]int32,[]*int32,[]uint32,[]*uint32,[]int64,[]*int64,[]uint64,[]*uint64,[]int,[]*int,[]uint,[]*uint element_type_name=int4 typed_array.go.erb > int4_array.go
-erb pgtype_array_type=Int8Array pgtype_element_type=Int8 go_array_types=[]int16,[]*int16,[]uint16,[]*uint16,[]int32,[]*int32,[]uint32,[]*uint32,[]int64,[]*int64,[]uint64,[]*uint64,[]int,[]*int,[]uint,[]*uint element_type_name=int8 typed_array.go.erb > int8_array.go
-erb pgtype_array_type=BoolArray pgtype_element_type=Bool go_array_types=[]bool,[]*bool element_type_name=bool typed_array.go.erb > bool_array.go
-erb pgtype_array_type=DateArray pgtype_element_type=Date go_array_types=[]time.Time,[]*time.Time element_type_name=date typed_array.go.erb > date_array.go
-erb pgtype_array_type=TimestamptzArray pgtype_element_type=Timestamptz go_array_types=[]time.Time,[]*time.Time element_type_name=timestamptz typed_array.go.erb > timestamptz_array.go
-erb pgtype_array_type=TstzrangeArray pgtype_element_type=Tstzrange go_array_types=[]Tstzrange element_type_name=tstzrange typed_array.go.erb > tstzrange_array.go
-erb pgtype_array_type=TsrangeArray pgtype_element_type=Tsrange go_array_types=[]Tsrange element_type_name=tsrange typed_array.go.erb > tsrange_array.go
-erb pgtype_array_type=TimestampArray pgtype_element_type=Timestamp go_array_types=[]time.Time,[]*time.Time element_type_name=timestamp typed_array.go.erb > timestamp_array.go
-erb pgtype_array_type=Float4Array pgtype_element_type=Float4 go_array_types=[]float32,[]*float32 element_type_name=float4 typed_array.go.erb > float4_array.go
-erb pgtype_array_type=Float8Array pgtype_element_type=Float8 go_array_types=[]float64,[]*float64 element_type_name=float8 typed_array.go.erb > float8_array.go
-erb pgtype_array_type=InetArray pgtype_element_type=Inet go_array_types=[]*net.IPNet,[]net.IP,[]*net.IP element_type_name=inet typed_array.go.erb > inet_array.go
-erb pgtype_array_type=MacaddrArray pgtype_element_type=Macaddr go_array_types=[]net.HardwareAddr,[]*net.HardwareAddr element_type_name=macaddr typed_array.go.erb > macaddr_array.go
-erb pgtype_array_type=CIDRArray pgtype_element_type=CIDR go_array_types=[]*net.IPNet,[]net.IP,[]*net.IP element_type_name=cidr typed_array.go.erb > cidr_array.go
-erb pgtype_array_type=TextArray pgtype_element_type=Text go_array_types=[]string,[]*string element_type_name=text typed_array.go.erb > text_array.go
-erb pgtype_array_type=VarcharArray pgtype_element_type=Varchar go_array_types=[]string,[]*string element_type_name=varchar typed_array.go.erb > varchar_array.go
-erb pgtype_array_type=BPCharArray pgtype_element_type=BPChar go_array_types=[]string,[]*string element_type_name=bpchar typed_array.go.erb > bpchar_array.go
-erb pgtype_array_type=ByteaArray pgtype_element_type=Bytea go_array_types=[][]byte element_type_name=bytea typed_array.go.erb > bytea_array.go
-erb pgtype_array_type=ACLItemArray pgtype_element_type=ACLItem go_array_types=[]string,[]*string element_type_name=aclitem binary_format=false typed_array.go.erb > aclitem_array.go
-erb pgtype_array_type=HstoreArray pgtype_element_type=Hstore go_array_types=[]map[string]string element_type_name=hstore typed_array.go.erb > hstore_array.go
-erb pgtype_array_type=NumericArray pgtype_element_type=Numeric go_array_types=[]float32,[]*float32,[]float64,[]*float64,[]int64,[]*int64,[]uint64,[]*uint64 element_type_name=numeric typed_array.go.erb > numeric_array.go
-erb pgtype_array_type=UUIDArray pgtype_element_type=UUID go_array_types=[][16]byte,[][]byte,[]string,[]*string element_type_name=uuid typed_array.go.erb > uuid_array.go
-erb pgtype_array_type=JSONArray pgtype_element_type=JSON go_array_types=[]string,[][]byte,[]json.RawMessage element_type_name=json typed_array.go.erb > json_array.go
-erb pgtype_array_type=JSONBArray pgtype_element_type=JSONB go_array_types=[]string,[][]byte,[]json.RawMessage element_type_name=jsonb typed_array.go.erb > jsonb_array.go
-
-# While the binary format is theoretically possible it is only practical to use the text format.
-erb pgtype_array_type=EnumArray pgtype_element_type=GenericText go_array_types=[]string,[]*string binary_format=false typed_array.go.erb > enum_array.go
-
-erb pgtype_array_type=RecordArray pgtype_element_type=Record go_array_types=[][]Value element_type_name=record text_null=NULL encode_binary=false text_format=false typed_array.go.erb > record_array.go
-
-goimports -w *_array.go
diff --git a/vendor/github.com/jackc/pgtype/typed_multirange.go.erb b/vendor/github.com/jackc/pgtype/typed_multirange.go.erb
deleted file mode 100644
index 84c8299..0000000
--- a/vendor/github.com/jackc/pgtype/typed_multirange.go.erb
+++ /dev/null
@@ -1,239 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
-
- "github.com/jackc/pgio"
-)
-
-type <%= multirange_type %> struct {
- Ranges []<%= range_type %>
- Status Status
-}
-
-func (dst *<%= multirange_type %>) Set(src interface{}) error {
- //untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = <%= multirange_type %>{Status: Null}
- return nil
- }
-
- switch value := src.(type) {
- case <%= multirange_type %>:
- *dst = value
- case *<%= multirange_type %>:
- *dst = *value
- case string:
- return dst.DecodeText(nil, []byte(value))
- case []<%= range_type %>:
- if value == nil {
- *dst = <%= multirange_type %>{Status: Null}
- } else if len(value) == 0 {
- *dst = <%= multirange_type %>{Status: Present}
- } else {
- elements := make([]<%= range_type %>, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = <%= multirange_type %>{
- Ranges: elements,
- Status: Present,
- }
- }
- case []*<%= range_type %>:
- if value == nil {
- *dst = <%= multirange_type %>{Status: Null}
- } else if len(value) == 0 {
- *dst = <%= multirange_type %>{Status: Present}
- } else {
- elements := make([]<%= range_type %>, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = <%= multirange_type %>{
- Ranges: elements,
- Status: Present,
- }
- }
- default:
- return fmt.Errorf("cannot convert %v to <%= multirange_type %>", src)
- }
-
- return nil
-
-}
-
-func (dst <%= multirange_type %>) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *<%= multirange_type %>) AssignTo(dst interface{}) error {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
-}
-
-func (dst *<%= multirange_type %>) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = <%= multirange_type %>{Status: Null}
- return nil
- }
-
- utmr, err := ParseUntypedTextMultirange(string(src))
- if err != nil {
- return err
- }
-
- var elements []<%= range_type %>
-
- if len(utmr.Elements) > 0 {
- elements = make([]<%= range_type %>, len(utmr.Elements))
-
- for i, s := range utmr.Elements {
- var elem <%= range_type %>
-
- elemSrc := []byte(s)
-
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = <%= multirange_type %>{Ranges: elements, Status: Present}
-
- return nil
-}
-
-func (dst *<%= multirange_type %>) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = <%= multirange_type %>{Status: Null}
- return nil
- }
-
- rp := 0
-
- numElems := int(binary.BigEndian.Uint32(src[rp:]))
- rp += 4
-
- if numElems == 0 {
- *dst = <%= multirange_type %>{Status: Present}
- return nil
- }
-
- elements := make([]<%= range_type %>, numElems)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err := elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = <%= multirange_type %>{Ranges: elements, Status: Present}
- return nil
-}
-
-func (src <%= multirange_type %>) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = append(buf, '{')
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Ranges {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- return nil, fmt.Errorf("multi-range does not allow null range")
- } else {
- buf = append(buf, string(elemBuf)...)
- }
-
- }
-
- buf = append(buf, '}')
-
- return buf, nil
-}
-
-func (src <%= multirange_type %>) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = pgio.AppendInt32(buf, int32(len(src.Ranges)))
-
- for i := range src.Ranges {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Ranges[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *<%= multirange_type %>) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src <%= multirange_type %>) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/typed_multirange_gen.sh b/vendor/github.com/jackc/pgtype/typed_multirange_gen.sh
deleted file mode 100644
index 610f40a..0000000
--- a/vendor/github.com/jackc/pgtype/typed_multirange_gen.sh
+++ /dev/null
@@ -1,8 +0,0 @@
-erb range_type=Numrange multirange_type=Nummultirange typed_multirange.go.erb > num_multirange.go
-erb range_type=Int4range multirange_type=Int4multirange typed_multirange.go.erb > int4_multirange.go
-erb range_type=Int8range multirange_type=Int8multirange typed_multirange.go.erb > int8_multirange.go
-# TODO
-# erb range_type=Tsrange multirange_type=Tsmultirange typed_multirange.go.erb > ts_multirange.go
-# erb range_type=Tstzrange multirange_type=Tstzmultirange typed_multirange.go.erb > tstz_multirange.go
-# erb range_type=Daterange multirange_type=Datemultirange typed_multirange.go.erb > date_multirange.go
-goimports -w *multirange.go \ No newline at end of file
diff --git a/vendor/github.com/jackc/pgtype/typed_range.go.erb b/vendor/github.com/jackc/pgtype/typed_range.go.erb
deleted file mode 100644
index 5625587..0000000
--- a/vendor/github.com/jackc/pgtype/typed_range.go.erb
+++ /dev/null
@@ -1,269 +0,0 @@
-package pgtype
-
-import (
- "bytes"
- "database/sql/driver"
- "fmt"
- "io"
-
- "github.com/jackc/pgio"
-)
-
-type <%= range_type %> struct {
- Lower <%= element_type %>
- Upper <%= element_type %>
- LowerType BoundType
- UpperType BoundType
- Status Status
-}
-
-func (dst *<%= range_type %>) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = <%= range_type %>{Status: Null}
- return nil
- }
-
- switch value := src.(type) {
- case <%= range_type %>:
- *dst = value
- case *<%= range_type %>:
- *dst = *value
- case string:
- return dst.DecodeText(nil, []byte(value))
- default:
- return fmt.Errorf("cannot convert %v to <%= range_type %>", src)
- }
-
- return nil
-}
-
-func (dst <%= range_type %>) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *<%= range_type %>) AssignTo(dst interface{}) error {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
-}
-
-func (dst *<%= range_type %>) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = <%= range_type %>{Status: Null}
- return nil
- }
-
- utr, err := ParseUntypedTextRange(string(src))
- if err != nil {
- return err
- }
-
- *dst = <%= range_type %>{Status: Present}
-
- dst.LowerType = utr.LowerType
- dst.UpperType = utr.UpperType
-
- if dst.LowerType == Empty {
- return nil
- }
-
- if dst.LowerType == Inclusive || dst.LowerType == Exclusive {
- if err := dst.Lower.DecodeText(ci, []byte(utr.Lower)); err != nil {
- return err
- }
- }
-
- if dst.UpperType == Inclusive || dst.UpperType == Exclusive {
- if err := dst.Upper.DecodeText(ci, []byte(utr.Upper)); err != nil {
- return err
- }
- }
-
- return nil
-}
-
-func (dst *<%= range_type %>) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = <%= range_type %>{Status: Null}
- return nil
- }
-
- ubr, err := ParseUntypedBinaryRange(src)
- if err != nil {
- return err
- }
-
- *dst = <%= range_type %>{Status: Present}
-
- dst.LowerType = ubr.LowerType
- dst.UpperType = ubr.UpperType
-
- if dst.LowerType == Empty {
- return nil
- }
-
- if dst.LowerType == Inclusive || dst.LowerType == Exclusive {
- if err := dst.Lower.DecodeBinary(ci, ubr.Lower); err != nil {
- return err
- }
- }
-
- if dst.UpperType == Inclusive || dst.UpperType == Exclusive {
- if err := dst.Upper.DecodeBinary(ci, ubr.Upper); err != nil {
- return err
- }
- }
-
- return nil
-}
-
-func (src <%= range_type %>) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- switch src.LowerType {
- case Exclusive, Unbounded:
- buf = append(buf, '(')
- case Inclusive:
- buf = append(buf, '[')
- case Empty:
- return append(buf, "empty"...), nil
- default:
- return nil, fmt.Errorf("unknown lower bound type %v", src.LowerType)
- }
-
- var err error
-
- if src.LowerType != Unbounded {
- buf, err = src.Lower.EncodeText(ci, buf)
- if err != nil {
- return nil, err
- } else if buf == nil {
- return nil, fmt.Errorf("Lower cannot be null unless LowerType is Unbounded")
- }
- }
-
- buf = append(buf, ',')
-
- if src.UpperType != Unbounded {
- buf, err = src.Upper.EncodeText(ci, buf)
- if err != nil {
- return nil, err
- } else if buf == nil {
- return nil, fmt.Errorf("Upper cannot be null unless UpperType is Unbounded")
- }
- }
-
- switch src.UpperType {
- case Exclusive, Unbounded:
- buf = append(buf, ')')
- case Inclusive:
- buf = append(buf, ']')
- default:
- return nil, fmt.Errorf("unknown upper bound type %v", src.UpperType)
- }
-
- return buf, nil
-}
-
-func (src <%= range_type %>) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- var rangeType byte
- switch src.LowerType {
- case Inclusive:
- rangeType |= lowerInclusiveMask
- case Unbounded:
- rangeType |= lowerUnboundedMask
- case Exclusive:
- case Empty:
- return append(buf, emptyMask), nil
- default:
- return nil, fmt.Errorf("unknown LowerType: %v", src.LowerType)
- }
-
- switch src.UpperType {
- case Inclusive:
- rangeType |= upperInclusiveMask
- case Unbounded:
- rangeType |= upperUnboundedMask
- case Exclusive:
- default:
- return nil, fmt.Errorf("unknown UpperType: %v", src.UpperType)
- }
-
- buf = append(buf, rangeType)
-
- var err error
-
- if src.LowerType != Unbounded {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- buf, err = src.Lower.EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, fmt.Errorf("Lower cannot be null unless LowerType is Unbounded")
- }
-
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
-
- if src.UpperType != Unbounded {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- buf, err = src.Upper.EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, fmt.Errorf("Upper cannot be null unless UpperType is Unbounded")
- }
-
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *<%= range_type %>) Scan(src interface{}) error {
- if src == nil {
- *dst = <%= range_type %>{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src <%= range_type %>) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/typed_range_gen.sh b/vendor/github.com/jackc/pgtype/typed_range_gen.sh
deleted file mode 100644
index bedda29..0000000
--- a/vendor/github.com/jackc/pgtype/typed_range_gen.sh
+++ /dev/null
@@ -1,7 +0,0 @@
-erb range_type=Int4range element_type=Int4 typed_range.go.erb > int4range.go
-erb range_type=Int8range element_type=Int8 typed_range.go.erb > int8range.go
-erb range_type=Tsrange element_type=Timestamp typed_range.go.erb > tsrange.go
-erb range_type=Tstzrange element_type=Timestamptz typed_range.go.erb > tstzrange.go
-erb range_type=Daterange element_type=Date typed_range.go.erb > daterange.go
-erb range_type=Numrange element_type=Numeric typed_range.go.erb > numrange.go
-goimports -w *range.go
diff --git a/vendor/github.com/jackc/pgtype/unknown.go b/vendor/github.com/jackc/pgtype/unknown.go
deleted file mode 100644
index c591b70..0000000
--- a/vendor/github.com/jackc/pgtype/unknown.go
+++ /dev/null
@@ -1,44 +0,0 @@
-package pgtype
-
-import "database/sql/driver"
-
-// Unknown represents the PostgreSQL unknown type. It is either a string literal
-// or NULL. It is used when PostgreSQL does not know the type of a value. In
-// general, this will only be used in pgx when selecting a null value without
-// type information. e.g. SELECT NULL;
-type Unknown struct {
- String string
- Status Status
-}
-
-func (dst *Unknown) Set(src interface{}) error {
- return (*Text)(dst).Set(src)
-}
-
-func (dst Unknown) Get() interface{} {
- return (Text)(dst).Get()
-}
-
-// AssignTo assigns from src to dst. Note that as Unknown is not a general number
-// type AssignTo does not do automatic type conversion as other number types do.
-func (src *Unknown) AssignTo(dst interface{}) error {
- return (*Text)(src).AssignTo(dst)
-}
-
-func (dst *Unknown) DecodeText(ci *ConnInfo, src []byte) error {
- return (*Text)(dst).DecodeText(ci, src)
-}
-
-func (dst *Unknown) DecodeBinary(ci *ConnInfo, src []byte) error {
- return (*Text)(dst).DecodeBinary(ci, src)
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Unknown) Scan(src interface{}) error {
- return (*Text)(dst).Scan(src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Unknown) Value() (driver.Value, error) {
- return (Text)(src).Value()
-}
diff --git a/vendor/github.com/jackc/pgtype/uuid.go b/vendor/github.com/jackc/pgtype/uuid.go
deleted file mode 100644
index 6839c05..0000000
--- a/vendor/github.com/jackc/pgtype/uuid.go
+++ /dev/null
@@ -1,231 +0,0 @@
-package pgtype
-
-import (
- "bytes"
- "database/sql/driver"
- "encoding/hex"
- "fmt"
-)
-
-type UUID struct {
- Bytes [16]byte
- Status Status
-}
-
-func (dst *UUID) Set(src interface{}) error {
- if src == nil {
- *dst = UUID{Status: Null}
- return nil
- }
-
- switch value := src.(type) {
- case interface{ Get() interface{} }:
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- case fmt.Stringer:
- value2 := value.String()
- return dst.Set(value2)
- case [16]byte:
- *dst = UUID{Bytes: value, Status: Present}
- case []byte:
- if value != nil {
- if len(value) != 16 {
- return fmt.Errorf("[]byte must be 16 bytes to convert to UUID: %d", len(value))
- }
- *dst = UUID{Status: Present}
- copy(dst.Bytes[:], value)
- } else {
- *dst = UUID{Status: Null}
- }
- case string:
- uuid, err := parseUUID(value)
- if err != nil {
- return err
- }
- *dst = UUID{Bytes: uuid, Status: Present}
- case *string:
- if value == nil {
- *dst = UUID{Status: Null}
- } else {
- return dst.Set(*value)
- }
- default:
- if originalSrc, ok := underlyingUUIDType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to UUID", value)
- }
-
- return nil
-}
-
-func (dst UUID) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst.Bytes
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *UUID) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- switch v := dst.(type) {
- case *[16]byte:
- *v = src.Bytes
- return nil
- case *[]byte:
- *v = make([]byte, 16)
- copy(*v, src.Bytes[:])
- return nil
- case *string:
- *v = encodeUUID(src.Bytes)
- return nil
- default:
- if nextDst, retry := GetAssignToDstType(v); retry {
- return src.AssignTo(nextDst)
- }
- }
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot assign %v into %T", src, dst)
-}
-
-// parseUUID converts a string UUID in standard form to a byte array.
-func parseUUID(src string) (dst [16]byte, err error) {
- switch len(src) {
- case 36:
- src = src[0:8] + src[9:13] + src[14:18] + src[19:23] + src[24:]
- case 32:
- // dashes already stripped, assume valid
- default:
- // assume invalid.
- return dst, fmt.Errorf("cannot parse UUID %v", src)
- }
-
- buf, err := hex.DecodeString(src)
- if err != nil {
- return dst, err
- }
-
- copy(dst[:], buf)
- return dst, err
-}
-
-// encodeUUID converts a uuid byte array to UUID standard string form.
-func encodeUUID(src [16]byte) string {
- return fmt.Sprintf("%x-%x-%x-%x-%x", src[0:4], src[4:6], src[6:8], src[8:10], src[10:16])
-}
-
-func (dst *UUID) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = UUID{Status: Null}
- return nil
- }
-
- if len(src) != 36 {
- return fmt.Errorf("invalid length for UUID: %v", len(src))
- }
-
- buf, err := parseUUID(string(src))
- if err != nil {
- return err
- }
-
- *dst = UUID{Bytes: buf, Status: Present}
- return nil
-}
-
-func (dst *UUID) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = UUID{Status: Null}
- return nil
- }
-
- if len(src) != 16 {
- return fmt.Errorf("invalid length for UUID: %v", len(src))
- }
-
- *dst = UUID{Status: Present}
- copy(dst.Bytes[:], src)
- return nil
-}
-
-func (src UUID) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- return append(buf, encodeUUID(src.Bytes)...), nil
-}
-
-func (src UUID) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- return append(buf, src.Bytes[:]...), nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *UUID) Scan(src interface{}) error {
- if src == nil {
- *dst = UUID{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src UUID) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
-
-func (src UUID) MarshalJSON() ([]byte, error) {
- switch src.Status {
- case Present:
- var buff bytes.Buffer
- buff.WriteByte('"')
- buff.WriteString(encodeUUID(src.Bytes))
- buff.WriteByte('"')
- return buff.Bytes(), nil
- case Null:
- return []byte("null"), nil
- case Undefined:
- return nil, errUndefined
- }
- return nil, errBadStatus
-}
-
-func (dst *UUID) UnmarshalJSON(src []byte) error {
- if bytes.Compare(src, []byte("null")) == 0 {
- return dst.Set(nil)
- }
- if len(src) != 38 {
- return fmt.Errorf("invalid length for UUID: %v", len(src))
- }
- return dst.Set(string(src[1 : len(src)-1]))
-}
diff --git a/vendor/github.com/jackc/pgtype/uuid_array.go b/vendor/github.com/jackc/pgtype/uuid_array.go
deleted file mode 100644
index 00721ef..0000000
--- a/vendor/github.com/jackc/pgtype/uuid_array.go
+++ /dev/null
@@ -1,573 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "reflect"
-
- "github.com/jackc/pgio"
-)
-
-type UUIDArray struct {
- Elements []UUID
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *UUIDArray) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = UUIDArray{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case [][16]byte:
- if value == nil {
- *dst = UUIDArray{Status: Null}
- } else if len(value) == 0 {
- *dst = UUIDArray{Status: Present}
- } else {
- elements := make([]UUID, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = UUIDArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case [][]byte:
- if value == nil {
- *dst = UUIDArray{Status: Null}
- } else if len(value) == 0 {
- *dst = UUIDArray{Status: Present}
- } else {
- elements := make([]UUID, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = UUIDArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []string:
- if value == nil {
- *dst = UUIDArray{Status: Null}
- } else if len(value) == 0 {
- *dst = UUIDArray{Status: Present}
- } else {
- elements := make([]UUID, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = UUIDArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*string:
- if value == nil {
- *dst = UUIDArray{Status: Null}
- } else if len(value) == 0 {
- *dst = UUIDArray{Status: Present}
- } else {
- elements := make([]UUID, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = UUIDArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []UUID:
- if value == nil {
- *dst = UUIDArray{Status: Null}
- } else if len(value) == 0 {
- *dst = UUIDArray{Status: Present}
- } else {
- *dst = UUIDArray{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = UUIDArray{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for UUIDArray", src)
- }
- if elementsLength == 0 {
- *dst = UUIDArray{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to UUIDArray", src)
- }
-
- *dst = UUIDArray{
- Elements: make([]UUID, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]UUID, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to UUIDArray, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *UUIDArray) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to UUIDArray")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in UUIDArray", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst UUIDArray) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *UUIDArray) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[][16]byte:
- *v = make([][16]byte, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[][]byte:
- *v = make([][]byte, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]string:
- *v = make([]string, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*string:
- *v = make([]*string, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *UUIDArray) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from UUIDArray")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from UUIDArray")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *UUIDArray) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = UUIDArray{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []UUID
-
- if len(uta.Elements) > 0 {
- elements = make([]UUID, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem UUID
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = UUIDArray{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *UUIDArray) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = UUIDArray{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = UUIDArray{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]UUID, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = UUIDArray{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src UUIDArray) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src UUIDArray) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("uuid"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "uuid")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *UUIDArray) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src UUIDArray) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/varbit.go b/vendor/github.com/jackc/pgtype/varbit.go
deleted file mode 100644
index f24dc5b..0000000
--- a/vendor/github.com/jackc/pgtype/varbit.go
+++ /dev/null
@@ -1,133 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
-
- "github.com/jackc/pgio"
-)
-
-type Varbit struct {
- Bytes []byte
- Len int32 // Number of bits
- Status Status
-}
-
-func (dst *Varbit) Set(src interface{}) error {
- return fmt.Errorf("cannot convert %v to Varbit", src)
-}
-
-func (dst Varbit) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *Varbit) AssignTo(dst interface{}) error {
- return fmt.Errorf("cannot assign %v to %T", src, dst)
-}
-
-func (dst *Varbit) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Varbit{Status: Null}
- return nil
- }
-
- bitLen := len(src)
- byteLen := bitLen / 8
- if bitLen%8 > 0 {
- byteLen++
- }
- buf := make([]byte, byteLen)
-
- for i, b := range src {
- if b == '1' {
- byteIdx := i / 8
- bitIdx := uint(i % 8)
- buf[byteIdx] = buf[byteIdx] | (128 >> bitIdx)
- }
- }
-
- *dst = Varbit{Bytes: buf, Len: int32(bitLen), Status: Present}
- return nil
-}
-
-func (dst *Varbit) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = Varbit{Status: Null}
- return nil
- }
-
- if len(src) < 4 {
- return fmt.Errorf("invalid length for varbit: %v", len(src))
- }
-
- bitLen := int32(binary.BigEndian.Uint32(src))
- rp := 4
-
- *dst = Varbit{Bytes: src[rp:], Len: bitLen, Status: Present}
- return nil
-}
-
-func (src Varbit) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- for i := int32(0); i < src.Len; i++ {
- byteIdx := i / 8
- bitMask := byte(128 >> byte(i%8))
- char := byte('0')
- if src.Bytes[byteIdx]&bitMask > 0 {
- char = '1'
- }
- buf = append(buf, char)
- }
-
- return buf, nil
-}
-
-func (src Varbit) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- buf = pgio.AppendInt32(buf, src.Len)
- return append(buf, src.Bytes...), nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Varbit) Scan(src interface{}) error {
- if src == nil {
- *dst = Varbit{Status: Null}
- return nil
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Varbit) Value() (driver.Value, error) {
- return EncodeValueText(src)
-}
diff --git a/vendor/github.com/jackc/pgtype/varchar.go b/vendor/github.com/jackc/pgtype/varchar.go
deleted file mode 100644
index fea31d1..0000000
--- a/vendor/github.com/jackc/pgtype/varchar.go
+++ /dev/null
@@ -1,66 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
-)
-
-type Varchar Text
-
-// Set converts from src to dst. Note that as Varchar is not a general
-// number type Set does not do automatic type conversion as other number
-// types do.
-func (dst *Varchar) Set(src interface{}) error {
- return (*Text)(dst).Set(src)
-}
-
-func (dst Varchar) Get() interface{} {
- return (Text)(dst).Get()
-}
-
-// AssignTo assigns from src to dst. Note that as Varchar is not a general number
-// type AssignTo does not do automatic type conversion as other number types do.
-func (src *Varchar) AssignTo(dst interface{}) error {
- return (*Text)(src).AssignTo(dst)
-}
-
-func (Varchar) PreferredResultFormat() int16 {
- return TextFormatCode
-}
-
-func (dst *Varchar) DecodeText(ci *ConnInfo, src []byte) error {
- return (*Text)(dst).DecodeText(ci, src)
-}
-
-func (dst *Varchar) DecodeBinary(ci *ConnInfo, src []byte) error {
- return (*Text)(dst).DecodeBinary(ci, src)
-}
-
-func (Varchar) PreferredParamFormat() int16 {
- return TextFormatCode
-}
-
-func (src Varchar) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- return (Text)(src).EncodeText(ci, buf)
-}
-
-func (src Varchar) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- return (Text)(src).EncodeBinary(ci, buf)
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *Varchar) Scan(src interface{}) error {
- return (*Text)(dst).Scan(src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src Varchar) Value() (driver.Value, error) {
- return (Text)(src).Value()
-}
-
-func (src Varchar) MarshalJSON() ([]byte, error) {
- return (Text)(src).MarshalJSON()
-}
-
-func (dst *Varchar) UnmarshalJSON(b []byte) error {
- return (*Text)(dst).UnmarshalJSON(b)
-}
diff --git a/vendor/github.com/jackc/pgtype/varchar_array.go b/vendor/github.com/jackc/pgtype/varchar_array.go
deleted file mode 100644
index 8a309a3..0000000
--- a/vendor/github.com/jackc/pgtype/varchar_array.go
+++ /dev/null
@@ -1,517 +0,0 @@
-// Code generated by erb. DO NOT EDIT.
-
-package pgtype
-
-import (
- "database/sql/driver"
- "encoding/binary"
- "fmt"
- "reflect"
-
- "github.com/jackc/pgio"
-)
-
-type VarcharArray struct {
- Elements []Varchar
- Dimensions []ArrayDimension
- Status Status
-}
-
-func (dst *VarcharArray) Set(src interface{}) error {
- // untyped nil and typed nil interfaces are different
- if src == nil {
- *dst = VarcharArray{Status: Null}
- return nil
- }
-
- if value, ok := src.(interface{ Get() interface{} }); ok {
- value2 := value.Get()
- if value2 != value {
- return dst.Set(value2)
- }
- }
-
- // Attempt to match to select common types:
- switch value := src.(type) {
-
- case []string:
- if value == nil {
- *dst = VarcharArray{Status: Null}
- } else if len(value) == 0 {
- *dst = VarcharArray{Status: Present}
- } else {
- elements := make([]Varchar, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = VarcharArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []*string:
- if value == nil {
- *dst = VarcharArray{Status: Null}
- } else if len(value) == 0 {
- *dst = VarcharArray{Status: Present}
- } else {
- elements := make([]Varchar, len(value))
- for i := range value {
- if err := elements[i].Set(value[i]); err != nil {
- return err
- }
- }
- *dst = VarcharArray{
- Elements: elements,
- Dimensions: []ArrayDimension{{Length: int32(len(elements)), LowerBound: 1}},
- Status: Present,
- }
- }
-
- case []Varchar:
- if value == nil {
- *dst = VarcharArray{Status: Null}
- } else if len(value) == 0 {
- *dst = VarcharArray{Status: Present}
- } else {
- *dst = VarcharArray{
- Elements: value,
- Dimensions: []ArrayDimension{{Length: int32(len(value)), LowerBound: 1}},
- Status: Present,
- }
- }
- default:
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- reflectedValue := reflect.ValueOf(src)
- if !reflectedValue.IsValid() || reflectedValue.IsZero() {
- *dst = VarcharArray{Status: Null}
- return nil
- }
-
- dimensions, elementsLength, ok := findDimensionsFromValue(reflectedValue, nil, 0)
- if !ok {
- return fmt.Errorf("cannot find dimensions of %v for VarcharArray", src)
- }
- if elementsLength == 0 {
- *dst = VarcharArray{Status: Present}
- return nil
- }
- if len(dimensions) == 0 {
- if originalSrc, ok := underlyingSliceType(src); ok {
- return dst.Set(originalSrc)
- }
- return fmt.Errorf("cannot convert %v to VarcharArray", src)
- }
-
- *dst = VarcharArray{
- Elements: make([]Varchar, elementsLength),
- Dimensions: dimensions,
- Status: Present,
- }
- elementCount, err := dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- // Maybe the target was one dimension too far, try again:
- if len(dst.Dimensions) > 1 {
- dst.Dimensions = dst.Dimensions[:len(dst.Dimensions)-1]
- elementsLength = 0
- for _, dim := range dst.Dimensions {
- if elementsLength == 0 {
- elementsLength = int(dim.Length)
- } else {
- elementsLength *= int(dim.Length)
- }
- }
- dst.Elements = make([]Varchar, elementsLength)
- elementCount, err = dst.setRecursive(reflectedValue, 0, 0)
- if err != nil {
- return err
- }
- } else {
- return err
- }
- }
- if elementCount != len(dst.Elements) {
- return fmt.Errorf("cannot convert %v to VarcharArray, expected %d dst.Elements, but got %d instead", src, len(dst.Elements), elementCount)
- }
- }
-
- return nil
-}
-
-func (dst *VarcharArray) setRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(dst.Dimensions) == dimension {
- break
- }
-
- valueLen := value.Len()
- if int32(valueLen) != dst.Dimensions[dimension].Length {
- return 0, fmt.Errorf("multidimensional arrays must have array expressions with matching dimensions")
- }
- for i := 0; i < valueLen; i++ {
- var err error
- index, err = dst.setRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if !value.CanInterface() {
- return 0, fmt.Errorf("cannot convert all values to VarcharArray")
- }
- if err := dst.Elements[index].Set(value.Interface()); err != nil {
- return 0, fmt.Errorf("%v in VarcharArray", err)
- }
- index++
-
- return index, nil
-}
-
-func (dst VarcharArray) Get() interface{} {
- switch dst.Status {
- case Present:
- return dst
- case Null:
- return nil
- default:
- return dst.Status
- }
-}
-
-func (src *VarcharArray) AssignTo(dst interface{}) error {
- switch src.Status {
- case Present:
- if len(src.Dimensions) <= 1 {
- // Attempt to match to select common types:
- switch v := dst.(type) {
-
- case *[]string:
- *v = make([]string, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- case *[]*string:
- *v = make([]*string, len(src.Elements))
- for i := range src.Elements {
- if err := src.Elements[i].AssignTo(&((*v)[i])); err != nil {
- return err
- }
- }
- return nil
-
- }
- }
-
- // Try to convert to something AssignTo can use directly.
- if nextDst, retry := GetAssignToDstType(dst); retry {
- return src.AssignTo(nextDst)
- }
-
- // Fallback to reflection if an optimised match was not found.
- // The reflection is necessary for arrays and multidimensional slices,
- // but it comes with a 20-50% performance penalty for large arrays/slices
- value := reflect.ValueOf(dst)
- if value.Kind() == reflect.Ptr {
- value = value.Elem()
- }
-
- switch value.Kind() {
- case reflect.Array, reflect.Slice:
- default:
- return fmt.Errorf("cannot assign %T to %T", src, dst)
- }
-
- if len(src.Elements) == 0 {
- if value.Kind() == reflect.Slice {
- value.Set(reflect.MakeSlice(value.Type(), 0, 0))
- return nil
- }
- }
-
- elementCount, err := src.assignToRecursive(value, 0, 0)
- if err != nil {
- return err
- }
- if elementCount != len(src.Elements) {
- return fmt.Errorf("cannot assign %v, needed to assign %d elements, but only assigned %d", dst, len(src.Elements), elementCount)
- }
-
- return nil
- case Null:
- return NullAssignTo(dst)
- }
-
- return fmt.Errorf("cannot decode %#v into %T", src, dst)
-}
-
-func (src *VarcharArray) assignToRecursive(value reflect.Value, index, dimension int) (int, error) {
- switch kind := value.Kind(); kind {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- if len(src.Dimensions) == dimension {
- break
- }
-
- length := int(src.Dimensions[dimension].Length)
- if reflect.Array == kind {
- typ := value.Type()
- if typ.Len() != length {
- return 0, fmt.Errorf("expected size %d array, but %s has size %d array", length, typ, typ.Len())
- }
- value.Set(reflect.New(typ).Elem())
- } else {
- value.Set(reflect.MakeSlice(value.Type(), length, length))
- }
-
- var err error
- for i := 0; i < length; i++ {
- index, err = src.assignToRecursive(value.Index(i), index, dimension+1)
- if err != nil {
- return 0, err
- }
- }
-
- return index, nil
- }
- if len(src.Dimensions) != dimension {
- return 0, fmt.Errorf("incorrect dimensions, expected %d, found %d", len(src.Dimensions), dimension)
- }
- if !value.CanAddr() {
- return 0, fmt.Errorf("cannot assign all values from VarcharArray")
- }
- addr := value.Addr()
- if !addr.CanInterface() {
- return 0, fmt.Errorf("cannot assign all values from VarcharArray")
- }
- if err := src.Elements[index].AssignTo(addr.Interface()); err != nil {
- return 0, err
- }
- index++
- return index, nil
-}
-
-func (dst *VarcharArray) DecodeText(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = VarcharArray{Status: Null}
- return nil
- }
-
- uta, err := ParseUntypedTextArray(string(src))
- if err != nil {
- return err
- }
-
- var elements []Varchar
-
- if len(uta.Elements) > 0 {
- elements = make([]Varchar, len(uta.Elements))
-
- for i, s := range uta.Elements {
- var elem Varchar
- var elemSrc []byte
- if s != "NULL" || uta.Quoted[i] {
- elemSrc = []byte(s)
- }
- err = elem.DecodeText(ci, elemSrc)
- if err != nil {
- return err
- }
-
- elements[i] = elem
- }
- }
-
- *dst = VarcharArray{Elements: elements, Dimensions: uta.Dimensions, Status: Present}
-
- return nil
-}
-
-func (dst *VarcharArray) DecodeBinary(ci *ConnInfo, src []byte) error {
- if src == nil {
- *dst = VarcharArray{Status: Null}
- return nil
- }
-
- var arrayHeader ArrayHeader
- rp, err := arrayHeader.DecodeBinary(ci, src)
- if err != nil {
- return err
- }
-
- if len(arrayHeader.Dimensions) == 0 {
- *dst = VarcharArray{Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
- }
-
- elementCount := arrayHeader.Dimensions[0].Length
- for _, d := range arrayHeader.Dimensions[1:] {
- elementCount *= d.Length
- }
-
- elements := make([]Varchar, elementCount)
-
- for i := range elements {
- elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
- rp += 4
- var elemSrc []byte
- if elemLen >= 0 {
- elemSrc = src[rp : rp+elemLen]
- rp += elemLen
- }
- err = elements[i].DecodeBinary(ci, elemSrc)
- if err != nil {
- return err
- }
- }
-
- *dst = VarcharArray{Elements: elements, Dimensions: arrayHeader.Dimensions, Status: Present}
- return nil
-}
-
-func (src VarcharArray) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- if len(src.Dimensions) == 0 {
- return append(buf, '{', '}'), nil
- }
-
- buf = EncodeTextArrayDimensions(buf, src.Dimensions)
-
- // dimElemCounts is the multiples of elements that each array lies on. For
- // example, a single dimension array of length 4 would have a dimElemCounts of
- // [4]. A multi-dimensional array of lengths [3,5,2] would have a
- // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
- // or '}'.
- dimElemCounts := make([]int, len(src.Dimensions))
- dimElemCounts[len(src.Dimensions)-1] = int(src.Dimensions[len(src.Dimensions)-1].Length)
- for i := len(src.Dimensions) - 2; i > -1; i-- {
- dimElemCounts[i] = int(src.Dimensions[i].Length) * dimElemCounts[i+1]
- }
-
- inElemBuf := make([]byte, 0, 32)
- for i, elem := range src.Elements {
- if i > 0 {
- buf = append(buf, ',')
- }
-
- for _, dec := range dimElemCounts {
- if i%dec == 0 {
- buf = append(buf, '{')
- }
- }
-
- elemBuf, err := elem.EncodeText(ci, inElemBuf)
- if err != nil {
- return nil, err
- }
- if elemBuf == nil {
- buf = append(buf, `NULL`...)
- } else {
- buf = append(buf, QuoteArrayElementIfNeeded(string(elemBuf))...)
- }
-
- for _, dec := range dimElemCounts {
- if (i+1)%dec == 0 {
- buf = append(buf, '}')
- }
- }
- }
-
- return buf, nil
-}
-
-func (src VarcharArray) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- switch src.Status {
- case Null:
- return nil, nil
- case Undefined:
- return nil, errUndefined
- }
-
- arrayHeader := ArrayHeader{
- Dimensions: src.Dimensions,
- }
-
- if dt, ok := ci.DataTypeForName("varchar"); ok {
- arrayHeader.ElementOID = int32(dt.OID)
- } else {
- return nil, fmt.Errorf("unable to find oid for type name %v", "varchar")
- }
-
- for i := range src.Elements {
- if src.Elements[i].Status == Null {
- arrayHeader.ContainsNull = true
- break
- }
- }
-
- buf = arrayHeader.EncodeBinary(ci, buf)
-
- for i := range src.Elements {
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
-
- elemBuf, err := src.Elements[i].EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if elemBuf != nil {
- buf = elemBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- }
-
- return buf, nil
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *VarcharArray) Scan(src interface{}) error {
- if src == nil {
- return dst.DecodeText(nil, nil)
- }
-
- switch src := src.(type) {
- case string:
- return dst.DecodeText(nil, []byte(src))
- case []byte:
- srcCopy := make([]byte, len(src))
- copy(srcCopy, src)
- return dst.DecodeText(nil, srcCopy)
- }
-
- return fmt.Errorf("cannot scan %T", src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src VarcharArray) Value() (driver.Value, error) {
- buf, err := src.EncodeText(nil, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
-
- return string(buf), nil
-}
diff --git a/vendor/github.com/jackc/pgtype/xid.go b/vendor/github.com/jackc/pgtype/xid.go
deleted file mode 100644
index f6d6b22..0000000
--- a/vendor/github.com/jackc/pgtype/xid.go
+++ /dev/null
@@ -1,64 +0,0 @@
-package pgtype
-
-import (
- "database/sql/driver"
-)
-
-// XID is PostgreSQL's Transaction ID type.
-//
-// In later versions of PostgreSQL, it is the type used for the backend_xid
-// and backend_xmin columns of the pg_stat_activity system view.
-//
-// Also, when one does
-//
-// select xmin, xmax, * from some_table;
-//
-// it is the data type of the xmin and xmax hidden system columns.
-//
-// It is currently implemented as an unsigned four byte integer.
-// Its definition can be found in src/include/postgres_ext.h as TransactionId
-// in the PostgreSQL sources.
-type XID pguint32
-
-// Set converts from src to dst. Note that as XID is not a general
-// number type Set does not do automatic type conversion as other number
-// types do.
-func (dst *XID) Set(src interface{}) error {
- return (*pguint32)(dst).Set(src)
-}
-
-func (dst XID) Get() interface{} {
- return (pguint32)(dst).Get()
-}
-
-// AssignTo assigns from src to dst. Note that as XID is not a general number
-// type AssignTo does not do automatic type conversion as other number types do.
-func (src *XID) AssignTo(dst interface{}) error {
- return (*pguint32)(src).AssignTo(dst)
-}
-
-func (dst *XID) DecodeText(ci *ConnInfo, src []byte) error {
- return (*pguint32)(dst).DecodeText(ci, src)
-}
-
-func (dst *XID) DecodeBinary(ci *ConnInfo, src []byte) error {
- return (*pguint32)(dst).DecodeBinary(ci, src)
-}
-
-func (src XID) EncodeText(ci *ConnInfo, buf []byte) ([]byte, error) {
- return (pguint32)(src).EncodeText(ci, buf)
-}
-
-func (src XID) EncodeBinary(ci *ConnInfo, buf []byte) ([]byte, error) {
- return (pguint32)(src).EncodeBinary(ci, buf)
-}
-
-// Scan implements the database/sql Scanner interface.
-func (dst *XID) Scan(src interface{}) error {
- return (*pguint32)(dst).Scan(src)
-}
-
-// Value implements the database/sql/driver Valuer interface.
-func (src XID) Value() (driver.Value, error) {
- return (pguint32)(src).Value()
-}
diff --git a/vendor/github.com/jackc/pgx/v4/CHANGELOG.md b/vendor/github.com/jackc/pgx/v4/CHANGELOG.md
deleted file mode 100644
index e8f2012..0000000
--- a/vendor/github.com/jackc/pgx/v4/CHANGELOG.md
+++ /dev/null
@@ -1,268 +0,0 @@
-# 4.17.2 (September 3, 2022)
-
-* Fix panic when logging batch error (Tom Möller)
-
-# 4.17.1 (August 27, 2022)
-
-* Upgrade puddle to v1.3.0 - fixes context failing to cancel Acquire when acquire is creating resource which was introduced in v4.17.0 (James Hartig)
-* Fix atomic alignment on 32-bit platforms
-
-# 4.17.0 (August 6, 2022)
-
-* Upgrade pgconn to v1.13.0
-* Upgrade pgproto3 to v2.3.1
-* Upgrade pgtype to v1.12.0
-* Allow background pool connections to continue even if cause is canceled (James Hartig)
-* Add LoggerFunc (Gabor Szabad)
-* pgxpool: health check should avoid going below minConns (James Hartig)
-* Add pgxpool.Conn.Hijack()
-* Logging improvements (Stepan Rabotkin)
-
-# 4.16.1 (May 7, 2022)
-
-* Upgrade pgconn to v1.12.1
-* Fix explicitly prepared statements with describe statement cache mode
-
-# 4.16.0 (April 21, 2022)
-
-* Upgrade pgconn to v1.12.0
-* Upgrade pgproto3 to v2.3.0
-* Upgrade pgtype to v1.11.0
-* Fix: Do not panic when context cancelled while getting statement from cache.
-* Fix: Less memory pinning from old Rows.
-* Fix: Support '\r' line ending when sanitizing SQL comment.
-* Add pluggable GSSAPI support (Oliver Tan)
-
-# 4.15.0 (February 7, 2022)
-
-* Upgrade to pgconn v1.11.0
-* Upgrade to pgtype v1.10.0
-* Upgrade puddle to v1.2.1
-* Make BatchResults.Close safe to be called multiple times
-
-# 4.14.1 (November 28, 2021)
-
-* Upgrade pgtype to v1.9.1 (fixes unintentional change to timestamp binary decoding)
-* Start pgxpool background health check after initial connections
-
-# 4.14.0 (November 20, 2021)
-
-* Upgrade pgconn to v1.10.1
-* Upgrade pgproto3 to v2.2.0
-* Upgrade pgtype to v1.9.0
-* Upgrade puddle to v1.2.0
-* Add QueryFunc to BatchResults
-* Add context options to zerologadapter (Thomas Frössman)
-* Add zerologadapter.NewContextLogger (urso)
-* Eager initialize minpoolsize on connect (Daniel)
-* Unpin memory used by large queries immediately after use
-
-# 4.13.0 (July 24, 2021)
-
-* Trimmed pseudo-dependencies in Go modules from other packages tests
-* Upgrade pgconn -- context cancellation no longer will return a net.Error
-* Support time durations for simple protocol (Michael Darr)
-
-# 4.12.0 (July 10, 2021)
-
-* ResetSession hook is called before a connection is reused from pool for another query (Dmytro Haranzha)
-* stdlib: Add RandomizeHostOrderFunc (dkinder)
-* stdlib: add OptionBeforeConnect (dkinder)
-* stdlib: Do not reuse ConnConfig strings (Andrew Kimball)
-* stdlib: implement Conn.ResetSession (Jonathan Amsterdam)
-* Upgrade pgconn to v1.9.0
-* Upgrade pgtype to v1.8.0
-
-# 4.11.0 (March 25, 2021)
-
-* Add BeforeConnect callback to pgxpool.Config (Robert Froehlich)
-* Add Ping method to pgxpool.Conn (davidsbond)
-* Added a kitlog level log adapter (Fabrice Aneche)
-* Make ScanArgError public to allow identification of offending column (Pau Sanchez)
-* Add *pgxpool.AcquireFunc
-* Add BeginFunc and BeginTxFunc
-* Add prefer_simple_protocol to connection string
-* Add logging on CopyFrom (Patrick Hemmer)
-* Add comment support when sanitizing SQL queries (Rusakow Andrew)
-* Do not panic on double close of pgxpool.Pool (Matt Schultz)
-* Avoid panic on SendBatch on closed Tx (Matt Schultz)
-* Update pgconn to v1.8.1
-* Update pgtype to v1.7.0
-
-# 4.10.1 (December 19, 2020)
-
-* Fix panic on Query error with nil stmtcache.
-
-# 4.10.0 (December 3, 2020)
-
-* Add CopyFromSlice to simplify CopyFrom usage (Egon Elbre)
-* Remove broken prepared statements from stmtcache (Ethan Pailes)
-* stdlib: consider any Ping error as fatal
-* Update puddle to v1.1.3 - this fixes an issue where concurrent Acquires can hang when a connection cannot be established
-* Update pgtype to v1.6.2
-
-# 4.9.2 (November 3, 2020)
-
-The underlying library updates fix an issue where appending to a scanned slice could corrupt other data.
-
-* Update pgconn to v1.7.2
-* Update pgproto3 to v2.0.6
-
-# 4.9.1 (October 31, 2020)
-
-* Update pgconn to v1.7.1
-* Update pgtype to v1.6.1
-* Fix SendBatch of all prepared statements with statement cache disabled
-
-# 4.9.0 (September 26, 2020)
-
-* pgxpool now waits for connection cleanup to finish before making room in pool for another connection. This prevents temporarily exceeding max pool size.
-* Fix when scanning a column to nil to skip it on the first row but scanning it to a real value on a subsequent row.
-* Fix prefer simple protocol with prepared statements. (Jinzhu)
-* Fix FieldDescriptions not being available on Rows before calling Next the first time.
-* Various minor fixes in updated versions of pgconn, pgtype, and puddle.
-
-# 4.8.1 (July 29, 2020)
-
-* Update pgconn to v1.6.4
- * Fix deadlock on error after CommandComplete but before ReadyForQuery
- * Fix panic on parsing DSN with trailing '='
-
-# 4.8.0 (July 22, 2020)
-
-* All argument types supported by native pgx should now also work through database/sql
-* Update pgconn to v1.6.3
-* Update pgtype to v1.4.2
-
-# 4.7.2 (July 14, 2020)
-
-* Improve performance of Columns() (zikaeroh)
-* Fix fatal Commit() failure not being considered fatal
-* Update pgconn to v1.6.2
-* Update pgtype to v1.4.1
-
-# 4.7.1 (June 29, 2020)
-
-* Fix stdlib decoding error with certain order and combination of fields
-
-# 4.7.0 (June 27, 2020)
-
-* Update pgtype to v1.4.0
-* Update pgconn to v1.6.1
-* Update puddle to v1.1.1
-* Fix context propagation with Tx commit and Rollback (georgysavva)
-* Add lazy connect option to pgxpool (georgysavva)
-* Fix connection leak if pgxpool.BeginTx() fail (Jean-Baptiste Bronisz)
-* Add native Go slice support for strings and numbers to simple protocol
-* stdlib add default timeouts for Conn.Close() and Stmt.Close() (georgysavva)
-* Assorted performance improvements especially with large result sets
-* Fix close pool on not lazy connect failure (Yegor Myskin)
-* Add Config copy (georgysavva)
-* Support SendBatch with Simple Protocol (Jordan Lewis)
-* Better error logging on rows close (Igor V. Kozinov)
-* Expose stdlib.Conn.Conn() to enable database/sql.Conn.Raw()
-* Improve unknown type support for database/sql
-* Fix transaction commit failure closing connection
-
-# 4.6.0 (March 30, 2020)
-
-* stdlib: Bail early if preloading rows.Next() results in rows.Err() (Bas van Beek)
-* Sanitize time to microsecond accuracy (Andrew Nicoll)
-* Update pgtype to v1.3.0
-* Update pgconn to v1.5.0
- * Update golang.org/x/crypto for security fix
- * Implement "verify-ca" SSL mode
-
-# 4.5.0 (March 7, 2020)
-
-* Update to pgconn v1.4.0
- * Fixes QueryRow with empty SQL
- * Adds PostgreSQL service file support
-* Add Len() to *pgx.Batch (WGH)
-* Better logging for individual batch items (Ben Bader)
-
-# 4.4.1 (February 14, 2020)
-
-* Update pgconn to v1.3.2 - better default read buffer size
-* Fix race in CopyFrom
-
-# 4.4.0 (February 5, 2020)
-
-* Update puddle to v1.1.0 - fixes possible deadlock when acquire is cancelled
-* Update pgconn to v1.3.1 - fixes CopyFrom deadlock when multiple NoticeResponse received during copy
-* Update pgtype to v1.2.0
-* Add MaxConnIdleTime to pgxpool (Patrick Ellul)
-* Add MinConns to pgxpool (Patrick Ellul)
-* Fix: stdlib.ReleaseConn closes connections left in invalid state
-
-# 4.3.0 (January 23, 2020)
-
-* Fix Rows.Values panic when unable to decode
-* Add Rows.Values support for unknown types
-* Add DriverContext support for stdlib (Alex Gaynor)
-* Update pgproto3 to v2.0.1 to never return an io.EOF as it would be misinterpreted by database/sql. Instead return io.UnexpectedEOF.
-
-# 4.2.1 (January 13, 2020)
-
-* Update pgconn to v1.2.1 (fixes context cancellation data race introduced in v1.2.0))
-
-# 4.2.0 (January 11, 2020)
-
-* Update pgconn to v1.2.0.
-* Update pgtype to v1.1.0.
-* Return error instead of panic when wrong number of arguments passed to Exec. (malstoun)
-* Fix large objects functionality when PreferSimpleProtocol = true.
-* Restore GetDefaultDriver which existed in v3. (Johan Brandhorst)
-* Add RegisterConnConfig to stdlib which replaces the removed RegisterDriverConfig from v3.
-
-# 4.1.2 (October 22, 2019)
-
-* Fix dbSavepoint.Begin recursive self call
-* Upgrade pgtype to v1.0.2 - fix scan pointer to pointer
-
-# 4.1.1 (October 21, 2019)
-
-* Fix pgxpool Rows.CommandTag() infinite loop / typo
-
-# 4.1.0 (October 12, 2019)
-
-## Potentially Breaking Changes
-
-Technically, two changes are breaking changes, but in practice these are extremely unlikely to break existing code.
-
-* Conn.Begin and Conn.BeginTx return a Tx interface instead of the internal dbTx struct. This is necessary for the Conn.Begin method to signature as other methods that begin a transaction.
-* Add Conn() to Tx interface. This is necessary to allow code using a Tx to access the *Conn (and pgconn.PgConn) on which the Tx is executing.
-
-## Fixes
-
-* Releasing a busy connection closes the connection instead of returning an unusable connection to the pool
-* Do not mutate config.Config.OnNotification in connect
-
-# 4.0.1 (September 19, 2019)
-
-* Fix statement cache cleanup.
-* Corrected daterange OID.
-* Fix Tx when committing or rolling back multiple times in certain cases.
-* Improve documentation.
-
-# 4.0.0 (September 14, 2019)
-
-v4 is a major release with many significant changes some of which are breaking changes. The most significant are
-included below.
-
-* Simplified establishing a connection with a connection string.
-* All potentially blocking operations now require a context.Context. The non-context aware functions have been removed.
-* OIDs are hard-coded for known types. This saves the query on connection.
-* Context cancellations while network activity is in progress is now always fatal. Previously, it was sometimes recoverable. This led to increased complexity in pgx itself and in application code.
-* Go modules are required.
-* Errors are now implemented in the Go 1.13 style.
-* `Rows` and `Tx` are now interfaces.
-* The connection pool as been decoupled from pgx and is now a separate, included package (github.com/jackc/pgx/v4/pgxpool).
-* pgtype has been spun off to a separate package (github.com/jackc/pgtype).
-* pgproto3 has been spun off to a separate package (github.com/jackc/pgproto3/v2).
-* Logical replication support has been spun off to a separate package (github.com/jackc/pglogrepl).
-* Lower level PostgreSQL functionality is now implemented in a separate package (github.com/jackc/pgconn).
-* Tests are now configured with environment variables.
-* Conn has an automatic statement cache by default.
-* Batch interface has been simplified.
-* QueryArgs has been removed.
diff --git a/vendor/github.com/jackc/pgx/v4/LICENSE b/vendor/github.com/jackc/pgx/v4/LICENSE
deleted file mode 100644
index 5c486c3..0000000
--- a/vendor/github.com/jackc/pgx/v4/LICENSE
+++ /dev/null
@@ -1,22 +0,0 @@
-Copyright (c) 2013-2021 Jack Christensen
-
-MIT License
-
-Permission is hereby granted, free of charge, to any person obtaining
-a copy of this software and associated documentation files (the
-"Software"), to deal in the Software without restriction, including
-without limitation the rights to use, copy, modify, merge, publish,
-distribute, sublicense, and/or sell copies of the Software, and to
-permit persons to whom the Software is furnished to do so, subject to
-the following conditions:
-
-The above copyright notice and this permission notice shall be
-included in all copies or substantial portions of the Software.
-
-THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
-EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
-MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
-NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
-LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
-OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
-WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/vendor/github.com/jackc/pgx/v4/README.md b/vendor/github.com/jackc/pgx/v4/README.md
deleted file mode 100644
index ec92127..0000000
--- a/vendor/github.com/jackc/pgx/v4/README.md
+++ /dev/null
@@ -1,196 +0,0 @@
-[![](https://godoc.org/github.com/jackc/pgx?status.svg)](https://pkg.go.dev/github.com/jackc/pgx/v4)
-[![Build Status](https://travis-ci.org/jackc/pgx.svg)](https://travis-ci.org/jackc/pgx)
-
----
-
-This is the previous stable `v4` release. `v5` been released.
-
----
-# pgx - PostgreSQL Driver and Toolkit
-
-pgx is a pure Go driver and toolkit for PostgreSQL.
-
-pgx aims to be low-level, fast, and performant, while also enabling PostgreSQL-specific features that the standard `database/sql` package does not allow for.
-
-The driver component of pgx can be used alongside the standard `database/sql` package.
-
-The toolkit component is a related set of packages that implement PostgreSQL functionality such as parsing the wire protocol
-and type mapping between PostgreSQL and Go. These underlying packages can be used to implement alternative drivers,
-proxies, load balancers, logical replication clients, etc.
-
-The current release of `pgx v4` requires Go modules. To use the previous version, checkout and vendor the `v3` branch.
-
-## Example Usage
-
-```go
-package main
-
-import (
- "context"
- "fmt"
- "os"
-
- "github.com/jackc/pgx/v4"
-)
-
-func main() {
- // urlExample := "postgres://username:password@localhost:5432/database_name"
- conn, err := pgx.Connect(context.Background(), os.Getenv("DATABASE_URL"))
- if err != nil {
- fmt.Fprintf(os.Stderr, "Unable to connect to database: %v\n", err)
- os.Exit(1)
- }
- defer conn.Close(context.Background())
-
- var name string
- var weight int64
- err = conn.QueryRow(context.Background(), "select name, weight from widgets where id=$1", 42).Scan(&name, &weight)
- if err != nil {
- fmt.Fprintf(os.Stderr, "QueryRow failed: %v\n", err)
- os.Exit(1)
- }
-
- fmt.Println(name, weight)
-}
-```
-
-See the [getting started guide](https://github.com/jackc/pgx/wiki/Getting-started-with-pgx) for more information.
-
-## Choosing Between the pgx and database/sql Interfaces
-
-It is recommended to use the pgx interface if:
-1. The application only targets PostgreSQL.
-2. No other libraries that require `database/sql` are in use.
-
-The pgx interface is faster and exposes more features.
-
-The `database/sql` interface only allows the underlying driver to return or receive the following types: `int64`,
-`float64`, `bool`, `[]byte`, `string`, `time.Time`, or `nil`. Handling other types requires implementing the
-`database/sql.Scanner` and the `database/sql/driver/driver.Valuer` interfaces which require transmission of values in text format. The binary format can be substantially faster, which is what the pgx interface uses.
-
-## Features
-
-pgx supports many features beyond what is available through `database/sql`:
-
-* Support for approximately 70 different PostgreSQL types
-* Automatic statement preparation and caching
-* Batch queries
-* Single-round trip query mode
-* Full TLS connection control
-* Binary format support for custom types (allows for much quicker encoding/decoding)
-* COPY protocol support for faster bulk data loads
-* Extendable logging support including built-in support for `log15adapter`, [`logrus`](https://github.com/sirupsen/logrus), [`zap`](https://github.com/uber-go/zap), and [`zerolog`](https://github.com/rs/zerolog)
-* Connection pool with after-connect hook for arbitrary connection setup
-* Listen / notify
-* Conversion of PostgreSQL arrays to Go slice mappings for integers, floats, and strings
-* Hstore support
-* JSON and JSONB support
-* Maps `inet` and `cidr` PostgreSQL types to `net.IPNet` and `net.IP`
-* Large object support
-* NULL mapping to Null* struct or pointer to pointer
-* Supports `database/sql.Scanner` and `database/sql/driver.Valuer` interfaces for custom types
-* Notice response handling
-* Simulated nested transactions with savepoints
-
-## Performance
-
-There are three areas in particular where pgx can provide a significant performance advantage over the standard
-`database/sql` interface and other drivers:
-
-1. PostgreSQL specific types - Types such as arrays can be parsed much quicker because pgx uses the binary format.
-2. Automatic statement preparation and caching - pgx will prepare and cache statements by default. This can provide an
- significant free improvement to code that does not explicitly use prepared statements. Under certain workloads, it can
- perform nearly 3x the number of queries per second.
-3. Batched queries - Multiple queries can be batched together to minimize network round trips.
-
-## Testing
-
-pgx tests naturally require a PostgreSQL database. It will connect to the database specified in the `PGX_TEST_DATABASE` environment
-variable. The `PGX_TEST_DATABASE` environment variable can either be a URL or DSN. In addition, the standard `PG*` environment
-variables will be respected. Consider using [direnv](https://github.com/direnv/direnv) to simplify environment variable
-handling.
-
-### Example Test Environment
-
-Connect to your PostgreSQL server and run:
-
-```
-create database pgx_test;
-```
-
-Connect to the newly-created database and run:
-
-```
-create domain uint64 as numeric(20,0);
-```
-
-Now, you can run the tests:
-
-```
-PGX_TEST_DATABASE="host=/var/run/postgresql database=pgx_test" go test ./...
-```
-
-In addition, there are tests specific for PgBouncer that will be executed if `PGX_TEST_PGBOUNCER_CONN_STRING` is set.
-
-## Supported Go and PostgreSQL Versions
-
-pgx supports the same versions of Go and PostgreSQL that are supported by their respective teams. For [Go](https://golang.org/doc/devel/release.html#policy) that is the two most recent major releases and for [PostgreSQL](https://www.postgresql.org/support/versioning/) the major releases in the last 5 years. This means pgx supports Go 1.16 and higher and PostgreSQL 10 and higher. pgx also is tested against the latest version of [CockroachDB](https://www.cockroachlabs.com/product/).
-
-## Version Policy
-
-pgx follows semantic versioning for the documented public API on stable releases. `v4` is the latest stable major version.
-
-## PGX Family Libraries
-
-pgx is the head of a family of PostgreSQL libraries. Many of these can be used independently. Many can also be accessed
-from pgx for lower-level control.
-
-### [github.com/jackc/pgconn](https://github.com/jackc/pgconn)
-
-`pgconn` is a lower-level PostgreSQL database driver that operates at nearly the same level as the C library `libpq`.
-
-### [github.com/jackc/pgx/v4/pgxpool](https://github.com/jackc/pgx/tree/master/pgxpool)
-
-`pgxpool` is a connection pool for pgx. pgx is entirely decoupled from its default pool implementation. This means that pgx can be used with a different pool or without any pool at all.
-
-### [github.com/jackc/pgx/v4/stdlib](https://github.com/jackc/pgx/tree/master/stdlib)
-
-This is a `database/sql` compatibility layer for pgx. pgx can be used as a normal `database/sql` driver, but at any time, the native interface can be acquired for more performance or PostgreSQL specific functionality.
-
-### [github.com/jackc/pgtype](https://github.com/jackc/pgtype)
-
-Over 70 PostgreSQL types are supported including `uuid`, `hstore`, `json`, `bytea`, `numeric`, `interval`, `inet`, and arrays. These types support `database/sql` interfaces and are usable outside of pgx. They are fully tested in pgx and pq. They also support a higher performance interface when used with the pgx driver.
-
-### [github.com/jackc/pgproto3](https://github.com/jackc/pgproto3)
-
-pgproto3 provides standalone encoding and decoding of the PostgreSQL v3 wire protocol. This is useful for implementing very low level PostgreSQL tooling.
-
-### [github.com/jackc/pglogrepl](https://github.com/jackc/pglogrepl)
-
-pglogrepl provides functionality to act as a client for PostgreSQL logical replication.
-
-### [github.com/jackc/pgmock](https://github.com/jackc/pgmock)
-
-pgmock offers the ability to create a server that mocks the PostgreSQL wire protocol. This is used internally to test pgx by purposely inducing unusual errors. pgproto3 and pgmock together provide most of the foundational tooling required to implement a PostgreSQL proxy or MitM (such as for a custom connection pooler).
-
-### [github.com/jackc/tern](https://github.com/jackc/tern)
-
-tern is a stand-alone SQL migration system.
-
-### [github.com/jackc/pgerrcode](https://github.com/jackc/pgerrcode)
-
-pgerrcode contains constants for the PostgreSQL error codes.
-
-## 3rd Party Libraries with PGX Support
-
-### [github.com/georgysavva/scany](https://github.com/georgysavva/scany)
-
-Library for scanning data from a database into Go structs and more.
-
-### [https://github.com/otan/gopgkrb5](https://github.com/otan/gopgkrb5)
-
-Adds GSSAPI / Kerberos authentication support.
-
-### [https://github.com/vgarvardt/pgx-google-uuid](https://github.com/vgarvardt/pgx-google-uuid)
-
-Adds support for [`github.com/google/uuid`](https://github.com/google/uuid).
diff --git a/vendor/github.com/jackc/pgx/v4/batch.go b/vendor/github.com/jackc/pgx/v4/batch.go
deleted file mode 100644
index 7f86ad5..0000000
--- a/vendor/github.com/jackc/pgx/v4/batch.go
+++ /dev/null
@@ -1,228 +0,0 @@
-package pgx
-
-import (
- "context"
- "errors"
- "fmt"
-
- "github.com/jackc/pgconn"
-)
-
-type batchItem struct {
- query string
- arguments []interface{}
-}
-
-// Batch queries are a way of bundling multiple queries together to avoid
-// unnecessary network round trips.
-type Batch struct {
- items []*batchItem
-}
-
-// Queue queues a query to batch b. query can be an SQL query or the name of a prepared statement.
-func (b *Batch) Queue(query string, arguments ...interface{}) {
- b.items = append(b.items, &batchItem{
- query: query,
- arguments: arguments,
- })
-}
-
-// Len returns number of queries that have been queued so far.
-func (b *Batch) Len() int {
- return len(b.items)
-}
-
-type BatchResults interface {
- // Exec reads the results from the next query in the batch as if the query has been sent with Conn.Exec.
- Exec() (pgconn.CommandTag, error)
-
- // Query reads the results from the next query in the batch as if the query has been sent with Conn.Query.
- Query() (Rows, error)
-
- // QueryRow reads the results from the next query in the batch as if the query has been sent with Conn.QueryRow.
- QueryRow() Row
-
- // QueryFunc reads the results from the next query in the batch as if the query has been sent with Conn.QueryFunc.
- QueryFunc(scans []interface{}, f func(QueryFuncRow) error) (pgconn.CommandTag, error)
-
- // Close closes the batch operation. This must be called before the underlying connection can be used again. Any error
- // that occurred during a batch operation may have made it impossible to resyncronize the connection with the server.
- // In this case the underlying connection will have been closed. Close is safe to call multiple times.
- Close() error
-}
-
-type batchResults struct {
- ctx context.Context
- conn *Conn
- mrr *pgconn.MultiResultReader
- err error
- b *Batch
- ix int
- closed bool
-}
-
-// Exec reads the results from the next query in the batch as if the query has been sent with Exec.
-func (br *batchResults) Exec() (pgconn.CommandTag, error) {
- if br.err != nil {
- return nil, br.err
- }
- if br.closed {
- return nil, fmt.Errorf("batch already closed")
- }
-
- query, arguments, _ := br.nextQueryAndArgs()
-
- if !br.mrr.NextResult() {
- err := br.mrr.Close()
- if err == nil {
- err = errors.New("no result")
- }
- if br.conn.shouldLog(LogLevelError) {
- br.conn.log(br.ctx, LogLevelError, "BatchResult.Exec", map[string]interface{}{
- "sql": query,
- "args": logQueryArgs(arguments),
- "err": err,
- })
- }
- return nil, err
- }
-
- commandTag, err := br.mrr.ResultReader().Close()
-
- if err != nil {
- if br.conn.shouldLog(LogLevelError) {
- br.conn.log(br.ctx, LogLevelError, "BatchResult.Exec", map[string]interface{}{
- "sql": query,
- "args": logQueryArgs(arguments),
- "err": err,
- })
- }
- } else if br.conn.shouldLog(LogLevelInfo) {
- br.conn.log(br.ctx, LogLevelInfo, "BatchResult.Exec", map[string]interface{}{
- "sql": query,
- "args": logQueryArgs(arguments),
- "commandTag": commandTag,
- })
- }
-
- return commandTag, err
-}
-
-// Query reads the results from the next query in the batch as if the query has been sent with Query.
-func (br *batchResults) Query() (Rows, error) {
- query, arguments, ok := br.nextQueryAndArgs()
- if !ok {
- query = "batch query"
- }
-
- if br.err != nil {
- return &connRows{err: br.err, closed: true}, br.err
- }
-
- if br.closed {
- alreadyClosedErr := fmt.Errorf("batch already closed")
- return &connRows{err: alreadyClosedErr, closed: true}, alreadyClosedErr
- }
-
- rows := br.conn.getRows(br.ctx, query, arguments)
-
- if !br.mrr.NextResult() {
- rows.err = br.mrr.Close()
- if rows.err == nil {
- rows.err = errors.New("no result")
- }
- rows.closed = true
-
- if br.conn.shouldLog(LogLevelError) {
- br.conn.log(br.ctx, LogLevelError, "BatchResult.Query", map[string]interface{}{
- "sql": query,
- "args": logQueryArgs(arguments),
- "err": rows.err,
- })
- }
-
- return rows, rows.err
- }
-
- rows.resultReader = br.mrr.ResultReader()
- return rows, nil
-}
-
-// QueryFunc reads the results from the next query in the batch as if the query has been sent with Conn.QueryFunc.
-func (br *batchResults) QueryFunc(scans []interface{}, f func(QueryFuncRow) error) (pgconn.CommandTag, error) {
- if br.closed {
- return nil, fmt.Errorf("batch already closed")
- }
-
- rows, err := br.Query()
- if err != nil {
- return nil, err
- }
- defer rows.Close()
-
- for rows.Next() {
- err = rows.Scan(scans...)
- if err != nil {
- return nil, err
- }
-
- err = f(rows)
- if err != nil {
- return nil, err
- }
- }
-
- if err := rows.Err(); err != nil {
- return nil, err
- }
-
- return rows.CommandTag(), nil
-}
-
-// QueryRow reads the results from the next query in the batch as if the query has been sent with QueryRow.
-func (br *batchResults) QueryRow() Row {
- rows, _ := br.Query()
- return (*connRow)(rows.(*connRows))
-
-}
-
-// Close closes the batch operation. Any error that occurred during a batch operation may have made it impossible to
-// resyncronize the connection with the server. In this case the underlying connection will have been closed.
-func (br *batchResults) Close() error {
- if br.err != nil {
- return br.err
- }
-
- if br.closed {
- return nil
- }
- br.closed = true
-
- // log any queries that haven't yet been logged by Exec or Query
- for {
- query, args, ok := br.nextQueryAndArgs()
- if !ok {
- break
- }
-
- if br.conn.shouldLog(LogLevelInfo) {
- br.conn.log(br.ctx, LogLevelInfo, "BatchResult.Close", map[string]interface{}{
- "sql": query,
- "args": logQueryArgs(args),
- })
- }
- }
-
- return br.mrr.Close()
-}
-
-func (br *batchResults) nextQueryAndArgs() (query string, args []interface{}, ok bool) {
- if br.b != nil && br.ix < len(br.b.items) {
- bi := br.b.items[br.ix]
- query = bi.query
- args = bi.arguments
- ok = true
- br.ix++
- }
- return
-}
diff --git a/vendor/github.com/jackc/pgx/v4/conn.go b/vendor/github.com/jackc/pgx/v4/conn.go
deleted file mode 100644
index 6f83f49..0000000
--- a/vendor/github.com/jackc/pgx/v4/conn.go
+++ /dev/null
@@ -1,857 +0,0 @@
-package pgx
-
-import (
- "context"
- "errors"
- "fmt"
- "strconv"
- "strings"
- "time"
-
- "github.com/jackc/pgconn"
- "github.com/jackc/pgconn/stmtcache"
- "github.com/jackc/pgproto3/v2"
- "github.com/jackc/pgtype"
- "github.com/jackc/pgx/v4/internal/sanitize"
-)
-
-// ConnConfig contains all the options used to establish a connection. It must be created by ParseConfig and
-// then it can be modified. A manually initialized ConnConfig will cause ConnectConfig to panic.
-type ConnConfig struct {
- pgconn.Config
- Logger Logger
- LogLevel LogLevel
-
- // Original connection string that was parsed into config.
- connString string
-
- // BuildStatementCache creates the stmtcache.Cache implementation for connections created with this config. Set
- // to nil to disable automatic prepared statements.
- BuildStatementCache BuildStatementCacheFunc
-
- // PreferSimpleProtocol disables implicit prepared statement usage. By default pgx automatically uses the extended
- // protocol. This can improve performance due to being able to use the binary format. It also does not rely on client
- // side parameter sanitization. However, it does incur two round-trips per query (unless using a prepared statement)
- // and may be incompatible proxies such as PGBouncer. Setting PreferSimpleProtocol causes the simple protocol to be
- // used by default. The same functionality can be controlled on a per query basis by setting
- // QueryExOptions.SimpleProtocol.
- PreferSimpleProtocol bool
-
- createdByParseConfig bool // Used to enforce created by ParseConfig rule.
-}
-
-// Copy returns a deep copy of the config that is safe to use and modify.
-// The only exception is the tls.Config:
-// according to the tls.Config docs it must not be modified after creation.
-func (cc *ConnConfig) Copy() *ConnConfig {
- newConfig := new(ConnConfig)
- *newConfig = *cc
- newConfig.Config = *newConfig.Config.Copy()
- return newConfig
-}
-
-// ConnString returns the connection string as parsed by pgx.ParseConfig into pgx.ConnConfig.
-func (cc *ConnConfig) ConnString() string { return cc.connString }
-
-// BuildStatementCacheFunc is a function that can be used to create a stmtcache.Cache implementation for connection.
-type BuildStatementCacheFunc func(conn *pgconn.PgConn) stmtcache.Cache
-
-// Conn is a PostgreSQL connection handle. It is not safe for concurrent usage. Use a connection pool to manage access
-// to multiple database connections from multiple goroutines.
-type Conn struct {
- pgConn *pgconn.PgConn
- config *ConnConfig // config used when establishing this connection
- preparedStatements map[string]*pgconn.StatementDescription
- stmtcache stmtcache.Cache
- logger Logger
- logLevel LogLevel
-
- notifications []*pgconn.Notification
-
- doneChan chan struct{}
- closedChan chan error
-
- connInfo *pgtype.ConnInfo
-
- wbuf []byte
- eqb extendedQueryBuilder
-}
-
-// Identifier a PostgreSQL identifier or name. Identifiers can be composed of
-// multiple parts such as ["schema", "table"] or ["table", "column"].
-type Identifier []string
-
-// Sanitize returns a sanitized string safe for SQL interpolation.
-func (ident Identifier) Sanitize() string {
- parts := make([]string, len(ident))
- for i := range ident {
- s := strings.ReplaceAll(ident[i], string([]byte{0}), "")
- parts[i] = `"` + strings.ReplaceAll(s, `"`, `""`) + `"`
- }
- return strings.Join(parts, ".")
-}
-
-// ErrNoRows occurs when rows are expected but none are returned.
-var ErrNoRows = errors.New("no rows in result set")
-
-// ErrInvalidLogLevel occurs on attempt to set an invalid log level.
-var ErrInvalidLogLevel = errors.New("invalid log level")
-
-// Connect establishes a connection with a PostgreSQL server with a connection string. See
-// pgconn.Connect for details.
-func Connect(ctx context.Context, connString string) (*Conn, error) {
- connConfig, err := ParseConfig(connString)
- if err != nil {
- return nil, err
- }
- return connect(ctx, connConfig)
-}
-
-// ConnectConfig establishes a connection with a PostgreSQL server with a configuration struct.
-// connConfig must have been created by ParseConfig.
-func ConnectConfig(ctx context.Context, connConfig *ConnConfig) (*Conn, error) {
- return connect(ctx, connConfig)
-}
-
-// ParseConfig creates a ConnConfig from a connection string. ParseConfig handles all options that pgconn.ParseConfig
-// does. In addition, it accepts the following options:
-//
-// statement_cache_capacity
-// The maximum size of the automatic statement cache. Set to 0 to disable automatic statement caching. Default: 512.
-//
-// statement_cache_mode
-// Possible values: "prepare" and "describe". "prepare" will create prepared statements on the PostgreSQL server.
-// "describe" will use the anonymous prepared statement to describe a statement without creating a statement on the
-// server. "describe" is primarily useful when the environment does not allow prepared statements such as when
-// running a connection pooler like PgBouncer. Default: "prepare"
-//
-// prefer_simple_protocol
-// Possible values: "true" and "false". Use the simple protocol instead of extended protocol. Default: false
-func ParseConfig(connString string) (*ConnConfig, error) {
- config, err := pgconn.ParseConfig(connString)
- if err != nil {
- return nil, err
- }
-
- var buildStatementCache BuildStatementCacheFunc
- statementCacheCapacity := 512
- statementCacheMode := stmtcache.ModePrepare
- if s, ok := config.RuntimeParams["statement_cache_capacity"]; ok {
- delete(config.RuntimeParams, "statement_cache_capacity")
- n, err := strconv.ParseInt(s, 10, 32)
- if err != nil {
- return nil, fmt.Errorf("cannot parse statement_cache_capacity: %w", err)
- }
- statementCacheCapacity = int(n)
- }
-
- if s, ok := config.RuntimeParams["statement_cache_mode"]; ok {
- delete(config.RuntimeParams, "statement_cache_mode")
- switch s {
- case "prepare":
- statementCacheMode = stmtcache.ModePrepare
- case "describe":
- statementCacheMode = stmtcache.ModeDescribe
- default:
- return nil, fmt.Errorf("invalid statement_cache_mod: %s", s)
- }
- }
-
- if statementCacheCapacity > 0 {
- buildStatementCache = func(conn *pgconn.PgConn) stmtcache.Cache {
- return stmtcache.New(conn, statementCacheMode, statementCacheCapacity)
- }
- }
-
- preferSimpleProtocol := false
- if s, ok := config.RuntimeParams["prefer_simple_protocol"]; ok {
- delete(config.RuntimeParams, "prefer_simple_protocol")
- if b, err := strconv.ParseBool(s); err == nil {
- preferSimpleProtocol = b
- } else {
- return nil, fmt.Errorf("invalid prefer_simple_protocol: %v", err)
- }
- }
-
- connConfig := &ConnConfig{
- Config: *config,
- createdByParseConfig: true,
- LogLevel: LogLevelInfo,
- BuildStatementCache: buildStatementCache,
- PreferSimpleProtocol: preferSimpleProtocol,
- connString: connString,
- }
-
- return connConfig, nil
-}
-
-func connect(ctx context.Context, config *ConnConfig) (c *Conn, err error) {
- // Default values are set in ParseConfig. Enforce initial creation by ParseConfig rather than setting defaults from
- // zero values.
- if !config.createdByParseConfig {
- panic("config must be created by ParseConfig")
- }
- originalConfig := config
-
- // This isn't really a deep copy. But it is enough to avoid the config.Config.OnNotification mutation from affecting
- // other connections with the same config. See https://github.com/jackc/pgx/issues/618.
- {
- configCopy := *config
- config = &configCopy
- }
-
- c = &Conn{
- config: originalConfig,
- connInfo: pgtype.NewConnInfo(),
- logLevel: config.LogLevel,
- logger: config.Logger,
- }
-
- // Only install pgx notification system if no other callback handler is present.
- if config.Config.OnNotification == nil {
- config.Config.OnNotification = c.bufferNotifications
- } else {
- if c.shouldLog(LogLevelDebug) {
- c.log(ctx, LogLevelDebug, "pgx notification handler disabled by application supplied OnNotification", map[string]interface{}{"host": config.Config.Host})
- }
- }
-
- if c.shouldLog(LogLevelInfo) {
- c.log(ctx, LogLevelInfo, "Dialing PostgreSQL server", map[string]interface{}{"host": config.Config.Host})
- }
- c.pgConn, err = pgconn.ConnectConfig(ctx, &config.Config)
- if err != nil {
- if c.shouldLog(LogLevelError) {
- c.log(ctx, LogLevelError, "connect failed", map[string]interface{}{"err": err})
- }
- return nil, err
- }
-
- c.preparedStatements = make(map[string]*pgconn.StatementDescription)
- c.doneChan = make(chan struct{})
- c.closedChan = make(chan error)
- c.wbuf = make([]byte, 0, 1024)
-
- if c.config.BuildStatementCache != nil {
- c.stmtcache = c.config.BuildStatementCache(c.pgConn)
- }
-
- // Replication connections can't execute the queries to
- // populate the c.PgTypes and c.pgsqlAfInet
- if _, ok := config.Config.RuntimeParams["replication"]; ok {
- return c, nil
- }
-
- return c, nil
-}
-
-// Close closes a connection. It is safe to call Close on a already closed
-// connection.
-func (c *Conn) Close(ctx context.Context) error {
- if c.IsClosed() {
- return nil
- }
-
- err := c.pgConn.Close(ctx)
- if c.shouldLog(LogLevelInfo) {
- c.log(ctx, LogLevelInfo, "closed connection", nil)
- }
- return err
-}
-
-// Prepare creates a prepared statement with name and sql. sql can contain placeholders
-// for bound parameters. These placeholders are referenced positional as $1, $2, etc.
-//
-// Prepare is idempotent; i.e. it is safe to call Prepare multiple times with the same
-// name and sql arguments. This allows a code path to Prepare and Query/Exec without
-// concern for if the statement has already been prepared.
-func (c *Conn) Prepare(ctx context.Context, name, sql string) (sd *pgconn.StatementDescription, err error) {
- if name != "" {
- var ok bool
- if sd, ok = c.preparedStatements[name]; ok && sd.SQL == sql {
- return sd, nil
- }
- }
-
- if c.shouldLog(LogLevelError) {
- defer func() {
- if err != nil {
- c.log(ctx, LogLevelError, "Prepare failed", map[string]interface{}{"err": err, "name": name, "sql": sql})
- }
- }()
- }
-
- sd, err = c.pgConn.Prepare(ctx, name, sql, nil)
- if err != nil {
- return nil, err
- }
-
- if name != "" {
- c.preparedStatements[name] = sd
- }
-
- return sd, nil
-}
-
-// Deallocate released a prepared statement
-func (c *Conn) Deallocate(ctx context.Context, name string) error {
- delete(c.preparedStatements, name)
- _, err := c.pgConn.Exec(ctx, "deallocate "+quoteIdentifier(name)).ReadAll()
- return err
-}
-
-func (c *Conn) bufferNotifications(_ *pgconn.PgConn, n *pgconn.Notification) {
- c.notifications = append(c.notifications, n)
-}
-
-// WaitForNotification waits for a PostgreSQL notification. It wraps the underlying pgconn notification system in a
-// slightly more convenient form.
-func (c *Conn) WaitForNotification(ctx context.Context) (*pgconn.Notification, error) {
- var n *pgconn.Notification
-
- // Return already received notification immediately
- if len(c.notifications) > 0 {
- n = c.notifications[0]
- c.notifications = c.notifications[1:]
- return n, nil
- }
-
- err := c.pgConn.WaitForNotification(ctx)
- if len(c.notifications) > 0 {
- n = c.notifications[0]
- c.notifications = c.notifications[1:]
- }
- return n, err
-}
-
-// IsClosed reports if the connection has been closed.
-func (c *Conn) IsClosed() bool {
- return c.pgConn.IsClosed()
-}
-
-func (c *Conn) die(err error) {
- if c.IsClosed() {
- return
- }
-
- ctx, cancel := context.WithCancel(context.Background())
- cancel() // force immediate hard cancel
- c.pgConn.Close(ctx)
-}
-
-func (c *Conn) shouldLog(lvl LogLevel) bool {
- return c.logger != nil && c.logLevel >= lvl
-}
-
-func (c *Conn) log(ctx context.Context, lvl LogLevel, msg string, data map[string]interface{}) {
- if data == nil {
- data = map[string]interface{}{}
- }
- if c.pgConn != nil && c.pgConn.PID() != 0 {
- data["pid"] = c.pgConn.PID()
- }
-
- c.logger.Log(ctx, lvl, msg, data)
-}
-
-func quoteIdentifier(s string) string {
- return `"` + strings.ReplaceAll(s, `"`, `""`) + `"`
-}
-
-// Ping executes an empty sql statement against the *Conn
-// If the sql returns without error, the database Ping is considered successful, otherwise, the error is returned.
-func (c *Conn) Ping(ctx context.Context) error {
- _, err := c.Exec(ctx, ";")
- return err
-}
-
-// PgConn returns the underlying *pgconn.PgConn. This is an escape hatch method that allows lower level access to the
-// PostgreSQL connection than pgx exposes.
-//
-// It is strongly recommended that the connection be idle (no in-progress queries) before the underlying *pgconn.PgConn
-// is used and the connection must be returned to the same state before any *pgx.Conn methods are again used.
-func (c *Conn) PgConn() *pgconn.PgConn { return c.pgConn }
-
-// StatementCache returns the statement cache used for this connection.
-func (c *Conn) StatementCache() stmtcache.Cache { return c.stmtcache }
-
-// ConnInfo returns the connection info used for this connection.
-func (c *Conn) ConnInfo() *pgtype.ConnInfo { return c.connInfo }
-
-// Config returns a copy of config that was used to establish this connection.
-func (c *Conn) Config() *ConnConfig { return c.config.Copy() }
-
-// Exec executes sql. sql can be either a prepared statement name or an SQL string. arguments should be referenced
-// positionally from the sql string as $1, $2, etc.
-func (c *Conn) Exec(ctx context.Context, sql string, arguments ...interface{}) (pgconn.CommandTag, error) {
- startTime := time.Now()
-
- commandTag, err := c.exec(ctx, sql, arguments...)
- if err != nil {
- if c.shouldLog(LogLevelError) {
- endTime := time.Now()
- c.log(ctx, LogLevelError, "Exec", map[string]interface{}{"sql": sql, "args": logQueryArgs(arguments), "err": err, "time": endTime.Sub(startTime)})
- }
- return commandTag, err
- }
-
- if c.shouldLog(LogLevelInfo) {
- endTime := time.Now()
- c.log(ctx, LogLevelInfo, "Exec", map[string]interface{}{"sql": sql, "args": logQueryArgs(arguments), "time": endTime.Sub(startTime), "commandTag": commandTag})
- }
-
- return commandTag, err
-}
-
-func (c *Conn) exec(ctx context.Context, sql string, arguments ...interface{}) (commandTag pgconn.CommandTag, err error) {
- simpleProtocol := c.config.PreferSimpleProtocol
-
-optionLoop:
- for len(arguments) > 0 {
- switch arg := arguments[0].(type) {
- case QuerySimpleProtocol:
- simpleProtocol = bool(arg)
- arguments = arguments[1:]
- default:
- break optionLoop
- }
- }
-
- if sd, ok := c.preparedStatements[sql]; ok {
- return c.execPrepared(ctx, sd, arguments)
- }
-
- if simpleProtocol {
- return c.execSimpleProtocol(ctx, sql, arguments)
- }
-
- if len(arguments) == 0 {
- return c.execSimpleProtocol(ctx, sql, arguments)
- }
-
- if c.stmtcache != nil {
- sd, err := c.stmtcache.Get(ctx, sql)
- if err != nil {
- return nil, err
- }
-
- if c.stmtcache.Mode() == stmtcache.ModeDescribe {
- return c.execParams(ctx, sd, arguments)
- }
- return c.execPrepared(ctx, sd, arguments)
- }
-
- sd, err := c.Prepare(ctx, "", sql)
- if err != nil {
- return nil, err
- }
- return c.execPrepared(ctx, sd, arguments)
-}
-
-func (c *Conn) execSimpleProtocol(ctx context.Context, sql string, arguments []interface{}) (commandTag pgconn.CommandTag, err error) {
- if len(arguments) > 0 {
- sql, err = c.sanitizeForSimpleQuery(sql, arguments...)
- if err != nil {
- return nil, err
- }
- }
-
- mrr := c.pgConn.Exec(ctx, sql)
- for mrr.NextResult() {
- commandTag, err = mrr.ResultReader().Close()
- }
- err = mrr.Close()
- return commandTag, err
-}
-
-func (c *Conn) execParamsAndPreparedPrefix(sd *pgconn.StatementDescription, arguments []interface{}) error {
- if len(sd.ParamOIDs) != len(arguments) {
- return fmt.Errorf("expected %d arguments, got %d", len(sd.ParamOIDs), len(arguments))
- }
-
- c.eqb.Reset()
-
- args, err := convertDriverValuers(arguments)
- if err != nil {
- return err
- }
-
- for i := range args {
- err = c.eqb.AppendParam(c.connInfo, sd.ParamOIDs[i], args[i])
- if err != nil {
- return err
- }
- }
-
- for i := range sd.Fields {
- c.eqb.AppendResultFormat(c.ConnInfo().ResultFormatCodeForOID(sd.Fields[i].DataTypeOID))
- }
-
- return nil
-}
-
-func (c *Conn) execParams(ctx context.Context, sd *pgconn.StatementDescription, arguments []interface{}) (pgconn.CommandTag, error) {
- err := c.execParamsAndPreparedPrefix(sd, arguments)
- if err != nil {
- return nil, err
- }
-
- result := c.pgConn.ExecParams(ctx, sd.SQL, c.eqb.paramValues, sd.ParamOIDs, c.eqb.paramFormats, c.eqb.resultFormats).Read()
- c.eqb.Reset() // Allow c.eqb internal memory to be GC'ed as soon as possible.
- return result.CommandTag, result.Err
-}
-
-func (c *Conn) execPrepared(ctx context.Context, sd *pgconn.StatementDescription, arguments []interface{}) (pgconn.CommandTag, error) {
- err := c.execParamsAndPreparedPrefix(sd, arguments)
- if err != nil {
- return nil, err
- }
-
- result := c.pgConn.ExecPrepared(ctx, sd.Name, c.eqb.paramValues, c.eqb.paramFormats, c.eqb.resultFormats).Read()
- c.eqb.Reset() // Allow c.eqb internal memory to be GC'ed as soon as possible.
- return result.CommandTag, result.Err
-}
-
-func (c *Conn) getRows(ctx context.Context, sql string, args []interface{}) *connRows {
- r := &connRows{}
-
- r.ctx = ctx
- r.logger = c
- r.connInfo = c.connInfo
- r.startTime = time.Now()
- r.sql = sql
- r.args = args
- r.conn = c
-
- return r
-}
-
-// QuerySimpleProtocol controls whether the simple or extended protocol is used to send the query.
-type QuerySimpleProtocol bool
-
-// QueryResultFormats controls the result format (text=0, binary=1) of a query by result column position.
-type QueryResultFormats []int16
-
-// QueryResultFormatsByOID controls the result format (text=0, binary=1) of a query by the result column OID.
-type QueryResultFormatsByOID map[uint32]int16
-
-// Query sends a query to the server and returns a Rows to read the results. Only errors encountered sending the query
-// and initializing Rows will be returned. Err() on the returned Rows must be checked after the Rows is closed to
-// determine if the query executed successfully.
-//
-// The returned Rows must be closed before the connection can be used again. It is safe to attempt to read from the
-// returned Rows even if an error is returned. The error will be the available in rows.Err() after rows are closed. It
-// is allowed to ignore the error returned from Query and handle it in Rows.
-//
-// Err() on the returned Rows must be checked after the Rows is closed to determine if the query executed successfully
-// as some errors can only be detected by reading the entire response. e.g. A divide by zero error on the last row.
-//
-// For extra control over how the query is executed, the types QuerySimpleProtocol, QueryResultFormats, and
-// QueryResultFormatsByOID may be used as the first args to control exactly how the query is executed. This is rarely
-// needed. See the documentation for those types for details.
-func (c *Conn) Query(ctx context.Context, sql string, args ...interface{}) (Rows, error) {
- var resultFormats QueryResultFormats
- var resultFormatsByOID QueryResultFormatsByOID
- simpleProtocol := c.config.PreferSimpleProtocol
-
-optionLoop:
- for len(args) > 0 {
- switch arg := args[0].(type) {
- case QueryResultFormats:
- resultFormats = arg
- args = args[1:]
- case QueryResultFormatsByOID:
- resultFormatsByOID = arg
- args = args[1:]
- case QuerySimpleProtocol:
- simpleProtocol = bool(arg)
- args = args[1:]
- default:
- break optionLoop
- }
- }
-
- rows := c.getRows(ctx, sql, args)
-
- var err error
- sd, ok := c.preparedStatements[sql]
-
- if simpleProtocol && !ok {
- sql, err = c.sanitizeForSimpleQuery(sql, args...)
- if err != nil {
- rows.fatal(err)
- return rows, err
- }
-
- mrr := c.pgConn.Exec(ctx, sql)
- if mrr.NextResult() {
- rows.resultReader = mrr.ResultReader()
- rows.multiResultReader = mrr
- } else {
- err = mrr.Close()
- rows.fatal(err)
- return rows, err
- }
-
- return rows, nil
- }
-
- c.eqb.Reset()
-
- if !ok {
- if c.stmtcache != nil {
- sd, err = c.stmtcache.Get(ctx, sql)
- if err != nil {
- rows.fatal(err)
- return rows, rows.err
- }
- } else {
- sd, err = c.pgConn.Prepare(ctx, "", sql, nil)
- if err != nil {
- rows.fatal(err)
- return rows, rows.err
- }
- }
- }
- if len(sd.ParamOIDs) != len(args) {
- rows.fatal(fmt.Errorf("expected %d arguments, got %d", len(sd.ParamOIDs), len(args)))
- return rows, rows.err
- }
-
- rows.sql = sd.SQL
-
- args, err = convertDriverValuers(args)
- if err != nil {
- rows.fatal(err)
- return rows, rows.err
- }
-
- for i := range args {
- err = c.eqb.AppendParam(c.connInfo, sd.ParamOIDs[i], args[i])
- if err != nil {
- rows.fatal(err)
- return rows, rows.err
- }
- }
-
- if resultFormatsByOID != nil {
- resultFormats = make([]int16, len(sd.Fields))
- for i := range resultFormats {
- resultFormats[i] = resultFormatsByOID[uint32(sd.Fields[i].DataTypeOID)]
- }
- }
-
- if resultFormats == nil {
- for i := range sd.Fields {
- c.eqb.AppendResultFormat(c.ConnInfo().ResultFormatCodeForOID(sd.Fields[i].DataTypeOID))
- }
-
- resultFormats = c.eqb.resultFormats
- }
-
- if c.stmtcache != nil && c.stmtcache.Mode() == stmtcache.ModeDescribe && !ok {
- rows.resultReader = c.pgConn.ExecParams(ctx, sql, c.eqb.paramValues, sd.ParamOIDs, c.eqb.paramFormats, resultFormats)
- } else {
- rows.resultReader = c.pgConn.ExecPrepared(ctx, sd.Name, c.eqb.paramValues, c.eqb.paramFormats, resultFormats)
- }
-
- c.eqb.Reset() // Allow c.eqb internal memory to be GC'ed as soon as possible.
-
- return rows, rows.err
-}
-
-// QueryRow is a convenience wrapper over Query. Any error that occurs while
-// querying is deferred until calling Scan on the returned Row. That Row will
-// error with ErrNoRows if no rows are returned.
-func (c *Conn) QueryRow(ctx context.Context, sql string, args ...interface{}) Row {
- rows, _ := c.Query(ctx, sql, args...)
- return (*connRow)(rows.(*connRows))
-}
-
-// QueryFuncRow is the argument to the QueryFunc callback function.
-//
-// QueryFuncRow is an interface instead of a struct to allow tests to mock QueryFunc. However, adding a method to an
-// interface is technically a breaking change. Because of this the QueryFuncRow interface is partially excluded from
-// semantic version requirements. Methods will not be removed or changed, but new methods may be added.
-type QueryFuncRow interface {
- FieldDescriptions() []pgproto3.FieldDescription
-
- // RawValues returns the unparsed bytes of the row values. The returned [][]byte is only valid during the current
- // function call. However, the underlying byte data is safe to retain a reference to and mutate.
- RawValues() [][]byte
-}
-
-// QueryFunc executes sql with args. For each row returned by the query the values will scanned into the elements of
-// scans and f will be called. If any row fails to scan or f returns an error the query will be aborted and the error
-// will be returned.
-func (c *Conn) QueryFunc(ctx context.Context, sql string, args []interface{}, scans []interface{}, f func(QueryFuncRow) error) (pgconn.CommandTag, error) {
- rows, err := c.Query(ctx, sql, args...)
- if err != nil {
- return nil, err
- }
- defer rows.Close()
-
- for rows.Next() {
- err = rows.Scan(scans...)
- if err != nil {
- return nil, err
- }
-
- err = f(rows)
- if err != nil {
- return nil, err
- }
- }
-
- if err := rows.Err(); err != nil {
- return nil, err
- }
-
- return rows.CommandTag(), nil
-}
-
-// SendBatch sends all queued queries to the server at once. All queries are run in an implicit transaction unless
-// explicit transaction control statements are executed. The returned BatchResults must be closed before the connection
-// is used again.
-func (c *Conn) SendBatch(ctx context.Context, b *Batch) BatchResults {
- startTime := time.Now()
-
- simpleProtocol := c.config.PreferSimpleProtocol
- var sb strings.Builder
- if simpleProtocol {
- for i, bi := range b.items {
- if i > 0 {
- sb.WriteByte(';')
- }
- sql, err := c.sanitizeForSimpleQuery(bi.query, bi.arguments...)
- if err != nil {
- return &batchResults{ctx: ctx, conn: c, err: err}
- }
- sb.WriteString(sql)
- }
- mrr := c.pgConn.Exec(ctx, sb.String())
- return &batchResults{
- ctx: ctx,
- conn: c,
- mrr: mrr,
- b: b,
- ix: 0,
- }
- }
-
- distinctUnpreparedQueries := map[string]struct{}{}
-
- for _, bi := range b.items {
- if _, ok := c.preparedStatements[bi.query]; ok {
- continue
- }
- distinctUnpreparedQueries[bi.query] = struct{}{}
- }
-
- var stmtCache stmtcache.Cache
- if len(distinctUnpreparedQueries) > 0 {
- if c.stmtcache != nil && c.stmtcache.Cap() >= len(distinctUnpreparedQueries) {
- stmtCache = c.stmtcache
- } else {
- stmtCache = stmtcache.New(c.pgConn, stmtcache.ModeDescribe, len(distinctUnpreparedQueries))
- }
-
- for sql, _ := range distinctUnpreparedQueries {
- _, err := stmtCache.Get(ctx, sql)
- if err != nil {
- return &batchResults{ctx: ctx, conn: c, err: err}
- }
- }
- }
-
- batch := &pgconn.Batch{}
-
- for _, bi := range b.items {
- c.eqb.Reset()
-
- sd := c.preparedStatements[bi.query]
- if sd == nil {
- var err error
- sd, err = stmtCache.Get(ctx, bi.query)
- if err != nil {
- return c.logBatchResults(ctx, startTime, &batchResults{ctx: ctx, conn: c, err: err})
- }
- }
-
- if len(sd.ParamOIDs) != len(bi.arguments) {
- return c.logBatchResults(ctx, startTime, &batchResults{ctx: ctx, conn: c, err: fmt.Errorf("mismatched param and argument count")})
- }
-
- args, err := convertDriverValuers(bi.arguments)
- if err != nil {
- return c.logBatchResults(ctx, startTime, &batchResults{ctx: ctx, conn: c, err: err})
- }
-
- for i := range args {
- err = c.eqb.AppendParam(c.connInfo, sd.ParamOIDs[i], args[i])
- if err != nil {
- return c.logBatchResults(ctx, startTime, &batchResults{ctx: ctx, conn: c, err: err})
- }
- }
-
- for i := range sd.Fields {
- c.eqb.AppendResultFormat(c.ConnInfo().ResultFormatCodeForOID(sd.Fields[i].DataTypeOID))
- }
-
- if sd.Name == "" {
- batch.ExecParams(bi.query, c.eqb.paramValues, sd.ParamOIDs, c.eqb.paramFormats, c.eqb.resultFormats)
- } else {
- batch.ExecPrepared(sd.Name, c.eqb.paramValues, c.eqb.paramFormats, c.eqb.resultFormats)
- }
- }
-
- c.eqb.Reset() // Allow c.eqb internal memory to be GC'ed as soon as possible.
-
- mrr := c.pgConn.ExecBatch(ctx, batch)
-
- return c.logBatchResults(ctx, startTime, &batchResults{
- ctx: ctx,
- conn: c,
- mrr: mrr,
- b: b,
- ix: 0,
- })
-}
-
-func (c *Conn) logBatchResults(ctx context.Context, startTime time.Time, results *batchResults) BatchResults {
- if results.err != nil {
- if c.shouldLog(LogLevelError) {
- endTime := time.Now()
- c.log(ctx, LogLevelError, "SendBatch", map[string]interface{}{"err": results.err, "time": endTime.Sub(startTime)})
- }
- return results
- }
-
- if c.shouldLog(LogLevelInfo) {
- endTime := time.Now()
- c.log(ctx, LogLevelInfo, "SendBatch", map[string]interface{}{"batchLen": results.b.Len(), "time": endTime.Sub(startTime)})
- }
-
- return results
-}
-
-func (c *Conn) sanitizeForSimpleQuery(sql string, args ...interface{}) (string, error) {
- if c.pgConn.ParameterStatus("standard_conforming_strings") != "on" {
- return "", errors.New("simple protocol queries must be run with standard_conforming_strings=on")
- }
-
- if c.pgConn.ParameterStatus("client_encoding") != "UTF8" {
- return "", errors.New("simple protocol queries must be run with client_encoding=UTF8")
- }
-
- var err error
- valueArgs := make([]interface{}, len(args))
- for i, a := range args {
- valueArgs[i], err = convertSimpleArgument(c.connInfo, a)
- if err != nil {
- return "", err
- }
- }
-
- return sanitize.SanitizeSQL(sql, valueArgs...)
-}
diff --git a/vendor/github.com/jackc/pgx/v4/doc.go b/vendor/github.com/jackc/pgx/v4/doc.go
deleted file mode 100644
index 222f904..0000000
--- a/vendor/github.com/jackc/pgx/v4/doc.go
+++ /dev/null
@@ -1,340 +0,0 @@
-// Package pgx is a PostgreSQL database driver.
-/*
-pgx provides lower level access to PostgreSQL than the standard database/sql. It remains as similar to the database/sql
-interface as possible while providing better speed and access to PostgreSQL specific features. Import
-github.com/jackc/pgx/v4/stdlib to use pgx as a database/sql compatible driver.
-
-Establishing a Connection
-
-The primary way of establishing a connection is with `pgx.Connect`.
-
- conn, err := pgx.Connect(context.Background(), os.Getenv("DATABASE_URL"))
-
-The database connection string can be in URL or DSN format. Both PostgreSQL settings and pgx settings can be specified
-here. In addition, a config struct can be created by `ParseConfig` and modified before establishing the connection with
-`ConnectConfig`.
-
- config, err := pgx.ParseConfig(os.Getenv("DATABASE_URL"))
- if err != nil {
- // ...
- }
- config.Logger = log15adapter.NewLogger(log.New("module", "pgx"))
-
- conn, err := pgx.ConnectConfig(context.Background(), config)
-
-Connection Pool
-
-`*pgx.Conn` represents a single connection to the database and is not concurrency safe. Use sub-package pgxpool for a
-concurrency safe connection pool.
-
-Query Interface
-
-pgx implements Query and Scan in the familiar database/sql style.
-
- var sum int32
-
- // Send the query to the server. The returned rows MUST be closed
- // before conn can be used again.
- rows, err := conn.Query(context.Background(), "select generate_series(1,$1)", 10)
- if err != nil {
- return err
- }
-
- // rows.Close is called by rows.Next when all rows are read
- // or an error occurs in Next or Scan. So it may optionally be
- // omitted if nothing in the rows.Next loop can panic. It is
- // safe to close rows multiple times.
- defer rows.Close()
-
- // Iterate through the result set
- for rows.Next() {
- var n int32
- err = rows.Scan(&n)
- if err != nil {
- return err
- }
- sum += n
- }
-
- // Any errors encountered by rows.Next or rows.Scan will be returned here
- if rows.Err() != nil {
- return rows.Err()
- }
-
- // No errors found - do something with sum
-
-pgx also implements QueryRow in the same style as database/sql.
-
- var name string
- var weight int64
- err := conn.QueryRow(context.Background(), "select name, weight from widgets where id=$1", 42).Scan(&name, &weight)
- if err != nil {
- return err
- }
-
-Use Exec to execute a query that does not return a result set.
-
- commandTag, err := conn.Exec(context.Background(), "delete from widgets where id=$1", 42)
- if err != nil {
- return err
- }
- if commandTag.RowsAffected() != 1 {
- return errors.New("No row found to delete")
- }
-
-QueryFunc can be used to execute a callback function for every row. This is often easier to use than Query.
-
- var sum, n int32
- _, err = conn.QueryFunc(
- context.Background(),
- "select generate_series(1,$1)",
- []interface{}{10},
- []interface{}{&n},
- func(pgx.QueryFuncRow) error {
- sum += n
- return nil
- },
- )
- if err != nil {
- return err
- }
-
-Base Type Mapping
-
-pgx maps between all common base types directly between Go and PostgreSQL. In particular:
-
- Go PostgreSQL
- -----------------------
- string varchar
- text
-
- // Integers are automatically be converted to any other integer type if
- // it can be done without overflow or underflow.
- int8
- int16 smallint
- int32 int
- int64 bigint
- int
- uint8
- uint16
- uint32
- uint64
- uint
-
- // Floats are strict and do not automatically convert like integers.
- float32 float4
- float64 float8
-
- time.Time date
- timestamp
- timestamptz
-
- []byte bytea
-
-
-Null Mapping
-
-pgx can map nulls in two ways. The first is package pgtype provides types that have a data field and a status field.
-They work in a similar fashion to database/sql. The second is to use a pointer to a pointer.
-
- var foo pgtype.Varchar
- var bar *string
- err := conn.QueryRow("select foo, bar from widgets where id=$1", 42).Scan(&foo, &bar)
- if err != nil {
- return err
- }
-
-Array Mapping
-
-pgx maps between int16, int32, int64, float32, float64, and string Go slices and the equivalent PostgreSQL array type.
-Go slices of native types do not support nulls, so if a PostgreSQL array that contains a null is read into a native Go
-slice an error will occur. The pgtype package includes many more array types for PostgreSQL types that do not directly
-map to native Go types.
-
-JSON and JSONB Mapping
-
-pgx includes built-in support to marshal and unmarshal between Go types and the PostgreSQL JSON and JSONB.
-
-Inet and CIDR Mapping
-
-pgx encodes from net.IPNet to and from inet and cidr PostgreSQL types. In addition, as a convenience pgx will encode
-from a net.IP; it will assume a /32 netmask for IPv4 and a /128 for IPv6.
-
-Custom Type Support
-
-pgx includes support for the common data types like integers, floats, strings, dates, and times that have direct
-mappings between Go and SQL. In addition, pgx uses the github.com/jackc/pgtype library to support more types. See
-documention for that library for instructions on how to implement custom types.
-
-See example_custom_type_test.go for an example of a custom type for the PostgreSQL point type.
-
-pgx also includes support for custom types implementing the database/sql.Scanner and database/sql/driver.Valuer
-interfaces.
-
-If pgx does cannot natively encode a type and that type is a renamed type (e.g. type MyTime time.Time) pgx will attempt
-to encode the underlying type. While this is usually desired behavior it can produce surprising behavior if one the
-underlying type and the renamed type each implement database/sql interfaces and the other implements pgx interfaces. It
-is recommended that this situation be avoided by implementing pgx interfaces on the renamed type.
-
-Composite types and row values
-
-Row values and composite types are represented as pgtype.Record (https://pkg.go.dev/github.com/jackc/pgtype?tab=doc#Record).
-It is possible to get values of your custom type by implementing DecodeBinary interface. Decoding into
-pgtype.Record first can simplify process by avoiding dealing with raw protocol directly.
-
-For example:
-
- type MyType struct {
- a int // NULL will cause decoding error
- b *string // there can be NULL in this position in SQL
- }
-
- func (t *MyType) DecodeBinary(ci *pgtype.ConnInfo, src []byte) error {
- r := pgtype.Record{
- Fields: []pgtype.Value{&pgtype.Int4{}, &pgtype.Text{}},
- }
-
- if err := r.DecodeBinary(ci, src); err != nil {
- return err
- }
-
- if r.Status != pgtype.Present {
- return errors.New("BUG: decoding should not be called on NULL value")
- }
-
- a := r.Fields[0].(*pgtype.Int4)
- b := r.Fields[1].(*pgtype.Text)
-
- // type compatibility is checked by AssignTo
- // only lossless assignments will succeed
- if err := a.AssignTo(&t.a); err != nil {
- return err
- }
-
- // AssignTo also deals with null value handling
- if err := b.AssignTo(&t.b); err != nil {
- return err
- }
- return nil
- }
-
- result := MyType{}
- err := conn.QueryRow(context.Background(), "select row(1, 'foo'::text)", pgx.QueryResultFormats{pgx.BinaryFormatCode}).Scan(&r)
-
-Raw Bytes Mapping
-
-[]byte passed as arguments to Query, QueryRow, and Exec are passed unmodified to PostgreSQL.
-
-Transactions
-
-Transactions are started by calling Begin.
-
- tx, err := conn.Begin(context.Background())
- if err != nil {
- return err
- }
- // Rollback is safe to call even if the tx is already closed, so if
- // the tx commits successfully, this is a no-op
- defer tx.Rollback(context.Background())
-
- _, err = tx.Exec(context.Background(), "insert into foo(id) values (1)")
- if err != nil {
- return err
- }
-
- err = tx.Commit(context.Background())
- if err != nil {
- return err
- }
-
-The Tx returned from Begin also implements the Begin method. This can be used to implement pseudo nested transactions.
-These are internally implemented with savepoints.
-
-Use BeginTx to control the transaction mode.
-
-BeginFunc and BeginTxFunc are variants that begin a transaction, execute a function, and commit or rollback the
-transaction depending on the return value of the function. These can be simpler and less error prone to use.
-
- err = conn.BeginFunc(context.Background(), func(tx pgx.Tx) error {
- _, err := tx.Exec(context.Background(), "insert into foo(id) values (1)")
- return err
- })
- if err != nil {
- return err
- }
-
-Prepared Statements
-
-Prepared statements can be manually created with the Prepare method. However, this is rarely necessary because pgx
-includes an automatic statement cache by default. Queries run through the normal Query, QueryRow, and Exec functions are
-automatically prepared on first execution and the prepared statement is reused on subsequent executions. See ParseConfig
-for information on how to customize or disable the statement cache.
-
-Copy Protocol
-
-Use CopyFrom to efficiently insert multiple rows at a time using the PostgreSQL copy protocol. CopyFrom accepts a
-CopyFromSource interface. If the data is already in a [][]interface{} use CopyFromRows to wrap it in a CopyFromSource
-interface. Or implement CopyFromSource to avoid buffering the entire data set in memory.
-
- rows := [][]interface{}{
- {"John", "Smith", int32(36)},
- {"Jane", "Doe", int32(29)},
- }
-
- copyCount, err := conn.CopyFrom(
- context.Background(),
- pgx.Identifier{"people"},
- []string{"first_name", "last_name", "age"},
- pgx.CopyFromRows(rows),
- )
-
-When you already have a typed array using CopyFromSlice can be more convenient.
-
- rows := []User{
- {"John", "Smith", 36},
- {"Jane", "Doe", 29},
- }
-
- copyCount, err := conn.CopyFrom(
- context.Background(),
- pgx.Identifier{"people"},
- []string{"first_name", "last_name", "age"},
- pgx.CopyFromSlice(len(rows), func(i int) ([]interface{}, error) {
- return []interface{}{rows[i].FirstName, rows[i].LastName, rows[i].Age}, nil
- }),
- )
-
-CopyFrom can be faster than an insert with as few as 5 rows.
-
-Listen and Notify
-
-pgx can listen to the PostgreSQL notification system with the `Conn.WaitForNotification` method. It blocks until a
-notification is received or the context is canceled.
-
- _, err := conn.Exec(context.Background(), "listen channelname")
- if err != nil {
- return nil
- }
-
- if notification, err := conn.WaitForNotification(context.Background()); err != nil {
- // do something with notification
- }
-
-
-Logging
-
-pgx defines a simple logger interface. Connections optionally accept a logger that satisfies this interface. Set
-LogLevel to control logging verbosity. Adapters for github.com/inconshreveable/log15, github.com/sirupsen/logrus,
-go.uber.org/zap, github.com/rs/zerolog, and the testing log are provided in the log directory.
-
-Lower Level PostgreSQL Functionality
-
-pgx is implemented on top of github.com/jackc/pgconn a lower level PostgreSQL driver. The Conn.PgConn() method can be
-used to access this lower layer.
-
-PgBouncer
-
-pgx is compatible with PgBouncer in two modes. One is when the connection has a statement cache in "describe" mode. The
-other is when the connection is using the simple protocol. This can be set with the PreferSimpleProtocol config option.
-*/
-package pgx
diff --git a/vendor/github.com/jackc/pgx/v4/extended_query_builder.go b/vendor/github.com/jackc/pgx/v4/extended_query_builder.go
deleted file mode 100644
index d06f63f..0000000
--- a/vendor/github.com/jackc/pgx/v4/extended_query_builder.go
+++ /dev/null
@@ -1,161 +0,0 @@
-package pgx
-
-import (
- "database/sql/driver"
- "fmt"
- "reflect"
-
- "github.com/jackc/pgtype"
-)
-
-type extendedQueryBuilder struct {
- paramValues [][]byte
- paramValueBytes []byte
- paramFormats []int16
- resultFormats []int16
-}
-
-func (eqb *extendedQueryBuilder) AppendParam(ci *pgtype.ConnInfo, oid uint32, arg interface{}) error {
- f := chooseParameterFormatCode(ci, oid, arg)
- eqb.paramFormats = append(eqb.paramFormats, f)
-
- v, err := eqb.encodeExtendedParamValue(ci, oid, f, arg)
- if err != nil {
- return err
- }
- eqb.paramValues = append(eqb.paramValues, v)
-
- return nil
-}
-
-func (eqb *extendedQueryBuilder) AppendResultFormat(f int16) {
- eqb.resultFormats = append(eqb.resultFormats, f)
-}
-
-// Reset readies eqb to build another query.
-func (eqb *extendedQueryBuilder) Reset() {
- eqb.paramValues = eqb.paramValues[0:0]
- eqb.paramValueBytes = eqb.paramValueBytes[0:0]
- eqb.paramFormats = eqb.paramFormats[0:0]
- eqb.resultFormats = eqb.resultFormats[0:0]
-
- if cap(eqb.paramValues) > 64 {
- eqb.paramValues = make([][]byte, 0, 64)
- }
-
- if cap(eqb.paramValueBytes) > 256 {
- eqb.paramValueBytes = make([]byte, 0, 256)
- }
-
- if cap(eqb.paramFormats) > 64 {
- eqb.paramFormats = make([]int16, 0, 64)
- }
- if cap(eqb.resultFormats) > 64 {
- eqb.resultFormats = make([]int16, 0, 64)
- }
-}
-
-func (eqb *extendedQueryBuilder) encodeExtendedParamValue(ci *pgtype.ConnInfo, oid uint32, formatCode int16, arg interface{}) ([]byte, error) {
- if arg == nil {
- return nil, nil
- }
-
- refVal := reflect.ValueOf(arg)
- argIsPtr := refVal.Kind() == reflect.Ptr
-
- if argIsPtr && refVal.IsNil() {
- return nil, nil
- }
-
- if eqb.paramValueBytes == nil {
- eqb.paramValueBytes = make([]byte, 0, 128)
- }
-
- var err error
- var buf []byte
- pos := len(eqb.paramValueBytes)
-
- if arg, ok := arg.(string); ok {
- return []byte(arg), nil
- }
-
- if formatCode == TextFormatCode {
- if arg, ok := arg.(pgtype.TextEncoder); ok {
- buf, err = arg.EncodeText(ci, eqb.paramValueBytes)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
- eqb.paramValueBytes = buf
- return eqb.paramValueBytes[pos:], nil
- }
- } else if formatCode == BinaryFormatCode {
- if arg, ok := arg.(pgtype.BinaryEncoder); ok {
- buf, err = arg.EncodeBinary(ci, eqb.paramValueBytes)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
- eqb.paramValueBytes = buf
- return eqb.paramValueBytes[pos:], nil
- }
- }
-
- if argIsPtr {
- // We have already checked that arg is not pointing to nil,
- // so it is safe to dereference here.
- arg = refVal.Elem().Interface()
- return eqb.encodeExtendedParamValue(ci, oid, formatCode, arg)
- }
-
- if dt, ok := ci.DataTypeForOID(oid); ok {
- value := dt.Value
- err := value.Set(arg)
- if err != nil {
- {
- if arg, ok := arg.(driver.Valuer); ok {
- v, err := callValuerValue(arg)
- if err != nil {
- return nil, err
- }
- return eqb.encodeExtendedParamValue(ci, oid, formatCode, v)
- }
- }
-
- return nil, err
- }
-
- return eqb.encodeExtendedParamValue(ci, oid, formatCode, value)
- }
-
- // There is no data type registered for the destination OID, but maybe there is data type registered for the arg
- // type. If so use it's text encoder (if available).
- if dt, ok := ci.DataTypeForValue(arg); ok {
- value := dt.Value
- if textEncoder, ok := value.(pgtype.TextEncoder); ok {
- err := value.Set(arg)
- if err != nil {
- return nil, err
- }
-
- buf, err = textEncoder.EncodeText(ci, eqb.paramValueBytes)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
- eqb.paramValueBytes = buf
- return eqb.paramValueBytes[pos:], nil
- }
- }
-
- if strippedArg, ok := stripNamedType(&refVal); ok {
- return eqb.encodeExtendedParamValue(ci, oid, formatCode, strippedArg)
- }
- return nil, SerializationError(fmt.Sprintf("Cannot encode %T into oid %v - %T must implement Encoder or be converted to a string", arg, oid, arg))
-}
diff --git a/vendor/github.com/jackc/pgx/v4/go_stdlib.go b/vendor/github.com/jackc/pgx/v4/go_stdlib.go
deleted file mode 100644
index 9372f9e..0000000
--- a/vendor/github.com/jackc/pgx/v4/go_stdlib.go
+++ /dev/null
@@ -1,61 +0,0 @@
-package pgx
-
-import (
- "database/sql/driver"
- "reflect"
-)
-
-// This file contains code copied from the Go standard library due to the
-// required function not being public.
-
-// Copyright (c) 2009 The Go Authors. All rights reserved.
-
-// Redistribution and use in source and binary forms, with or without
-// modification, are permitted provided that the following conditions are
-// met:
-
-// * Redistributions of source code must retain the above copyright
-// notice, this list of conditions and the following disclaimer.
-// * Redistributions in binary form must reproduce the above
-// copyright notice, this list of conditions and the following disclaimer
-// in the documentation and/or other materials provided with the
-// distribution.
-// * Neither the name of Google Inc. nor the names of its
-// contributors may be used to endorse or promote products derived from
-// this software without specific prior written permission.
-
-// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
-// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
-// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
-// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
-// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
-// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
-// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
-// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
-// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
-// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
-// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
-
-// From database/sql/convert.go
-
-var valuerReflectType = reflect.TypeOf((*driver.Valuer)(nil)).Elem()
-
-// callValuerValue returns vr.Value(), with one exception:
-// If vr.Value is an auto-generated method on a pointer type and the
-// pointer is nil, it would panic at runtime in the panicwrap
-// method. Treat it like nil instead.
-// Issue 8415.
-//
-// This is so people can implement driver.Value on value types and
-// still use nil pointers to those types to mean nil/NULL, just like
-// string/*string.
-//
-// This function is mirrored in the database/sql/driver package.
-func callValuerValue(vr driver.Valuer) (v driver.Value, err error) {
- if rv := reflect.ValueOf(vr); rv.Kind() == reflect.Ptr &&
- rv.IsNil() &&
- rv.Type().Elem().Implements(valuerReflectType) {
- return nil, nil
- }
- return vr.Value()
-}
diff --git a/vendor/github.com/jackc/pgx/v4/logger.go b/vendor/github.com/jackc/pgx/v4/logger.go
deleted file mode 100644
index 41f8b7e..0000000
--- a/vendor/github.com/jackc/pgx/v4/logger.go
+++ /dev/null
@@ -1,107 +0,0 @@
-package pgx
-
-import (
- "context"
- "encoding/hex"
- "errors"
- "fmt"
-)
-
-// The values for log levels are chosen such that the zero value means that no
-// log level was specified.
-const (
- LogLevelTrace = 6
- LogLevelDebug = 5
- LogLevelInfo = 4
- LogLevelWarn = 3
- LogLevelError = 2
- LogLevelNone = 1
-)
-
-// LogLevel represents the pgx logging level. See LogLevel* constants for
-// possible values.
-type LogLevel int
-
-func (ll LogLevel) String() string {
- switch ll {
- case LogLevelTrace:
- return "trace"
- case LogLevelDebug:
- return "debug"
- case LogLevelInfo:
- return "info"
- case LogLevelWarn:
- return "warn"
- case LogLevelError:
- return "error"
- case LogLevelNone:
- return "none"
- default:
- return fmt.Sprintf("invalid level %d", ll)
- }
-}
-
-// Logger is the interface used to get logging from pgx internals.
-type Logger interface {
- // Log a message at the given level with data key/value pairs. data may be nil.
- Log(ctx context.Context, level LogLevel, msg string, data map[string]interface{})
-}
-
-// LoggerFunc is a wrapper around a function to satisfy the pgx.Logger interface
-type LoggerFunc func(ctx context.Context, level LogLevel, msg string, data map[string]interface{})
-
-// Log delegates the logging request to the wrapped function
-func (f LoggerFunc) Log(ctx context.Context, level LogLevel, msg string, data map[string]interface{}) {
- f(ctx, level, msg, data)
-}
-
-// LogLevelFromString converts log level string to constant
-//
-// Valid levels:
-//
-// trace
-// debug
-// info
-// warn
-// error
-// none
-func LogLevelFromString(s string) (LogLevel, error) {
- switch s {
- case "trace":
- return LogLevelTrace, nil
- case "debug":
- return LogLevelDebug, nil
- case "info":
- return LogLevelInfo, nil
- case "warn":
- return LogLevelWarn, nil
- case "error":
- return LogLevelError, nil
- case "none":
- return LogLevelNone, nil
- default:
- return 0, errors.New("invalid log level")
- }
-}
-
-func logQueryArgs(args []interface{}) []interface{} {
- logArgs := make([]interface{}, 0, len(args))
-
- for _, a := range args {
- switch v := a.(type) {
- case []byte:
- if len(v) < 64 {
- a = hex.EncodeToString(v)
- } else {
- a = fmt.Sprintf("%x (truncated %d bytes)", v[:64], len(v)-64)
- }
- case string:
- if len(v) > 64 {
- a = fmt.Sprintf("%s (truncated %d bytes)", v[:64], len(v)-64)
- }
- }
- logArgs = append(logArgs, a)
- }
-
- return logArgs
-}
diff --git a/vendor/github.com/jackc/pgx/v4/messages.go b/vendor/github.com/jackc/pgx/v4/messages.go
deleted file mode 100644
index 5324cbb..0000000
--- a/vendor/github.com/jackc/pgx/v4/messages.go
+++ /dev/null
@@ -1,23 +0,0 @@
-package pgx
-
-import (
- "database/sql/driver"
-
- "github.com/jackc/pgtype"
-)
-
-func convertDriverValuers(args []interface{}) ([]interface{}, error) {
- for i, arg := range args {
- switch arg := arg.(type) {
- case pgtype.BinaryEncoder:
- case pgtype.TextEncoder:
- case driver.Valuer:
- v, err := callValuerValue(arg)
- if err != nil {
- return nil, err
- }
- args[i] = v
- }
- }
- return args, nil
-}
diff --git a/vendor/github.com/jackc/pgx/v4/rows.go b/vendor/github.com/jackc/pgx/v4/rows.go
deleted file mode 100644
index 4749ead..0000000
--- a/vendor/github.com/jackc/pgx/v4/rows.go
+++ /dev/null
@@ -1,351 +0,0 @@
-package pgx
-
-import (
- "context"
- "errors"
- "fmt"
- "time"
-
- "github.com/jackc/pgconn"
- "github.com/jackc/pgproto3/v2"
- "github.com/jackc/pgtype"
-)
-
-// Rows is the result set returned from *Conn.Query. Rows must be closed before
-// the *Conn can be used again. Rows are closed by explicitly calling Close(),
-// calling Next() until it returns false, or when a fatal error occurs.
-//
-// Once a Rows is closed the only methods that may be called are Close(), Err(), and CommandTag().
-//
-// Rows is an interface instead of a struct to allow tests to mock Query. However,
-// adding a method to an interface is technically a breaking change. Because of this
-// the Rows interface is partially excluded from semantic version requirements.
-// Methods will not be removed or changed, but new methods may be added.
-type Rows interface {
- // Close closes the rows, making the connection ready for use again. It is safe
- // to call Close after rows is already closed.
- Close()
-
- // Err returns any error that occurred while reading.
- Err() error
-
- // CommandTag returns the command tag from this query. It is only available after Rows is closed.
- CommandTag() pgconn.CommandTag
-
- FieldDescriptions() []pgproto3.FieldDescription
-
- // Next prepares the next row for reading. It returns true if there is another
- // row and false if no more rows are available. It automatically closes rows
- // when all rows are read.
- Next() bool
-
- // Scan reads the values from the current row into dest values positionally.
- // dest can include pointers to core types, values implementing the Scanner
- // interface, and nil. nil will skip the value entirely. It is an error to
- // call Scan without first calling Next() and checking that it returned true.
- Scan(dest ...interface{}) error
-
- // Values returns the decoded row values. As with Scan(), it is an error to
- // call Values without first calling Next() and checking that it returned
- // true.
- Values() ([]interface{}, error)
-
- // RawValues returns the unparsed bytes of the row values. The returned [][]byte is only valid until the next Next
- // call or the Rows is closed. However, the underlying byte data is safe to retain a reference to and mutate.
- RawValues() [][]byte
-}
-
-// Row is a convenience wrapper over Rows that is returned by QueryRow.
-//
-// Row is an interface instead of a struct to allow tests to mock QueryRow. However,
-// adding a method to an interface is technically a breaking change. Because of this
-// the Row interface is partially excluded from semantic version requirements.
-// Methods will not be removed or changed, but new methods may be added.
-type Row interface {
- // Scan works the same as Rows. with the following exceptions. If no
- // rows were found it returns ErrNoRows. If multiple rows are returned it
- // ignores all but the first.
- Scan(dest ...interface{}) error
-}
-
-// connRow implements the Row interface for Conn.QueryRow.
-type connRow connRows
-
-func (r *connRow) Scan(dest ...interface{}) (err error) {
- rows := (*connRows)(r)
-
- if rows.Err() != nil {
- return rows.Err()
- }
-
- if !rows.Next() {
- if rows.Err() == nil {
- return ErrNoRows
- }
- return rows.Err()
- }
-
- rows.Scan(dest...)
- rows.Close()
- return rows.Err()
-}
-
-type rowLog interface {
- shouldLog(lvl LogLevel) bool
- log(ctx context.Context, lvl LogLevel, msg string, data map[string]interface{})
-}
-
-// connRows implements the Rows interface for Conn.Query.
-type connRows struct {
- ctx context.Context
- logger rowLog
- connInfo *pgtype.ConnInfo
- values [][]byte
- rowCount int
- err error
- commandTag pgconn.CommandTag
- startTime time.Time
- sql string
- args []interface{}
- closed bool
- conn *Conn
-
- resultReader *pgconn.ResultReader
- multiResultReader *pgconn.MultiResultReader
-
- scanPlans []pgtype.ScanPlan
-}
-
-func (rows *connRows) FieldDescriptions() []pgproto3.FieldDescription {
- return rows.resultReader.FieldDescriptions()
-}
-
-func (rows *connRows) Close() {
- if rows.closed {
- return
- }
-
- rows.closed = true
-
- if rows.resultReader != nil {
- var closeErr error
- rows.commandTag, closeErr = rows.resultReader.Close()
- if rows.err == nil {
- rows.err = closeErr
- }
- }
-
- if rows.multiResultReader != nil {
- closeErr := rows.multiResultReader.Close()
- if rows.err == nil {
- rows.err = closeErr
- }
- }
-
- if rows.logger != nil {
- endTime := time.Now()
-
- if rows.err == nil {
- if rows.logger.shouldLog(LogLevelInfo) {
- rows.logger.log(rows.ctx, LogLevelInfo, "Query", map[string]interface{}{"sql": rows.sql, "args": logQueryArgs(rows.args), "time": endTime.Sub(rows.startTime), "rowCount": rows.rowCount})
- }
- } else {
- if rows.logger.shouldLog(LogLevelError) {
- rows.logger.log(rows.ctx, LogLevelError, "Query", map[string]interface{}{"err": rows.err, "sql": rows.sql, "time": endTime.Sub(rows.startTime), "args": logQueryArgs(rows.args)})
- }
- if rows.err != nil && rows.conn.stmtcache != nil {
- rows.conn.stmtcache.StatementErrored(rows.sql, rows.err)
- }
- }
- }
-}
-
-func (rows *connRows) CommandTag() pgconn.CommandTag {
- return rows.commandTag
-}
-
-func (rows *connRows) Err() error {
- return rows.err
-}
-
-// fatal signals an error occurred after the query was sent to the server. It
-// closes the rows automatically.
-func (rows *connRows) fatal(err error) {
- if rows.err != nil {
- return
- }
-
- rows.err = err
- rows.Close()
-}
-
-func (rows *connRows) Next() bool {
- if rows.closed {
- return false
- }
-
- if rows.resultReader.NextRow() {
- rows.rowCount++
- rows.values = rows.resultReader.Values()
- return true
- } else {
- rows.Close()
- return false
- }
-}
-
-func (rows *connRows) Scan(dest ...interface{}) error {
- ci := rows.connInfo
- fieldDescriptions := rows.FieldDescriptions()
- values := rows.values
-
- if len(fieldDescriptions) != len(values) {
- err := fmt.Errorf("number of field descriptions must equal number of values, got %d and %d", len(fieldDescriptions), len(values))
- rows.fatal(err)
- return err
- }
- if len(fieldDescriptions) != len(dest) {
- err := fmt.Errorf("number of field descriptions must equal number of destinations, got %d and %d", len(fieldDescriptions), len(dest))
- rows.fatal(err)
- return err
- }
-
- if rows.scanPlans == nil {
- rows.scanPlans = make([]pgtype.ScanPlan, len(values))
- for i := range dest {
- rows.scanPlans[i] = ci.PlanScan(fieldDescriptions[i].DataTypeOID, fieldDescriptions[i].Format, dest[i])
- }
- }
-
- for i, dst := range dest {
- if dst == nil {
- continue
- }
-
- err := rows.scanPlans[i].Scan(ci, fieldDescriptions[i].DataTypeOID, fieldDescriptions[i].Format, values[i], dst)
- if err != nil {
- err = ScanArgError{ColumnIndex: i, Err: err}
- rows.fatal(err)
- return err
- }
- }
-
- return nil
-}
-
-func (rows *connRows) Values() ([]interface{}, error) {
- if rows.closed {
- return nil, errors.New("rows is closed")
- }
-
- values := make([]interface{}, 0, len(rows.FieldDescriptions()))
-
- for i := range rows.FieldDescriptions() {
- buf := rows.values[i]
- fd := &rows.FieldDescriptions()[i]
-
- if buf == nil {
- values = append(values, nil)
- continue
- }
-
- if dt, ok := rows.connInfo.DataTypeForOID(fd.DataTypeOID); ok {
- value := dt.Value
-
- switch fd.Format {
- case TextFormatCode:
- decoder, ok := value.(pgtype.TextDecoder)
- if !ok {
- decoder = &pgtype.GenericText{}
- }
- err := decoder.DecodeText(rows.connInfo, buf)
- if err != nil {
- rows.fatal(err)
- }
- values = append(values, decoder.(pgtype.Value).Get())
- case BinaryFormatCode:
- decoder, ok := value.(pgtype.BinaryDecoder)
- if !ok {
- decoder = &pgtype.GenericBinary{}
- }
- err := decoder.DecodeBinary(rows.connInfo, buf)
- if err != nil {
- rows.fatal(err)
- }
- values = append(values, value.Get())
- default:
- rows.fatal(errors.New("Unknown format code"))
- }
- } else {
- switch fd.Format {
- case TextFormatCode:
- decoder := &pgtype.GenericText{}
- err := decoder.DecodeText(rows.connInfo, buf)
- if err != nil {
- rows.fatal(err)
- }
- values = append(values, decoder.Get())
- case BinaryFormatCode:
- decoder := &pgtype.GenericBinary{}
- err := decoder.DecodeBinary(rows.connInfo, buf)
- if err != nil {
- rows.fatal(err)
- }
- values = append(values, decoder.Get())
- default:
- rows.fatal(errors.New("Unknown format code"))
- }
- }
-
- if rows.Err() != nil {
- return nil, rows.Err()
- }
- }
-
- return values, rows.Err()
-}
-
-func (rows *connRows) RawValues() [][]byte {
- return rows.values
-}
-
-type ScanArgError struct {
- ColumnIndex int
- Err error
-}
-
-func (e ScanArgError) Error() string {
- return fmt.Sprintf("can't scan into dest[%d]: %v", e.ColumnIndex, e.Err)
-}
-
-func (e ScanArgError) Unwrap() error {
- return e.Err
-}
-
-// ScanRow decodes raw row data into dest. It can be used to scan rows read from the lower level pgconn interface.
-//
-// connInfo - OID to Go type mapping.
-// fieldDescriptions - OID and format of values
-// values - the raw data as returned from the PostgreSQL server
-// dest - the destination that values will be decoded into
-func ScanRow(connInfo *pgtype.ConnInfo, fieldDescriptions []pgproto3.FieldDescription, values [][]byte, dest ...interface{}) error {
- if len(fieldDescriptions) != len(values) {
- return fmt.Errorf("number of field descriptions must equal number of values, got %d and %d", len(fieldDescriptions), len(values))
- }
- if len(fieldDescriptions) != len(dest) {
- return fmt.Errorf("number of field descriptions must equal number of destinations, got %d and %d", len(fieldDescriptions), len(dest))
- }
-
- for i, d := range dest {
- if d == nil {
- continue
- }
-
- err := connInfo.Scan(fieldDescriptions[i].DataTypeOID, fieldDescriptions[i].Format, values[i], d)
- if err != nil {
- return ScanArgError{ColumnIndex: i, Err: err}
- }
- }
-
- return nil
-}
diff --git a/vendor/github.com/jackc/pgx/v4/values.go b/vendor/github.com/jackc/pgx/v4/values.go
deleted file mode 100644
index 1a94547..0000000
--- a/vendor/github.com/jackc/pgx/v4/values.go
+++ /dev/null
@@ -1,280 +0,0 @@
-package pgx
-
-import (
- "database/sql/driver"
- "fmt"
- "math"
- "reflect"
- "time"
-
- "github.com/jackc/pgio"
- "github.com/jackc/pgtype"
-)
-
-// PostgreSQL format codes
-const (
- TextFormatCode = 0
- BinaryFormatCode = 1
-)
-
-// SerializationError occurs on failure to encode or decode a value
-type SerializationError string
-
-func (e SerializationError) Error() string {
- return string(e)
-}
-
-func convertSimpleArgument(ci *pgtype.ConnInfo, arg interface{}) (interface{}, error) {
- if arg == nil {
- return nil, nil
- }
-
- refVal := reflect.ValueOf(arg)
- if refVal.Kind() == reflect.Ptr && refVal.IsNil() {
- return nil, nil
- }
-
- switch arg := arg.(type) {
-
- // https://github.com/jackc/pgx/issues/409 Changed JSON and JSONB to surface
- // []byte to database/sql instead of string. But that caused problems with the
- // simple protocol because the driver.Valuer case got taken before the
- // pgtype.TextEncoder case. And driver.Valuer needed to be first in the usual
- // case because of https://github.com/jackc/pgx/issues/339. So instead we
- // special case JSON and JSONB.
- case *pgtype.JSON:
- buf, err := arg.EncodeText(ci, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
- return string(buf), nil
- case *pgtype.JSONB:
- buf, err := arg.EncodeText(ci, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
- return string(buf), nil
-
- case driver.Valuer:
- return callValuerValue(arg)
- case pgtype.TextEncoder:
- buf, err := arg.EncodeText(ci, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
- return string(buf), nil
- case float32:
- return float64(arg), nil
- case float64:
- return arg, nil
- case bool:
- return arg, nil
- case time.Duration:
- return fmt.Sprintf("%d microsecond", int64(arg)/1000), nil
- case time.Time:
- return arg, nil
- case string:
- return arg, nil
- case []byte:
- return arg, nil
- case int8:
- return int64(arg), nil
- case int16:
- return int64(arg), nil
- case int32:
- return int64(arg), nil
- case int64:
- return arg, nil
- case int:
- return int64(arg), nil
- case uint8:
- return int64(arg), nil
- case uint16:
- return int64(arg), nil
- case uint32:
- return int64(arg), nil
- case uint64:
- if arg > math.MaxInt64 {
- return nil, fmt.Errorf("arg too big for int64: %v", arg)
- }
- return int64(arg), nil
- case uint:
- if uint64(arg) > math.MaxInt64 {
- return nil, fmt.Errorf("arg too big for int64: %v", arg)
- }
- return int64(arg), nil
- }
-
- if dt, found := ci.DataTypeForValue(arg); found {
- v := dt.Value
- err := v.Set(arg)
- if err != nil {
- return nil, err
- }
- buf, err := v.(pgtype.TextEncoder).EncodeText(ci, nil)
- if err != nil {
- return nil, err
- }
- if buf == nil {
- return nil, nil
- }
- return string(buf), nil
- }
-
- if refVal.Kind() == reflect.Ptr {
- arg = refVal.Elem().Interface()
- return convertSimpleArgument(ci, arg)
- }
-
- if strippedArg, ok := stripNamedType(&refVal); ok {
- return convertSimpleArgument(ci, strippedArg)
- }
- return nil, SerializationError(fmt.Sprintf("Cannot encode %T in simple protocol - %T must implement driver.Valuer, pgtype.TextEncoder, or be a native type", arg, arg))
-}
-
-func encodePreparedStatementArgument(ci *pgtype.ConnInfo, buf []byte, oid uint32, arg interface{}) ([]byte, error) {
- if arg == nil {
- return pgio.AppendInt32(buf, -1), nil
- }
-
- switch arg := arg.(type) {
- case pgtype.BinaryEncoder:
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
- argBuf, err := arg.EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if argBuf != nil {
- buf = argBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- return buf, nil
- case pgtype.TextEncoder:
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
- argBuf, err := arg.EncodeText(ci, buf)
- if err != nil {
- return nil, err
- }
- if argBuf != nil {
- buf = argBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- return buf, nil
- case string:
- buf = pgio.AppendInt32(buf, int32(len(arg)))
- buf = append(buf, arg...)
- return buf, nil
- }
-
- refVal := reflect.ValueOf(arg)
-
- if refVal.Kind() == reflect.Ptr {
- if refVal.IsNil() {
- return pgio.AppendInt32(buf, -1), nil
- }
- arg = refVal.Elem().Interface()
- return encodePreparedStatementArgument(ci, buf, oid, arg)
- }
-
- if dt, ok := ci.DataTypeForOID(oid); ok {
- value := dt.Value
- err := value.Set(arg)
- if err != nil {
- {
- if arg, ok := arg.(driver.Valuer); ok {
- v, err := callValuerValue(arg)
- if err != nil {
- return nil, err
- }
- return encodePreparedStatementArgument(ci, buf, oid, v)
- }
- }
-
- return nil, err
- }
-
- sp := len(buf)
- buf = pgio.AppendInt32(buf, -1)
- argBuf, err := value.(pgtype.BinaryEncoder).EncodeBinary(ci, buf)
- if err != nil {
- return nil, err
- }
- if argBuf != nil {
- buf = argBuf
- pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
- }
- return buf, nil
- }
-
- if strippedArg, ok := stripNamedType(&refVal); ok {
- return encodePreparedStatementArgument(ci, buf, oid, strippedArg)
- }
- return nil, SerializationError(fmt.Sprintf("Cannot encode %T into oid %v - %T must implement Encoder or be converted to a string", arg, oid, arg))
-}
-
-// chooseParameterFormatCode determines the correct format code for an
-// argument to a prepared statement. It defaults to TextFormatCode if no
-// determination can be made.
-func chooseParameterFormatCode(ci *pgtype.ConnInfo, oid uint32, arg interface{}) int16 {
- switch arg := arg.(type) {
- case pgtype.ParamFormatPreferrer:
- return arg.PreferredParamFormat()
- case pgtype.BinaryEncoder:
- return BinaryFormatCode
- case string, *string, pgtype.TextEncoder:
- return TextFormatCode
- }
-
- return ci.ParamFormatCodeForOID(oid)
-}
-
-func stripNamedType(val *reflect.Value) (interface{}, bool) {
- switch val.Kind() {
- case reflect.Int:
- convVal := int(val.Int())
- return convVal, reflect.TypeOf(convVal) != val.Type()
- case reflect.Int8:
- convVal := int8(val.Int())
- return convVal, reflect.TypeOf(convVal) != val.Type()
- case reflect.Int16:
- convVal := int16(val.Int())
- return convVal, reflect.TypeOf(convVal) != val.Type()
- case reflect.Int32:
- convVal := int32(val.Int())
- return convVal, reflect.TypeOf(convVal) != val.Type()
- case reflect.Int64:
- convVal := int64(val.Int())
- return convVal, reflect.TypeOf(convVal) != val.Type()
- case reflect.Uint:
- convVal := uint(val.Uint())
- return convVal, reflect.TypeOf(convVal) != val.Type()
- case reflect.Uint8:
- convVal := uint8(val.Uint())
- return convVal, reflect.TypeOf(convVal) != val.Type()
- case reflect.Uint16:
- convVal := uint16(val.Uint())
- return convVal, reflect.TypeOf(convVal) != val.Type()
- case reflect.Uint32:
- convVal := uint32(val.Uint())
- return convVal, reflect.TypeOf(convVal) != val.Type()
- case reflect.Uint64:
- convVal := uint64(val.Uint())
- return convVal, reflect.TypeOf(convVal) != val.Type()
- case reflect.String:
- convVal := val.String()
- return convVal, reflect.TypeOf(convVal) != val.Type()
- }
-
- return nil, false
-}
diff --git a/vendor/github.com/jackc/pgx/v4/.gitignore b/vendor/github.com/jackc/pgx/v5/.gitignore
index 39175a9..a2ebbe9 100644
--- a/vendor/github.com/jackc/pgx/v4/.gitignore
+++ b/vendor/github.com/jackc/pgx/v5/.gitignore
@@ -22,3 +22,6 @@ _testmain.go
*.exe
.envrc
+/.testdb
+
+.DS_Store
diff --git a/vendor/github.com/jackc/pgx/v5/CHANGELOG.md b/vendor/github.com/jackc/pgx/v5/CHANGELOG.md
new file mode 100644
index 0000000..6470088
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/CHANGELOG.md
@@ -0,0 +1,434 @@
+# 5.7.2 (December 21, 2024)
+
+* Fix prepared statement already exists on batch prepare failure
+* Add commit query to tx options (Lucas Hild)
+* Fix pgtype.Timestamp json unmarshal (Shean de Montigny-Desautels)
+* Add message body size limits in frontend and backend (zene)
+* Add xid8 type
+* Ensure planning encodes and scans cannot infinitely recurse
+* Implement pgtype.UUID.String() (Konstantin Grachev)
+* Switch from ExecParams to Exec in ValidateConnectTargetSessionAttrs functions (Alexander Rumyantsev)
+* Update golang.org/x/crypto
+
+# 5.7.1 (September 10, 2024)
+
+* Fix data race in tracelog.TraceLog
+* Update puddle to v2.2.2. This removes the import of nanotime via linkname.
+* Update golang.org/x/crypto and golang.org/x/text
+
+# 5.7.0 (September 7, 2024)
+
+* Add support for sslrootcert=system (Yann Soubeyrand)
+* Add LoadTypes to load multiple types in a single SQL query (Nick Farrell)
+* Add XMLCodec supports encoding + scanning XML column type like json (nickcruess-soda)
+* Add MultiTrace (Stepan Rabotkin)
+* Add TraceLogConfig with customizable TimeKey (stringintech)
+* pgx.ErrNoRows wraps sql.ErrNoRows to aid in database/sql compatibility with native pgx functions (merlin)
+* Support scanning binary formatted uint32 into string / TextScanner (jennifersp)
+* Fix interval encoding to allow 0s and avoid extra spaces (Carlos Pérez-Aradros Herce)
+* Update pgservicefile - fixes panic when parsing invalid file
+* Better error message when reading past end of batch
+* Don't print url when url.Parse returns an error (Kevin Biju)
+* Fix snake case name normalization collision in RowToStructByName with db tag (nolandseigler)
+* Fix: Scan and encode types with underlying types of arrays
+
+# 5.6.0 (May 25, 2024)
+
+* Add StrictNamedArgs (Tomas Zahradnicek)
+* Add support for macaddr8 type (Carlos Pérez-Aradros Herce)
+* Add SeverityUnlocalized field to PgError / Notice
+* Performance optimization of RowToStructByPos/Name (Zach Olstein)
+* Allow customizing context canceled behavior for pgconn
+* Add ScanLocation to pgtype.Timestamp[tz]Codec
+* Add custom data to pgconn.PgConn
+* Fix ResultReader.Read() to handle nil values
+* Do not encode interval microseconds when they are 0 (Carlos Pérez-Aradros Herce)
+* pgconn.SafeToRetry checks for wrapped errors (tjasko)
+* Failed connection attempts include all errors
+* Optimize LargeObject.Read (Mitar)
+* Add tracing for connection acquire and release from pool (ngavinsir)
+* Fix encode driver.Valuer not called when nil
+* Add support for custom JSON marshal and unmarshal (Mitar)
+* Use Go default keepalive for TCP connections (Hans-Joachim Kliemeck)
+
+# 5.5.5 (March 9, 2024)
+
+Use spaces instead of parentheses for SQL sanitization.
+
+This still solves the problem of negative numbers creating a line comment, but this avoids breaking edge cases such as
+`set foo to $1` where the substitution is taking place in a location where an arbitrary expression is not allowed.
+
+# 5.5.4 (March 4, 2024)
+
+Fix CVE-2024-27304
+
+SQL injection can occur if an attacker can cause a single query or bind message to exceed 4 GB in size. An integer
+overflow in the calculated message size can cause the one large message to be sent as multiple messages under the
+attacker's control.
+
+Thanks to Paul Gerste for reporting this issue.
+
+* Fix behavior of CollectRows to return empty slice if Rows are empty (Felix)
+* Fix simple protocol encoding of json.RawMessage
+* Fix *Pipeline.getResults should close pipeline on error
+* Fix panic in TryFindUnderlyingTypeScanPlan (David Kurman)
+* Fix deallocation of invalidated cached statements in a transaction
+* Handle invalid sslkey file
+* Fix scan float4 into sql.Scanner
+* Fix pgtype.Bits not making copy of data from read buffer. This would cause the data to be corrupted by future reads.
+
+# 5.5.3 (February 3, 2024)
+
+* Fix: prepared statement already exists
+* Improve CopyFrom auto-conversion of text-ish values
+* Add ltree type support (Florent Viel)
+* Make some properties of Batch and QueuedQuery public (Pavlo Golub)
+* Add AppendRows function (Edoardo Spadolini)
+* Optimize convert UUID [16]byte to string (Kirill Malikov)
+* Fix: LargeObject Read and Write of more than ~1GB at a time (Mitar)
+
+# 5.5.2 (January 13, 2024)
+
+* Allow NamedArgs to start with underscore
+* pgproto3: Maximum message body length support (jeremy.spriet)
+* Upgrade golang.org/x/crypto to v0.17.0
+* Add snake_case support to RowToStructByName (Tikhon Fedulov)
+* Fix: update description cache after exec prepare (James Hartig)
+* Fix: pipeline checks if it is closed (James Hartig and Ryan Fowler)
+* Fix: normalize timeout / context errors during TLS startup (Samuel Stauffer)
+* Add OnPgError for easier centralized error handling (James Hartig)
+
+# 5.5.1 (December 9, 2023)
+
+* Add CopyFromFunc helper function. (robford)
+* Add PgConn.Deallocate method that uses PostgreSQL protocol Close message.
+* pgx uses new PgConn.Deallocate method. This allows deallocating statements to work in a failed transaction. This fixes a case where the prepared statement map could become invalid.
+* Fix: Prefer driver.Valuer over json.Marshaler for json fields. (Jacopo)
+* Fix: simple protocol SQL sanitizer previously panicked if an invalid $0 placeholder was used. This now returns an error instead. (maksymnevajdev)
+* Add pgtype.Numeric.ScanScientific (Eshton Robateau)
+
+# 5.5.0 (November 4, 2023)
+
+* Add CollectExactlyOneRow. (Julien GOTTELAND)
+* Add OpenDBFromPool to create *database/sql.DB from *pgxpool.Pool. (Lev Zakharov)
+* Prepare can automatically choose statement name based on sql. This makes it easier to explicitly manage prepared statements.
+* Statement cache now uses deterministic, stable statement names.
+* database/sql prepared statement names are deterministically generated.
+* Fix: SendBatch wasn't respecting context cancellation.
+* Fix: Timeout error from pipeline is now normalized.
+* Fix: database/sql encoding json.RawMessage to []byte.
+* CancelRequest: Wait for the cancel request to be acknowledged by the server. This should improve PgBouncer compatibility. (Anton Levakin)
+* stdlib: Use Ping instead of CheckConn in ResetSession
+* Add json.Marshaler and json.Unmarshaler for Float4, Float8 (Kirill Mironov)
+
+# 5.4.3 (August 5, 2023)
+
+* Fix: QCharArrayOID was defined with the wrong OID (Christoph Engelbert)
+* Fix: connect_timeout for sslmode=allow|prefer (smaher-edb)
+* Fix: pgxpool: background health check cannot overflow pool
+* Fix: Check for nil in defer when sending batch (recover properly from panic)
+* Fix: json scan of non-string pointer to pointer
+* Fix: zeronull.Timestamptz should use pgtype.Timestamptz
+* Fix: NewConnsCount was not correctly counting connections created by Acquire directly. (James Hartig)
+* RowTo(AddrOf)StructByPos ignores fields with "-" db tag
+* Optimization: improve text format numeric parsing (horpto)
+
+# 5.4.2 (July 11, 2023)
+
+* Fix: RowScanner errors are fatal to Rows
+* Fix: Enable failover efforts when pg_hba.conf disallows non-ssl connections (Brandon Kauffman)
+* Hstore text codec internal improvements (Evan Jones)
+* Fix: Stop timers for background reader when not in use. Fixes memory leak when closing connections (Adrian-Stefan Mares)
+* Fix: Stop background reader as soon as possible.
+* Add PgConn.SyncConn(). This combined with the above fix makes it safe to directly use the underlying net.Conn.
+
+# 5.4.1 (June 18, 2023)
+
+* Fix: concurrency bug with pgtypeDefaultMap and simple protocol (Lev Zakharov)
+* Add TxOptions.BeginQuery to allow overriding the default BEGIN query
+
+# 5.4.0 (June 14, 2023)
+
+* Replace platform specific syscalls for non-blocking IO with more traditional goroutines and deadlines. This returns to the v4 approach with some additional improvements and fixes. This restores the ability to use a pgx.Conn over an ssh.Conn as well as other non-TCP or Unix socket connections. In addition, it is a significantly simpler implementation that is less likely to have cross platform issues.
+* Optimization: The default type registrations are now shared among all connections. This saves about 100KB of memory per connection. `pgtype.Type` and `pgtype.Codec` values are now required to be immutable after registration. This was already necessary in most cases but wasn't documented until now. (Lev Zakharov)
+* Fix: Ensure pgxpool.Pool.QueryRow.Scan releases connection on panic
+* CancelRequest: don't try to read the reply (Nicola Murino)
+* Fix: correctly handle bool type aliases (Wichert Akkerman)
+* Fix: pgconn.CancelRequest: Fix unix sockets: don't use RemoteAddr()
+* Fix: pgx.Conn memory leak with prepared statement caching (Evan Jones)
+* Add BeforeClose to pgxpool.Pool (Evan Cordell)
+* Fix: various hstore fixes and optimizations (Evan Jones)
+* Fix: RowToStructByPos with embedded unexported struct
+* Support different bool string representations (Lev Zakharov)
+* Fix: error when using BatchResults.Exec on a select that returns an error after some rows.
+* Fix: pipelineBatchResults.Exec() not returning error from ResultReader
+* Fix: pipeline batch results not closing pipeline when error occurs while reading directly from results instead of using
+ a callback.
+* Fix: scanning a table type into a struct
+* Fix: scan array of record to pointer to slice of struct
+* Fix: handle null for json (Cemre Mengu)
+* Batch Query callback is called even when there is an error
+* Add RowTo(AddrOf)StructByNameLax (Audi P. Risa P)
+
+# 5.3.1 (February 27, 2023)
+
+* Fix: Support v4 and v5 stdlib in same program (Tomáš Procházka)
+* Fix: sql.Scanner not being used in certain cases
+* Add text format jsonpath support
+* Fix: fake non-blocking read adaptive wait time
+
+# 5.3.0 (February 11, 2023)
+
+* Fix: json values work with sql.Scanner
+* Fixed / improved error messages (Mark Chambers and Yevgeny Pats)
+* Fix: support scan into single dimensional arrays
+* Fix: MaxConnLifetimeJitter setting actually jitter (Ben Weintraub)
+* Fix: driver.Value representation of bytea should be []byte not string
+* Fix: better handling of unregistered OIDs
+* CopyFrom can use query cache to avoid extra round trip to get OIDs (Alejandro Do Nascimento Mora)
+* Fix: encode to json ignoring driver.Valuer
+* Support sql.Scanner on renamed base type
+* Fix: pgtype.Numeric text encoding of negative numbers (Mark Chambers)
+* Fix: connect with multiple hostnames when one can't be resolved
+* Upgrade puddle to remove dependency on uber/atomic and fix alignment issue on 32-bit platform
+* Fix: scanning json column into **string
+* Multiple reductions in memory allocations
+* Fake non-blocking read adapts its max wait time
+* Improve CopyFrom performance and reduce memory usage
+* Fix: encode []any to array
+* Fix: LoadType for composite with dropped attributes (Felix Röhrich)
+* Support v4 and v5 stdlib in same program
+* Fix: text format array decoding with string of "NULL"
+* Prefer binary format for arrays
+
+# 5.2.0 (December 5, 2022)
+
+* `tracelog.TraceLog` implements the pgx.PrepareTracer interface. (Vitalii Solodilov)
+* Optimize creating begin transaction SQL string (Petr Evdokimov and ksco)
+* `Conn.LoadType` supports range and multirange types (Vitalii Solodilov)
+* Fix scan `uint` and `uint64` `ScanNumeric`. This resolves a PostgreSQL `numeric` being incorrectly scanned into `uint` and `uint64`.
+
+# 5.1.1 (November 17, 2022)
+
+* Fix simple query sanitizer where query text contains a Unicode replacement character.
+* Remove erroneous `name` argument from `DeallocateAll()`. Technically, this is a breaking change, but given that method was only added 5 days ago this change was accepted. (Bodo Kaiser)
+
+# 5.1.0 (November 12, 2022)
+
+* Update puddle to v2.1.2. This resolves a race condition and a deadlock in pgxpool.
+* `QueryRewriter.RewriteQuery` now returns an error. Technically, this is a breaking change for any external implementers, but given the minimal likelihood that there are actually any external implementers this change was accepted.
+* Expose `GetSSLPassword` support to pgx.
+* Fix encode `ErrorResponse` unknown field handling. This would only affect pgproto3 being used directly as a proxy with a non-PostgreSQL server that included additional error fields.
+* Fix date text format encoding with 5 digit years.
+* Fix date values passed to a `sql.Scanner` as `string` instead of `time.Time`.
+* DateCodec.DecodeValue can return `pgtype.InfinityModifier` instead of `string` for infinite values. This now matches the behavior of the timestamp types.
+* Add domain type support to `Conn.LoadType()`.
+* Add `RowToStructByName` and `RowToAddrOfStructByName`. (Pavlo Golub)
+* Add `Conn.DeallocateAll()` to clear all prepared statements including the statement cache. (Bodo Kaiser)
+
+# 5.0.4 (October 24, 2022)
+
+* Fix: CollectOneRow prefers PostgreSQL error over pgx.ErrorNoRows
+* Fix: some reflect Kind checks to first check for nil
+* Bump golang.org/x/text dependency to placate snyk
+* Fix: RowToStructByPos on structs with multiple anonymous sub-structs (Baptiste Fontaine)
+* Fix: Exec checks if tx is closed
+
+# 5.0.3 (October 14, 2022)
+
+* Fix `driver.Valuer` handling edge cases that could cause infinite loop or crash
+
+# v5.0.2 (October 8, 2022)
+
+* Fix date encoding in text format to always use 2 digits for month and day
+* Prefer driver.Valuer over wrap plans when encoding
+* Fix scan to pointer to pointer to renamed type
+* Allow scanning NULL even if PG and Go types are incompatible
+
+# v5.0.1 (September 24, 2022)
+
+* Fix 32-bit atomic usage
+* Add MarshalJSON for Float8 (yogipristiawan)
+* Add `[` and `]` to text encoding of `Lseg`
+* Fix sqlScannerWrapper NULL handling
+
+# v5.0.0 (September 17, 2022)
+
+## Merged Packages
+
+`github.com/jackc/pgtype`, `github.com/jackc/pgconn`, and `github.com/jackc/pgproto3` are now included in the main
+`github.com/jackc/pgx` repository. Previously there was confusion as to where issues should be reported, additional
+release work due to releasing multiple packages, and less clear changelogs.
+
+## pgconn
+
+`CommandTag` is now an opaque type instead of directly exposing an underlying `[]byte`.
+
+The return value `ResultReader.Values()` is no longer safe to retain a reference to after a subsequent call to `NextRow()` or `Close()`.
+
+`Trace()` method adds low level message tracing similar to the `PQtrace` function in `libpq`.
+
+pgconn now uses non-blocking IO. This is a significant internal restructuring, but it should not cause any visible changes on its own. However, it is important in implementing other new features.
+
+`CheckConn()` checks a connection's liveness by doing a non-blocking read. This can be used to detect database restarts or network interruptions without executing a query or a ping.
+
+pgconn now supports pipeline mode.
+
+`*PgConn.ReceiveResults` removed. Use pipeline mode instead.
+
+`Timeout()` no longer considers `context.Canceled` as a timeout error. `context.DeadlineExceeded` still is considered a timeout error.
+
+## pgxpool
+
+`Connect` and `ConnectConfig` have been renamed to `New` and `NewWithConfig` respectively. The `LazyConnect` option has been removed. Pools always lazily connect.
+
+## pgtype
+
+The `pgtype` package has been significantly changed.
+
+### NULL Representation
+
+Previously, types had a `Status` field that could be `Undefined`, `Null`, or `Present`. This has been changed to a
+`Valid` `bool` field to harmonize with how `database/sql` represents `NULL` and to make the zero value useable.
+
+Previously, a type that implemented `driver.Valuer` would have the `Value` method called even on a nil pointer. All nils
+whether typed or untyped now represent `NULL`.
+
+### Codec and Value Split
+
+Previously, the type system combined decoding and encoding values with the value types. e.g. Type `Int8` both handled
+encoding and decoding the PostgreSQL representation and acted as a value object. This caused some difficulties when
+there was not an exact 1 to 1 relationship between the Go types and the PostgreSQL types For example, scanning a
+PostgreSQL binary `numeric` into a Go `float64` was awkward (see https://github.com/jackc/pgtype/issues/147). This
+concepts have been separated. A `Codec` only has responsibility for encoding and decoding values. Value types are
+generally defined by implementing an interface that a particular `Codec` understands (e.g. `PointScanner` and
+`PointValuer` for the PostgreSQL `point` type).
+
+### Array Types
+
+All array types are now handled by `ArrayCodec` instead of using code generation for each new array type. This also
+means that less common array types such as `point[]` are now supported. `Array[T]` supports PostgreSQL multi-dimensional
+arrays.
+
+### Composite Types
+
+Composite types must be registered before use. `CompositeFields` may still be used to construct and destruct composite
+values, but any type may now implement `CompositeIndexGetter` and `CompositeIndexScanner` to be used as a composite.
+
+### Range Types
+
+Range types are now handled with types `RangeCodec` and `Range[T]`. This allows additional user defined range types to
+easily be handled. Multirange types are handled similarly with `MultirangeCodec` and `Multirange[T]`.
+
+### pgxtype
+
+`LoadDataType` moved to `*Conn` as `LoadType`.
+
+### Bytea
+
+The `Bytea` and `GenericBinary` types have been replaced. Use the following instead:
+
+* `[]byte` - For normal usage directly use `[]byte`.
+* `DriverBytes` - Uses driver memory only available until next database method call. Avoids a copy and an allocation.
+* `PreallocBytes` - Uses preallocated byte slice to avoid an allocation.
+* `UndecodedBytes` - Avoids any decoding. Allows working with raw bytes.
+
+### Dropped lib/pq Support
+
+`pgtype` previously supported and was tested against [lib/pq](https://github.com/lib/pq). While it will continue to work
+in most cases this is no longer supported.
+
+### database/sql Scan
+
+Previously, most `Scan` implementations would convert `[]byte` to `string` automatically to decode a text value. Now
+only `string` is handled. This is to allow the possibility of future binary support in `database/sql` mode by
+considering `[]byte` to be binary format and `string` text format. This change should have no effect for any use with
+`pgx`. The previous behavior was only necessary for `lib/pq` compatibility.
+
+Added `*Map.SQLScanner` to create a `sql.Scanner` for types such as `[]int32` and `Range[T]` that do not implement
+`sql.Scanner` directly.
+
+### Number Type Fields Include Bit size
+
+`Int2`, `Int4`, `Int8`, `Float4`, `Float8`, and `Uint32` fields now include bit size. e.g. `Int` is renamed to `Int64`.
+This matches the convention set by `database/sql`. In addition, for comparable types like `pgtype.Int8` and
+`sql.NullInt64` the structures are identical. This means they can be directly converted one to another.
+
+### 3rd Party Type Integrations
+
+* Extracted integrations with https://github.com/shopspring/decimal and https://github.com/gofrs/uuid to
+ https://github.com/jackc/pgx-shopspring-decimal and https://github.com/jackc/pgx-gofrs-uuid respectively. This trims
+ the pgx dependency tree.
+
+### Other Changes
+
+* `Bit` and `Varbit` are both replaced by the `Bits` type.
+* `CID`, `OID`, `OIDValue`, and `XID` are replaced by the `Uint32` type.
+* `Hstore` is now defined as `map[string]*string`.
+* `JSON` and `JSONB` types removed. Use `[]byte` or `string` directly.
+* `QChar` type removed. Use `rune` or `byte` directly.
+* `Inet` and `Cidr` types removed. Use `netip.Addr` and `netip.Prefix` directly. These types are more memory efficient than the previous `net.IPNet`.
+* `Macaddr` type removed. Use `net.HardwareAddr` directly.
+* Renamed `pgtype.ConnInfo` to `pgtype.Map`.
+* Renamed `pgtype.DataType` to `pgtype.Type`.
+* Renamed `pgtype.None` to `pgtype.Finite`.
+* `RegisterType` now accepts a `*Type` instead of `Type`.
+* Assorted array helper methods and types made private.
+
+## stdlib
+
+* Removed `AcquireConn` and `ReleaseConn` as that functionality has been built in since Go 1.13.
+
+## Reduced Memory Usage by Reusing Read Buffers
+
+Previously, the connection read buffer would allocate large chunks of memory and never reuse them. This allowed
+transferring ownership to anything such as scanned values without incurring an additional allocation and memory copy.
+However, this came at the cost of overall increased memory allocation size. But worse it was also possible to pin large
+chunks of memory by retaining a reference to a small value that originally came directly from the read buffer. Now
+ownership remains with the read buffer and anything needing to retain a value must make a copy.
+
+## Query Execution Modes
+
+Control over automatic prepared statement caching and simple protocol use are now combined into query execution mode.
+See documentation for `QueryExecMode`.
+
+## QueryRewriter Interface and NamedArgs
+
+pgx now supports named arguments with the `NamedArgs` type. This is implemented via the new `QueryRewriter` interface which
+allows arbitrary rewriting of query SQL and arguments.
+
+## RowScanner Interface
+
+The `RowScanner` interface allows a single argument to Rows.Scan to scan the entire row.
+
+## Rows Result Helpers
+
+* `CollectRows` and `RowTo*` functions simplify collecting results into a slice.
+* `CollectOneRow` collects one row using `RowTo*` functions.
+* `ForEachRow` simplifies scanning each row and executing code using the scanned values. `ForEachRow` replaces `QueryFunc`.
+
+## Tx Helpers
+
+Rather than every type that implemented `Begin` or `BeginTx` methods also needing to implement `BeginFunc` and
+`BeginTxFunc` these methods have been converted to functions that take a db that implements `Begin` or `BeginTx`.
+
+## Improved Batch Query Ergonomics
+
+Previously, the code for building a batch went in one place before the call to `SendBatch`, and the code for reading the
+results went in one place after the call to `SendBatch`. This could make it difficult to match up the query and the code
+to handle the results. Now `Queue` returns a `QueuedQuery` which has methods `Query`, `QueryRow`, and `Exec` which can
+be used to register a callback function that will handle the result. Callback functions are called automatically when
+`BatchResults.Close` is called.
+
+## SendBatch Uses Pipeline Mode When Appropriate
+
+Previously, a batch with 10 unique parameterized statements executed 100 times would entail 11 network round trips. 1
+for each prepare / describe and 1 for executing them all. Now pipeline mode is used to prepare / describe all statements
+in a single network round trip. So it would only take 2 round trips.
+
+## Tracing and Logging
+
+Internal logging support has been replaced with tracing hooks. This allows custom tracing integration with tools like OpenTelemetry. Package tracelog provides an adapter for pgx v4 loggers to act as a tracer.
+
+All integrations with 3rd party loggers have been extracted to separate repositories. This trims the pgx dependency
+tree.
diff --git a/vendor/github.com/jackc/pgx/v5/CONTRIBUTING.md b/vendor/github.com/jackc/pgx/v5/CONTRIBUTING.md
new file mode 100644
index 0000000..c975a93
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/CONTRIBUTING.md
@@ -0,0 +1,121 @@
+# Contributing
+
+## Discuss Significant Changes
+
+Before you invest a significant amount of time on a change, please create a discussion or issue describing your
+proposal. This will help to ensure your proposed change has a reasonable chance of being merged.
+
+## Avoid Dependencies
+
+Adding a dependency is a big deal. While on occasion a new dependency may be accepted, the default answer to any change
+that adds a dependency is no.
+
+## Development Environment Setup
+
+pgx tests naturally require a PostgreSQL database. It will connect to the database specified in the `PGX_TEST_DATABASE`
+environment variable. The `PGX_TEST_DATABASE` environment variable can either be a URL or key-value pairs. In addition,
+the standard `PG*` environment variables will be respected. Consider using [direnv](https://github.com/direnv/direnv) to
+simplify environment variable handling.
+
+### Using an Existing PostgreSQL Cluster
+
+If you already have a PostgreSQL development server this is the quickest way to start and run the majority of the pgx
+test suite. Some tests will be skipped that require server configuration changes (e.g. those testing different
+authentication methods).
+
+Create and setup a test database:
+
+```
+export PGDATABASE=pgx_test
+createdb
+psql -c 'create extension hstore;'
+psql -c 'create extension ltree;'
+psql -c 'create domain uint64 as numeric(20,0);'
+```
+
+Ensure a `postgres` user exists. This happens by default in normal PostgreSQL installs, but some installation methods
+such as Homebrew do not.
+
+```
+createuser -s postgres
+```
+
+Ensure your `PGX_TEST_DATABASE` environment variable points to the database you just created and run the tests.
+
+```
+export PGX_TEST_DATABASE="host=/private/tmp database=pgx_test"
+go test ./...
+```
+
+This will run the vast majority of the tests, but some tests will be skipped (e.g. those testing different connection methods).
+
+### Creating a New PostgreSQL Cluster Exclusively for Testing
+
+The following environment variables need to be set both for initial setup and whenever the tests are run. (direnv is
+highly recommended). Depending on your platform, you may need to change the host for `PGX_TEST_UNIX_SOCKET_CONN_STRING`.
+
+```
+export PGPORT=5015
+export PGUSER=postgres
+export PGDATABASE=pgx_test
+export POSTGRESQL_DATA_DIR=postgresql
+
+export PGX_TEST_DATABASE="host=127.0.0.1 database=pgx_test user=pgx_md5 password=secret"
+export PGX_TEST_UNIX_SOCKET_CONN_STRING="host=/private/tmp database=pgx_test"
+export PGX_TEST_TCP_CONN_STRING="host=127.0.0.1 database=pgx_test user=pgx_md5 password=secret"
+export PGX_TEST_SCRAM_PASSWORD_CONN_STRING="host=127.0.0.1 user=pgx_scram password=secret database=pgx_test"
+export PGX_TEST_MD5_PASSWORD_CONN_STRING="host=127.0.0.1 database=pgx_test user=pgx_md5 password=secret"
+export PGX_TEST_PLAIN_PASSWORD_CONN_STRING="host=127.0.0.1 user=pgx_pw password=secret"
+export PGX_TEST_TLS_CONN_STRING="host=localhost user=pgx_ssl password=secret sslmode=verify-full sslrootcert=`pwd`/.testdb/ca.pem"
+export PGX_SSL_PASSWORD=certpw
+export PGX_TEST_TLS_CLIENT_CONN_STRING="host=localhost user=pgx_sslcert sslmode=verify-full sslrootcert=`pwd`/.testdb/ca.pem database=pgx_test sslcert=`pwd`/.testdb/pgx_sslcert.crt sslkey=`pwd`/.testdb/pgx_sslcert.key"
+```
+
+Create a new database cluster.
+
+```
+initdb --locale=en_US -E UTF-8 --username=postgres .testdb/$POSTGRESQL_DATA_DIR
+
+echo "listen_addresses = '127.0.0.1'" >> .testdb/$POSTGRESQL_DATA_DIR/postgresql.conf
+echo "port = $PGPORT" >> .testdb/$POSTGRESQL_DATA_DIR/postgresql.conf
+cat testsetup/postgresql_ssl.conf >> .testdb/$POSTGRESQL_DATA_DIR/postgresql.conf
+cp testsetup/pg_hba.conf .testdb/$POSTGRESQL_DATA_DIR/pg_hba.conf
+
+cd .testdb
+
+# Generate CA, server, and encrypted client certificates.
+go run ../testsetup/generate_certs.go
+
+# Copy certificates to server directory and set permissions.
+cp ca.pem $POSTGRESQL_DATA_DIR/root.crt
+cp localhost.key $POSTGRESQL_DATA_DIR/server.key
+chmod 600 $POSTGRESQL_DATA_DIR/server.key
+cp localhost.crt $POSTGRESQL_DATA_DIR/server.crt
+
+cd ..
+```
+
+
+Start the new cluster. This will be necessary whenever you are running pgx tests.
+
+```
+postgres -D .testdb/$POSTGRESQL_DATA_DIR
+```
+
+Setup the test database in the new cluster.
+
+```
+createdb
+psql --no-psqlrc -f testsetup/postgresql_setup.sql
+```
+
+### PgBouncer
+
+There are tests specific for PgBouncer that will be executed if `PGX_TEST_PGBOUNCER_CONN_STRING` is set.
+
+### Optional Tests
+
+pgx supports multiple connection types and means of authentication. These tests are optional. They will only run if the
+appropriate environment variables are set. In addition, there may be tests specific to particular PostgreSQL versions,
+non-PostgreSQL servers (e.g. CockroachDB), or connection poolers (e.g. PgBouncer). `go test ./... -v | grep SKIP` to see
+if any tests are being skipped.
diff --git a/vendor/github.com/jackc/pgtype/LICENSE b/vendor/github.com/jackc/pgx/v5/LICENSE
index 5c486c3..5c486c3 100644
--- a/vendor/github.com/jackc/pgtype/LICENSE
+++ b/vendor/github.com/jackc/pgx/v5/LICENSE
diff --git a/vendor/github.com/jackc/pgx/v5/README.md b/vendor/github.com/jackc/pgx/v5/README.md
new file mode 100644
index 0000000..bbeb133
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/README.md
@@ -0,0 +1,174 @@
+[![Go Reference](https://pkg.go.dev/badge/github.com/jackc/pgx/v5.svg)](https://pkg.go.dev/github.com/jackc/pgx/v5)
+[![Build Status](https://github.com/jackc/pgx/actions/workflows/ci.yml/badge.svg)](https://github.com/jackc/pgx/actions/workflows/ci.yml)
+
+# pgx - PostgreSQL Driver and Toolkit
+
+pgx is a pure Go driver and toolkit for PostgreSQL.
+
+The pgx driver is a low-level, high performance interface that exposes PostgreSQL-specific features such as `LISTEN` /
+`NOTIFY` and `COPY`. It also includes an adapter for the standard `database/sql` interface.
+
+The toolkit component is a related set of packages that implement PostgreSQL functionality such as parsing the wire protocol
+and type mapping between PostgreSQL and Go. These underlying packages can be used to implement alternative drivers,
+proxies, load balancers, logical replication clients, etc.
+
+## Example Usage
+
+```go
+package main
+
+import (
+ "context"
+ "fmt"
+ "os"
+
+ "github.com/jackc/pgx/v5"
+)
+
+func main() {
+ // urlExample := "postgres://username:password@localhost:5432/database_name"
+ conn, err := pgx.Connect(context.Background(), os.Getenv("DATABASE_URL"))
+ if err != nil {
+ fmt.Fprintf(os.Stderr, "Unable to connect to database: %v\n", err)
+ os.Exit(1)
+ }
+ defer conn.Close(context.Background())
+
+ var name string
+ var weight int64
+ err = conn.QueryRow(context.Background(), "select name, weight from widgets where id=$1", 42).Scan(&name, &weight)
+ if err != nil {
+ fmt.Fprintf(os.Stderr, "QueryRow failed: %v\n", err)
+ os.Exit(1)
+ }
+
+ fmt.Println(name, weight)
+}
+```
+
+See the [getting started guide](https://github.com/jackc/pgx/wiki/Getting-started-with-pgx) for more information.
+
+## Features
+
+* Support for approximately 70 different PostgreSQL types
+* Automatic statement preparation and caching
+* Batch queries
+* Single-round trip query mode
+* Full TLS connection control
+* Binary format support for custom types (allows for much quicker encoding/decoding)
+* `COPY` protocol support for faster bulk data loads
+* Tracing and logging support
+* Connection pool with after-connect hook for arbitrary connection setup
+* `LISTEN` / `NOTIFY`
+* Conversion of PostgreSQL arrays to Go slice mappings for integers, floats, and strings
+* `hstore` support
+* `json` and `jsonb` support
+* Maps `inet` and `cidr` PostgreSQL types to `netip.Addr` and `netip.Prefix`
+* Large object support
+* NULL mapping to pointer to pointer
+* Supports `database/sql.Scanner` and `database/sql/driver.Valuer` interfaces for custom types
+* Notice response handling
+* Simulated nested transactions with savepoints
+
+## Choosing Between the pgx and database/sql Interfaces
+
+The pgx interface is faster. Many PostgreSQL specific features such as `LISTEN` / `NOTIFY` and `COPY` are not available
+through the `database/sql` interface.
+
+The pgx interface is recommended when:
+
+1. The application only targets PostgreSQL.
+2. No other libraries that require `database/sql` are in use.
+
+It is also possible to use the `database/sql` interface and convert a connection to the lower-level pgx interface as needed.
+
+## Testing
+
+See [CONTRIBUTING.md](./CONTRIBUTING.md) for setup instructions.
+
+## Architecture
+
+See the presentation at Golang Estonia, [PGX Top to Bottom](https://www.youtube.com/watch?v=sXMSWhcHCf8) for a description of pgx architecture.
+
+## Supported Go and PostgreSQL Versions
+
+pgx supports the same versions of Go and PostgreSQL that are supported by their respective teams. For [Go](https://golang.org/doc/devel/release.html#policy) that is the two most recent major releases and for [PostgreSQL](https://www.postgresql.org/support/versioning/) the major releases in the last 5 years. This means pgx supports Go 1.21 and higher and PostgreSQL 12 and higher. pgx also is tested against the latest version of [CockroachDB](https://www.cockroachlabs.com/product/).
+
+## Version Policy
+
+pgx follows semantic versioning for the documented public API on stable releases. `v5` is the latest stable major version.
+
+## PGX Family Libraries
+
+### [github.com/jackc/pglogrepl](https://github.com/jackc/pglogrepl)
+
+pglogrepl provides functionality to act as a client for PostgreSQL logical replication.
+
+### [github.com/jackc/pgmock](https://github.com/jackc/pgmock)
+
+pgmock offers the ability to create a server that mocks the PostgreSQL wire protocol. This is used internally to test pgx by purposely inducing unusual errors. pgproto3 and pgmock together provide most of the foundational tooling required to implement a PostgreSQL proxy or MitM (such as for a custom connection pooler).
+
+### [github.com/jackc/tern](https://github.com/jackc/tern)
+
+tern is a stand-alone SQL migration system.
+
+### [github.com/jackc/pgerrcode](https://github.com/jackc/pgerrcode)
+
+pgerrcode contains constants for the PostgreSQL error codes.
+
+## Adapters for 3rd Party Types
+
+* [github.com/jackc/pgx-gofrs-uuid](https://github.com/jackc/pgx-gofrs-uuid)
+* [github.com/jackc/pgx-shopspring-decimal](https://github.com/jackc/pgx-shopspring-decimal)
+* [github.com/twpayne/pgx-geos](https://github.com/twpayne/pgx-geos) ([PostGIS](https://postgis.net/) and [GEOS](https://libgeos.org/) via [go-geos](https://github.com/twpayne/go-geos))
+* [github.com/vgarvardt/pgx-google-uuid](https://github.com/vgarvardt/pgx-google-uuid)
+
+
+## Adapters for 3rd Party Tracers
+
+* [github.com/jackhopner/pgx-xray-tracer](https://github.com/jackhopner/pgx-xray-tracer)
+
+## Adapters for 3rd Party Loggers
+
+These adapters can be used with the tracelog package.
+
+* [github.com/jackc/pgx-go-kit-log](https://github.com/jackc/pgx-go-kit-log)
+* [github.com/jackc/pgx-log15](https://github.com/jackc/pgx-log15)
+* [github.com/jackc/pgx-logrus](https://github.com/jackc/pgx-logrus)
+* [github.com/jackc/pgx-zap](https://github.com/jackc/pgx-zap)
+* [github.com/jackc/pgx-zerolog](https://github.com/jackc/pgx-zerolog)
+* [github.com/mcosta74/pgx-slog](https://github.com/mcosta74/pgx-slog)
+* [github.com/kataras/pgx-golog](https://github.com/kataras/pgx-golog)
+
+## 3rd Party Libraries with PGX Support
+
+### [github.com/pashagolub/pgxmock](https://github.com/pashagolub/pgxmock)
+
+pgxmock is a mock library implementing pgx interfaces.
+pgxmock has one and only purpose - to simulate pgx behavior in tests, without needing a real database connection.
+
+### [github.com/georgysavva/scany](https://github.com/georgysavva/scany)
+
+Library for scanning data from a database into Go structs and more.
+
+### [github.com/vingarcia/ksql](https://github.com/vingarcia/ksql)
+
+A carefully designed SQL client for making using SQL easier,
+more productive, and less error-prone on Golang.
+
+### [github.com/otan/gopgkrb5](https://github.com/otan/gopgkrb5)
+
+Adds GSSAPI / Kerberos authentication support.
+
+### [github.com/wcamarao/pmx](https://github.com/wcamarao/pmx)
+
+Explicit data mapping and scanning library for Go structs and slices.
+
+### [github.com/stephenafamo/scan](https://github.com/stephenafamo/scan)
+
+Type safe and flexible package for scanning database data into Go types.
+Supports, structs, maps, slices and custom mapping functions.
+
+### [github.com/z0ne-dev/mgx](https://github.com/z0ne-dev/mgx)
+
+Code first migration library for native pgx (no database/sql abstraction).
diff --git a/vendor/github.com/jackc/pgx/v5/Rakefile b/vendor/github.com/jackc/pgx/v5/Rakefile
new file mode 100644
index 0000000..d957573
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/Rakefile
@@ -0,0 +1,18 @@
+require "erb"
+
+rule '.go' => '.go.erb' do |task|
+ erb = ERB.new(File.read(task.source))
+ File.write(task.name, "// Do not edit. Generated from #{task.source}\n" + erb.result(binding))
+ sh "goimports", "-w", task.name
+end
+
+generated_code_files = [
+ "pgtype/int.go",
+ "pgtype/int_test.go",
+ "pgtype/integration_benchmark_test.go",
+ "pgtype/zeronull/int.go",
+ "pgtype/zeronull/int_test.go"
+]
+
+desc "Generate code"
+task generate: generated_code_files
diff --git a/vendor/github.com/jackc/pgx/v5/batch.go b/vendor/github.com/jackc/pgx/v5/batch.go
new file mode 100644
index 0000000..c3c2834
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/batch.go
@@ -0,0 +1,443 @@
+package pgx
+
+import (
+ "context"
+ "errors"
+ "fmt"
+
+ "github.com/jackc/pgx/v5/pgconn"
+)
+
+// QueuedQuery is a query that has been queued for execution via a Batch.
+type QueuedQuery struct {
+ SQL string
+ Arguments []any
+ Fn batchItemFunc
+ sd *pgconn.StatementDescription
+}
+
+type batchItemFunc func(br BatchResults) error
+
+// Query sets fn to be called when the response to qq is received.
+func (qq *QueuedQuery) Query(fn func(rows Rows) error) {
+ qq.Fn = func(br BatchResults) error {
+ rows, _ := br.Query()
+ defer rows.Close()
+
+ err := fn(rows)
+ if err != nil {
+ return err
+ }
+ rows.Close()
+
+ return rows.Err()
+ }
+}
+
+// Query sets fn to be called when the response to qq is received.
+func (qq *QueuedQuery) QueryRow(fn func(row Row) error) {
+ qq.Fn = func(br BatchResults) error {
+ row := br.QueryRow()
+ return fn(row)
+ }
+}
+
+// Exec sets fn to be called when the response to qq is received.
+func (qq *QueuedQuery) Exec(fn func(ct pgconn.CommandTag) error) {
+ qq.Fn = func(br BatchResults) error {
+ ct, err := br.Exec()
+ if err != nil {
+ return err
+ }
+
+ return fn(ct)
+ }
+}
+
+// Batch queries are a way of bundling multiple queries together to avoid
+// unnecessary network round trips. A Batch must only be sent once.
+type Batch struct {
+ QueuedQueries []*QueuedQuery
+}
+
+// Queue queues a query to batch b. query can be an SQL query or the name of a prepared statement. The only pgx option
+// argument that is supported is QueryRewriter. Queries are executed using the connection's DefaultQueryExecMode.
+//
+// While query can contain multiple statements if the connection's DefaultQueryExecMode is QueryModeSimple, this should
+// be avoided. QueuedQuery.Fn must not be set as it will only be called for the first query. That is, QueuedQuery.Query,
+// QueuedQuery.QueryRow, and QueuedQuery.Exec must not be called. In addition, any error messages or tracing that
+// include the current query may reference the wrong query.
+func (b *Batch) Queue(query string, arguments ...any) *QueuedQuery {
+ qq := &QueuedQuery{
+ SQL: query,
+ Arguments: arguments,
+ }
+ b.QueuedQueries = append(b.QueuedQueries, qq)
+ return qq
+}
+
+// Len returns number of queries that have been queued so far.
+func (b *Batch) Len() int {
+ return len(b.QueuedQueries)
+}
+
+type BatchResults interface {
+ // Exec reads the results from the next query in the batch as if the query has been sent with Conn.Exec. Prefer
+ // calling Exec on the QueuedQuery.
+ Exec() (pgconn.CommandTag, error)
+
+ // Query reads the results from the next query in the batch as if the query has been sent with Conn.Query. Prefer
+ // calling Query on the QueuedQuery.
+ Query() (Rows, error)
+
+ // QueryRow reads the results from the next query in the batch as if the query has been sent with Conn.QueryRow.
+ // Prefer calling QueryRow on the QueuedQuery.
+ QueryRow() Row
+
+ // Close closes the batch operation. All unread results are read and any callback functions registered with
+ // QueuedQuery.Query, QueuedQuery.QueryRow, or QueuedQuery.Exec will be called. If a callback function returns an
+ // error or the batch encounters an error subsequent callback functions will not be called.
+ //
+ // Close must be called before the underlying connection can be used again. Any error that occurred during a batch
+ // operation may have made it impossible to resyncronize the connection with the server. In this case the underlying
+ // connection will have been closed.
+ //
+ // Close is safe to call multiple times. If it returns an error subsequent calls will return the same error. Callback
+ // functions will not be rerun.
+ Close() error
+}
+
+type batchResults struct {
+ ctx context.Context
+ conn *Conn
+ mrr *pgconn.MultiResultReader
+ err error
+ b *Batch
+ qqIdx int
+ closed bool
+ endTraced bool
+}
+
+// Exec reads the results from the next query in the batch as if the query has been sent with Exec.
+func (br *batchResults) Exec() (pgconn.CommandTag, error) {
+ if br.err != nil {
+ return pgconn.CommandTag{}, br.err
+ }
+ if br.closed {
+ return pgconn.CommandTag{}, fmt.Errorf("batch already closed")
+ }
+
+ query, arguments, _ := br.nextQueryAndArgs()
+
+ if !br.mrr.NextResult() {
+ err := br.mrr.Close()
+ if err == nil {
+ err = errors.New("no more results in batch")
+ }
+ if br.conn.batchTracer != nil {
+ br.conn.batchTracer.TraceBatchQuery(br.ctx, br.conn, TraceBatchQueryData{
+ SQL: query,
+ Args: arguments,
+ Err: err,
+ })
+ }
+ return pgconn.CommandTag{}, err
+ }
+
+ commandTag, err := br.mrr.ResultReader().Close()
+ if err != nil {
+ br.err = err
+ br.mrr.Close()
+ }
+
+ if br.conn.batchTracer != nil {
+ br.conn.batchTracer.TraceBatchQuery(br.ctx, br.conn, TraceBatchQueryData{
+ SQL: query,
+ Args: arguments,
+ CommandTag: commandTag,
+ Err: br.err,
+ })
+ }
+
+ return commandTag, br.err
+}
+
+// Query reads the results from the next query in the batch as if the query has been sent with Query.
+func (br *batchResults) Query() (Rows, error) {
+ query, arguments, ok := br.nextQueryAndArgs()
+ if !ok {
+ query = "batch query"
+ }
+
+ if br.err != nil {
+ return &baseRows{err: br.err, closed: true}, br.err
+ }
+
+ if br.closed {
+ alreadyClosedErr := fmt.Errorf("batch already closed")
+ return &baseRows{err: alreadyClosedErr, closed: true}, alreadyClosedErr
+ }
+
+ rows := br.conn.getRows(br.ctx, query, arguments)
+ rows.batchTracer = br.conn.batchTracer
+
+ if !br.mrr.NextResult() {
+ rows.err = br.mrr.Close()
+ if rows.err == nil {
+ rows.err = errors.New("no more results in batch")
+ }
+ rows.closed = true
+
+ if br.conn.batchTracer != nil {
+ br.conn.batchTracer.TraceBatchQuery(br.ctx, br.conn, TraceBatchQueryData{
+ SQL: query,
+ Args: arguments,
+ Err: rows.err,
+ })
+ }
+
+ return rows, rows.err
+ }
+
+ rows.resultReader = br.mrr.ResultReader()
+ return rows, nil
+}
+
+// QueryRow reads the results from the next query in the batch as if the query has been sent with QueryRow.
+func (br *batchResults) QueryRow() Row {
+ rows, _ := br.Query()
+ return (*connRow)(rows.(*baseRows))
+
+}
+
+// Close closes the batch operation. Any error that occurred during a batch operation may have made it impossible to
+// resyncronize the connection with the server. In this case the underlying connection will have been closed.
+func (br *batchResults) Close() error {
+ defer func() {
+ if !br.endTraced {
+ if br.conn != nil && br.conn.batchTracer != nil {
+ br.conn.batchTracer.TraceBatchEnd(br.ctx, br.conn, TraceBatchEndData{Err: br.err})
+ }
+ br.endTraced = true
+ }
+ }()
+
+ if br.err != nil {
+ return br.err
+ }
+
+ if br.closed {
+ return nil
+ }
+
+ // Read and run fn for all remaining items
+ for br.err == nil && !br.closed && br.b != nil && br.qqIdx < len(br.b.QueuedQueries) {
+ if br.b.QueuedQueries[br.qqIdx].Fn != nil {
+ err := br.b.QueuedQueries[br.qqIdx].Fn(br)
+ if err != nil {
+ br.err = err
+ }
+ } else {
+ br.Exec()
+ }
+ }
+
+ br.closed = true
+
+ err := br.mrr.Close()
+ if br.err == nil {
+ br.err = err
+ }
+
+ return br.err
+}
+
+func (br *batchResults) earlyError() error {
+ return br.err
+}
+
+func (br *batchResults) nextQueryAndArgs() (query string, args []any, ok bool) {
+ if br.b != nil && br.qqIdx < len(br.b.QueuedQueries) {
+ bi := br.b.QueuedQueries[br.qqIdx]
+ query = bi.SQL
+ args = bi.Arguments
+ ok = true
+ br.qqIdx++
+ }
+ return
+}
+
+type pipelineBatchResults struct {
+ ctx context.Context
+ conn *Conn
+ pipeline *pgconn.Pipeline
+ lastRows *baseRows
+ err error
+ b *Batch
+ qqIdx int
+ closed bool
+ endTraced bool
+}
+
+// Exec reads the results from the next query in the batch as if the query has been sent with Exec.
+func (br *pipelineBatchResults) Exec() (pgconn.CommandTag, error) {
+ if br.err != nil {
+ return pgconn.CommandTag{}, br.err
+ }
+ if br.closed {
+ return pgconn.CommandTag{}, fmt.Errorf("batch already closed")
+ }
+ if br.lastRows != nil && br.lastRows.err != nil {
+ return pgconn.CommandTag{}, br.err
+ }
+
+ query, arguments, err := br.nextQueryAndArgs()
+ if err != nil {
+ return pgconn.CommandTag{}, err
+ }
+
+ results, err := br.pipeline.GetResults()
+ if err != nil {
+ br.err = err
+ return pgconn.CommandTag{}, br.err
+ }
+ var commandTag pgconn.CommandTag
+ switch results := results.(type) {
+ case *pgconn.ResultReader:
+ commandTag, br.err = results.Close()
+ default:
+ return pgconn.CommandTag{}, fmt.Errorf("unexpected pipeline result: %T", results)
+ }
+
+ if br.conn.batchTracer != nil {
+ br.conn.batchTracer.TraceBatchQuery(br.ctx, br.conn, TraceBatchQueryData{
+ SQL: query,
+ Args: arguments,
+ CommandTag: commandTag,
+ Err: br.err,
+ })
+ }
+
+ return commandTag, br.err
+}
+
+// Query reads the results from the next query in the batch as if the query has been sent with Query.
+func (br *pipelineBatchResults) Query() (Rows, error) {
+ if br.err != nil {
+ return &baseRows{err: br.err, closed: true}, br.err
+ }
+
+ if br.closed {
+ alreadyClosedErr := fmt.Errorf("batch already closed")
+ return &baseRows{err: alreadyClosedErr, closed: true}, alreadyClosedErr
+ }
+
+ if br.lastRows != nil && br.lastRows.err != nil {
+ br.err = br.lastRows.err
+ return &baseRows{err: br.err, closed: true}, br.err
+ }
+
+ query, arguments, err := br.nextQueryAndArgs()
+ if err != nil {
+ return &baseRows{err: err, closed: true}, err
+ }
+
+ rows := br.conn.getRows(br.ctx, query, arguments)
+ rows.batchTracer = br.conn.batchTracer
+ br.lastRows = rows
+
+ results, err := br.pipeline.GetResults()
+ if err != nil {
+ br.err = err
+ rows.err = err
+ rows.closed = true
+
+ if br.conn.batchTracer != nil {
+ br.conn.batchTracer.TraceBatchQuery(br.ctx, br.conn, TraceBatchQueryData{
+ SQL: query,
+ Args: arguments,
+ Err: err,
+ })
+ }
+ } else {
+ switch results := results.(type) {
+ case *pgconn.ResultReader:
+ rows.resultReader = results
+ default:
+ err = fmt.Errorf("unexpected pipeline result: %T", results)
+ br.err = err
+ rows.err = err
+ rows.closed = true
+ }
+ }
+
+ return rows, rows.err
+}
+
+// QueryRow reads the results from the next query in the batch as if the query has been sent with QueryRow.
+func (br *pipelineBatchResults) QueryRow() Row {
+ rows, _ := br.Query()
+ return (*connRow)(rows.(*baseRows))
+
+}
+
+// Close closes the batch operation. Any error that occurred during a batch operation may have made it impossible to
+// resyncronize the connection with the server. In this case the underlying connection will have been closed.
+func (br *pipelineBatchResults) Close() error {
+ defer func() {
+ if !br.endTraced {
+ if br.conn.batchTracer != nil {
+ br.conn.batchTracer.TraceBatchEnd(br.ctx, br.conn, TraceBatchEndData{Err: br.err})
+ }
+ br.endTraced = true
+ }
+ }()
+
+ if br.err == nil && br.lastRows != nil && br.lastRows.err != nil {
+ br.err = br.lastRows.err
+ return br.err
+ }
+
+ if br.closed {
+ return br.err
+ }
+
+ // Read and run fn for all remaining items
+ for br.err == nil && !br.closed && br.b != nil && br.qqIdx < len(br.b.QueuedQueries) {
+ if br.b.QueuedQueries[br.qqIdx].Fn != nil {
+ err := br.b.QueuedQueries[br.qqIdx].Fn(br)
+ if err != nil {
+ br.err = err
+ }
+ } else {
+ br.Exec()
+ }
+ }
+
+ br.closed = true
+
+ err := br.pipeline.Close()
+ if br.err == nil {
+ br.err = err
+ }
+
+ return br.err
+}
+
+func (br *pipelineBatchResults) earlyError() error {
+ return br.err
+}
+
+func (br *pipelineBatchResults) nextQueryAndArgs() (query string, args []any, err error) {
+ if br.b == nil {
+ return "", nil, errors.New("no reference to batch")
+ }
+
+ if br.qqIdx >= len(br.b.QueuedQueries) {
+ return "", nil, errors.New("no more results in batch")
+ }
+
+ bi := br.b.QueuedQueries[br.qqIdx]
+ br.qqIdx++
+ return bi.SQL, bi.Arguments, nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/conn.go b/vendor/github.com/jackc/pgx/v5/conn.go
new file mode 100644
index 0000000..ed6a3a0
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/conn.go
@@ -0,0 +1,1444 @@
+package pgx
+
+import (
+ "context"
+ "crypto/sha256"
+ "database/sql"
+ "encoding/hex"
+ "errors"
+ "fmt"
+ "strconv"
+ "strings"
+ "time"
+
+ "github.com/jackc/pgx/v5/internal/sanitize"
+ "github.com/jackc/pgx/v5/internal/stmtcache"
+ "github.com/jackc/pgx/v5/pgconn"
+ "github.com/jackc/pgx/v5/pgtype"
+)
+
+// ConnConfig contains all the options used to establish a connection. It must be created by ParseConfig and
+// then it can be modified. A manually initialized ConnConfig will cause ConnectConfig to panic.
+type ConnConfig struct {
+ pgconn.Config
+
+ Tracer QueryTracer
+
+ // Original connection string that was parsed into config.
+ connString string
+
+ // StatementCacheCapacity is maximum size of the statement cache used when executing a query with "cache_statement"
+ // query exec mode.
+ StatementCacheCapacity int
+
+ // DescriptionCacheCapacity is the maximum size of the description cache used when executing a query with
+ // "cache_describe" query exec mode.
+ DescriptionCacheCapacity int
+
+ // DefaultQueryExecMode controls the default mode for executing queries. By default pgx uses the extended protocol
+ // and automatically prepares and caches prepared statements. However, this may be incompatible with proxies such as
+ // PGBouncer. In this case it may be preferable to use QueryExecModeExec or QueryExecModeSimpleProtocol. The same
+ // functionality can be controlled on a per query basis by passing a QueryExecMode as the first query argument.
+ DefaultQueryExecMode QueryExecMode
+
+ createdByParseConfig bool // Used to enforce created by ParseConfig rule.
+}
+
+// ParseConfigOptions contains options that control how a config is built such as getsslpassword.
+type ParseConfigOptions struct {
+ pgconn.ParseConfigOptions
+}
+
+// Copy returns a deep copy of the config that is safe to use and modify.
+// The only exception is the tls.Config:
+// according to the tls.Config docs it must not be modified after creation.
+func (cc *ConnConfig) Copy() *ConnConfig {
+ newConfig := new(ConnConfig)
+ *newConfig = *cc
+ newConfig.Config = *newConfig.Config.Copy()
+ return newConfig
+}
+
+// ConnString returns the connection string as parsed by pgx.ParseConfig into pgx.ConnConfig.
+func (cc *ConnConfig) ConnString() string { return cc.connString }
+
+// Conn is a PostgreSQL connection handle. It is not safe for concurrent usage. Use a connection pool to manage access
+// to multiple database connections from multiple goroutines.
+type Conn struct {
+ pgConn *pgconn.PgConn
+ config *ConnConfig // config used when establishing this connection
+ preparedStatements map[string]*pgconn.StatementDescription
+ statementCache stmtcache.Cache
+ descriptionCache stmtcache.Cache
+
+ queryTracer QueryTracer
+ batchTracer BatchTracer
+ copyFromTracer CopyFromTracer
+ prepareTracer PrepareTracer
+
+ notifications []*pgconn.Notification
+
+ doneChan chan struct{}
+ closedChan chan error
+
+ typeMap *pgtype.Map
+
+ wbuf []byte
+ eqb ExtendedQueryBuilder
+}
+
+// Identifier a PostgreSQL identifier or name. Identifiers can be composed of
+// multiple parts such as ["schema", "table"] or ["table", "column"].
+type Identifier []string
+
+// Sanitize returns a sanitized string safe for SQL interpolation.
+func (ident Identifier) Sanitize() string {
+ parts := make([]string, len(ident))
+ for i := range ident {
+ s := strings.ReplaceAll(ident[i], string([]byte{0}), "")
+ parts[i] = `"` + strings.ReplaceAll(s, `"`, `""`) + `"`
+ }
+ return strings.Join(parts, ".")
+}
+
+var (
+ // ErrNoRows occurs when rows are expected but none are returned.
+ ErrNoRows = newProxyErr(sql.ErrNoRows, "no rows in result set")
+ // ErrTooManyRows occurs when more rows than expected are returned.
+ ErrTooManyRows = errors.New("too many rows in result set")
+)
+
+func newProxyErr(background error, msg string) error {
+ return &proxyError{
+ msg: msg,
+ background: background,
+ }
+}
+
+type proxyError struct {
+ msg string
+ background error
+}
+
+func (err *proxyError) Error() string { return err.msg }
+
+func (err *proxyError) Unwrap() error { return err.background }
+
+var (
+ errDisabledStatementCache = fmt.Errorf("cannot use QueryExecModeCacheStatement with disabled statement cache")
+ errDisabledDescriptionCache = fmt.Errorf("cannot use QueryExecModeCacheDescribe with disabled description cache")
+)
+
+// Connect establishes a connection with a PostgreSQL server with a connection string. See
+// pgconn.Connect for details.
+func Connect(ctx context.Context, connString string) (*Conn, error) {
+ connConfig, err := ParseConfig(connString)
+ if err != nil {
+ return nil, err
+ }
+ return connect(ctx, connConfig)
+}
+
+// ConnectWithOptions behaves exactly like Connect with the addition of options. At the present options is only used to
+// provide a GetSSLPassword function.
+func ConnectWithOptions(ctx context.Context, connString string, options ParseConfigOptions) (*Conn, error) {
+ connConfig, err := ParseConfigWithOptions(connString, options)
+ if err != nil {
+ return nil, err
+ }
+ return connect(ctx, connConfig)
+}
+
+// ConnectConfig establishes a connection with a PostgreSQL server with a configuration struct.
+// connConfig must have been created by ParseConfig.
+func ConnectConfig(ctx context.Context, connConfig *ConnConfig) (*Conn, error) {
+ // In general this improves safety. In particular avoid the config.Config.OnNotification mutation from affecting other
+ // connections with the same config. See https://github.com/jackc/pgx/issues/618.
+ connConfig = connConfig.Copy()
+
+ return connect(ctx, connConfig)
+}
+
+// ParseConfigWithOptions behaves exactly as ParseConfig does with the addition of options. At the present options is
+// only used to provide a GetSSLPassword function.
+func ParseConfigWithOptions(connString string, options ParseConfigOptions) (*ConnConfig, error) {
+ config, err := pgconn.ParseConfigWithOptions(connString, options.ParseConfigOptions)
+ if err != nil {
+ return nil, err
+ }
+
+ statementCacheCapacity := 512
+ if s, ok := config.RuntimeParams["statement_cache_capacity"]; ok {
+ delete(config.RuntimeParams, "statement_cache_capacity")
+ n, err := strconv.ParseInt(s, 10, 32)
+ if err != nil {
+ return nil, fmt.Errorf("cannot parse statement_cache_capacity: %w", err)
+ }
+ statementCacheCapacity = int(n)
+ }
+
+ descriptionCacheCapacity := 512
+ if s, ok := config.RuntimeParams["description_cache_capacity"]; ok {
+ delete(config.RuntimeParams, "description_cache_capacity")
+ n, err := strconv.ParseInt(s, 10, 32)
+ if err != nil {
+ return nil, fmt.Errorf("cannot parse description_cache_capacity: %w", err)
+ }
+ descriptionCacheCapacity = int(n)
+ }
+
+ defaultQueryExecMode := QueryExecModeCacheStatement
+ if s, ok := config.RuntimeParams["default_query_exec_mode"]; ok {
+ delete(config.RuntimeParams, "default_query_exec_mode")
+ switch s {
+ case "cache_statement":
+ defaultQueryExecMode = QueryExecModeCacheStatement
+ case "cache_describe":
+ defaultQueryExecMode = QueryExecModeCacheDescribe
+ case "describe_exec":
+ defaultQueryExecMode = QueryExecModeDescribeExec
+ case "exec":
+ defaultQueryExecMode = QueryExecModeExec
+ case "simple_protocol":
+ defaultQueryExecMode = QueryExecModeSimpleProtocol
+ default:
+ return nil, fmt.Errorf("invalid default_query_exec_mode: %s", s)
+ }
+ }
+
+ connConfig := &ConnConfig{
+ Config: *config,
+ createdByParseConfig: true,
+ StatementCacheCapacity: statementCacheCapacity,
+ DescriptionCacheCapacity: descriptionCacheCapacity,
+ DefaultQueryExecMode: defaultQueryExecMode,
+ connString: connString,
+ }
+
+ return connConfig, nil
+}
+
+// ParseConfig creates a ConnConfig from a connection string. ParseConfig handles all options that [pgconn.ParseConfig]
+// does. In addition, it accepts the following options:
+//
+// - default_query_exec_mode.
+// Possible values: "cache_statement", "cache_describe", "describe_exec", "exec", and "simple_protocol". See
+// QueryExecMode constant documentation for the meaning of these values. Default: "cache_statement".
+//
+// - statement_cache_capacity.
+// The maximum size of the statement cache used when executing a query with "cache_statement" query exec mode.
+// Default: 512.
+//
+// - description_cache_capacity.
+// The maximum size of the description cache used when executing a query with "cache_describe" query exec mode.
+// Default: 512.
+func ParseConfig(connString string) (*ConnConfig, error) {
+ return ParseConfigWithOptions(connString, ParseConfigOptions{})
+}
+
+// connect connects to a database. connect takes ownership of config. The caller must not use or access it again.
+func connect(ctx context.Context, config *ConnConfig) (c *Conn, err error) {
+ if connectTracer, ok := config.Tracer.(ConnectTracer); ok {
+ ctx = connectTracer.TraceConnectStart(ctx, TraceConnectStartData{ConnConfig: config})
+ defer func() {
+ connectTracer.TraceConnectEnd(ctx, TraceConnectEndData{Conn: c, Err: err})
+ }()
+ }
+
+ // Default values are set in ParseConfig. Enforce initial creation by ParseConfig rather than setting defaults from
+ // zero values.
+ if !config.createdByParseConfig {
+ panic("config must be created by ParseConfig")
+ }
+
+ c = &Conn{
+ config: config,
+ typeMap: pgtype.NewMap(),
+ queryTracer: config.Tracer,
+ }
+
+ if t, ok := c.queryTracer.(BatchTracer); ok {
+ c.batchTracer = t
+ }
+ if t, ok := c.queryTracer.(CopyFromTracer); ok {
+ c.copyFromTracer = t
+ }
+ if t, ok := c.queryTracer.(PrepareTracer); ok {
+ c.prepareTracer = t
+ }
+
+ // Only install pgx notification system if no other callback handler is present.
+ if config.Config.OnNotification == nil {
+ config.Config.OnNotification = c.bufferNotifications
+ }
+
+ c.pgConn, err = pgconn.ConnectConfig(ctx, &config.Config)
+ if err != nil {
+ return nil, err
+ }
+
+ c.preparedStatements = make(map[string]*pgconn.StatementDescription)
+ c.doneChan = make(chan struct{})
+ c.closedChan = make(chan error)
+ c.wbuf = make([]byte, 0, 1024)
+
+ if c.config.StatementCacheCapacity > 0 {
+ c.statementCache = stmtcache.NewLRUCache(c.config.StatementCacheCapacity)
+ }
+
+ if c.config.DescriptionCacheCapacity > 0 {
+ c.descriptionCache = stmtcache.NewLRUCache(c.config.DescriptionCacheCapacity)
+ }
+
+ return c, nil
+}
+
+// Close closes a connection. It is safe to call Close on an already closed
+// connection.
+func (c *Conn) Close(ctx context.Context) error {
+ if c.IsClosed() {
+ return nil
+ }
+
+ err := c.pgConn.Close(ctx)
+ return err
+}
+
+// Prepare creates a prepared statement with name and sql. sql can contain placeholders for bound parameters. These
+// placeholders are referenced positionally as $1, $2, etc. name can be used instead of sql with Query, QueryRow, and
+// Exec to execute the statement. It can also be used with Batch.Queue.
+//
+// The underlying PostgreSQL identifier for the prepared statement will be name if name != sql or a digest of sql if
+// name == sql.
+//
+// Prepare is idempotent; i.e. it is safe to call Prepare multiple times with the same name and sql arguments. This
+// allows a code path to Prepare and Query/Exec without concern for if the statement has already been prepared.
+func (c *Conn) Prepare(ctx context.Context, name, sql string) (sd *pgconn.StatementDescription, err error) {
+ if c.prepareTracer != nil {
+ ctx = c.prepareTracer.TracePrepareStart(ctx, c, TracePrepareStartData{Name: name, SQL: sql})
+ }
+
+ if name != "" {
+ var ok bool
+ if sd, ok = c.preparedStatements[name]; ok && sd.SQL == sql {
+ if c.prepareTracer != nil {
+ c.prepareTracer.TracePrepareEnd(ctx, c, TracePrepareEndData{AlreadyPrepared: true})
+ }
+ return sd, nil
+ }
+ }
+
+ if c.prepareTracer != nil {
+ defer func() {
+ c.prepareTracer.TracePrepareEnd(ctx, c, TracePrepareEndData{Err: err})
+ }()
+ }
+
+ var psName, psKey string
+ if name == sql {
+ digest := sha256.Sum256([]byte(sql))
+ psName = "stmt_" + hex.EncodeToString(digest[0:24])
+ psKey = sql
+ } else {
+ psName = name
+ psKey = name
+ }
+
+ sd, err = c.pgConn.Prepare(ctx, psName, sql, nil)
+ if err != nil {
+ return nil, err
+ }
+
+ if psKey != "" {
+ c.preparedStatements[psKey] = sd
+ }
+
+ return sd, nil
+}
+
+// Deallocate releases a prepared statement. Calling Deallocate on a non-existent prepared statement will succeed.
+func (c *Conn) Deallocate(ctx context.Context, name string) error {
+ var psName string
+ sd := c.preparedStatements[name]
+ if sd != nil {
+ psName = sd.Name
+ } else {
+ psName = name
+ }
+
+ err := c.pgConn.Deallocate(ctx, psName)
+ if err != nil {
+ return err
+ }
+
+ if sd != nil {
+ delete(c.preparedStatements, name)
+ }
+
+ return nil
+}
+
+// DeallocateAll releases all previously prepared statements from the server and client, where it also resets the statement and description cache.
+func (c *Conn) DeallocateAll(ctx context.Context) error {
+ c.preparedStatements = map[string]*pgconn.StatementDescription{}
+ if c.config.StatementCacheCapacity > 0 {
+ c.statementCache = stmtcache.NewLRUCache(c.config.StatementCacheCapacity)
+ }
+ if c.config.DescriptionCacheCapacity > 0 {
+ c.descriptionCache = stmtcache.NewLRUCache(c.config.DescriptionCacheCapacity)
+ }
+ _, err := c.pgConn.Exec(ctx, "deallocate all").ReadAll()
+ return err
+}
+
+func (c *Conn) bufferNotifications(_ *pgconn.PgConn, n *pgconn.Notification) {
+ c.notifications = append(c.notifications, n)
+}
+
+// WaitForNotification waits for a PostgreSQL notification. It wraps the underlying pgconn notification system in a
+// slightly more convenient form.
+func (c *Conn) WaitForNotification(ctx context.Context) (*pgconn.Notification, error) {
+ var n *pgconn.Notification
+
+ // Return already received notification immediately
+ if len(c.notifications) > 0 {
+ n = c.notifications[0]
+ c.notifications = c.notifications[1:]
+ return n, nil
+ }
+
+ err := c.pgConn.WaitForNotification(ctx)
+ if len(c.notifications) > 0 {
+ n = c.notifications[0]
+ c.notifications = c.notifications[1:]
+ }
+ return n, err
+}
+
+// IsClosed reports if the connection has been closed.
+func (c *Conn) IsClosed() bool {
+ return c.pgConn.IsClosed()
+}
+
+func (c *Conn) die(err error) {
+ if c.IsClosed() {
+ return
+ }
+
+ ctx, cancel := context.WithCancel(context.Background())
+ cancel() // force immediate hard cancel
+ c.pgConn.Close(ctx)
+}
+
+func quoteIdentifier(s string) string {
+ return `"` + strings.ReplaceAll(s, `"`, `""`) + `"`
+}
+
+// Ping delegates to the underlying *pgconn.PgConn.Ping.
+func (c *Conn) Ping(ctx context.Context) error {
+ return c.pgConn.Ping(ctx)
+}
+
+// PgConn returns the underlying *pgconn.PgConn. This is an escape hatch method that allows lower level access to the
+// PostgreSQL connection than pgx exposes.
+//
+// It is strongly recommended that the connection be idle (no in-progress queries) before the underlying *pgconn.PgConn
+// is used and the connection must be returned to the same state before any *pgx.Conn methods are again used.
+func (c *Conn) PgConn() *pgconn.PgConn { return c.pgConn }
+
+// TypeMap returns the connection info used for this connection.
+func (c *Conn) TypeMap() *pgtype.Map { return c.typeMap }
+
+// Config returns a copy of config that was used to establish this connection.
+func (c *Conn) Config() *ConnConfig { return c.config.Copy() }
+
+// Exec executes sql. sql can be either a prepared statement name or an SQL string. arguments should be referenced
+// positionally from the sql string as $1, $2, etc.
+func (c *Conn) Exec(ctx context.Context, sql string, arguments ...any) (pgconn.CommandTag, error) {
+ if c.queryTracer != nil {
+ ctx = c.queryTracer.TraceQueryStart(ctx, c, TraceQueryStartData{SQL: sql, Args: arguments})
+ }
+
+ if err := c.deallocateInvalidatedCachedStatements(ctx); err != nil {
+ return pgconn.CommandTag{}, err
+ }
+
+ commandTag, err := c.exec(ctx, sql, arguments...)
+
+ if c.queryTracer != nil {
+ c.queryTracer.TraceQueryEnd(ctx, c, TraceQueryEndData{CommandTag: commandTag, Err: err})
+ }
+
+ return commandTag, err
+}
+
+func (c *Conn) exec(ctx context.Context, sql string, arguments ...any) (commandTag pgconn.CommandTag, err error) {
+ mode := c.config.DefaultQueryExecMode
+ var queryRewriter QueryRewriter
+
+optionLoop:
+ for len(arguments) > 0 {
+ switch arg := arguments[0].(type) {
+ case QueryExecMode:
+ mode = arg
+ arguments = arguments[1:]
+ case QueryRewriter:
+ queryRewriter = arg
+ arguments = arguments[1:]
+ default:
+ break optionLoop
+ }
+ }
+
+ if queryRewriter != nil {
+ sql, arguments, err = queryRewriter.RewriteQuery(ctx, c, sql, arguments)
+ if err != nil {
+ return pgconn.CommandTag{}, fmt.Errorf("rewrite query failed: %w", err)
+ }
+ }
+
+ // Always use simple protocol when there are no arguments.
+ if len(arguments) == 0 {
+ mode = QueryExecModeSimpleProtocol
+ }
+
+ if sd, ok := c.preparedStatements[sql]; ok {
+ return c.execPrepared(ctx, sd, arguments)
+ }
+
+ switch mode {
+ case QueryExecModeCacheStatement:
+ if c.statementCache == nil {
+ return pgconn.CommandTag{}, errDisabledStatementCache
+ }
+ sd := c.statementCache.Get(sql)
+ if sd == nil {
+ sd, err = c.Prepare(ctx, stmtcache.StatementName(sql), sql)
+ if err != nil {
+ return pgconn.CommandTag{}, err
+ }
+ c.statementCache.Put(sd)
+ }
+
+ return c.execPrepared(ctx, sd, arguments)
+ case QueryExecModeCacheDescribe:
+ if c.descriptionCache == nil {
+ return pgconn.CommandTag{}, errDisabledDescriptionCache
+ }
+ sd := c.descriptionCache.Get(sql)
+ if sd == nil {
+ sd, err = c.Prepare(ctx, "", sql)
+ if err != nil {
+ return pgconn.CommandTag{}, err
+ }
+ c.descriptionCache.Put(sd)
+ }
+
+ return c.execParams(ctx, sd, arguments)
+ case QueryExecModeDescribeExec:
+ sd, err := c.Prepare(ctx, "", sql)
+ if err != nil {
+ return pgconn.CommandTag{}, err
+ }
+ return c.execPrepared(ctx, sd, arguments)
+ case QueryExecModeExec:
+ return c.execSQLParams(ctx, sql, arguments)
+ case QueryExecModeSimpleProtocol:
+ return c.execSimpleProtocol(ctx, sql, arguments)
+ default:
+ return pgconn.CommandTag{}, fmt.Errorf("unknown QueryExecMode: %v", mode)
+ }
+}
+
+func (c *Conn) execSimpleProtocol(ctx context.Context, sql string, arguments []any) (commandTag pgconn.CommandTag, err error) {
+ if len(arguments) > 0 {
+ sql, err = c.sanitizeForSimpleQuery(sql, arguments...)
+ if err != nil {
+ return pgconn.CommandTag{}, err
+ }
+ }
+
+ mrr := c.pgConn.Exec(ctx, sql)
+ for mrr.NextResult() {
+ commandTag, _ = mrr.ResultReader().Close()
+ }
+ err = mrr.Close()
+ return commandTag, err
+}
+
+func (c *Conn) execParams(ctx context.Context, sd *pgconn.StatementDescription, arguments []any) (pgconn.CommandTag, error) {
+ err := c.eqb.Build(c.typeMap, sd, arguments)
+ if err != nil {
+ return pgconn.CommandTag{}, err
+ }
+
+ result := c.pgConn.ExecParams(ctx, sd.SQL, c.eqb.ParamValues, sd.ParamOIDs, c.eqb.ParamFormats, c.eqb.ResultFormats).Read()
+ c.eqb.reset() // Allow c.eqb internal memory to be GC'ed as soon as possible.
+ return result.CommandTag, result.Err
+}
+
+func (c *Conn) execPrepared(ctx context.Context, sd *pgconn.StatementDescription, arguments []any) (pgconn.CommandTag, error) {
+ err := c.eqb.Build(c.typeMap, sd, arguments)
+ if err != nil {
+ return pgconn.CommandTag{}, err
+ }
+
+ result := c.pgConn.ExecPrepared(ctx, sd.Name, c.eqb.ParamValues, c.eqb.ParamFormats, c.eqb.ResultFormats).Read()
+ c.eqb.reset() // Allow c.eqb internal memory to be GC'ed as soon as possible.
+ return result.CommandTag, result.Err
+}
+
+type unknownArgumentTypeQueryExecModeExecError struct {
+ arg any
+}
+
+func (e *unknownArgumentTypeQueryExecModeExecError) Error() string {
+ return fmt.Sprintf("cannot use unregistered type %T as query argument in QueryExecModeExec", e.arg)
+}
+
+func (c *Conn) execSQLParams(ctx context.Context, sql string, args []any) (pgconn.CommandTag, error) {
+ err := c.eqb.Build(c.typeMap, nil, args)
+ if err != nil {
+ return pgconn.CommandTag{}, err
+ }
+
+ result := c.pgConn.ExecParams(ctx, sql, c.eqb.ParamValues, nil, c.eqb.ParamFormats, c.eqb.ResultFormats).Read()
+ c.eqb.reset() // Allow c.eqb internal memory to be GC'ed as soon as possible.
+ return result.CommandTag, result.Err
+}
+
+func (c *Conn) getRows(ctx context.Context, sql string, args []any) *baseRows {
+ r := &baseRows{}
+
+ r.ctx = ctx
+ r.queryTracer = c.queryTracer
+ r.typeMap = c.typeMap
+ r.startTime = time.Now()
+ r.sql = sql
+ r.args = args
+ r.conn = c
+
+ return r
+}
+
+type QueryExecMode int32
+
+const (
+ _ QueryExecMode = iota
+
+ // Automatically prepare and cache statements. This uses the extended protocol. Queries are executed in a single round
+ // trip after the statement is cached. This is the default. If the database schema is modified or the search_path is
+ // changed after a statement is cached then the first execution of a previously cached query may fail. e.g. If the
+ // number of columns returned by a "SELECT *" changes or the type of a column is changed.
+ QueryExecModeCacheStatement
+
+ // Cache statement descriptions (i.e. argument and result types) and assume they do not change. This uses the extended
+ // protocol. Queries are executed in a single round trip after the description is cached. If the database schema is
+ // modified or the search_path is changed after a statement is cached then the first execution of a previously cached
+ // query may fail. e.g. If the number of columns returned by a "SELECT *" changes or the type of a column is changed.
+ QueryExecModeCacheDescribe
+
+ // Get the statement description on every execution. This uses the extended protocol. Queries require two round trips
+ // to execute. It does not use named prepared statements. But it does use the unnamed prepared statement to get the
+ // statement description on the first round trip and then uses it to execute the query on the second round trip. This
+ // may cause problems with connection poolers that switch the underlying connection between round trips. It is safe
+ // even when the database schema is modified concurrently.
+ QueryExecModeDescribeExec
+
+ // Assume the PostgreSQL query parameter types based on the Go type of the arguments. This uses the extended protocol
+ // with text formatted parameters and results. Queries are executed in a single round trip. Type mappings can be
+ // registered with pgtype.Map.RegisterDefaultPgType. Queries will be rejected that have arguments that are
+ // unregistered or ambiguous. e.g. A map[string]string may have the PostgreSQL type json or hstore. Modes that know
+ // the PostgreSQL type can use a map[string]string directly as an argument. This mode cannot.
+ //
+ // On rare occasions user defined types may behave differently when encoded in the text format instead of the binary
+ // format. For example, this could happen if a "type RomanNumeral int32" implements fmt.Stringer to format integers as
+ // Roman numerals (e.g. 7 is VII). The binary format would properly encode the integer 7 as the binary value for 7.
+ // But the text format would encode the integer 7 as the string "VII". As QueryExecModeExec uses the text format, it
+ // is possible that changing query mode from another mode to QueryExecModeExec could change the behavior of the query.
+ // This should not occur with types pgx supports directly and can be avoided by registering the types with
+ // pgtype.Map.RegisterDefaultPgType and implementing the appropriate type interfaces. In the cas of RomanNumeral, it
+ // should implement pgtype.Int64Valuer.
+ QueryExecModeExec
+
+ // Use the simple protocol. Assume the PostgreSQL query parameter types based on the Go type of the arguments. Queries
+ // are executed in a single round trip. Type mappings can be registered with pgtype.Map.RegisterDefaultPgType. Queries
+ // will be rejected that have arguments that are unregistered or ambiguous. e.g. A map[string]string may have the
+ // PostgreSQL type json or hstore. Modes that know the PostgreSQL type can use a map[string]string directly as an
+ // argument. This mode cannot.
+ //
+ // QueryExecModeSimpleProtocol should have the user application visible behavior as QueryExecModeExec. This includes
+ // the warning regarding differences in text format and binary format encoding with user defined types. There may be
+ // other minor exceptions such as behavior when multiple result returning queries are erroneously sent in a single
+ // string.
+ //
+ // QueryExecModeSimpleProtocol uses client side parameter interpolation. All values are quoted and escaped. Prefer
+ // QueryExecModeExec over QueryExecModeSimpleProtocol whenever possible. In general QueryExecModeSimpleProtocol should
+ // only be used if connecting to a proxy server, connection pool server, or non-PostgreSQL server that does not
+ // support the extended protocol.
+ QueryExecModeSimpleProtocol
+)
+
+func (m QueryExecMode) String() string {
+ switch m {
+ case QueryExecModeCacheStatement:
+ return "cache statement"
+ case QueryExecModeCacheDescribe:
+ return "cache describe"
+ case QueryExecModeDescribeExec:
+ return "describe exec"
+ case QueryExecModeExec:
+ return "exec"
+ case QueryExecModeSimpleProtocol:
+ return "simple protocol"
+ default:
+ return "invalid"
+ }
+}
+
+// QueryResultFormats controls the result format (text=0, binary=1) of a query by result column position.
+type QueryResultFormats []int16
+
+// QueryResultFormatsByOID controls the result format (text=0, binary=1) of a query by the result column OID.
+type QueryResultFormatsByOID map[uint32]int16
+
+// QueryRewriter rewrites a query when used as the first arguments to a query method.
+type QueryRewriter interface {
+ RewriteQuery(ctx context.Context, conn *Conn, sql string, args []any) (newSQL string, newArgs []any, err error)
+}
+
+// Query sends a query to the server and returns a Rows to read the results. Only errors encountered sending the query
+// and initializing Rows will be returned. Err() on the returned Rows must be checked after the Rows is closed to
+// determine if the query executed successfully.
+//
+// The returned Rows must be closed before the connection can be used again. It is safe to attempt to read from the
+// returned Rows even if an error is returned. The error will be the available in rows.Err() after rows are closed. It
+// is allowed to ignore the error returned from Query and handle it in Rows.
+//
+// It is possible for a call of FieldDescriptions on the returned Rows to return nil even if the Query call did not
+// return an error.
+//
+// It is possible for a query to return one or more rows before encountering an error. In most cases the rows should be
+// collected before processing rather than processed while receiving each row. This avoids the possibility of the
+// application processing rows from a query that the server rejected. The CollectRows function is useful here.
+//
+// An implementor of QueryRewriter may be passed as the first element of args. It can rewrite the sql and change or
+// replace args. For example, NamedArgs is QueryRewriter that implements named arguments.
+//
+// For extra control over how the query is executed, the types QueryExecMode, QueryResultFormats, and
+// QueryResultFormatsByOID may be used as the first args to control exactly how the query is executed. This is rarely
+// needed. See the documentation for those types for details.
+func (c *Conn) Query(ctx context.Context, sql string, args ...any) (Rows, error) {
+ if c.queryTracer != nil {
+ ctx = c.queryTracer.TraceQueryStart(ctx, c, TraceQueryStartData{SQL: sql, Args: args})
+ }
+
+ if err := c.deallocateInvalidatedCachedStatements(ctx); err != nil {
+ if c.queryTracer != nil {
+ c.queryTracer.TraceQueryEnd(ctx, c, TraceQueryEndData{Err: err})
+ }
+ return &baseRows{err: err, closed: true}, err
+ }
+
+ var resultFormats QueryResultFormats
+ var resultFormatsByOID QueryResultFormatsByOID
+ mode := c.config.DefaultQueryExecMode
+ var queryRewriter QueryRewriter
+
+optionLoop:
+ for len(args) > 0 {
+ switch arg := args[0].(type) {
+ case QueryResultFormats:
+ resultFormats = arg
+ args = args[1:]
+ case QueryResultFormatsByOID:
+ resultFormatsByOID = arg
+ args = args[1:]
+ case QueryExecMode:
+ mode = arg
+ args = args[1:]
+ case QueryRewriter:
+ queryRewriter = arg
+ args = args[1:]
+ default:
+ break optionLoop
+ }
+ }
+
+ if queryRewriter != nil {
+ var err error
+ originalSQL := sql
+ originalArgs := args
+ sql, args, err = queryRewriter.RewriteQuery(ctx, c, sql, args)
+ if err != nil {
+ rows := c.getRows(ctx, originalSQL, originalArgs)
+ err = fmt.Errorf("rewrite query failed: %w", err)
+ rows.fatal(err)
+ return rows, err
+ }
+ }
+
+ // Bypass any statement caching.
+ if sql == "" {
+ mode = QueryExecModeSimpleProtocol
+ }
+
+ c.eqb.reset()
+ rows := c.getRows(ctx, sql, args)
+
+ var err error
+ sd, explicitPreparedStatement := c.preparedStatements[sql]
+ if sd != nil || mode == QueryExecModeCacheStatement || mode == QueryExecModeCacheDescribe || mode == QueryExecModeDescribeExec {
+ if sd == nil {
+ sd, err = c.getStatementDescription(ctx, mode, sql)
+ if err != nil {
+ rows.fatal(err)
+ return rows, err
+ }
+ }
+
+ if len(sd.ParamOIDs) != len(args) {
+ rows.fatal(fmt.Errorf("expected %d arguments, got %d", len(sd.ParamOIDs), len(args)))
+ return rows, rows.err
+ }
+
+ rows.sql = sd.SQL
+
+ err = c.eqb.Build(c.typeMap, sd, args)
+ if err != nil {
+ rows.fatal(err)
+ return rows, rows.err
+ }
+
+ if resultFormatsByOID != nil {
+ resultFormats = make([]int16, len(sd.Fields))
+ for i := range resultFormats {
+ resultFormats[i] = resultFormatsByOID[uint32(sd.Fields[i].DataTypeOID)]
+ }
+ }
+
+ if resultFormats == nil {
+ resultFormats = c.eqb.ResultFormats
+ }
+
+ if !explicitPreparedStatement && mode == QueryExecModeCacheDescribe {
+ rows.resultReader = c.pgConn.ExecParams(ctx, sql, c.eqb.ParamValues, sd.ParamOIDs, c.eqb.ParamFormats, resultFormats)
+ } else {
+ rows.resultReader = c.pgConn.ExecPrepared(ctx, sd.Name, c.eqb.ParamValues, c.eqb.ParamFormats, resultFormats)
+ }
+ } else if mode == QueryExecModeExec {
+ err := c.eqb.Build(c.typeMap, nil, args)
+ if err != nil {
+ rows.fatal(err)
+ return rows, rows.err
+ }
+
+ rows.resultReader = c.pgConn.ExecParams(ctx, sql, c.eqb.ParamValues, nil, c.eqb.ParamFormats, c.eqb.ResultFormats)
+ } else if mode == QueryExecModeSimpleProtocol {
+ sql, err = c.sanitizeForSimpleQuery(sql, args...)
+ if err != nil {
+ rows.fatal(err)
+ return rows, err
+ }
+
+ mrr := c.pgConn.Exec(ctx, sql)
+ if mrr.NextResult() {
+ rows.resultReader = mrr.ResultReader()
+ rows.multiResultReader = mrr
+ } else {
+ err = mrr.Close()
+ rows.fatal(err)
+ return rows, err
+ }
+
+ return rows, nil
+ } else {
+ err = fmt.Errorf("unknown QueryExecMode: %v", mode)
+ rows.fatal(err)
+ return rows, rows.err
+ }
+
+ c.eqb.reset() // Allow c.eqb internal memory to be GC'ed as soon as possible.
+
+ return rows, rows.err
+}
+
+// getStatementDescription returns the statement description of the sql query
+// according to the given mode.
+//
+// If the mode is one that doesn't require to know the param and result OIDs
+// then nil is returned without error.
+func (c *Conn) getStatementDescription(
+ ctx context.Context,
+ mode QueryExecMode,
+ sql string,
+) (sd *pgconn.StatementDescription, err error) {
+ switch mode {
+ case QueryExecModeCacheStatement:
+ if c.statementCache == nil {
+ return nil, errDisabledStatementCache
+ }
+ sd = c.statementCache.Get(sql)
+ if sd == nil {
+ sd, err = c.Prepare(ctx, stmtcache.StatementName(sql), sql)
+ if err != nil {
+ return nil, err
+ }
+ c.statementCache.Put(sd)
+ }
+ case QueryExecModeCacheDescribe:
+ if c.descriptionCache == nil {
+ return nil, errDisabledDescriptionCache
+ }
+ sd = c.descriptionCache.Get(sql)
+ if sd == nil {
+ sd, err = c.Prepare(ctx, "", sql)
+ if err != nil {
+ return nil, err
+ }
+ c.descriptionCache.Put(sd)
+ }
+ case QueryExecModeDescribeExec:
+ return c.Prepare(ctx, "", sql)
+ }
+ return sd, err
+}
+
+// QueryRow is a convenience wrapper over Query. Any error that occurs while
+// querying is deferred until calling Scan on the returned Row. That Row will
+// error with ErrNoRows if no rows are returned.
+func (c *Conn) QueryRow(ctx context.Context, sql string, args ...any) Row {
+ rows, _ := c.Query(ctx, sql, args...)
+ return (*connRow)(rows.(*baseRows))
+}
+
+// SendBatch sends all queued queries to the server at once. All queries are run in an implicit transaction unless
+// explicit transaction control statements are executed. The returned BatchResults must be closed before the connection
+// is used again.
+//
+// Depending on the QueryExecMode, all queries may be prepared before any are executed. This means that creating a table
+// and using it in a subsequent query in the same batch can fail.
+func (c *Conn) SendBatch(ctx context.Context, b *Batch) (br BatchResults) {
+ if c.batchTracer != nil {
+ ctx = c.batchTracer.TraceBatchStart(ctx, c, TraceBatchStartData{Batch: b})
+ defer func() {
+ err := br.(interface{ earlyError() error }).earlyError()
+ if err != nil {
+ c.batchTracer.TraceBatchEnd(ctx, c, TraceBatchEndData{Err: err})
+ }
+ }()
+ }
+
+ if err := c.deallocateInvalidatedCachedStatements(ctx); err != nil {
+ return &batchResults{ctx: ctx, conn: c, err: err}
+ }
+
+ for _, bi := range b.QueuedQueries {
+ var queryRewriter QueryRewriter
+ sql := bi.SQL
+ arguments := bi.Arguments
+
+ optionLoop:
+ for len(arguments) > 0 {
+ // Update Batch.Queue function comment when additional options are implemented
+ switch arg := arguments[0].(type) {
+ case QueryRewriter:
+ queryRewriter = arg
+ arguments = arguments[1:]
+ default:
+ break optionLoop
+ }
+ }
+
+ if queryRewriter != nil {
+ var err error
+ sql, arguments, err = queryRewriter.RewriteQuery(ctx, c, sql, arguments)
+ if err != nil {
+ return &batchResults{ctx: ctx, conn: c, err: fmt.Errorf("rewrite query failed: %w", err)}
+ }
+ }
+
+ bi.SQL = sql
+ bi.Arguments = arguments
+ }
+
+ // TODO: changing mode per batch? Update Batch.Queue function comment when implemented
+ mode := c.config.DefaultQueryExecMode
+ if mode == QueryExecModeSimpleProtocol {
+ return c.sendBatchQueryExecModeSimpleProtocol(ctx, b)
+ }
+
+ // All other modes use extended protocol and thus can use prepared statements.
+ for _, bi := range b.QueuedQueries {
+ if sd, ok := c.preparedStatements[bi.SQL]; ok {
+ bi.sd = sd
+ }
+ }
+
+ switch mode {
+ case QueryExecModeExec:
+ return c.sendBatchQueryExecModeExec(ctx, b)
+ case QueryExecModeCacheStatement:
+ return c.sendBatchQueryExecModeCacheStatement(ctx, b)
+ case QueryExecModeCacheDescribe:
+ return c.sendBatchQueryExecModeCacheDescribe(ctx, b)
+ case QueryExecModeDescribeExec:
+ return c.sendBatchQueryExecModeDescribeExec(ctx, b)
+ default:
+ panic("unknown QueryExecMode")
+ }
+}
+
+func (c *Conn) sendBatchQueryExecModeSimpleProtocol(ctx context.Context, b *Batch) *batchResults {
+ var sb strings.Builder
+ for i, bi := range b.QueuedQueries {
+ if i > 0 {
+ sb.WriteByte(';')
+ }
+ sql, err := c.sanitizeForSimpleQuery(bi.SQL, bi.Arguments...)
+ if err != nil {
+ return &batchResults{ctx: ctx, conn: c, err: err}
+ }
+ sb.WriteString(sql)
+ }
+ mrr := c.pgConn.Exec(ctx, sb.String())
+ return &batchResults{
+ ctx: ctx,
+ conn: c,
+ mrr: mrr,
+ b: b,
+ qqIdx: 0,
+ }
+}
+
+func (c *Conn) sendBatchQueryExecModeExec(ctx context.Context, b *Batch) *batchResults {
+ batch := &pgconn.Batch{}
+
+ for _, bi := range b.QueuedQueries {
+ sd := bi.sd
+ if sd != nil {
+ err := c.eqb.Build(c.typeMap, sd, bi.Arguments)
+ if err != nil {
+ return &batchResults{ctx: ctx, conn: c, err: err}
+ }
+
+ batch.ExecPrepared(sd.Name, c.eqb.ParamValues, c.eqb.ParamFormats, c.eqb.ResultFormats)
+ } else {
+ err := c.eqb.Build(c.typeMap, nil, bi.Arguments)
+ if err != nil {
+ return &batchResults{ctx: ctx, conn: c, err: err}
+ }
+ batch.ExecParams(bi.SQL, c.eqb.ParamValues, nil, c.eqb.ParamFormats, c.eqb.ResultFormats)
+ }
+ }
+
+ c.eqb.reset() // Allow c.eqb internal memory to be GC'ed as soon as possible.
+
+ mrr := c.pgConn.ExecBatch(ctx, batch)
+
+ return &batchResults{
+ ctx: ctx,
+ conn: c,
+ mrr: mrr,
+ b: b,
+ qqIdx: 0,
+ }
+}
+
+func (c *Conn) sendBatchQueryExecModeCacheStatement(ctx context.Context, b *Batch) (pbr *pipelineBatchResults) {
+ if c.statementCache == nil {
+ return &pipelineBatchResults{ctx: ctx, conn: c, err: errDisabledStatementCache, closed: true}
+ }
+
+ distinctNewQueries := []*pgconn.StatementDescription{}
+ distinctNewQueriesIdxMap := make(map[string]int)
+
+ for _, bi := range b.QueuedQueries {
+ if bi.sd == nil {
+ sd := c.statementCache.Get(bi.SQL)
+ if sd != nil {
+ bi.sd = sd
+ } else {
+ if idx, present := distinctNewQueriesIdxMap[bi.SQL]; present {
+ bi.sd = distinctNewQueries[idx]
+ } else {
+ sd = &pgconn.StatementDescription{
+ Name: stmtcache.StatementName(bi.SQL),
+ SQL: bi.SQL,
+ }
+ distinctNewQueriesIdxMap[sd.SQL] = len(distinctNewQueries)
+ distinctNewQueries = append(distinctNewQueries, sd)
+ bi.sd = sd
+ }
+ }
+ }
+ }
+
+ return c.sendBatchExtendedWithDescription(ctx, b, distinctNewQueries, c.statementCache)
+}
+
+func (c *Conn) sendBatchQueryExecModeCacheDescribe(ctx context.Context, b *Batch) (pbr *pipelineBatchResults) {
+ if c.descriptionCache == nil {
+ return &pipelineBatchResults{ctx: ctx, conn: c, err: errDisabledDescriptionCache, closed: true}
+ }
+
+ distinctNewQueries := []*pgconn.StatementDescription{}
+ distinctNewQueriesIdxMap := make(map[string]int)
+
+ for _, bi := range b.QueuedQueries {
+ if bi.sd == nil {
+ sd := c.descriptionCache.Get(bi.SQL)
+ if sd != nil {
+ bi.sd = sd
+ } else {
+ if idx, present := distinctNewQueriesIdxMap[bi.SQL]; present {
+ bi.sd = distinctNewQueries[idx]
+ } else {
+ sd = &pgconn.StatementDescription{
+ SQL: bi.SQL,
+ }
+ distinctNewQueriesIdxMap[sd.SQL] = len(distinctNewQueries)
+ distinctNewQueries = append(distinctNewQueries, sd)
+ bi.sd = sd
+ }
+ }
+ }
+ }
+
+ return c.sendBatchExtendedWithDescription(ctx, b, distinctNewQueries, c.descriptionCache)
+}
+
+func (c *Conn) sendBatchQueryExecModeDescribeExec(ctx context.Context, b *Batch) (pbr *pipelineBatchResults) {
+ distinctNewQueries := []*pgconn.StatementDescription{}
+ distinctNewQueriesIdxMap := make(map[string]int)
+
+ for _, bi := range b.QueuedQueries {
+ if bi.sd == nil {
+ if idx, present := distinctNewQueriesIdxMap[bi.SQL]; present {
+ bi.sd = distinctNewQueries[idx]
+ } else {
+ sd := &pgconn.StatementDescription{
+ SQL: bi.SQL,
+ }
+ distinctNewQueriesIdxMap[sd.SQL] = len(distinctNewQueries)
+ distinctNewQueries = append(distinctNewQueries, sd)
+ bi.sd = sd
+ }
+ }
+ }
+
+ return c.sendBatchExtendedWithDescription(ctx, b, distinctNewQueries, nil)
+}
+
+func (c *Conn) sendBatchExtendedWithDescription(ctx context.Context, b *Batch, distinctNewQueries []*pgconn.StatementDescription, sdCache stmtcache.Cache) (pbr *pipelineBatchResults) {
+ pipeline := c.pgConn.StartPipeline(ctx)
+ defer func() {
+ if pbr != nil && pbr.err != nil {
+ pipeline.Close()
+ }
+ }()
+
+ // Prepare any needed queries
+ if len(distinctNewQueries) > 0 {
+ err := func() (err error) {
+ for _, sd := range distinctNewQueries {
+ pipeline.SendPrepare(sd.Name, sd.SQL, nil)
+ }
+
+ // Store all statements we are preparing into the cache. It's fine if it overflows because HandleInvalidated will
+ // clean them up later.
+ if sdCache != nil {
+ for _, sd := range distinctNewQueries {
+ sdCache.Put(sd)
+ }
+ }
+
+ // If something goes wrong preparing the statements, we need to invalidate the cache entries we just added.
+ defer func() {
+ if err != nil && sdCache != nil {
+ for _, sd := range distinctNewQueries {
+ sdCache.Invalidate(sd.SQL)
+ }
+ }
+ }()
+
+ err = pipeline.Sync()
+ if err != nil {
+ return err
+ }
+
+ for _, sd := range distinctNewQueries {
+ results, err := pipeline.GetResults()
+ if err != nil {
+ return err
+ }
+
+ resultSD, ok := results.(*pgconn.StatementDescription)
+ if !ok {
+ return fmt.Errorf("expected statement description, got %T", results)
+ }
+
+ // Fill in the previously empty / pending statement descriptions.
+ sd.ParamOIDs = resultSD.ParamOIDs
+ sd.Fields = resultSD.Fields
+ }
+
+ results, err := pipeline.GetResults()
+ if err != nil {
+ return err
+ }
+
+ _, ok := results.(*pgconn.PipelineSync)
+ if !ok {
+ return fmt.Errorf("expected sync, got %T", results)
+ }
+
+ return nil
+ }()
+ if err != nil {
+ return &pipelineBatchResults{ctx: ctx, conn: c, err: err, closed: true}
+ }
+ }
+
+ // Queue the queries.
+ for _, bi := range b.QueuedQueries {
+ err := c.eqb.Build(c.typeMap, bi.sd, bi.Arguments)
+ if err != nil {
+ // we wrap the error so we the user can understand which query failed inside the batch
+ err = fmt.Errorf("error building query %s: %w", bi.SQL, err)
+ return &pipelineBatchResults{ctx: ctx, conn: c, err: err, closed: true}
+ }
+
+ if bi.sd.Name == "" {
+ pipeline.SendQueryParams(bi.sd.SQL, c.eqb.ParamValues, bi.sd.ParamOIDs, c.eqb.ParamFormats, c.eqb.ResultFormats)
+ } else {
+ pipeline.SendQueryPrepared(bi.sd.Name, c.eqb.ParamValues, c.eqb.ParamFormats, c.eqb.ResultFormats)
+ }
+ }
+
+ err := pipeline.Sync()
+ if err != nil {
+ return &pipelineBatchResults{ctx: ctx, conn: c, err: err, closed: true}
+ }
+
+ return &pipelineBatchResults{
+ ctx: ctx,
+ conn: c,
+ pipeline: pipeline,
+ b: b,
+ }
+}
+
+func (c *Conn) sanitizeForSimpleQuery(sql string, args ...any) (string, error) {
+ if c.pgConn.ParameterStatus("standard_conforming_strings") != "on" {
+ return "", errors.New("simple protocol queries must be run with standard_conforming_strings=on")
+ }
+
+ if c.pgConn.ParameterStatus("client_encoding") != "UTF8" {
+ return "", errors.New("simple protocol queries must be run with client_encoding=UTF8")
+ }
+
+ var err error
+ valueArgs := make([]any, len(args))
+ for i, a := range args {
+ valueArgs[i], err = convertSimpleArgument(c.typeMap, a)
+ if err != nil {
+ return "", err
+ }
+ }
+
+ return sanitize.SanitizeSQL(sql, valueArgs...)
+}
+
+// LoadType inspects the database for typeName and produces a pgtype.Type suitable for registration. typeName must be
+// the name of a type where the underlying type(s) is already understood by pgx. It is for derived types. In particular,
+// typeName must be one of the following:
+// - An array type name of a type that is already registered. e.g. "_foo" when "foo" is registered.
+// - A composite type name where all field types are already registered.
+// - A domain type name where the base type is already registered.
+// - An enum type name.
+// - A range type name where the element type is already registered.
+// - A multirange type name where the element type is already registered.
+func (c *Conn) LoadType(ctx context.Context, typeName string) (*pgtype.Type, error) {
+ var oid uint32
+
+ err := c.QueryRow(ctx, "select $1::text::regtype::oid;", typeName).Scan(&oid)
+ if err != nil {
+ return nil, err
+ }
+
+ var typtype string
+ var typbasetype uint32
+
+ err = c.QueryRow(ctx, "select typtype::text, typbasetype from pg_type where oid=$1", oid).Scan(&typtype, &typbasetype)
+ if err != nil {
+ return nil, err
+ }
+
+ switch typtype {
+ case "b": // array
+ elementOID, err := c.getArrayElementOID(ctx, oid)
+ if err != nil {
+ return nil, err
+ }
+
+ dt, ok := c.TypeMap().TypeForOID(elementOID)
+ if !ok {
+ return nil, errors.New("array element OID not registered")
+ }
+
+ return &pgtype.Type{Name: typeName, OID: oid, Codec: &pgtype.ArrayCodec{ElementType: dt}}, nil
+ case "c": // composite
+ fields, err := c.getCompositeFields(ctx, oid)
+ if err != nil {
+ return nil, err
+ }
+
+ return &pgtype.Type{Name: typeName, OID: oid, Codec: &pgtype.CompositeCodec{Fields: fields}}, nil
+ case "d": // domain
+ dt, ok := c.TypeMap().TypeForOID(typbasetype)
+ if !ok {
+ return nil, errors.New("domain base type OID not registered")
+ }
+
+ return &pgtype.Type{Name: typeName, OID: oid, Codec: dt.Codec}, nil
+ case "e": // enum
+ return &pgtype.Type{Name: typeName, OID: oid, Codec: &pgtype.EnumCodec{}}, nil
+ case "r": // range
+ elementOID, err := c.getRangeElementOID(ctx, oid)
+ if err != nil {
+ return nil, err
+ }
+
+ dt, ok := c.TypeMap().TypeForOID(elementOID)
+ if !ok {
+ return nil, errors.New("range element OID not registered")
+ }
+
+ return &pgtype.Type{Name: typeName, OID: oid, Codec: &pgtype.RangeCodec{ElementType: dt}}, nil
+ case "m": // multirange
+ elementOID, err := c.getMultiRangeElementOID(ctx, oid)
+ if err != nil {
+ return nil, err
+ }
+
+ dt, ok := c.TypeMap().TypeForOID(elementOID)
+ if !ok {
+ return nil, errors.New("multirange element OID not registered")
+ }
+
+ return &pgtype.Type{Name: typeName, OID: oid, Codec: &pgtype.MultirangeCodec{ElementType: dt}}, nil
+ default:
+ return &pgtype.Type{}, errors.New("unknown typtype")
+ }
+}
+
+func (c *Conn) getArrayElementOID(ctx context.Context, oid uint32) (uint32, error) {
+ var typelem uint32
+
+ err := c.QueryRow(ctx, "select typelem from pg_type where oid=$1", oid).Scan(&typelem)
+ if err != nil {
+ return 0, err
+ }
+
+ return typelem, nil
+}
+
+func (c *Conn) getRangeElementOID(ctx context.Context, oid uint32) (uint32, error) {
+ var typelem uint32
+
+ err := c.QueryRow(ctx, "select rngsubtype from pg_range where rngtypid=$1", oid).Scan(&typelem)
+ if err != nil {
+ return 0, err
+ }
+
+ return typelem, nil
+}
+
+func (c *Conn) getMultiRangeElementOID(ctx context.Context, oid uint32) (uint32, error) {
+ var typelem uint32
+
+ err := c.QueryRow(ctx, "select rngtypid from pg_range where rngmultitypid=$1", oid).Scan(&typelem)
+ if err != nil {
+ return 0, err
+ }
+
+ return typelem, nil
+}
+
+func (c *Conn) getCompositeFields(ctx context.Context, oid uint32) ([]pgtype.CompositeCodecField, error) {
+ var typrelid uint32
+
+ err := c.QueryRow(ctx, "select typrelid from pg_type where oid=$1", oid).Scan(&typrelid)
+ if err != nil {
+ return nil, err
+ }
+
+ var fields []pgtype.CompositeCodecField
+ var fieldName string
+ var fieldOID uint32
+ rows, _ := c.Query(ctx, `select attname, atttypid
+from pg_attribute
+where attrelid=$1
+ and not attisdropped
+ and attnum > 0
+order by attnum`,
+ typrelid,
+ )
+ _, err = ForEachRow(rows, []any{&fieldName, &fieldOID}, func() error {
+ dt, ok := c.TypeMap().TypeForOID(fieldOID)
+ if !ok {
+ return fmt.Errorf("unknown composite type field OID: %v", fieldOID)
+ }
+ fields = append(fields, pgtype.CompositeCodecField{Name: fieldName, Type: dt})
+ return nil
+ })
+ if err != nil {
+ return nil, err
+ }
+
+ return fields, nil
+}
+
+func (c *Conn) deallocateInvalidatedCachedStatements(ctx context.Context) error {
+ if txStatus := c.pgConn.TxStatus(); txStatus != 'I' && txStatus != 'T' {
+ return nil
+ }
+
+ if c.descriptionCache != nil {
+ c.descriptionCache.RemoveInvalidated()
+ }
+
+ var invalidatedStatements []*pgconn.StatementDescription
+ if c.statementCache != nil {
+ invalidatedStatements = c.statementCache.GetInvalidated()
+ }
+
+ if len(invalidatedStatements) == 0 {
+ return nil
+ }
+
+ pipeline := c.pgConn.StartPipeline(ctx)
+ defer pipeline.Close()
+
+ for _, sd := range invalidatedStatements {
+ pipeline.SendDeallocate(sd.Name)
+ }
+
+ err := pipeline.Sync()
+ if err != nil {
+ return fmt.Errorf("failed to deallocate cached statement(s): %w", err)
+ }
+
+ err = pipeline.Close()
+ if err != nil {
+ return fmt.Errorf("failed to deallocate cached statement(s): %w", err)
+ }
+
+ c.statementCache.RemoveInvalidated()
+ for _, sd := range invalidatedStatements {
+ delete(c.preparedStatements, sd.Name)
+ }
+
+ return nil
+}
diff --git a/vendor/github.com/jackc/pgx/v4/copy_from.go b/vendor/github.com/jackc/pgx/v5/copy_from.go
index 49139d0..abcd223 100644
--- a/vendor/github.com/jackc/pgx/v4/copy_from.go
+++ b/vendor/github.com/jackc/pgx/v5/copy_from.go
@@ -5,20 +5,19 @@ import (
"context"
"fmt"
"io"
- "time"
- "github.com/jackc/pgconn"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
+ "github.com/jackc/pgx/v5/pgconn"
)
// CopyFromRows returns a CopyFromSource interface over the provided rows slice
// making it usable by *Conn.CopyFrom.
-func CopyFromRows(rows [][]interface{}) CopyFromSource {
+func CopyFromRows(rows [][]any) CopyFromSource {
return &copyFromRows{rows: rows, idx: -1}
}
type copyFromRows struct {
- rows [][]interface{}
+ rows [][]any
idx int
}
@@ -27,7 +26,7 @@ func (ctr *copyFromRows) Next() bool {
return ctr.idx < len(ctr.rows)
}
-func (ctr *copyFromRows) Values() ([]interface{}, error) {
+func (ctr *copyFromRows) Values() ([]any, error) {
return ctr.rows[ctr.idx], nil
}
@@ -37,12 +36,12 @@ func (ctr *copyFromRows) Err() error {
// CopyFromSlice returns a CopyFromSource interface over a dynamic func
// making it usable by *Conn.CopyFrom.
-func CopyFromSlice(length int, next func(int) ([]interface{}, error)) CopyFromSource {
+func CopyFromSlice(length int, next func(int) ([]any, error)) CopyFromSource {
return &copyFromSlice{next: next, idx: -1, len: length}
}
type copyFromSlice struct {
- next func(int) ([]interface{}, error)
+ next func(int) ([]any, error)
idx int
len int
err error
@@ -53,7 +52,7 @@ func (cts *copyFromSlice) Next() bool {
return cts.idx < cts.len
}
-func (cts *copyFromSlice) Values() ([]interface{}, error) {
+func (cts *copyFromSlice) Values() ([]any, error) {
values, err := cts.next(cts.idx)
if err != nil {
cts.err = err
@@ -65,6 +64,33 @@ func (cts *copyFromSlice) Err() error {
return cts.err
}
+// CopyFromFunc returns a CopyFromSource interface that relies on nxtf for values.
+// nxtf returns rows until it either signals an 'end of data' by returning row=nil and err=nil,
+// or it returns an error. If nxtf returns an error, the copy is aborted.
+func CopyFromFunc(nxtf func() (row []any, err error)) CopyFromSource {
+ return &copyFromFunc{next: nxtf}
+}
+
+type copyFromFunc struct {
+ next func() ([]any, error)
+ valueRow []any
+ err error
+}
+
+func (g *copyFromFunc) Next() bool {
+ g.valueRow, g.err = g.next()
+ // only return true if valueRow exists and no error
+ return g.valueRow != nil && g.err == nil
+}
+
+func (g *copyFromFunc) Values() ([]any, error) {
+ return g.valueRow, g.err
+}
+
+func (g *copyFromFunc) Err() error {
+ return g.err
+}
+
// CopyFromSource is the interface used by *Conn.CopyFrom as the source for copy data.
type CopyFromSource interface {
// Next returns true if there is another row and makes the next row data
@@ -73,7 +99,7 @@ type CopyFromSource interface {
Next() bool
// Values returns the values for the current row.
- Values() ([]interface{}, error)
+ Values() ([]any, error)
// Err returns any error that has been encountered by the CopyFromSource. If
// this is not nil *Conn.CopyFrom will abort the copy.
@@ -86,9 +112,17 @@ type copyFrom struct {
columnNames []string
rowSrc CopyFromSource
readerErrChan chan error
+ mode QueryExecMode
}
func (ct *copyFrom) run(ctx context.Context) (int64, error) {
+ if ct.conn.copyFromTracer != nil {
+ ctx = ct.conn.copyFromTracer.TraceCopyFromStart(ctx, ct.conn, TraceCopyFromStartData{
+ TableName: ct.tableName,
+ ColumnNames: ct.columnNames,
+ })
+ }
+
quotedTableName := ct.tableName.Sanitize()
cbuf := &bytes.Buffer{}
for i, cn := range ct.columnNames {
@@ -99,9 +133,29 @@ func (ct *copyFrom) run(ctx context.Context) (int64, error) {
}
quotedColumnNames := cbuf.String()
- sd, err := ct.conn.Prepare(ctx, "", fmt.Sprintf("select %s from %s", quotedColumnNames, quotedTableName))
- if err != nil {
- return 0, err
+ var sd *pgconn.StatementDescription
+ switch ct.mode {
+ case QueryExecModeExec, QueryExecModeSimpleProtocol:
+ // These modes don't support the binary format. Before the inclusion of the
+ // QueryExecModes, Conn.Prepare was called on every COPY operation to get
+ // the OIDs. These prepared statements were not cached.
+ //
+ // Since that's the same behavior provided by QueryExecModeDescribeExec,
+ // we'll default to that mode.
+ ct.mode = QueryExecModeDescribeExec
+ fallthrough
+ case QueryExecModeCacheStatement, QueryExecModeCacheDescribe, QueryExecModeDescribeExec:
+ var err error
+ sd, err = ct.conn.getStatementDescription(
+ ctx,
+ ct.mode,
+ fmt.Sprintf("select %s from %s", quotedColumnNames, quotedTableName),
+ )
+ if err != nil {
+ return 0, fmt.Errorf("statement description failed: %w", err)
+ }
+ default:
+ return 0, fmt.Errorf("unknown QueryExecMode: %v", ct.mode)
}
r, w := io.Pipe()
@@ -145,29 +199,29 @@ func (ct *copyFrom) run(ctx context.Context) (int64, error) {
w.Close()
}()
- startTime := time.Now()
-
commandTag, err := ct.conn.pgConn.CopyFrom(ctx, r, fmt.Sprintf("copy %s ( %s ) from stdin binary;", quotedTableName, quotedColumnNames))
r.Close()
<-doneChan
- rowsAffected := commandTag.RowsAffected()
- endTime := time.Now()
- if err == nil {
- if ct.conn.shouldLog(LogLevelInfo) {
- ct.conn.log(ctx, LogLevelInfo, "CopyFrom", map[string]interface{}{"tableName": ct.tableName, "columnNames": ct.columnNames, "time": endTime.Sub(startTime), "rowCount": rowsAffected})
- }
- } else if ct.conn.shouldLog(LogLevelError) {
- ct.conn.log(ctx, LogLevelError, "CopyFrom", map[string]interface{}{"err": err, "tableName": ct.tableName, "columnNames": ct.columnNames, "time": endTime.Sub(startTime)})
+ if ct.conn.copyFromTracer != nil {
+ ct.conn.copyFromTracer.TraceCopyFromEnd(ctx, ct.conn, TraceCopyFromEndData{
+ CommandTag: commandTag,
+ Err: err,
+ })
}
- return rowsAffected, err
+ return commandTag.RowsAffected(), err
}
func (ct *copyFrom) buildCopyBuf(buf []byte, sd *pgconn.StatementDescription) (bool, []byte, error) {
+ const sendBufSize = 65536 - 5 // The packet has a 5-byte header
+ lastBufLen := 0
+ largestRowLen := 0
for ct.rowSrc.Next() {
+ lastBufLen = len(buf)
+
values, err := ct.rowSrc.Values()
if err != nil {
return false, nil, err
@@ -178,13 +232,21 @@ func (ct *copyFrom) buildCopyBuf(buf []byte, sd *pgconn.StatementDescription) (b
buf = pgio.AppendInt16(buf, int16(len(ct.columnNames)))
for i, val := range values {
- buf, err = encodePreparedStatementArgument(ct.conn.connInfo, buf, sd.Fields[i].DataTypeOID, val)
+ buf, err = encodeCopyValue(ct.conn.typeMap, buf, sd.Fields[i].DataTypeOID, val)
if err != nil {
return false, nil, err
}
}
- if len(buf) > 65536 {
+ rowLen := len(buf) - lastBufLen
+ if rowLen > largestRowLen {
+ largestRowLen = rowLen
+ }
+
+ // Try not to overflow size of the buffer PgConn.CopyFrom will be reading into. If that happens then the nature of
+ // io.Pipe means that the next Read will be short. This can lead to pathological send sizes such as 65531, 13, 65531
+ // 13, 65531, 13, 65531, 13.
+ if len(buf) > sendBufSize-largestRowLen {
return true, buf, nil
}
}
@@ -192,12 +254,14 @@ func (ct *copyFrom) buildCopyBuf(buf []byte, sd *pgconn.StatementDescription) (b
return false, buf, nil
}
-// CopyFrom uses the PostgreSQL copy protocol to perform bulk data insertion.
-// It returns the number of rows copied and an error.
+// CopyFrom uses the PostgreSQL copy protocol to perform bulk data insertion. It returns the number of rows copied and
+// an error.
+//
+// CopyFrom requires all values use the binary format. A pgtype.Type that supports the binary format must be registered
+// for the type of each column. Almost all types implemented by pgx support the binary format.
//
-// CopyFrom requires all values use the binary format. Almost all types
-// implemented by pgx use the binary format by default. Types implementing
-// Encoder can only be used if they encode to the binary format.
+// Even though enum types appear to be strings they still must be registered to use with CopyFrom. This can be done with
+// Conn.LoadType and pgtype.Map.RegisterType.
func (c *Conn) CopyFrom(ctx context.Context, tableName Identifier, columnNames []string, rowSrc CopyFromSource) (int64, error) {
ct := &copyFrom{
conn: c,
@@ -205,6 +269,7 @@ func (c *Conn) CopyFrom(ctx context.Context, tableName Identifier, columnNames [
columnNames: columnNames,
rowSrc: rowSrc,
readerErrChan: make(chan error),
+ mode: c.config.DefaultQueryExecMode,
}
return ct.run(ctx)
diff --git a/vendor/github.com/jackc/pgx/v5/derived_types.go b/vendor/github.com/jackc/pgx/v5/derived_types.go
new file mode 100644
index 0000000..22ab069
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/derived_types.go
@@ -0,0 +1,262 @@
+package pgx
+
+import (
+ "context"
+ "fmt"
+ "regexp"
+ "strconv"
+ "strings"
+
+ "github.com/jackc/pgx/v5/pgtype"
+)
+
+/*
+buildLoadDerivedTypesSQL generates the correct query for retrieving type information.
+
+ pgVersion: the major version of the PostgreSQL server
+ typeNames: the names of the types to load. If nil, load all types.
+*/
+func buildLoadDerivedTypesSQL(pgVersion int64, typeNames []string) string {
+ supportsMultirange := (pgVersion >= 14)
+ var typeNamesClause string
+
+ if typeNames == nil {
+ // This should not occur; this will not return any types
+ typeNamesClause = "= ''"
+ } else {
+ typeNamesClause = "= ANY($1)"
+ }
+ parts := make([]string, 0, 10)
+
+ // Each of the type names provided might be found in pg_class or pg_type.
+ // Additionally, it may or may not include a schema portion.
+ parts = append(parts, `
+WITH RECURSIVE
+-- find the OIDs in pg_class which match one of the provided type names
+selected_classes(oid,reltype) AS (
+ -- this query uses the namespace search path, so will match type names without a schema prefix
+ SELECT pg_class.oid, pg_class.reltype
+ FROM pg_catalog.pg_class
+ LEFT JOIN pg_catalog.pg_namespace n ON n.oid = pg_class.relnamespace
+ WHERE pg_catalog.pg_table_is_visible(pg_class.oid)
+ AND relname `, typeNamesClause, `
+UNION ALL
+ -- this query will only match type names which include the schema prefix
+ SELECT pg_class.oid, pg_class.reltype
+ FROM pg_class
+ INNER JOIN pg_namespace ON (pg_class.relnamespace = pg_namespace.oid)
+ WHERE nspname || '.' || relname `, typeNamesClause, `
+),
+selected_types(oid) AS (
+ -- collect the OIDs from pg_types which correspond to the selected classes
+ SELECT reltype AS oid
+ FROM selected_classes
+UNION ALL
+ -- as well as any other type names which match our criteria
+ SELECT pg_type.oid
+ FROM pg_type
+ LEFT OUTER JOIN pg_namespace ON (pg_type.typnamespace = pg_namespace.oid)
+ WHERE typname `, typeNamesClause, `
+ OR nspname || '.' || typname `, typeNamesClause, `
+),
+-- this builds a parent/child mapping of objects, allowing us to know
+-- all the child (ie: dependent) types that a parent (type) requires
+-- As can be seen, there are 3 ways this can occur (the last of which
+-- is due to being a composite class, where the composite fields are children)
+pc(parent, child) AS (
+ SELECT parent.oid, parent.typelem
+ FROM pg_type parent
+ WHERE parent.typtype = 'b' AND parent.typelem != 0
+UNION ALL
+ SELECT parent.oid, parent.typbasetype
+ FROM pg_type parent
+ WHERE parent.typtypmod = -1 AND parent.typbasetype != 0
+UNION ALL
+ SELECT pg_type.oid, atttypid
+ FROM pg_attribute
+ INNER JOIN pg_class ON (pg_class.oid = pg_attribute.attrelid)
+ INNER JOIN pg_type ON (pg_type.oid = pg_class.reltype)
+ WHERE NOT attisdropped
+ AND attnum > 0
+),
+-- Now construct a recursive query which includes a 'depth' element.
+-- This is used to ensure that the "youngest" children are registered before
+-- their parents.
+relationships(parent, child, depth) AS (
+ SELECT DISTINCT 0::OID, selected_types.oid, 0
+ FROM selected_types
+UNION ALL
+ SELECT pg_type.oid AS parent, pg_attribute.atttypid AS child, 1
+ FROM selected_classes c
+ inner join pg_type ON (c.reltype = pg_type.oid)
+ inner join pg_attribute on (c.oid = pg_attribute.attrelid)
+UNION ALL
+ SELECT pc.parent, pc.child, relationships.depth + 1
+ FROM pc
+ INNER JOIN relationships ON (pc.parent = relationships.child)
+),
+-- composite fields need to be encapsulated as a couple of arrays to provide the required information for registration
+composite AS (
+ SELECT pg_type.oid, ARRAY_AGG(attname ORDER BY attnum) AS attnames, ARRAY_AGG(atttypid ORDER BY ATTNUM) AS atttypids
+ FROM pg_attribute
+ INNER JOIN pg_class ON (pg_class.oid = pg_attribute.attrelid)
+ INNER JOIN pg_type ON (pg_type.oid = pg_class.reltype)
+ WHERE NOT attisdropped
+ AND attnum > 0
+ GROUP BY pg_type.oid
+)
+-- Bring together this information, showing all the information which might possibly be required
+-- to complete the registration, applying filters to only show the items which relate to the selected
+-- types/classes.
+SELECT typname,
+ pg_namespace.nspname,
+ typtype,
+ typbasetype,
+ typelem,
+ pg_type.oid,`)
+ if supportsMultirange {
+ parts = append(parts, `
+ COALESCE(multirange.rngtypid, 0) AS rngtypid,`)
+ } else {
+ parts = append(parts, `
+ 0 AS rngtypid,`)
+ }
+ parts = append(parts, `
+ COALESCE(pg_range.rngsubtype, 0) AS rngsubtype,
+ attnames, atttypids
+ FROM relationships
+ INNER JOIN pg_type ON (pg_type.oid = relationships.child)
+ LEFT OUTER JOIN pg_range ON (pg_type.oid = pg_range.rngtypid)`)
+ if supportsMultirange {
+ parts = append(parts, `
+ LEFT OUTER JOIN pg_range multirange ON (pg_type.oid = multirange.rngmultitypid)`)
+ }
+
+ parts = append(parts, `
+ LEFT OUTER JOIN composite USING (oid)
+ LEFT OUTER JOIN pg_namespace ON (pg_type.typnamespace = pg_namespace.oid)
+ WHERE NOT (typtype = 'b' AND typelem = 0)`)
+ parts = append(parts, `
+ GROUP BY typname, pg_namespace.nspname, typtype, typbasetype, typelem, pg_type.oid, pg_range.rngsubtype,`)
+ if supportsMultirange {
+ parts = append(parts, `
+ multirange.rngtypid,`)
+ }
+ parts = append(parts, `
+ attnames, atttypids
+ ORDER BY MAX(depth) desc, typname;`)
+ return strings.Join(parts, "")
+}
+
+type derivedTypeInfo struct {
+ Oid, Typbasetype, Typelem, Rngsubtype, Rngtypid uint32
+ TypeName, Typtype, NspName string
+ Attnames []string
+ Atttypids []uint32
+}
+
+// LoadTypes performs a single (complex) query, returning all the required
+// information to register the named types, as well as any other types directly
+// or indirectly required to complete the registration.
+// The result of this call can be passed into RegisterTypes to complete the process.
+func (c *Conn) LoadTypes(ctx context.Context, typeNames []string) ([]*pgtype.Type, error) {
+ m := c.TypeMap()
+ if typeNames == nil || len(typeNames) == 0 {
+ return nil, fmt.Errorf("No type names were supplied.")
+ }
+
+ // Disregard server version errors. This will result in
+ // the SQL not support recent structures such as multirange
+ serverVersion, _ := serverVersion(c)
+ sql := buildLoadDerivedTypesSQL(serverVersion, typeNames)
+ var rows Rows
+ var err error
+ if typeNames == nil {
+ rows, err = c.Query(ctx, sql, QueryExecModeSimpleProtocol)
+ } else {
+ rows, err = c.Query(ctx, sql, QueryExecModeSimpleProtocol, typeNames)
+ }
+ if err != nil {
+ return nil, fmt.Errorf("While generating load types query: %w", err)
+ }
+ defer rows.Close()
+ result := make([]*pgtype.Type, 0, 100)
+ for rows.Next() {
+ ti := derivedTypeInfo{}
+ err = rows.Scan(&ti.TypeName, &ti.NspName, &ti.Typtype, &ti.Typbasetype, &ti.Typelem, &ti.Oid, &ti.Rngtypid, &ti.Rngsubtype, &ti.Attnames, &ti.Atttypids)
+ if err != nil {
+ return nil, fmt.Errorf("While scanning type information: %w", err)
+ }
+ var type_ *pgtype.Type
+ switch ti.Typtype {
+ case "b": // array
+ dt, ok := m.TypeForOID(ti.Typelem)
+ if !ok {
+ return nil, fmt.Errorf("Array element OID %v not registered while loading pgtype %q", ti.Typelem, ti.TypeName)
+ }
+ type_ = &pgtype.Type{Name: ti.TypeName, OID: ti.Oid, Codec: &pgtype.ArrayCodec{ElementType: dt}}
+ case "c": // composite
+ var fields []pgtype.CompositeCodecField
+ for i, fieldName := range ti.Attnames {
+ dt, ok := m.TypeForOID(ti.Atttypids[i])
+ if !ok {
+ return nil, fmt.Errorf("Unknown field for composite type %q: field %q (OID %v) is not already registered.", ti.TypeName, fieldName, ti.Atttypids[i])
+ }
+ fields = append(fields, pgtype.CompositeCodecField{Name: fieldName, Type: dt})
+ }
+
+ type_ = &pgtype.Type{Name: ti.TypeName, OID: ti.Oid, Codec: &pgtype.CompositeCodec{Fields: fields}}
+ case "d": // domain
+ dt, ok := m.TypeForOID(ti.Typbasetype)
+ if !ok {
+ return nil, fmt.Errorf("Domain base type OID %v was not already registered, needed for %q", ti.Typbasetype, ti.TypeName)
+ }
+
+ type_ = &pgtype.Type{Name: ti.TypeName, OID: ti.Oid, Codec: dt.Codec}
+ case "e": // enum
+ type_ = &pgtype.Type{Name: ti.TypeName, OID: ti.Oid, Codec: &pgtype.EnumCodec{}}
+ case "r": // range
+ dt, ok := m.TypeForOID(ti.Rngsubtype)
+ if !ok {
+ return nil, fmt.Errorf("Range element OID %v was not already registered, needed for %q", ti.Rngsubtype, ti.TypeName)
+ }
+
+ type_ = &pgtype.Type{Name: ti.TypeName, OID: ti.Oid, Codec: &pgtype.RangeCodec{ElementType: dt}}
+ case "m": // multirange
+ dt, ok := m.TypeForOID(ti.Rngtypid)
+ if !ok {
+ return nil, fmt.Errorf("Multirange element OID %v was not already registered, needed for %q", ti.Rngtypid, ti.TypeName)
+ }
+
+ type_ = &pgtype.Type{Name: ti.TypeName, OID: ti.Oid, Codec: &pgtype.MultirangeCodec{ElementType: dt}}
+ default:
+ return nil, fmt.Errorf("Unknown typtype %q was found while registering %q", ti.Typtype, ti.TypeName)
+ }
+ if type_ != nil {
+ m.RegisterType(type_)
+ if ti.NspName != "" {
+ nspType := &pgtype.Type{Name: ti.NspName + "." + type_.Name, OID: type_.OID, Codec: type_.Codec}
+ m.RegisterType(nspType)
+ result = append(result, nspType)
+ }
+ result = append(result, type_)
+ }
+ }
+ return result, nil
+}
+
+// serverVersion returns the postgresql server version.
+func serverVersion(c *Conn) (int64, error) {
+ serverVersionStr := c.PgConn().ParameterStatus("server_version")
+ serverVersionStr = regexp.MustCompile(`^[0-9]+`).FindString(serverVersionStr)
+ // if not PostgreSQL do nothing
+ if serverVersionStr == "" {
+ return 0, fmt.Errorf("Cannot identify server version in %q", serverVersionStr)
+ }
+
+ version, err := strconv.ParseInt(serverVersionStr, 10, 64)
+ if err != nil {
+ return 0, fmt.Errorf("postgres version parsing failed: %w", err)
+ }
+ return version, nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/doc.go b/vendor/github.com/jackc/pgx/v5/doc.go
new file mode 100644
index 0000000..0e91d64
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/doc.go
@@ -0,0 +1,194 @@
+// Package pgx is a PostgreSQL database driver.
+/*
+pgx provides a native PostgreSQL driver and can act as a database/sql driver. The native PostgreSQL interface is similar
+to the database/sql interface while providing better speed and access to PostgreSQL specific features. Use
+github.com/jackc/pgx/v5/stdlib to use pgx as a database/sql compatible driver. See that package's documentation for
+details.
+
+Establishing a Connection
+
+The primary way of establishing a connection is with [pgx.Connect]:
+
+ conn, err := pgx.Connect(context.Background(), os.Getenv("DATABASE_URL"))
+
+The database connection string can be in URL or key/value format. Both PostgreSQL settings and pgx settings can be
+specified here. In addition, a config struct can be created by [ParseConfig] and modified before establishing the
+connection with [ConnectConfig] to configure settings such as tracing that cannot be configured with a connection
+string.
+
+Connection Pool
+
+[*pgx.Conn] represents a single connection to the database and is not concurrency safe. Use package
+github.com/jackc/pgx/v5/pgxpool for a concurrency safe connection pool.
+
+Query Interface
+
+pgx implements Query in the familiar database/sql style. However, pgx provides generic functions such as CollectRows and
+ForEachRow that are a simpler and safer way of processing rows than manually calling defer rows.Close(), rows.Next(),
+rows.Scan, and rows.Err().
+
+CollectRows can be used collect all returned rows into a slice.
+
+ rows, _ := conn.Query(context.Background(), "select generate_series(1,$1)", 5)
+ numbers, err := pgx.CollectRows(rows, pgx.RowTo[int32])
+ if err != nil {
+ return err
+ }
+ // numbers => [1 2 3 4 5]
+
+ForEachRow can be used to execute a callback function for every row. This is often easier than iterating over rows
+directly.
+
+ var sum, n int32
+ rows, _ := conn.Query(context.Background(), "select generate_series(1,$1)", 10)
+ _, err := pgx.ForEachRow(rows, []any{&n}, func() error {
+ sum += n
+ return nil
+ })
+ if err != nil {
+ return err
+ }
+
+pgx also implements QueryRow in the same style as database/sql.
+
+ var name string
+ var weight int64
+ err := conn.QueryRow(context.Background(), "select name, weight from widgets where id=$1", 42).Scan(&name, &weight)
+ if err != nil {
+ return err
+ }
+
+Use Exec to execute a query that does not return a result set.
+
+ commandTag, err := conn.Exec(context.Background(), "delete from widgets where id=$1", 42)
+ if err != nil {
+ return err
+ }
+ if commandTag.RowsAffected() != 1 {
+ return errors.New("No row found to delete")
+ }
+
+PostgreSQL Data Types
+
+pgx uses the pgtype package to converting Go values to and from PostgreSQL values. It supports many PostgreSQL types
+directly and is customizable and extendable. User defined data types such as enums, domains, and composite types may
+require type registration. See that package's documentation for details.
+
+Transactions
+
+Transactions are started by calling Begin.
+
+ tx, err := conn.Begin(context.Background())
+ if err != nil {
+ return err
+ }
+ // Rollback is safe to call even if the tx is already closed, so if
+ // the tx commits successfully, this is a no-op
+ defer tx.Rollback(context.Background())
+
+ _, err = tx.Exec(context.Background(), "insert into foo(id) values (1)")
+ if err != nil {
+ return err
+ }
+
+ err = tx.Commit(context.Background())
+ if err != nil {
+ return err
+ }
+
+The Tx returned from Begin also implements the Begin method. This can be used to implement pseudo nested transactions.
+These are internally implemented with savepoints.
+
+Use BeginTx to control the transaction mode. BeginTx also can be used to ensure a new transaction is created instead of
+a pseudo nested transaction.
+
+BeginFunc and BeginTxFunc are functions that begin a transaction, execute a function, and commit or rollback the
+transaction depending on the return value of the function. These can be simpler and less error prone to use.
+
+ err = pgx.BeginFunc(context.Background(), conn, func(tx pgx.Tx) error {
+ _, err := tx.Exec(context.Background(), "insert into foo(id) values (1)")
+ return err
+ })
+ if err != nil {
+ return err
+ }
+
+Prepared Statements
+
+Prepared statements can be manually created with the Prepare method. However, this is rarely necessary because pgx
+includes an automatic statement cache by default. Queries run through the normal Query, QueryRow, and Exec functions are
+automatically prepared on first execution and the prepared statement is reused on subsequent executions. See ParseConfig
+for information on how to customize or disable the statement cache.
+
+Copy Protocol
+
+Use CopyFrom to efficiently insert multiple rows at a time using the PostgreSQL copy protocol. CopyFrom accepts a
+CopyFromSource interface. If the data is already in a [][]any use CopyFromRows to wrap it in a CopyFromSource interface.
+Or implement CopyFromSource to avoid buffering the entire data set in memory.
+
+ rows := [][]any{
+ {"John", "Smith", int32(36)},
+ {"Jane", "Doe", int32(29)},
+ }
+
+ copyCount, err := conn.CopyFrom(
+ context.Background(),
+ pgx.Identifier{"people"},
+ []string{"first_name", "last_name", "age"},
+ pgx.CopyFromRows(rows),
+ )
+
+When you already have a typed array using CopyFromSlice can be more convenient.
+
+ rows := []User{
+ {"John", "Smith", 36},
+ {"Jane", "Doe", 29},
+ }
+
+ copyCount, err := conn.CopyFrom(
+ context.Background(),
+ pgx.Identifier{"people"},
+ []string{"first_name", "last_name", "age"},
+ pgx.CopyFromSlice(len(rows), func(i int) ([]any, error) {
+ return []any{rows[i].FirstName, rows[i].LastName, rows[i].Age}, nil
+ }),
+ )
+
+CopyFrom can be faster than an insert with as few as 5 rows.
+
+Listen and Notify
+
+pgx can listen to the PostgreSQL notification system with the `Conn.WaitForNotification` method. It blocks until a
+notification is received or the context is canceled.
+
+ _, err := conn.Exec(context.Background(), "listen channelname")
+ if err != nil {
+ return err
+ }
+
+ notification, err := conn.WaitForNotification(context.Background())
+ if err != nil {
+ return err
+ }
+ // do something with notification
+
+
+Tracing and Logging
+
+pgx supports tracing by setting ConnConfig.Tracer. To combine several tracers you can use the multitracer.Tracer.
+
+In addition, the tracelog package provides the TraceLog type which lets a traditional logger act as a Tracer.
+
+For debug tracing of the actual PostgreSQL wire protocol messages see github.com/jackc/pgx/v5/pgproto3.
+
+Lower Level PostgreSQL Functionality
+
+github.com/jackc/pgx/v5/pgconn contains a lower level PostgreSQL driver roughly at the level of libpq. pgx.Conn in
+implemented on top of pgconn. The Conn.PgConn() method can be used to access this lower layer.
+
+PgBouncer
+
+By default pgx automatically uses prepared statements. Prepared statements are incompatible with PgBouncer. This can be
+disabled by setting a different QueryExecMode in ConnConfig.DefaultQueryExecMode.
+*/
+package pgx
diff --git a/vendor/github.com/jackc/pgx/v5/extended_query_builder.go b/vendor/github.com/jackc/pgx/v5/extended_query_builder.go
new file mode 100644
index 0000000..526b0e9
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/extended_query_builder.go
@@ -0,0 +1,146 @@
+package pgx
+
+import (
+ "fmt"
+
+ "github.com/jackc/pgx/v5/pgconn"
+ "github.com/jackc/pgx/v5/pgtype"
+)
+
+// ExtendedQueryBuilder is used to choose the parameter formats, to format the parameters and to choose the result
+// formats for an extended query.
+type ExtendedQueryBuilder struct {
+ ParamValues [][]byte
+ paramValueBytes []byte
+ ParamFormats []int16
+ ResultFormats []int16
+}
+
+// Build sets ParamValues, ParamFormats, and ResultFormats for use with *PgConn.ExecParams or *PgConn.ExecPrepared. If
+// sd is nil then QueryExecModeExec behavior will be used.
+func (eqb *ExtendedQueryBuilder) Build(m *pgtype.Map, sd *pgconn.StatementDescription, args []any) error {
+ eqb.reset()
+
+ if sd == nil {
+ for i := range args {
+ err := eqb.appendParam(m, 0, pgtype.TextFormatCode, args[i])
+ if err != nil {
+ err = fmt.Errorf("failed to encode args[%d]: %w", i, err)
+ return err
+ }
+ }
+ return nil
+ }
+
+ if len(sd.ParamOIDs) != len(args) {
+ return fmt.Errorf("mismatched param and argument count")
+ }
+
+ for i := range args {
+ err := eqb.appendParam(m, sd.ParamOIDs[i], -1, args[i])
+ if err != nil {
+ err = fmt.Errorf("failed to encode args[%d]: %w", i, err)
+ return err
+ }
+ }
+
+ for i := range sd.Fields {
+ eqb.appendResultFormat(m.FormatCodeForOID(sd.Fields[i].DataTypeOID))
+ }
+
+ return nil
+}
+
+// appendParam appends a parameter to the query. format may be -1 to automatically choose the format. If arg is nil it
+// must be an untyped nil.
+func (eqb *ExtendedQueryBuilder) appendParam(m *pgtype.Map, oid uint32, format int16, arg any) error {
+ if format == -1 {
+ preferredFormat := eqb.chooseParameterFormatCode(m, oid, arg)
+ preferredErr := eqb.appendParam(m, oid, preferredFormat, arg)
+ if preferredErr == nil {
+ return nil
+ }
+
+ var otherFormat int16
+ if preferredFormat == TextFormatCode {
+ otherFormat = BinaryFormatCode
+ } else {
+ otherFormat = TextFormatCode
+ }
+
+ otherErr := eqb.appendParam(m, oid, otherFormat, arg)
+ if otherErr == nil {
+ return nil
+ }
+
+ return preferredErr // return the error from the preferred format
+ }
+
+ v, err := eqb.encodeExtendedParamValue(m, oid, format, arg)
+ if err != nil {
+ return err
+ }
+
+ eqb.ParamFormats = append(eqb.ParamFormats, format)
+ eqb.ParamValues = append(eqb.ParamValues, v)
+
+ return nil
+}
+
+// appendResultFormat appends a result format to the query.
+func (eqb *ExtendedQueryBuilder) appendResultFormat(format int16) {
+ eqb.ResultFormats = append(eqb.ResultFormats, format)
+}
+
+// reset readies eqb to build another query.
+func (eqb *ExtendedQueryBuilder) reset() {
+ eqb.ParamValues = eqb.ParamValues[0:0]
+ eqb.paramValueBytes = eqb.paramValueBytes[0:0]
+ eqb.ParamFormats = eqb.ParamFormats[0:0]
+ eqb.ResultFormats = eqb.ResultFormats[0:0]
+
+ if cap(eqb.ParamValues) > 64 {
+ eqb.ParamValues = make([][]byte, 0, 64)
+ }
+
+ if cap(eqb.paramValueBytes) > 256 {
+ eqb.paramValueBytes = make([]byte, 0, 256)
+ }
+
+ if cap(eqb.ParamFormats) > 64 {
+ eqb.ParamFormats = make([]int16, 0, 64)
+ }
+ if cap(eqb.ResultFormats) > 64 {
+ eqb.ResultFormats = make([]int16, 0, 64)
+ }
+}
+
+func (eqb *ExtendedQueryBuilder) encodeExtendedParamValue(m *pgtype.Map, oid uint32, formatCode int16, arg any) ([]byte, error) {
+ if eqb.paramValueBytes == nil {
+ eqb.paramValueBytes = make([]byte, 0, 128)
+ }
+
+ pos := len(eqb.paramValueBytes)
+
+ buf, err := m.Encode(oid, formatCode, arg, eqb.paramValueBytes)
+ if err != nil {
+ return nil, err
+ }
+ if buf == nil {
+ return nil, nil
+ }
+ eqb.paramValueBytes = buf
+ return eqb.paramValueBytes[pos:], nil
+}
+
+// chooseParameterFormatCode determines the correct format code for an
+// argument to a prepared statement. It defaults to TextFormatCode if no
+// determination can be made.
+func (eqb *ExtendedQueryBuilder) chooseParameterFormatCode(m *pgtype.Map, oid uint32, arg any) int16 {
+ switch arg.(type) {
+ case string, *string:
+ return TextFormatCode
+ }
+
+ return m.FormatCodeForOID(oid)
+}
diff --git a/vendor/github.com/jackc/pgx/v5/internal/iobufpool/iobufpool.go b/vendor/github.com/jackc/pgx/v5/internal/iobufpool/iobufpool.go
new file mode 100644
index 0000000..89e0c22
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/internal/iobufpool/iobufpool.go
@@ -0,0 +1,70 @@
+// Package iobufpool implements a global segregated-fit pool of buffers for IO.
+//
+// It uses *[]byte instead of []byte to avoid the sync.Pool allocation with Put. Unfortunately, using a pointer to avoid
+// an allocation is purposely not documented. https://github.com/golang/go/issues/16323
+package iobufpool
+
+import "sync"
+
+const minPoolExpOf2 = 8
+
+var pools [18]*sync.Pool
+
+func init() {
+ for i := range pools {
+ bufLen := 1 << (minPoolExpOf2 + i)
+ pools[i] = &sync.Pool{
+ New: func() any {
+ buf := make([]byte, bufLen)
+ return &buf
+ },
+ }
+ }
+}
+
+// Get gets a []byte of len size with cap <= size*2.
+func Get(size int) *[]byte {
+ i := getPoolIdx(size)
+ if i >= len(pools) {
+ buf := make([]byte, size)
+ return &buf
+ }
+
+ ptrBuf := (pools[i].Get().(*[]byte))
+ *ptrBuf = (*ptrBuf)[:size]
+
+ return ptrBuf
+}
+
+func getPoolIdx(size int) int {
+ size--
+ size >>= minPoolExpOf2
+ i := 0
+ for size > 0 {
+ size >>= 1
+ i++
+ }
+
+ return i
+}
+
+// Put returns buf to the pool.
+func Put(buf *[]byte) {
+ i := putPoolIdx(cap(*buf))
+ if i < 0 {
+ return
+ }
+
+ pools[i].Put(buf)
+}
+
+func putPoolIdx(size int) int {
+ minPoolSize := 1 << minPoolExpOf2
+ for i := range pools {
+ if size == minPoolSize<<i {
+ return i
+ }
+ }
+
+ return -1
+}
diff --git a/vendor/github.com/jackc/pgx/v5/internal/pgio/README.md b/vendor/github.com/jackc/pgx/v5/internal/pgio/README.md
new file mode 100644
index 0000000..b2fc580
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/internal/pgio/README.md
@@ -0,0 +1,6 @@
+# pgio
+
+Package pgio is a low-level toolkit building messages in the PostgreSQL wire protocol.
+
+pgio provides functions for appending integers to a []byte while doing byte
+order conversion.
diff --git a/vendor/github.com/jackc/pgio/doc.go b/vendor/github.com/jackc/pgx/v5/internal/pgio/doc.go
index ef2dcc7..ef2dcc7 100644
--- a/vendor/github.com/jackc/pgio/doc.go
+++ b/vendor/github.com/jackc/pgx/v5/internal/pgio/doc.go
diff --git a/vendor/github.com/jackc/pgio/write.go b/vendor/github.com/jackc/pgx/v5/internal/pgio/write.go
index 96aedf9..96aedf9 100644
--- a/vendor/github.com/jackc/pgio/write.go
+++ b/vendor/github.com/jackc/pgx/v5/internal/pgio/write.go
diff --git a/vendor/github.com/jackc/pgx/v4/internal/sanitize/sanitize.go b/vendor/github.com/jackc/pgx/v5/internal/sanitize/sanitize.go
index 5eef456..df58c44 100644
--- a/vendor/github.com/jackc/pgx/v4/internal/sanitize/sanitize.go
+++ b/vendor/github.com/jackc/pgx/v5/internal/sanitize/sanitize.go
@@ -12,7 +12,7 @@ import (
// Part is either a string or an int. A string is raw SQL. An int is a
// argument placeholder.
-type Part interface{}
+type Part any
type Query struct {
Parts []Part
@@ -24,7 +24,7 @@ type Query struct {
// https://github.com/jackc/pgx/issues/1380
const replacementcharacterwidth = 3
-func (q *Query) Sanitize(args ...interface{}) (string, error) {
+func (q *Query) Sanitize(args ...any) (string, error) {
argUse := make([]bool, len(args))
buf := &bytes.Buffer{}
@@ -35,6 +35,11 @@ func (q *Query) Sanitize(args ...interface{}) (string, error) {
str = part
case int:
argIdx := part - 1
+
+ if argIdx < 0 {
+ return "", fmt.Errorf("first sql argument must be > 0")
+ }
+
if argIdx >= len(args) {
return "", fmt.Errorf("insufficient arguments")
}
@@ -58,6 +63,10 @@ func (q *Query) Sanitize(args ...interface{}) (string, error) {
return "", fmt.Errorf("invalid arg type: %T", arg)
}
argUse[argIdx] = true
+
+ // Prevent SQL injection via Line Comment Creation
+ // https://github.com/jackc/pgx/security/advisories/GHSA-m7wr-2xf7-cm9p
+ str = " " + str + " "
default:
return "", fmt.Errorf("invalid Part type: %T", part)
}
@@ -313,7 +322,7 @@ func multilineCommentState(l *sqlLexer) stateFn {
// SanitizeSQL replaces placeholder values with args. It quotes and escapes args
// as necessary. This function is only safe when standard_conforming_strings is
// on.
-func SanitizeSQL(sql string, args ...interface{}) (string, error) {
+func SanitizeSQL(sql string, args ...any) (string, error) {
query, err := NewQuery(sql)
if err != nil {
return "", err
diff --git a/vendor/github.com/jackc/pgx/v5/internal/stmtcache/lru_cache.go b/vendor/github.com/jackc/pgx/v5/internal/stmtcache/lru_cache.go
new file mode 100644
index 0000000..dec83f4
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/internal/stmtcache/lru_cache.go
@@ -0,0 +1,112 @@
+package stmtcache
+
+import (
+ "container/list"
+
+ "github.com/jackc/pgx/v5/pgconn"
+)
+
+// LRUCache implements Cache with a Least Recently Used (LRU) cache.
+type LRUCache struct {
+ cap int
+ m map[string]*list.Element
+ l *list.List
+ invalidStmts []*pgconn.StatementDescription
+}
+
+// NewLRUCache creates a new LRUCache. cap is the maximum size of the cache.
+func NewLRUCache(cap int) *LRUCache {
+ return &LRUCache{
+ cap: cap,
+ m: make(map[string]*list.Element),
+ l: list.New(),
+ }
+}
+
+// Get returns the statement description for sql. Returns nil if not found.
+func (c *LRUCache) Get(key string) *pgconn.StatementDescription {
+ if el, ok := c.m[key]; ok {
+ c.l.MoveToFront(el)
+ return el.Value.(*pgconn.StatementDescription)
+ }
+
+ return nil
+
+}
+
+// Put stores sd in the cache. Put panics if sd.SQL is "". Put does nothing if sd.SQL already exists in the cache or
+// sd.SQL has been invalidated and HandleInvalidated has not been called yet.
+func (c *LRUCache) Put(sd *pgconn.StatementDescription) {
+ if sd.SQL == "" {
+ panic("cannot store statement description with empty SQL")
+ }
+
+ if _, present := c.m[sd.SQL]; present {
+ return
+ }
+
+ // The statement may have been invalidated but not yet handled. Do not readd it to the cache.
+ for _, invalidSD := range c.invalidStmts {
+ if invalidSD.SQL == sd.SQL {
+ return
+ }
+ }
+
+ if c.l.Len() == c.cap {
+ c.invalidateOldest()
+ }
+
+ el := c.l.PushFront(sd)
+ c.m[sd.SQL] = el
+}
+
+// Invalidate invalidates statement description identified by sql. Does nothing if not found.
+func (c *LRUCache) Invalidate(sql string) {
+ if el, ok := c.m[sql]; ok {
+ delete(c.m, sql)
+ c.invalidStmts = append(c.invalidStmts, el.Value.(*pgconn.StatementDescription))
+ c.l.Remove(el)
+ }
+}
+
+// InvalidateAll invalidates all statement descriptions.
+func (c *LRUCache) InvalidateAll() {
+ el := c.l.Front()
+ for el != nil {
+ c.invalidStmts = append(c.invalidStmts, el.Value.(*pgconn.StatementDescription))
+ el = el.Next()
+ }
+
+ c.m = make(map[string]*list.Element)
+ c.l = list.New()
+}
+
+// GetInvalidated returns a slice of all statement descriptions invalidated since the last call to RemoveInvalidated.
+func (c *LRUCache) GetInvalidated() []*pgconn.StatementDescription {
+ return c.invalidStmts
+}
+
+// RemoveInvalidated removes all invalidated statement descriptions. No other calls to Cache must be made between a
+// call to GetInvalidated and RemoveInvalidated or RemoveInvalidated may remove statement descriptions that were
+// never seen by the call to GetInvalidated.
+func (c *LRUCache) RemoveInvalidated() {
+ c.invalidStmts = nil
+}
+
+// Len returns the number of cached prepared statement descriptions.
+func (c *LRUCache) Len() int {
+ return c.l.Len()
+}
+
+// Cap returns the maximum number of cached prepared statement descriptions.
+func (c *LRUCache) Cap() int {
+ return c.cap
+}
+
+func (c *LRUCache) invalidateOldest() {
+ oldest := c.l.Back()
+ sd := oldest.Value.(*pgconn.StatementDescription)
+ c.invalidStmts = append(c.invalidStmts, sd)
+ delete(c.m, sd.SQL)
+ c.l.Remove(oldest)
+}
diff --git a/vendor/github.com/jackc/pgx/v5/internal/stmtcache/stmtcache.go b/vendor/github.com/jackc/pgx/v5/internal/stmtcache/stmtcache.go
new file mode 100644
index 0000000..d57bdd2
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/internal/stmtcache/stmtcache.go
@@ -0,0 +1,45 @@
+// Package stmtcache is a cache for statement descriptions.
+package stmtcache
+
+import (
+ "crypto/sha256"
+ "encoding/hex"
+
+ "github.com/jackc/pgx/v5/pgconn"
+)
+
+// StatementName returns a statement name that will be stable for sql across multiple connections and program
+// executions.
+func StatementName(sql string) string {
+ digest := sha256.Sum256([]byte(sql))
+ return "stmtcache_" + hex.EncodeToString(digest[0:24])
+}
+
+// Cache caches statement descriptions.
+type Cache interface {
+ // Get returns the statement description for sql. Returns nil if not found.
+ Get(sql string) *pgconn.StatementDescription
+
+ // Put stores sd in the cache. Put panics if sd.SQL is "". Put does nothing if sd.SQL already exists in the cache.
+ Put(sd *pgconn.StatementDescription)
+
+ // Invalidate invalidates statement description identified by sql. Does nothing if not found.
+ Invalidate(sql string)
+
+ // InvalidateAll invalidates all statement descriptions.
+ InvalidateAll()
+
+ // GetInvalidated returns a slice of all statement descriptions invalidated since the last call to RemoveInvalidated.
+ GetInvalidated() []*pgconn.StatementDescription
+
+ // RemoveInvalidated removes all invalidated statement descriptions. No other calls to Cache must be made between a
+ // call to GetInvalidated and RemoveInvalidated or RemoveInvalidated may remove statement descriptions that were
+ // never seen by the call to GetInvalidated.
+ RemoveInvalidated()
+
+ // Len returns the number of cached prepared statement descriptions.
+ Len() int
+
+ // Cap returns the maximum number of cached prepared statement descriptions.
+ Cap() int
+}
diff --git a/vendor/github.com/jackc/pgx/v5/internal/stmtcache/unlimited_cache.go b/vendor/github.com/jackc/pgx/v5/internal/stmtcache/unlimited_cache.go
new file mode 100644
index 0000000..6964132
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/internal/stmtcache/unlimited_cache.go
@@ -0,0 +1,77 @@
+package stmtcache
+
+import (
+ "math"
+
+ "github.com/jackc/pgx/v5/pgconn"
+)
+
+// UnlimitedCache implements Cache with no capacity limit.
+type UnlimitedCache struct {
+ m map[string]*pgconn.StatementDescription
+ invalidStmts []*pgconn.StatementDescription
+}
+
+// NewUnlimitedCache creates a new UnlimitedCache.
+func NewUnlimitedCache() *UnlimitedCache {
+ return &UnlimitedCache{
+ m: make(map[string]*pgconn.StatementDescription),
+ }
+}
+
+// Get returns the statement description for sql. Returns nil if not found.
+func (c *UnlimitedCache) Get(sql string) *pgconn.StatementDescription {
+ return c.m[sql]
+}
+
+// Put stores sd in the cache. Put panics if sd.SQL is "". Put does nothing if sd.SQL already exists in the cache.
+func (c *UnlimitedCache) Put(sd *pgconn.StatementDescription) {
+ if sd.SQL == "" {
+ panic("cannot store statement description with empty SQL")
+ }
+
+ if _, present := c.m[sd.SQL]; present {
+ return
+ }
+
+ c.m[sd.SQL] = sd
+}
+
+// Invalidate invalidates statement description identified by sql. Does nothing if not found.
+func (c *UnlimitedCache) Invalidate(sql string) {
+ if sd, ok := c.m[sql]; ok {
+ delete(c.m, sql)
+ c.invalidStmts = append(c.invalidStmts, sd)
+ }
+}
+
+// InvalidateAll invalidates all statement descriptions.
+func (c *UnlimitedCache) InvalidateAll() {
+ for _, sd := range c.m {
+ c.invalidStmts = append(c.invalidStmts, sd)
+ }
+
+ c.m = make(map[string]*pgconn.StatementDescription)
+}
+
+// GetInvalidated returns a slice of all statement descriptions invalidated since the last call to RemoveInvalidated.
+func (c *UnlimitedCache) GetInvalidated() []*pgconn.StatementDescription {
+ return c.invalidStmts
+}
+
+// RemoveInvalidated removes all invalidated statement descriptions. No other calls to Cache must be made between a
+// call to GetInvalidated and RemoveInvalidated or RemoveInvalidated may remove statement descriptions that were
+// never seen by the call to GetInvalidated.
+func (c *UnlimitedCache) RemoveInvalidated() {
+ c.invalidStmts = nil
+}
+
+// Len returns the number of cached prepared statement descriptions.
+func (c *UnlimitedCache) Len() int {
+ return len(c.m)
+}
+
+// Cap returns the maximum number of cached prepared statement descriptions.
+func (c *UnlimitedCache) Cap() int {
+ return math.MaxInt
+}
diff --git a/vendor/github.com/jackc/pgx/v4/large_objects.go b/vendor/github.com/jackc/pgx/v5/large_objects.go
index c238ab9..9d21afd 100644
--- a/vendor/github.com/jackc/pgx/v4/large_objects.go
+++ b/vendor/github.com/jackc/pgx/v5/large_objects.go
@@ -4,8 +4,15 @@ import (
"context"
"errors"
"io"
+
+ "github.com/jackc/pgx/v5/pgtype"
)
+// The PostgreSQL wire protocol has a limit of 1 GB - 1 per message. See definition of
+// PQ_LARGE_MESSAGE_LIMIT in the PostgreSQL source code. To allow for the other data
+// in the message,maxLargeObjectMessageLength should be no larger than 1 GB - 1 KB.
+var maxLargeObjectMessageLength = 1024*1024*1024 - 1024
+
// LargeObjects is a structure used to access the large objects API. It is only valid within the transaction where it
// was created.
//
@@ -68,32 +75,65 @@ type LargeObject struct {
// Write writes p to the large object and returns the number of bytes written and an error if not all of p was written.
func (o *LargeObject) Write(p []byte) (int, error) {
- var n int
- err := o.tx.QueryRow(o.ctx, "select lowrite($1, $2)", o.fd, p).Scan(&n)
- if err != nil {
- return n, err
+ nTotal := 0
+ for {
+ expected := len(p) - nTotal
+ if expected == 0 {
+ break
+ } else if expected > maxLargeObjectMessageLength {
+ expected = maxLargeObjectMessageLength
+ }
+
+ var n int
+ err := o.tx.QueryRow(o.ctx, "select lowrite($1, $2)", o.fd, p[nTotal:nTotal+expected]).Scan(&n)
+ if err != nil {
+ return nTotal, err
+ }
+
+ if n < 0 {
+ return nTotal, errors.New("failed to write to large object")
+ }
+
+ nTotal += n
+
+ if n < expected {
+ return nTotal, errors.New("short write to large object")
+ } else if n > expected {
+ return nTotal, errors.New("invalid write to large object")
+ }
}
- if n < 0 {
- return 0, errors.New("failed to write to large object")
- }
-
- return n, nil
+ return nTotal, nil
}
// Read reads up to len(p) bytes into p returning the number of bytes read.
func (o *LargeObject) Read(p []byte) (int, error) {
- var res []byte
- err := o.tx.QueryRow(o.ctx, "select loread($1, $2)", o.fd, len(p)).Scan(&res)
- copy(p, res)
- if err != nil {
- return len(res), err
+ nTotal := 0
+ for {
+ expected := len(p) - nTotal
+ if expected == 0 {
+ break
+ } else if expected > maxLargeObjectMessageLength {
+ expected = maxLargeObjectMessageLength
+ }
+
+ res := pgtype.PreallocBytes(p[nTotal:])
+ err := o.tx.QueryRow(o.ctx, "select loread($1, $2)", o.fd, expected).Scan(&res)
+ // We compute expected so that it always fits into p, so it should never happen
+ // that PreallocBytes's ScanBytes had to allocate a new slice.
+ nTotal += len(res)
+ if err != nil {
+ return nTotal, err
+ }
+
+ if len(res) < expected {
+ return nTotal, io.EOF
+ } else if len(res) > expected {
+ return nTotal, errors.New("invalid read of large object")
+ }
}
- if len(res) < len(p) {
- err = io.EOF
- }
- return len(res), err
+ return nTotal, nil
}
// Seek moves the current location pointer to the new location specified by offset.
diff --git a/vendor/github.com/jackc/pgx/v5/named_args.go b/vendor/github.com/jackc/pgx/v5/named_args.go
new file mode 100644
index 0000000..c88991e
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/named_args.go
@@ -0,0 +1,295 @@
+package pgx
+
+import (
+ "context"
+ "fmt"
+ "strconv"
+ "strings"
+ "unicode/utf8"
+)
+
+// NamedArgs can be used as the first argument to a query method. It will replace every '@' named placeholder with a '$'
+// ordinal placeholder and construct the appropriate arguments.
+//
+// For example, the following two queries are equivalent:
+//
+// conn.Query(ctx, "select * from widgets where foo = @foo and bar = @bar", pgx.NamedArgs{"foo": 1, "bar": 2})
+// conn.Query(ctx, "select * from widgets where foo = $1 and bar = $2", 1, 2)
+//
+// Named placeholders are case sensitive and must start with a letter or underscore. Subsequent characters can be
+// letters, numbers, or underscores.
+type NamedArgs map[string]any
+
+// RewriteQuery implements the QueryRewriter interface.
+func (na NamedArgs) RewriteQuery(ctx context.Context, conn *Conn, sql string, args []any) (newSQL string, newArgs []any, err error) {
+ return rewriteQuery(na, sql, false)
+}
+
+// StrictNamedArgs can be used in the same way as NamedArgs, but provided arguments are also checked to include all
+// named arguments that the sql query uses, and no extra arguments.
+type StrictNamedArgs map[string]any
+
+// RewriteQuery implements the QueryRewriter interface.
+func (sna StrictNamedArgs) RewriteQuery(ctx context.Context, conn *Conn, sql string, args []any) (newSQL string, newArgs []any, err error) {
+ return rewriteQuery(sna, sql, true)
+}
+
+type namedArg string
+
+type sqlLexer struct {
+ src string
+ start int
+ pos int
+ nested int // multiline comment nesting level.
+ stateFn stateFn
+ parts []any
+
+ nameToOrdinal map[namedArg]int
+}
+
+type stateFn func(*sqlLexer) stateFn
+
+func rewriteQuery(na map[string]any, sql string, isStrict bool) (newSQL string, newArgs []any, err error) {
+ l := &sqlLexer{
+ src: sql,
+ stateFn: rawState,
+ nameToOrdinal: make(map[namedArg]int, len(na)),
+ }
+
+ for l.stateFn != nil {
+ l.stateFn = l.stateFn(l)
+ }
+
+ sb := strings.Builder{}
+ for _, p := range l.parts {
+ switch p := p.(type) {
+ case string:
+ sb.WriteString(p)
+ case namedArg:
+ sb.WriteRune('$')
+ sb.WriteString(strconv.Itoa(l.nameToOrdinal[p]))
+ }
+ }
+
+ newArgs = make([]any, len(l.nameToOrdinal))
+ for name, ordinal := range l.nameToOrdinal {
+ var found bool
+ newArgs[ordinal-1], found = na[string(name)]
+ if isStrict && !found {
+ return "", nil, fmt.Errorf("argument %s found in sql query but not present in StrictNamedArgs", name)
+ }
+ }
+
+ if isStrict {
+ for name := range na {
+ if _, found := l.nameToOrdinal[namedArg(name)]; !found {
+ return "", nil, fmt.Errorf("argument %s of StrictNamedArgs not found in sql query", name)
+ }
+ }
+ }
+
+ return sb.String(), newArgs, nil
+}
+
+func rawState(l *sqlLexer) stateFn {
+ for {
+ r, width := utf8.DecodeRuneInString(l.src[l.pos:])
+ l.pos += width
+
+ switch r {
+ case 'e', 'E':
+ nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:])
+ if nextRune == '\'' {
+ l.pos += width
+ return escapeStringState
+ }
+ case '\'':
+ return singleQuoteState
+ case '"':
+ return doubleQuoteState
+ case '@':
+ nextRune, _ := utf8.DecodeRuneInString(l.src[l.pos:])
+ if isLetter(nextRune) || nextRune == '_' {
+ if l.pos-l.start > 0 {
+ l.parts = append(l.parts, l.src[l.start:l.pos-width])
+ }
+ l.start = l.pos
+ return namedArgState
+ }
+ case '-':
+ nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:])
+ if nextRune == '-' {
+ l.pos += width
+ return oneLineCommentState
+ }
+ case '/':
+ nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:])
+ if nextRune == '*' {
+ l.pos += width
+ return multilineCommentState
+ }
+ case utf8.RuneError:
+ if l.pos-l.start > 0 {
+ l.parts = append(l.parts, l.src[l.start:l.pos])
+ l.start = l.pos
+ }
+ return nil
+ }
+ }
+}
+
+func isLetter(r rune) bool {
+ return (r >= 'a' && r <= 'z') || (r >= 'A' && r <= 'Z')
+}
+
+func namedArgState(l *sqlLexer) stateFn {
+ for {
+ r, width := utf8.DecodeRuneInString(l.src[l.pos:])
+ l.pos += width
+
+ if r == utf8.RuneError {
+ if l.pos-l.start > 0 {
+ na := namedArg(l.src[l.start:l.pos])
+ if _, found := l.nameToOrdinal[na]; !found {
+ l.nameToOrdinal[na] = len(l.nameToOrdinal) + 1
+ }
+ l.parts = append(l.parts, na)
+ l.start = l.pos
+ }
+ return nil
+ } else if !(isLetter(r) || (r >= '0' && r <= '9') || r == '_') {
+ l.pos -= width
+ na := namedArg(l.src[l.start:l.pos])
+ if _, found := l.nameToOrdinal[na]; !found {
+ l.nameToOrdinal[na] = len(l.nameToOrdinal) + 1
+ }
+ l.parts = append(l.parts, namedArg(na))
+ l.start = l.pos
+ return rawState
+ }
+ }
+}
+
+func singleQuoteState(l *sqlLexer) stateFn {
+ for {
+ r, width := utf8.DecodeRuneInString(l.src[l.pos:])
+ l.pos += width
+
+ switch r {
+ case '\'':
+ nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:])
+ if nextRune != '\'' {
+ return rawState
+ }
+ l.pos += width
+ case utf8.RuneError:
+ if l.pos-l.start > 0 {
+ l.parts = append(l.parts, l.src[l.start:l.pos])
+ l.start = l.pos
+ }
+ return nil
+ }
+ }
+}
+
+func doubleQuoteState(l *sqlLexer) stateFn {
+ for {
+ r, width := utf8.DecodeRuneInString(l.src[l.pos:])
+ l.pos += width
+
+ switch r {
+ case '"':
+ nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:])
+ if nextRune != '"' {
+ return rawState
+ }
+ l.pos += width
+ case utf8.RuneError:
+ if l.pos-l.start > 0 {
+ l.parts = append(l.parts, l.src[l.start:l.pos])
+ l.start = l.pos
+ }
+ return nil
+ }
+ }
+}
+
+func escapeStringState(l *sqlLexer) stateFn {
+ for {
+ r, width := utf8.DecodeRuneInString(l.src[l.pos:])
+ l.pos += width
+
+ switch r {
+ case '\\':
+ _, width = utf8.DecodeRuneInString(l.src[l.pos:])
+ l.pos += width
+ case '\'':
+ nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:])
+ if nextRune != '\'' {
+ return rawState
+ }
+ l.pos += width
+ case utf8.RuneError:
+ if l.pos-l.start > 0 {
+ l.parts = append(l.parts, l.src[l.start:l.pos])
+ l.start = l.pos
+ }
+ return nil
+ }
+ }
+}
+
+func oneLineCommentState(l *sqlLexer) stateFn {
+ for {
+ r, width := utf8.DecodeRuneInString(l.src[l.pos:])
+ l.pos += width
+
+ switch r {
+ case '\\':
+ _, width = utf8.DecodeRuneInString(l.src[l.pos:])
+ l.pos += width
+ case '\n', '\r':
+ return rawState
+ case utf8.RuneError:
+ if l.pos-l.start > 0 {
+ l.parts = append(l.parts, l.src[l.start:l.pos])
+ l.start = l.pos
+ }
+ return nil
+ }
+ }
+}
+
+func multilineCommentState(l *sqlLexer) stateFn {
+ for {
+ r, width := utf8.DecodeRuneInString(l.src[l.pos:])
+ l.pos += width
+
+ switch r {
+ case '/':
+ nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:])
+ if nextRune == '*' {
+ l.pos += width
+ l.nested++
+ }
+ case '*':
+ nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:])
+ if nextRune != '/' {
+ continue
+ }
+
+ l.pos += width
+ if l.nested == 0 {
+ return rawState
+ }
+ l.nested--
+
+ case utf8.RuneError:
+ if l.pos-l.start > 0 {
+ l.parts = append(l.parts, l.src[l.start:l.pos])
+ l.start = l.pos
+ }
+ return nil
+ }
+ }
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgconn/README.md b/vendor/github.com/jackc/pgx/v5/pgconn/README.md
new file mode 100644
index 0000000..1fe15c2
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgconn/README.md
@@ -0,0 +1,29 @@
+# pgconn
+
+Package pgconn is a low-level PostgreSQL database driver. It operates at nearly the same level as the C library libpq.
+It is primarily intended to serve as the foundation for higher level libraries such as https://github.com/jackc/pgx.
+Applications should handle normal queries with a higher level library and only use pgconn directly when required for
+low-level access to PostgreSQL functionality.
+
+## Example Usage
+
+```go
+pgConn, err := pgconn.Connect(context.Background(), os.Getenv("DATABASE_URL"))
+if err != nil {
+ log.Fatalln("pgconn failed to connect:", err)
+}
+defer pgConn.Close(context.Background())
+
+result := pgConn.ExecParams(context.Background(), "SELECT email FROM users WHERE id=$1", [][]byte{[]byte("123")}, nil, nil, nil)
+for result.NextRow() {
+ fmt.Println("User 123 has email:", string(result.Values()[0]))
+}
+_, err = result.Close()
+if err != nil {
+ log.Fatalln("failed reading result:", err)
+}
+```
+
+## Testing
+
+See CONTRIBUTING.md for setup instructions.
diff --git a/vendor/github.com/jackc/pgconn/auth_scram.go b/vendor/github.com/jackc/pgx/v5/pgconn/auth_scram.go
index d8d7111..0649836 100644
--- a/vendor/github.com/jackc/pgconn/auth_scram.go
+++ b/vendor/github.com/jackc/pgx/v5/pgconn/auth_scram.go
@@ -22,7 +22,7 @@ import (
"fmt"
"strconv"
- "github.com/jackc/pgproto3/v2"
+ "github.com/jackc/pgx/v5/pgproto3"
"golang.org/x/crypto/pbkdf2"
"golang.org/x/text/secure/precis"
)
@@ -41,12 +41,13 @@ func (c *PgConn) scramAuth(serverAuthMechanisms []string) error {
AuthMechanism: "SCRAM-SHA-256",
Data: sc.clientFirstMessage(),
}
- _, err = c.conn.Write(saslInitialResponse.Encode(nil))
+ c.frontend.Send(saslInitialResponse)
+ err = c.flushWithPotentialWriteReadDeadlock()
if err != nil {
return err
}
- // Receive server-first-message payload in a AuthenticationSASLContinue.
+ // Receive server-first-message payload in an AuthenticationSASLContinue.
saslContinue, err := c.rxSASLContinue()
if err != nil {
return err
@@ -60,12 +61,13 @@ func (c *PgConn) scramAuth(serverAuthMechanisms []string) error {
saslResponse := &pgproto3.SASLResponse{
Data: []byte(sc.clientFinalMessage()),
}
- _, err = c.conn.Write(saslResponse.Encode(nil))
+ c.frontend.Send(saslResponse)
+ err = c.flushWithPotentialWriteReadDeadlock()
if err != nil {
return err
}
- // Receive server-final-message payload in a AuthenticationSASLFinal.
+ // Receive server-final-message payload in an AuthenticationSASLFinal.
saslFinal, err := c.rxSASLFinal()
if err != nil {
return err
diff --git a/vendor/github.com/jackc/pgconn/config.go b/vendor/github.com/jackc/pgx/v5/pgconn/config.go
index 4080f2c..46b39f1 100644
--- a/vendor/github.com/jackc/pgconn/config.go
+++ b/vendor/github.com/jackc/pgx/v5/pgconn/config.go
@@ -8,7 +8,6 @@ import (
"errors"
"fmt"
"io"
- "io/ioutil"
"math"
"net"
"net/url"
@@ -18,17 +17,17 @@ import (
"strings"
"time"
- "github.com/jackc/chunkreader/v2"
"github.com/jackc/pgpassfile"
- "github.com/jackc/pgproto3/v2"
"github.com/jackc/pgservicefile"
+ "github.com/jackc/pgx/v5/pgconn/ctxwatch"
+ "github.com/jackc/pgx/v5/pgproto3"
)
type AfterConnectFunc func(ctx context.Context, pgconn *PgConn) error
type ValidateConnectFunc func(ctx context.Context, pgconn *PgConn) error
type GetSSLPasswordFunc func(ctx context.Context) string
-// Config is the settings used to establish a connection to a PostgreSQL server. It must be created by ParseConfig. A
+// Config is the settings used to establish a connection to a PostgreSQL server. It must be created by [ParseConfig]. A
// manually initialized Config will cause ConnectConfig to panic.
type Config struct {
Host string // host (e.g. localhost) or absolute path to unix domain socket directory (e.g. /private/tmp)
@@ -41,7 +40,12 @@ type Config struct {
DialFunc DialFunc // e.g. net.Dialer.DialContext
LookupFunc LookupFunc // e.g. net.Resolver.LookupHost
BuildFrontend BuildFrontendFunc
- RuntimeParams map[string]string // Run-time parameters to set on connection as session default values (e.g. search_path or application_name)
+
+ // BuildContextWatcherHandler is called to create a ContextWatcherHandler for a connection. The handler is called
+ // when a context passed to a PgConn method is canceled.
+ BuildContextWatcherHandler func(*PgConn) ctxwatch.Handler
+
+ RuntimeParams map[string]string // Run-time parameters to set on connection as session default values (e.g. search_path or application_name)
KerberosSrvName string
KerberosSpn string
@@ -62,12 +66,17 @@ type Config struct {
// OnNotification is a callback function called when a notification from the LISTEN/NOTIFY system is received.
OnNotification NotificationHandler
+ // OnPgError is a callback function called when a Postgres error is received by the server. The default handler will close
+ // the connection on any FATAL errors. If you override this handler you should call the previously set handler or ensure
+ // that you close on FATAL errors by returning false.
+ OnPgError PgErrorHandler
+
createdByParseConfig bool // Used to enforce created by ParseConfig rule.
}
-// ParseConfigOptions contains options that control how a config is built such as getsslpassword.
+// ParseConfigOptions contains options that control how a config is built such as GetSSLPassword.
type ParseConfigOptions struct {
- // GetSSLPassword gets the password to decrypt a SSL client certificate. This is analogous to the the libpq function
+ // GetSSLPassword gets the password to decrypt a SSL client certificate. This is analogous to the libpq function
// PQsetSSLKeyPassHook_OpenSSL.
GetSSLPassword GetSSLPasswordFunc
}
@@ -109,6 +118,14 @@ type FallbackConfig struct {
TLSConfig *tls.Config // nil disables TLS
}
+// connectOneConfig is the configuration for a single attempt to connect to a single host.
+type connectOneConfig struct {
+ network string
+ address string
+ originalHostname string // original hostname before resolving
+ tlsConfig *tls.Config // nil disables TLS
+}
+
// isAbsolutePath checks if the provided value is an absolute path either
// beginning with a forward slash (as on Linux-based systems) or with a capital
// letter A-Z followed by a colon and a backslash, e.g., "C:\", (as on Windows).
@@ -143,15 +160,15 @@ func NetworkAddress(host string, port uint16) (network, address string) {
// ParseConfig builds a *Config from connString with similar behavior to the PostgreSQL standard C library libpq. It
// uses the same defaults as libpq (e.g. port=5432) and understands most PG* environment variables. ParseConfig closely
-// matches the parsing behavior of libpq. connString may either be in URL format or keyword = value format (DSN style).
-// See https://www.postgresql.org/docs/current/libpq-connect.html#LIBPQ-CONNSTRING for details. connString also may be
-// empty to only read from the environment. If a password is not supplied it will attempt to read the .pgpass file.
+// matches the parsing behavior of libpq. connString may either be in URL format or keyword = value format. See
+// https://www.postgresql.org/docs/current/libpq-connect.html#LIBPQ-CONNSTRING for details. connString also may be empty
+// to only read from the environment. If a password is not supplied it will attempt to read the .pgpass file.
//
-// # Example DSN
-// user=jack password=secret host=pg.example.com port=5432 dbname=mydb sslmode=verify-ca
+// # Example Keyword/Value
+// user=jack password=secret host=pg.example.com port=5432 dbname=mydb sslmode=verify-ca
//
-// # Example URL
-// postgres://jack:secret@pg.example.com:5432/mydb?sslmode=verify-ca
+// # Example URL
+// postgres://jack:secret@pg.example.com:5432/mydb?sslmode=verify-ca
//
// The returned *Config may be modified. However, it is strongly recommended that any configuration that can be done
// through the connection string be done there. In particular the fields Host, Port, TLSConfig, and Fallbacks can be
@@ -162,28 +179,28 @@ func NetworkAddress(host string, port uint16) (network, address string) {
// values that will be tried in order. This can be used as part of a high availability system. See
// https://www.postgresql.org/docs/11/libpq-connect.html#LIBPQ-MULTIPLE-HOSTS for more information.
//
-// # Example URL
-// postgres://jack:secret@foo.example.com:5432,bar.example.com:5432/mydb
+// # Example URL
+// postgres://jack:secret@foo.example.com:5432,bar.example.com:5432/mydb
//
// ParseConfig currently recognizes the following environment variable and their parameter key word equivalents passed
-// via database URL or DSN:
+// via database URL or keyword/value:
//
-// PGHOST
-// PGPORT
-// PGDATABASE
-// PGUSER
-// PGPASSWORD
-// PGPASSFILE
-// PGSERVICE
-// PGSERVICEFILE
-// PGSSLMODE
-// PGSSLCERT
-// PGSSLKEY
-// PGSSLROOTCERT
-// PGSSLPASSWORD
-// PGAPPNAME
-// PGCONNECT_TIMEOUT
-// PGTARGETSESSIONATTRS
+// PGHOST
+// PGPORT
+// PGDATABASE
+// PGUSER
+// PGPASSWORD
+// PGPASSFILE
+// PGSERVICE
+// PGSERVICEFILE
+// PGSSLMODE
+// PGSSLCERT
+// PGSSLKEY
+// PGSSLROOTCERT
+// PGSSLPASSWORD
+// PGAPPNAME
+// PGCONNECT_TIMEOUT
+// PGTARGETSESSIONATTRS
//
// See http://www.postgresql.org/docs/11/static/libpq-envars.html for details on the meaning of environment variables.
//
@@ -212,11 +229,9 @@ func NetworkAddress(host string, port uint16) (network, address string) {
//
// In addition, ParseConfig accepts the following options:
//
-// min_read_buffer_size
-// The minimum size of the internal read buffer. Default 8192.
-// servicefile
-// libpq only reads servicefile from the PGSERVICEFILE environment variable. ParseConfig accepts servicefile as a
-// part of the connection string.
+// - servicefile.
+// libpq only reads servicefile from the PGSERVICEFILE environment variable. ParseConfig accepts servicefile as a
+// part of the connection string.
func ParseConfig(connString string) (*Config, error) {
var parseConfigOptions ParseConfigOptions
return ParseConfigWithOptions(connString, parseConfigOptions)
@@ -232,16 +247,16 @@ func ParseConfigWithOptions(connString string, options ParseConfigOptions) (*Con
connStringSettings := make(map[string]string)
if connString != "" {
var err error
- // connString may be a database URL or a DSN
+ // connString may be a database URL or in PostgreSQL keyword/value format
if strings.HasPrefix(connString, "postgres://") || strings.HasPrefix(connString, "postgresql://") {
connStringSettings, err = parseURLSettings(connString)
if err != nil {
- return nil, &parseConfigError{connString: connString, msg: "failed to parse as URL", err: err}
+ return nil, &ParseConfigError{ConnString: connString, msg: "failed to parse as URL", err: err}
}
} else {
- connStringSettings, err = parseDSNSettings(connString)
+ connStringSettings, err = parseKeywordValueSettings(connString)
if err != nil {
- return nil, &parseConfigError{connString: connString, msg: "failed to parse as DSN", err: err}
+ return nil, &ParseConfigError{ConnString: connString, msg: "failed to parse as keyword/value", err: err}
}
}
}
@@ -250,30 +265,37 @@ func ParseConfigWithOptions(connString string, options ParseConfigOptions) (*Con
if service, present := settings["service"]; present {
serviceSettings, err := parseServiceSettings(settings["servicefile"], service)
if err != nil {
- return nil, &parseConfigError{connString: connString, msg: "failed to read service", err: err}
+ return nil, &ParseConfigError{ConnString: connString, msg: "failed to read service", err: err}
}
settings = mergeSettings(defaultSettings, envSettings, serviceSettings, connStringSettings)
}
- minReadBufferSize, err := strconv.ParseInt(settings["min_read_buffer_size"], 10, 32)
- if err != nil {
- return nil, &parseConfigError{connString: connString, msg: "cannot parse min_read_buffer_size", err: err}
- }
-
config := &Config{
createdByParseConfig: true,
Database: settings["database"],
User: settings["user"],
Password: settings["password"],
RuntimeParams: make(map[string]string),
- BuildFrontend: makeDefaultBuildFrontendFunc(int(minReadBufferSize)),
+ BuildFrontend: func(r io.Reader, w io.Writer) *pgproto3.Frontend {
+ return pgproto3.NewFrontend(r, w)
+ },
+ BuildContextWatcherHandler: func(pgConn *PgConn) ctxwatch.Handler {
+ return &DeadlineContextWatcherHandler{Conn: pgConn.conn}
+ },
+ OnPgError: func(_ *PgConn, pgErr *PgError) bool {
+ // we want to automatically close any fatal errors
+ if strings.EqualFold(pgErr.Severity, "FATAL") {
+ return false
+ }
+ return true
+ },
}
if connectTimeoutSetting, present := settings["connect_timeout"]; present {
connectTimeout, err := parseConnectTimeoutSetting(connectTimeoutSetting)
if err != nil {
- return nil, &parseConfigError{connString: connString, msg: "invalid connect_timeout", err: err}
+ return nil, &ParseConfigError{ConnString: connString, msg: "invalid connect_timeout", err: err}
}
config.ConnectTimeout = connectTimeout
config.DialFunc = makeConnectTimeoutDialFunc(connectTimeout)
@@ -301,7 +323,6 @@ func ParseConfigWithOptions(connString string, options ParseConfigOptions) (*Con
"krbspn": {},
"krbsrvname": {},
"target_session_attrs": {},
- "min_read_buffer_size": {},
"service": {},
"servicefile": {},
}
@@ -336,7 +357,7 @@ func ParseConfigWithOptions(connString string, options ParseConfigOptions) (*Con
port, err := parsePort(portStr)
if err != nil {
- return nil, &parseConfigError{connString: connString, msg: "invalid port", err: err}
+ return nil, &ParseConfigError{ConnString: connString, msg: "invalid port", err: err}
}
var tlsConfigs []*tls.Config
@@ -348,7 +369,7 @@ func ParseConfigWithOptions(connString string, options ParseConfigOptions) (*Con
var err error
tlsConfigs, err = configTLS(settings, host, options)
if err != nil {
- return nil, &parseConfigError{connString: connString, msg: "failed to configure TLS", err: err}
+ return nil, &ParseConfigError{ConnString: connString, msg: "failed to configure TLS", err: err}
}
}
@@ -392,7 +413,7 @@ func ParseConfigWithOptions(connString string, options ParseConfigOptions) (*Con
case "any":
// do nothing
default:
- return nil, &parseConfigError{connString: connString, msg: fmt.Sprintf("unknown target_session_attrs value: %v", tsa)}
+ return nil, &ParseConfigError{ConnString: connString, msg: fmt.Sprintf("unknown target_session_attrs value: %v", tsa)}
}
return config, nil
@@ -446,14 +467,17 @@ func parseEnvSettings() map[string]string {
func parseURLSettings(connString string) (map[string]string, error) {
settings := make(map[string]string)
- url, err := url.Parse(connString)
+ parsedURL, err := url.Parse(connString)
if err != nil {
+ if urlErr := new(url.Error); errors.As(err, &urlErr) {
+ return nil, urlErr.Err
+ }
return nil, err
}
- if url.User != nil {
- settings["user"] = url.User.Username()
- if password, present := url.User.Password(); present {
+ if parsedURL.User != nil {
+ settings["user"] = parsedURL.User.Username()
+ if password, present := parsedURL.User.Password(); present {
settings["password"] = password
}
}
@@ -461,7 +485,7 @@ func parseURLSettings(connString string) (map[string]string, error) {
// Handle multiple host:port's in url.Host by splitting them into host,host,host and port,port,port.
var hosts []string
var ports []string
- for _, host := range strings.Split(url.Host, ",") {
+ for _, host := range strings.Split(parsedURL.Host, ",") {
if host == "" {
continue
}
@@ -487,7 +511,7 @@ func parseURLSettings(connString string) (map[string]string, error) {
settings["port"] = strings.Join(ports, ",")
}
- database := strings.TrimLeft(url.Path, "/")
+ database := strings.TrimLeft(parsedURL.Path, "/")
if database != "" {
settings["database"] = database
}
@@ -496,7 +520,7 @@ func parseURLSettings(connString string) (map[string]string, error) {
"dbname": "database",
}
- for k, v := range url.Query() {
+ for k, v := range parsedURL.Query() {
if k2, present := nameMap[k]; present {
k = k2
}
@@ -513,7 +537,7 @@ func isIPOnly(host string) bool {
var asciiSpace = [256]uint8{'\t': 1, '\n': 1, '\v': 1, '\f': 1, '\r': 1, ' ': 1}
-func parseDSNSettings(s string) (map[string]string, error) {
+func parseKeywordValueSettings(s string) (map[string]string, error) {
settings := make(map[string]string)
nameMap := map[string]string{
@@ -524,7 +548,7 @@ func parseDSNSettings(s string) (map[string]string, error) {
var key, val string
eqIdx := strings.IndexRune(s, '=')
if eqIdx < 0 {
- return nil, errors.New("invalid dsn")
+ return nil, errors.New("invalid keyword/value")
}
key = strings.Trim(s[:eqIdx], " \t\n\r\v\f")
@@ -576,7 +600,7 @@ func parseDSNSettings(s string) (map[string]string, error) {
}
if key == "" {
- return nil, errors.New("invalid dsn")
+ return nil, errors.New("invalid keyword/value")
}
settings[key] = val
@@ -633,6 +657,36 @@ func configTLS(settings map[string]string, thisHost string, parseConfigOptions P
tlsConfig := &tls.Config{}
+ if sslrootcert != "" {
+ var caCertPool *x509.CertPool
+
+ if sslrootcert == "system" {
+ var err error
+
+ caCertPool, err = x509.SystemCertPool()
+ if err != nil {
+ return nil, fmt.Errorf("unable to load system certificate pool: %w", err)
+ }
+
+ sslmode = "verify-full"
+ } else {
+ caCertPool = x509.NewCertPool()
+
+ caPath := sslrootcert
+ caCert, err := os.ReadFile(caPath)
+ if err != nil {
+ return nil, fmt.Errorf("unable to read CA file: %w", err)
+ }
+
+ if !caCertPool.AppendCertsFromPEM(caCert) {
+ return nil, errors.New("unable to add CA to cert pool")
+ }
+ }
+
+ tlsConfig.RootCAs = caCertPool
+ tlsConfig.ClientCAs = caCertPool
+ }
+
switch sslmode {
case "disable":
return []*tls.Config{nil}, nil
@@ -690,33 +744,19 @@ func configTLS(settings map[string]string, thisHost string, parseConfigOptions P
return nil, errors.New("sslmode is invalid")
}
- if sslrootcert != "" {
- caCertPool := x509.NewCertPool()
-
- caPath := sslrootcert
- caCert, err := ioutil.ReadFile(caPath)
- if err != nil {
- return nil, fmt.Errorf("unable to read CA file: %w", err)
- }
-
- if !caCertPool.AppendCertsFromPEM(caCert) {
- return nil, errors.New("unable to add CA to cert pool")
- }
-
- tlsConfig.RootCAs = caCertPool
- tlsConfig.ClientCAs = caCertPool
- }
-
if (sslcert != "" && sslkey == "") || (sslcert == "" && sslkey != "") {
return nil, errors.New(`both "sslcert" and "sslkey" are required`)
}
if sslcert != "" && sslkey != "" {
- buf, err := ioutil.ReadFile(sslkey)
+ buf, err := os.ReadFile(sslkey)
if err != nil {
return nil, fmt.Errorf("unable to read sslkey: %w", err)
}
block, _ := pem.Decode(buf)
+ if block == nil {
+ return nil, errors.New("failed to decode sslkey")
+ }
var pemKey []byte
var decryptedKey []byte
var decryptedError error
@@ -751,7 +791,7 @@ func configTLS(settings map[string]string, thisHost string, parseConfigOptions P
} else {
pemKey = pem.EncodeToMemory(block)
}
- certfile, err := ioutil.ReadFile(sslcert)
+ certfile, err := os.ReadFile(sslcert)
if err != nil {
return nil, fmt.Errorf("unable to read cert: %w", err)
}
@@ -793,25 +833,14 @@ func parsePort(s string) (uint16, error) {
}
func makeDefaultDialer() *net.Dialer {
- return &net.Dialer{KeepAlive: 5 * time.Minute}
+ // rely on GOLANG KeepAlive settings
+ return &net.Dialer{}
}
func makeDefaultResolver() *net.Resolver {
return net.DefaultResolver
}
-func makeDefaultBuildFrontendFunc(minBufferLen int) BuildFrontendFunc {
- return func(r io.Reader, w io.Writer) Frontend {
- cr, err := chunkreader.NewConfig(r, chunkreader.Config{MinBufLen: minBufferLen})
- if err != nil {
- panic(fmt.Sprintf("BUG: chunkreader.NewConfig failed: %v", err))
- }
- frontend := pgproto3.NewFrontend(cr, w)
-
- return frontend
- }
-}
-
func parseConnectTimeoutSetting(s string) (time.Duration, error) {
timeout, err := strconv.ParseInt(s, 10, 64)
if err != nil {
@@ -829,75 +858,75 @@ func makeConnectTimeoutDialFunc(timeout time.Duration) DialFunc {
return d.DialContext
}
-// ValidateConnectTargetSessionAttrsReadWrite is an ValidateConnectFunc that implements libpq compatible
+// ValidateConnectTargetSessionAttrsReadWrite is a ValidateConnectFunc that implements libpq compatible
// target_session_attrs=read-write.
func ValidateConnectTargetSessionAttrsReadWrite(ctx context.Context, pgConn *PgConn) error {
- result := pgConn.ExecParams(ctx, "show transaction_read_only", nil, nil, nil, nil).Read()
- if result.Err != nil {
- return result.Err
+ result, err := pgConn.Exec(ctx, "show transaction_read_only").ReadAll()
+ if err != nil {
+ return err
}
- if string(result.Rows[0][0]) == "on" {
+ if string(result[0].Rows[0][0]) == "on" {
return errors.New("read only connection")
}
return nil
}
-// ValidateConnectTargetSessionAttrsReadOnly is an ValidateConnectFunc that implements libpq compatible
+// ValidateConnectTargetSessionAttrsReadOnly is a ValidateConnectFunc that implements libpq compatible
// target_session_attrs=read-only.
func ValidateConnectTargetSessionAttrsReadOnly(ctx context.Context, pgConn *PgConn) error {
- result := pgConn.ExecParams(ctx, "show transaction_read_only", nil, nil, nil, nil).Read()
- if result.Err != nil {
- return result.Err
+ result, err := pgConn.Exec(ctx, "show transaction_read_only").ReadAll()
+ if err != nil {
+ return err
}
- if string(result.Rows[0][0]) != "on" {
+ if string(result[0].Rows[0][0]) != "on" {
return errors.New("connection is not read only")
}
return nil
}
-// ValidateConnectTargetSessionAttrsStandby is an ValidateConnectFunc that implements libpq compatible
+// ValidateConnectTargetSessionAttrsStandby is a ValidateConnectFunc that implements libpq compatible
// target_session_attrs=standby.
func ValidateConnectTargetSessionAttrsStandby(ctx context.Context, pgConn *PgConn) error {
- result := pgConn.ExecParams(ctx, "select pg_is_in_recovery()", nil, nil, nil, nil).Read()
- if result.Err != nil {
- return result.Err
+ result, err := pgConn.Exec(ctx, "select pg_is_in_recovery()").ReadAll()
+ if err != nil {
+ return err
}
- if string(result.Rows[0][0]) != "t" {
+ if string(result[0].Rows[0][0]) != "t" {
return errors.New("server is not in hot standby mode")
}
return nil
}
-// ValidateConnectTargetSessionAttrsPrimary is an ValidateConnectFunc that implements libpq compatible
+// ValidateConnectTargetSessionAttrsPrimary is a ValidateConnectFunc that implements libpq compatible
// target_session_attrs=primary.
func ValidateConnectTargetSessionAttrsPrimary(ctx context.Context, pgConn *PgConn) error {
- result := pgConn.ExecParams(ctx, "select pg_is_in_recovery()", nil, nil, nil, nil).Read()
- if result.Err != nil {
- return result.Err
+ result, err := pgConn.Exec(ctx, "select pg_is_in_recovery()").ReadAll()
+ if err != nil {
+ return err
}
- if string(result.Rows[0][0]) == "t" {
+ if string(result[0].Rows[0][0]) == "t" {
return errors.New("server is in standby mode")
}
return nil
}
-// ValidateConnectTargetSessionAttrsPreferStandby is an ValidateConnectFunc that implements libpq compatible
+// ValidateConnectTargetSessionAttrsPreferStandby is a ValidateConnectFunc that implements libpq compatible
// target_session_attrs=prefer-standby.
func ValidateConnectTargetSessionAttrsPreferStandby(ctx context.Context, pgConn *PgConn) error {
- result := pgConn.ExecParams(ctx, "select pg_is_in_recovery()", nil, nil, nil, nil).Read()
- if result.Err != nil {
- return result.Err
+ result, err := pgConn.Exec(ctx, "select pg_is_in_recovery()").ReadAll()
+ if err != nil {
+ return err
}
- if string(result.Rows[0][0]) != "t" {
+ if string(result[0].Rows[0][0]) != "t" {
return &NotPreferredError{err: errors.New("server is not in hot standby mode")}
}
diff --git a/vendor/github.com/jackc/pgconn/internal/ctxwatch/context_watcher.go b/vendor/github.com/jackc/pgx/v5/pgconn/ctxwatch/context_watcher.go
index b39cb3e..db8884e 100644
--- a/vendor/github.com/jackc/pgconn/internal/ctxwatch/context_watcher.go
+++ b/vendor/github.com/jackc/pgx/v5/pgconn/ctxwatch/context_watcher.go
@@ -8,9 +8,8 @@ import (
// ContextWatcher watches a context and performs an action when the context is canceled. It can watch one context at a
// time.
type ContextWatcher struct {
- onCancel func()
- onUnwatchAfterCancel func()
- unwatchChan chan struct{}
+ handler Handler
+ unwatchChan chan struct{}
lock sync.Mutex
watchInProgress bool
@@ -20,11 +19,10 @@ type ContextWatcher struct {
// NewContextWatcher returns a ContextWatcher. onCancel will be called when a watched context is canceled.
// OnUnwatchAfterCancel will be called when Unwatch is called and the watched context had already been canceled and
// onCancel called.
-func NewContextWatcher(onCancel func(), onUnwatchAfterCancel func()) *ContextWatcher {
+func NewContextWatcher(handler Handler) *ContextWatcher {
cw := &ContextWatcher{
- onCancel: onCancel,
- onUnwatchAfterCancel: onUnwatchAfterCancel,
- unwatchChan: make(chan struct{}),
+ handler: handler,
+ unwatchChan: make(chan struct{}),
}
return cw
@@ -46,7 +44,7 @@ func (cw *ContextWatcher) Watch(ctx context.Context) {
go func() {
select {
case <-ctx.Done():
- cw.onCancel()
+ cw.handler.HandleCancel(ctx)
cw.onCancelWasCalled = true
<-cw.unwatchChan
case <-cw.unwatchChan:
@@ -66,8 +64,17 @@ func (cw *ContextWatcher) Unwatch() {
if cw.watchInProgress {
cw.unwatchChan <- struct{}{}
if cw.onCancelWasCalled {
- cw.onUnwatchAfterCancel()
+ cw.handler.HandleUnwatchAfterCancel()
}
cw.watchInProgress = false
}
}
+
+type Handler interface {
+ // HandleCancel is called when the context that a ContextWatcher is currently watching is canceled. canceledCtx is the
+ // context that was canceled.
+ HandleCancel(canceledCtx context.Context)
+
+ // HandleUnwatchAfterCancel is called when a ContextWatcher that called HandleCancel on this Handler is unwatched.
+ HandleUnwatchAfterCancel()
+}
diff --git a/vendor/github.com/jackc/pgconn/defaults.go b/vendor/github.com/jackc/pgx/v5/pgconn/defaults.go
index c7209fd..1dd514f 100644
--- a/vendor/github.com/jackc/pgconn/defaults.go
+++ b/vendor/github.com/jackc/pgx/v5/pgconn/defaults.go
@@ -40,8 +40,6 @@ func defaultSettings() map[string]string {
settings["target_session_attrs"] = "any"
- settings["min_read_buffer_size"] = "8192"
-
return settings
}
diff --git a/vendor/github.com/jackc/pgconn/defaults_windows.go b/vendor/github.com/jackc/pgx/v5/pgconn/defaults_windows.go
index 71eb77d..33b4a1f 100644
--- a/vendor/github.com/jackc/pgconn/defaults_windows.go
+++ b/vendor/github.com/jackc/pgx/v5/pgconn/defaults_windows.go
@@ -46,8 +46,6 @@ func defaultSettings() map[string]string {
settings["target_session_attrs"] = "any"
- settings["min_read_buffer_size"] = "8192"
-
return settings
}
diff --git a/vendor/github.com/jackc/pgx/v5/pgconn/doc.go b/vendor/github.com/jackc/pgx/v5/pgconn/doc.go
new file mode 100644
index 0000000..7013750
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgconn/doc.go
@@ -0,0 +1,38 @@
+// Package pgconn is a low-level PostgreSQL database driver.
+/*
+pgconn provides lower level access to a PostgreSQL connection than a database/sql or pgx connection. It operates at
+nearly the same level is the C library libpq.
+
+Establishing a Connection
+
+Use Connect to establish a connection. It accepts a connection string in URL or keyword/value format and will read the
+environment for libpq style environment variables.
+
+Executing a Query
+
+ExecParams and ExecPrepared execute a single query. They return readers that iterate over each row. The Read method
+reads all rows into memory.
+
+Executing Multiple Queries in a Single Round Trip
+
+Exec and ExecBatch can execute multiple queries in a single round trip. They return readers that iterate over each query
+result. The ReadAll method reads all query results into memory.
+
+Pipeline Mode
+
+Pipeline mode allows sending queries without having read the results of previously sent queries. It allows control of
+exactly how many and when network round trips occur.
+
+Context Support
+
+All potentially blocking operations take a context.Context. The default behavior when a context is canceled is for the
+method to immediately return. In most circumstances, this will also close the underlying connection. This behavior can
+be customized by using BuildContextWatcherHandler on the Config to create a ctxwatch.Handler with different behavior.
+This can be especially useful when queries that are frequently canceled and the overhead of creating new connections is
+a problem. DeadlineContextWatcherHandler and CancelRequestContextWatcherHandler can be used to introduce a delay before
+interrupting the query in such a way as to close the connection.
+
+The CancelRequest method may be used to request the PostgreSQL server cancel an in-progress query without forcing the
+client to abort.
+*/
+package pgconn
diff --git a/vendor/github.com/jackc/pgconn/errors.go b/vendor/github.com/jackc/pgx/v5/pgconn/errors.go
index 66d3558..ec4a6d4 100644
--- a/vendor/github.com/jackc/pgconn/errors.go
+++ b/vendor/github.com/jackc/pgx/v5/pgconn/errors.go
@@ -12,14 +12,15 @@ import (
// SafeToRetry checks if the err is guaranteed to have occurred before sending any data to the server.
func SafeToRetry(err error) bool {
- if e, ok := err.(interface{ SafeToRetry() bool }); ok {
- return e.SafeToRetry()
+ var retryableErr interface{ SafeToRetry() bool }
+ if errors.As(err, &retryableErr) {
+ return retryableErr.SafeToRetry()
}
return false
}
-// Timeout checks if err was was caused by a timeout. To be specific, it is true if err was caused within pgconn by a
-// context.Canceled, context.DeadlineExceeded or an implementer of net.Error where Timeout() is true.
+// Timeout checks if err was caused by a timeout. To be specific, it is true if err was caused within pgconn by a
+// context.DeadlineExceeded or an implementer of net.Error where Timeout() is true.
func Timeout(err error) bool {
var timeoutErr *errTimeout
return errors.As(err, &timeoutErr)
@@ -29,23 +30,24 @@ func Timeout(err error) bool {
// http://www.postgresql.org/docs/11/static/protocol-error-fields.html for
// detailed field description.
type PgError struct {
- Severity string
- Code string
- Message string
- Detail string
- Hint string
- Position int32
- InternalPosition int32
- InternalQuery string
- Where string
- SchemaName string
- TableName string
- ColumnName string
- DataTypeName string
- ConstraintName string
- File string
- Line int32
- Routine string
+ Severity string
+ SeverityUnlocalized string
+ Code string
+ Message string
+ Detail string
+ Hint string
+ Position int32
+ InternalPosition int32
+ InternalQuery string
+ Where string
+ SchemaName string
+ TableName string
+ ColumnName string
+ DataTypeName string
+ ConstraintName string
+ File string
+ Line int32
+ Routine string
}
func (pe *PgError) Error() string {
@@ -57,22 +59,37 @@ func (pe *PgError) SQLState() string {
return pe.Code
}
-type connectError struct {
- config *Config
- msg string
+// ConnectError is the error returned when a connection attempt fails.
+type ConnectError struct {
+ Config *Config // The configuration that was used in the connection attempt.
err error
}
-func (e *connectError) Error() string {
- sb := &strings.Builder{}
- fmt.Fprintf(sb, "failed to connect to `host=%s user=%s database=%s`: %s", e.config.Host, e.config.User, e.config.Database, e.msg)
- if e.err != nil {
- fmt.Fprintf(sb, " (%s)", e.err.Error())
+func (e *ConnectError) Error() string {
+ prefix := fmt.Sprintf("failed to connect to `user=%s database=%s`:", e.Config.User, e.Config.Database)
+ details := e.err.Error()
+ if strings.Contains(details, "\n") {
+ return prefix + "\n\t" + strings.ReplaceAll(details, "\n", "\n\t")
+ } else {
+ return prefix + " " + details
}
- return sb.String()
}
-func (e *connectError) Unwrap() error {
+func (e *ConnectError) Unwrap() error {
+ return e.err
+}
+
+type perDialConnectError struct {
+ address string
+ originalHostname string
+ err error
+}
+
+func (e *perDialConnectError) Error() string {
+ return fmt.Sprintf("%s (%s): %s", e.address, e.originalHostname, e.err.Error())
+}
+
+func (e *perDialConnectError) Unwrap() error {
return e.err
}
@@ -88,29 +105,39 @@ func (e *connLockError) Error() string {
return e.status
}
-type parseConfigError struct {
- connString string
+// ParseConfigError is the error returned when a connection string cannot be parsed.
+type ParseConfigError struct {
+ ConnString string // The connection string that could not be parsed.
msg string
err error
}
-func (e *parseConfigError) Error() string {
- connString := redactPW(e.connString)
+func (e *ParseConfigError) Error() string {
+ // Now that ParseConfigError is public and ConnString is available to the developer, perhaps it would be better only
+ // return a static string. That would ensure that the error message cannot leak a password. The ConnString field would
+ // allow access to the original string if desired and Unwrap would allow access to the underlying error.
+ connString := redactPW(e.ConnString)
if e.err == nil {
return fmt.Sprintf("cannot parse `%s`: %s", connString, e.msg)
}
return fmt.Sprintf("cannot parse `%s`: %s (%s)", connString, e.msg, e.err.Error())
}
-func (e *parseConfigError) Unwrap() error {
+func (e *ParseConfigError) Unwrap() error {
return e.err
}
-// preferContextOverNetTimeoutError returns ctx.Err() if ctx.Err() is present and err is a net.Error with Timeout() ==
-// true. Otherwise returns err.
-func preferContextOverNetTimeoutError(ctx context.Context, err error) error {
- if err, ok := err.(net.Error); ok && err.Timeout() && ctx.Err() != nil {
- return &errTimeout{err: ctx.Err()}
+func normalizeTimeoutError(ctx context.Context, err error) error {
+ var netErr net.Error
+ if errors.As(err, &netErr) && netErr.Timeout() {
+ if ctx.Err() == context.Canceled {
+ // Since the timeout was caused by a context cancellation, the actual error is context.Canceled not the timeout error.
+ return context.Canceled
+ } else if ctx.Err() == context.DeadlineExceeded {
+ return &errTimeout{err: ctx.Err()}
+ } else {
+ return &errTimeout{err: netErr}
+ }
}
return err
}
@@ -178,33 +205,16 @@ func newContextAlreadyDoneError(ctx context.Context) (err error) {
return &errTimeout{&contextAlreadyDoneError{err: ctx.Err()}}
}
-type writeError struct {
- err error
- safeToRetry bool
-}
-
-func (e *writeError) Error() string {
- return fmt.Sprintf("write failed: %s", e.err.Error())
-}
-
-func (e *writeError) SafeToRetry() bool {
- return e.safeToRetry
-}
-
-func (e *writeError) Unwrap() error {
- return e.err
-}
-
func redactPW(connString string) string {
if strings.HasPrefix(connString, "postgres://") || strings.HasPrefix(connString, "postgresql://") {
if u, err := url.Parse(connString); err == nil {
return redactURL(u)
}
}
- quotedDSN := regexp.MustCompile(`password='[^']*'`)
- connString = quotedDSN.ReplaceAllLiteralString(connString, "password=xxxxx")
- plainDSN := regexp.MustCompile(`password=[^ ]*`)
- connString = plainDSN.ReplaceAllLiteralString(connString, "password=xxxxx")
+ quotedKV := regexp.MustCompile(`password='[^']*'`)
+ connString = quotedKV.ReplaceAllLiteralString(connString, "password=xxxxx")
+ plainKV := regexp.MustCompile(`password=[^ ]*`)
+ connString = plainKV.ReplaceAllLiteralString(connString, "password=xxxxx")
brokenURL := regexp.MustCompile(`:[^:@]+?@`)
connString = brokenURL.ReplaceAllLiteralString(connString, ":xxxxxx@")
return connString
diff --git a/vendor/github.com/jackc/pgx/v5/pgconn/internal/bgreader/bgreader.go b/vendor/github.com/jackc/pgx/v5/pgconn/internal/bgreader/bgreader.go
new file mode 100644
index 0000000..e65c2c2
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgconn/internal/bgreader/bgreader.go
@@ -0,0 +1,139 @@
+// Package bgreader provides a io.Reader that can optionally buffer reads in the background.
+package bgreader
+
+import (
+ "io"
+ "sync"
+
+ "github.com/jackc/pgx/v5/internal/iobufpool"
+)
+
+const (
+ StatusStopped = iota
+ StatusRunning
+ StatusStopping
+)
+
+// BGReader is an io.Reader that can optionally buffer reads in the background. It is safe for concurrent use.
+type BGReader struct {
+ r io.Reader
+
+ cond *sync.Cond
+ status int32
+ readResults []readResult
+}
+
+type readResult struct {
+ buf *[]byte
+ err error
+}
+
+// Start starts the backgrounder reader. If the background reader is already running this is a no-op. The background
+// reader will stop automatically when the underlying reader returns an error.
+func (r *BGReader) Start() {
+ r.cond.L.Lock()
+ defer r.cond.L.Unlock()
+
+ switch r.status {
+ case StatusStopped:
+ r.status = StatusRunning
+ go r.bgRead()
+ case StatusRunning:
+ // no-op
+ case StatusStopping:
+ r.status = StatusRunning
+ }
+}
+
+// Stop tells the background reader to stop after the in progress Read returns. It is safe to call Stop when the
+// background reader is not running.
+func (r *BGReader) Stop() {
+ r.cond.L.Lock()
+ defer r.cond.L.Unlock()
+
+ switch r.status {
+ case StatusStopped:
+ // no-op
+ case StatusRunning:
+ r.status = StatusStopping
+ case StatusStopping:
+ // no-op
+ }
+}
+
+// Status returns the current status of the background reader.
+func (r *BGReader) Status() int32 {
+ r.cond.L.Lock()
+ defer r.cond.L.Unlock()
+ return r.status
+}
+
+func (r *BGReader) bgRead() {
+ keepReading := true
+ for keepReading {
+ buf := iobufpool.Get(8192)
+ n, err := r.r.Read(*buf)
+ *buf = (*buf)[:n]
+
+ r.cond.L.Lock()
+ r.readResults = append(r.readResults, readResult{buf: buf, err: err})
+ if r.status == StatusStopping || err != nil {
+ r.status = StatusStopped
+ keepReading = false
+ }
+ r.cond.L.Unlock()
+ r.cond.Broadcast()
+ }
+}
+
+// Read implements the io.Reader interface.
+func (r *BGReader) Read(p []byte) (int, error) {
+ r.cond.L.Lock()
+ defer r.cond.L.Unlock()
+
+ if len(r.readResults) > 0 {
+ return r.readFromReadResults(p)
+ }
+
+ // There are no unread background read results and the background reader is stopped.
+ if r.status == StatusStopped {
+ return r.r.Read(p)
+ }
+
+ // Wait for results from the background reader
+ for len(r.readResults) == 0 {
+ r.cond.Wait()
+ }
+ return r.readFromReadResults(p)
+}
+
+// readBackgroundResults reads a result previously read by the background reader. r.cond.L must be held.
+func (r *BGReader) readFromReadResults(p []byte) (int, error) {
+ buf := r.readResults[0].buf
+ var err error
+
+ n := copy(p, *buf)
+ if n == len(*buf) {
+ err = r.readResults[0].err
+ iobufpool.Put(buf)
+ if len(r.readResults) == 1 {
+ r.readResults = nil
+ } else {
+ r.readResults = r.readResults[1:]
+ }
+ } else {
+ *buf = (*buf)[n:]
+ r.readResults[0].buf = buf
+ }
+
+ return n, err
+}
+
+func New(r io.Reader) *BGReader {
+ return &BGReader{
+ r: r,
+ cond: &sync.Cond{
+ L: &sync.Mutex{},
+ },
+ }
+}
diff --git a/vendor/github.com/jackc/pgconn/krb5.go b/vendor/github.com/jackc/pgx/v5/pgconn/krb5.go
index 08427b8..3c1af34 100644
--- a/vendor/github.com/jackc/pgconn/krb5.go
+++ b/vendor/github.com/jackc/pgx/v5/pgconn/krb5.go
@@ -4,7 +4,7 @@ import (
"errors"
"fmt"
- "github.com/jackc/pgproto3/v2"
+ "github.com/jackc/pgx/v5/pgproto3"
)
// NewGSSFunc creates a GSS authentication provider, for use with
@@ -62,7 +62,8 @@ func (c *PgConn) gssAuth() error {
gssResponse := &pgproto3.GSSResponse{
Data: nextData,
}
- _, err = c.conn.Write(gssResponse.Encode(nil))
+ c.frontend.Send(gssResponse)
+ err = c.flushWithPotentialWriteReadDeadlock()
if err != nil {
return err
}
diff --git a/vendor/github.com/jackc/pgconn/pgconn.go b/vendor/github.com/jackc/pgx/v5/pgconn/pgconn.go
index 6601194..7efb522 100644
--- a/vendor/github.com/jackc/pgconn/pgconn.go
+++ b/vendor/github.com/jackc/pgx/v5/pgconn/pgconn.go
@@ -16,9 +16,11 @@ import (
"sync"
"time"
- "github.com/jackc/pgconn/internal/ctxwatch"
- "github.com/jackc/pgio"
- "github.com/jackc/pgproto3/v2"
+ "github.com/jackc/pgx/v5/internal/iobufpool"
+ "github.com/jackc/pgx/v5/internal/pgio"
+ "github.com/jackc/pgx/v5/pgconn/ctxwatch"
+ "github.com/jackc/pgx/v5/pgconn/internal/bgreader"
+ "github.com/jackc/pgx/v5/pgproto3"
)
const (
@@ -29,8 +31,6 @@ const (
connStatusBusy
)
-const wbufLen = 1024
-
// Notice represents a notice response message reported by the PostgreSQL server. Be aware that this is distinct from
// LISTEN/NOTIFY notification.
type Notice PgError
@@ -50,7 +50,13 @@ type DialFunc func(ctx context.Context, network, addr string) (net.Conn, error)
type LookupFunc func(ctx context.Context, host string) (addrs []string, err error)
// BuildFrontendFunc is a function that can be used to create Frontend implementation for connection.
-type BuildFrontendFunc func(r io.Reader, w io.Writer) Frontend
+type BuildFrontendFunc func(r io.Reader, w io.Writer) *pgproto3.Frontend
+
+// PgErrorHandler is a function that handles errors returned from Postgres. This function must return true to keep
+// the connection open. Returning false will cause the connection to be closed immediately. You should return
+// false on any FATAL-severity errors. This will not receive network errors. The *PgConn is provided so the handler is
+// aware of the origin of the error, but it must not invoke any query method.
+type PgErrorHandler func(*PgConn, *PgError) bool
// NoticeHandler is a function that can handle notices received from the PostgreSQL server. Notices can be received at
// any time, usually during handling of a query response. The *PgConn is provided so the handler is aware of the origin
@@ -64,19 +70,19 @@ type NoticeHandler func(*PgConn, *Notice)
// notice event.
type NotificationHandler func(*PgConn, *Notification)
-// Frontend used to receive messages from backend.
-type Frontend interface {
- Receive() (pgproto3.BackendMessage, error)
-}
-
// PgConn is a low-level PostgreSQL connection handle. It is not safe for concurrent usage.
type PgConn struct {
- conn net.Conn // the underlying TCP or unix domain socket connection
+ conn net.Conn
pid uint32 // backend pid
secretKey uint32 // key to use to send a cancel query message to the server
parameterStatuses map[string]string // parameters that have been reported by the server
txStatus byte
- frontend Frontend
+ frontend *pgproto3.Frontend
+ bgReader *bgreader.BGReader
+ slowWriteTimer *time.Timer
+ bgReaderStarted chan struct{}
+
+ customData map[string]any
config *Config
@@ -90,16 +96,18 @@ type PgConn struct {
peekedMsg pgproto3.BackendMessage
// Reusable / preallocated resources
- wbuf []byte // write buffer
resultReader ResultReader
multiResultReader MultiResultReader
+ pipeline Pipeline
contextWatcher *ctxwatch.ContextWatcher
+ fieldDescriptions [16]FieldDescription
cleanupDone chan struct{}
}
-// Connect establishes a connection to a PostgreSQL server using the environment and connString (in URL or DSN format)
-// to provide configuration. See documentation for ParseConfig for details. ctx can be used to cancel a connect attempt.
+// Connect establishes a connection to a PostgreSQL server using the environment and connString (in URL or keyword/value
+// format) to provide configuration. See documentation for [ParseConfig] for details. ctx can be used to cancel a
+// connect attempt.
func Connect(ctx context.Context, connString string) (*PgConn, error) {
config, err := ParseConfig(connString)
if err != nil {
@@ -109,9 +117,9 @@ func Connect(ctx context.Context, connString string) (*PgConn, error) {
return ConnectConfig(ctx, config)
}
-// Connect establishes a connection to a PostgreSQL server using the environment and connString (in URL or DSN format)
-// and ParseConfigOptions to provide additional configuration. See documentation for ParseConfig for details. ctx can be
-// used to cancel a connect attempt.
+// Connect establishes a connection to a PostgreSQL server using the environment and connString (in URL or keyword/value
+// format) and ParseConfigOptions to provide additional configuration. See documentation for [ParseConfig] for details.
+// ctx can be used to cancel a connect attempt.
func ConnectWithOptions(ctx context.Context, connString string, parseConfigOptions ParseConfigOptions) (*PgConn, error) {
config, err := ParseConfigWithOptions(connString, parseConfigOptions)
if err != nil {
@@ -122,112 +130,82 @@ func ConnectWithOptions(ctx context.Context, connString string, parseConfigOptio
}
// Connect establishes a connection to a PostgreSQL server using config. config must have been constructed with
-// ParseConfig. ctx can be used to cancel a connect attempt.
+// [ParseConfig]. ctx can be used to cancel a connect attempt.
//
// If config.Fallbacks are present they will sequentially be tried in case of error establishing network connection. An
// authentication error will terminate the chain of attempts (like libpq:
-// https://www.postgresql.org/docs/11/libpq-connect.html#LIBPQ-MULTIPLE-HOSTS) and be returned as the error. Otherwise,
-// if all attempts fail the last error is returned.
-func ConnectConfig(octx context.Context, config *Config) (pgConn *PgConn, err error) {
+// https://www.postgresql.org/docs/11/libpq-connect.html#LIBPQ-MULTIPLE-HOSTS) and be returned as the error.
+func ConnectConfig(ctx context.Context, config *Config) (*PgConn, error) {
// Default values are set in ParseConfig. Enforce initial creation by ParseConfig rather than setting defaults from
// zero values.
if !config.createdByParseConfig {
panic("config must be created by ParseConfig")
}
- // Simplify usage by treating primary config and fallbacks the same.
- fallbackConfigs := []*FallbackConfig{
- {
- Host: config.Host,
- Port: config.Port,
- TLSConfig: config.TLSConfig,
- },
- }
- fallbackConfigs = append(fallbackConfigs, config.Fallbacks...)
- ctx := octx
- fallbackConfigs, err = expandWithIPs(ctx, config.LookupFunc, fallbackConfigs)
- if err != nil {
- return nil, &connectError{config: config, msg: "hostname resolving error", err: err}
- }
-
- if len(fallbackConfigs) == 0 {
- return nil, &connectError{config: config, msg: "hostname resolving error", err: errors.New("ip addr wasn't found")}
- }
+ var allErrors []error
- foundBestServer := false
- var fallbackConfig *FallbackConfig
- for _, fc := range fallbackConfigs {
- // ConnectTimeout restricts the whole connection process.
- if config.ConnectTimeout != 0 {
- var cancel context.CancelFunc
- ctx, cancel = context.WithTimeout(octx, config.ConnectTimeout)
- defer cancel()
- } else {
- ctx = octx
- }
- pgConn, err = connect(ctx, config, fc, false)
- if err == nil {
- foundBestServer = true
- break
- } else if pgerr, ok := err.(*PgError); ok {
- err = &connectError{config: config, msg: "server error", err: pgerr}
- const ERRCODE_INVALID_PASSWORD = "28P01" // wrong password
- const ERRCODE_INVALID_AUTHORIZATION_SPECIFICATION = "28000" // wrong password or bad pg_hba.conf settings
- const ERRCODE_INVALID_CATALOG_NAME = "3D000" // db does not exist
- const ERRCODE_INSUFFICIENT_PRIVILEGE = "42501" // missing connect privilege
- if pgerr.Code == ERRCODE_INVALID_PASSWORD ||
- pgerr.Code == ERRCODE_INVALID_AUTHORIZATION_SPECIFICATION ||
- pgerr.Code == ERRCODE_INVALID_CATALOG_NAME ||
- pgerr.Code == ERRCODE_INSUFFICIENT_PRIVILEGE {
- break
- }
- } else if cerr, ok := err.(*connectError); ok {
- if _, ok := cerr.err.(*NotPreferredError); ok {
- fallbackConfig = fc
- }
- }
+ connectConfigs, errs := buildConnectOneConfigs(ctx, config)
+ if len(errs) > 0 {
+ allErrors = append(allErrors, errs...)
}
- if !foundBestServer && fallbackConfig != nil {
- pgConn, err = connect(ctx, config, fallbackConfig, true)
- if pgerr, ok := err.(*PgError); ok {
- err = &connectError{config: config, msg: "server error", err: pgerr}
- }
+ if len(connectConfigs) == 0 {
+ return nil, &ConnectError{Config: config, err: fmt.Errorf("hostname resolving error: %w", errors.Join(allErrors...))}
}
- if err != nil {
- return nil, err // no need to wrap in connectError because it will already be wrapped in all cases except PgError
+ pgConn, errs := connectPreferred(ctx, config, connectConfigs)
+ if len(errs) > 0 {
+ allErrors = append(allErrors, errs...)
+ return nil, &ConnectError{Config: config, err: errors.Join(allErrors...)}
}
if config.AfterConnect != nil {
err := config.AfterConnect(ctx, pgConn)
if err != nil {
pgConn.conn.Close()
- return nil, &connectError{config: config, msg: "AfterConnect error", err: err}
+ return nil, &ConnectError{Config: config, err: fmt.Errorf("AfterConnect error: %w", err)}
}
}
return pgConn, nil
}
-func expandWithIPs(ctx context.Context, lookupFn LookupFunc, fallbacks []*FallbackConfig) ([]*FallbackConfig, error) {
- var configs []*FallbackConfig
+// buildConnectOneConfigs resolves hostnames and builds a list of connectOneConfigs to try connecting to. It returns a
+// slice of successfully resolved connectOneConfigs and a slice of errors. It is possible for both slices to contain
+// values if some hosts were successfully resolved and others were not.
+func buildConnectOneConfigs(ctx context.Context, config *Config) ([]*connectOneConfig, []error) {
+ // Simplify usage by treating primary config and fallbacks the same.
+ fallbackConfigs := []*FallbackConfig{
+ {
+ Host: config.Host,
+ Port: config.Port,
+ TLSConfig: config.TLSConfig,
+ },
+ }
+ fallbackConfigs = append(fallbackConfigs, config.Fallbacks...)
+
+ var configs []*connectOneConfig
- for _, fb := range fallbacks {
+ var allErrors []error
+
+ for _, fb := range fallbackConfigs {
// skip resolve for unix sockets
if isAbsolutePath(fb.Host) {
- configs = append(configs, &FallbackConfig{
- Host: fb.Host,
- Port: fb.Port,
- TLSConfig: fb.TLSConfig,
+ network, address := NetworkAddress(fb.Host, fb.Port)
+ configs = append(configs, &connectOneConfig{
+ network: network,
+ address: address,
+ originalHostname: fb.Host,
+ tlsConfig: fb.TLSConfig,
})
continue
}
- ips, err := lookupFn(ctx, fb.Host)
+ ips, err := config.LookupFunc(ctx, fb.Host)
if err != nil {
- return nil, err
+ allErrors = append(allErrors, err)
+ continue
}
for _, ip := range ips {
@@ -235,66 +213,140 @@ func expandWithIPs(ctx context.Context, lookupFn LookupFunc, fallbacks []*Fallba
if err == nil {
port, err := strconv.ParseUint(splitPort, 10, 16)
if err != nil {
- return nil, fmt.Errorf("error parsing port (%s) from lookup: %w", splitPort, err)
+ return nil, []error{fmt.Errorf("error parsing port (%s) from lookup: %w", splitPort, err)}
}
- configs = append(configs, &FallbackConfig{
- Host: splitIP,
- Port: uint16(port),
- TLSConfig: fb.TLSConfig,
+ network, address := NetworkAddress(splitIP, uint16(port))
+ configs = append(configs, &connectOneConfig{
+ network: network,
+ address: address,
+ originalHostname: fb.Host,
+ tlsConfig: fb.TLSConfig,
})
} else {
- configs = append(configs, &FallbackConfig{
- Host: ip,
- Port: fb.Port,
- TLSConfig: fb.TLSConfig,
+ network, address := NetworkAddress(ip, fb.Port)
+ configs = append(configs, &connectOneConfig{
+ network: network,
+ address: address,
+ originalHostname: fb.Host,
+ tlsConfig: fb.TLSConfig,
})
}
}
}
- return configs, nil
+ return configs, allErrors
+}
+
+// connectPreferred attempts to connect to the preferred host from connectOneConfigs. The connections are attempted in
+// order. If a connection is successful it is returned. If no connection is successful then all errors are returned. If
+// a connection attempt returns a [NotPreferredError], then that host will be used if no other hosts are successful.
+func connectPreferred(ctx context.Context, config *Config, connectOneConfigs []*connectOneConfig) (*PgConn, []error) {
+ octx := ctx
+ var allErrors []error
+
+ var fallbackConnectOneConfig *connectOneConfig
+ for i, c := range connectOneConfigs {
+ // ConnectTimeout restricts the whole connection process.
+ if config.ConnectTimeout != 0 {
+ // create new context first time or when previous host was different
+ if i == 0 || (connectOneConfigs[i].address != connectOneConfigs[i-1].address) {
+ var cancel context.CancelFunc
+ ctx, cancel = context.WithTimeout(octx, config.ConnectTimeout)
+ defer cancel()
+ }
+ } else {
+ ctx = octx
+ }
+
+ pgConn, err := connectOne(ctx, config, c, false)
+ if pgConn != nil {
+ return pgConn, nil
+ }
+
+ allErrors = append(allErrors, err)
+
+ var pgErr *PgError
+ if errors.As(err, &pgErr) {
+ const ERRCODE_INVALID_PASSWORD = "28P01" // wrong password
+ const ERRCODE_INVALID_AUTHORIZATION_SPECIFICATION = "28000" // wrong password or bad pg_hba.conf settings
+ const ERRCODE_INVALID_CATALOG_NAME = "3D000" // db does not exist
+ const ERRCODE_INSUFFICIENT_PRIVILEGE = "42501" // missing connect privilege
+ if pgErr.Code == ERRCODE_INVALID_PASSWORD ||
+ pgErr.Code == ERRCODE_INVALID_AUTHORIZATION_SPECIFICATION && c.tlsConfig != nil ||
+ pgErr.Code == ERRCODE_INVALID_CATALOG_NAME ||
+ pgErr.Code == ERRCODE_INSUFFICIENT_PRIVILEGE {
+ return nil, allErrors
+ }
+ }
+
+ var npErr *NotPreferredError
+ if errors.As(err, &npErr) {
+ fallbackConnectOneConfig = c
+ }
+ }
+
+ if fallbackConnectOneConfig != nil {
+ pgConn, err := connectOne(ctx, config, fallbackConnectOneConfig, true)
+ if err == nil {
+ return pgConn, nil
+ }
+ allErrors = append(allErrors, err)
+ }
+
+ return nil, allErrors
}
-func connect(ctx context.Context, config *Config, fallbackConfig *FallbackConfig,
- ignoreNotPreferredErr bool) (*PgConn, error) {
+// connectOne makes one connection attempt to a single host.
+func connectOne(ctx context.Context, config *Config, connectConfig *connectOneConfig,
+ ignoreNotPreferredErr bool,
+) (*PgConn, error) {
pgConn := new(PgConn)
pgConn.config = config
- pgConn.wbuf = make([]byte, 0, wbufLen)
pgConn.cleanupDone = make(chan struct{})
+ pgConn.customData = make(map[string]any)
var err error
- network, address := NetworkAddress(fallbackConfig.Host, fallbackConfig.Port)
- netConn, err := config.DialFunc(ctx, network, address)
- if err != nil {
- var netErr net.Error
- if errors.As(err, &netErr) && netErr.Timeout() {
- err = &errTimeout{err: err}
- }
- return nil, &connectError{config: config, msg: "dial error", err: err}
+
+ newPerDialConnectError := func(msg string, err error) *perDialConnectError {
+ err = normalizeTimeoutError(ctx, err)
+ e := &perDialConnectError{address: connectConfig.address, originalHostname: connectConfig.originalHostname, err: fmt.Errorf("%s: %w", msg, err)}
+ return e
}
- pgConn.conn = netConn
- pgConn.contextWatcher = newContextWatcher(netConn)
- pgConn.contextWatcher.Watch(ctx)
+ pgConn.conn, err = config.DialFunc(ctx, connectConfig.network, connectConfig.address)
+ if err != nil {
+ return nil, newPerDialConnectError("dial error", err)
+ }
- if fallbackConfig.TLSConfig != nil {
- tlsConn, err := startTLS(netConn, fallbackConfig.TLSConfig)
+ if connectConfig.tlsConfig != nil {
+ pgConn.contextWatcher = ctxwatch.NewContextWatcher(&DeadlineContextWatcherHandler{Conn: pgConn.conn})
+ pgConn.contextWatcher.Watch(ctx)
+ tlsConn, err := startTLS(pgConn.conn, connectConfig.tlsConfig)
pgConn.contextWatcher.Unwatch() // Always unwatch `netConn` after TLS.
if err != nil {
- netConn.Close()
- return nil, &connectError{config: config, msg: "tls error", err: err}
+ pgConn.conn.Close()
+ return nil, newPerDialConnectError("tls error", err)
}
pgConn.conn = tlsConn
- pgConn.contextWatcher = newContextWatcher(tlsConn)
- pgConn.contextWatcher.Watch(ctx)
}
+ pgConn.contextWatcher = ctxwatch.NewContextWatcher(config.BuildContextWatcherHandler(pgConn))
+ pgConn.contextWatcher.Watch(ctx)
defer pgConn.contextWatcher.Unwatch()
pgConn.parameterStatuses = make(map[string]string)
pgConn.status = connStatusConnecting
- pgConn.frontend = config.BuildFrontend(pgConn.conn, pgConn.conn)
+ pgConn.bgReader = bgreader.New(pgConn.conn)
+ pgConn.slowWriteTimer = time.AfterFunc(time.Duration(math.MaxInt64),
+ func() {
+ pgConn.bgReader.Start()
+ pgConn.bgReaderStarted <- struct{}{}
+ },
+ )
+ pgConn.slowWriteTimer.Stop()
+ pgConn.bgReaderStarted = make(chan struct{})
+ pgConn.frontend = config.BuildFrontend(pgConn.bgReader, pgConn.conn)
startupMsg := pgproto3.StartupMessage{
ProtocolVersion: pgproto3.ProtocolVersionNumber,
@@ -311,9 +363,10 @@ func connect(ctx context.Context, config *Config, fallbackConfig *FallbackConfig
startupMsg.Parameters["database"] = config.Database
}
- if _, err := pgConn.conn.Write(startupMsg.Encode(pgConn.wbuf)); err != nil {
+ pgConn.frontend.Send(&startupMsg)
+ if err := pgConn.flushWithPotentialWriteReadDeadlock(); err != nil {
pgConn.conn.Close()
- return nil, &connectError{config: config, msg: "failed to write startup message", err: err}
+ return nil, newPerDialConnectError("failed to write startup message", err)
}
for {
@@ -321,9 +374,9 @@ func connect(ctx context.Context, config *Config, fallbackConfig *FallbackConfig
if err != nil {
pgConn.conn.Close()
if err, ok := err.(*PgError); ok {
- return nil, err
+ return nil, newPerDialConnectError("server error", err)
}
- return nil, &connectError{config: config, msg: "failed to receive message", err: preferContextOverNetTimeoutError(ctx, err)}
+ return nil, newPerDialConnectError("failed to receive message", err)
}
switch msg := msg.(type) {
@@ -336,26 +389,26 @@ func connect(ctx context.Context, config *Config, fallbackConfig *FallbackConfig
err = pgConn.txPasswordMessage(pgConn.config.Password)
if err != nil {
pgConn.conn.Close()
- return nil, &connectError{config: config, msg: "failed to write password message", err: err}
+ return nil, newPerDialConnectError("failed to write password message", err)
}
case *pgproto3.AuthenticationMD5Password:
digestedPassword := "md5" + hexMD5(hexMD5(pgConn.config.Password+pgConn.config.User)+string(msg.Salt[:]))
err = pgConn.txPasswordMessage(digestedPassword)
if err != nil {
pgConn.conn.Close()
- return nil, &connectError{config: config, msg: "failed to write password message", err: err}
+ return nil, newPerDialConnectError("failed to write password message", err)
}
case *pgproto3.AuthenticationSASL:
err = pgConn.scramAuth(msg.AuthMechanisms)
if err != nil {
pgConn.conn.Close()
- return nil, &connectError{config: config, msg: "failed SASL auth", err: err}
+ return nil, newPerDialConnectError("failed SASL auth", err)
}
case *pgproto3.AuthenticationGSS:
err = pgConn.gssAuth()
if err != nil {
pgConn.conn.Close()
- return nil, &connectError{config: config, msg: "failed GSS auth", err: err}
+ return nil, newPerDialConnectError("failed GSS auth", err)
}
case *pgproto3.ReadyForQuery:
pgConn.status = connStatusIdle
@@ -373,7 +426,7 @@ func connect(ctx context.Context, config *Config, fallbackConfig *FallbackConfig
return pgConn, nil
}
pgConn.conn.Close()
- return nil, &connectError{config: config, msg: "ValidateConnect failed", err: err}
+ return nil, newPerDialConnectError("ValidateConnect failed", err)
}
}
return pgConn, nil
@@ -381,21 +434,14 @@ func connect(ctx context.Context, config *Config, fallbackConfig *FallbackConfig
// handled by ReceiveMessage
case *pgproto3.ErrorResponse:
pgConn.conn.Close()
- return nil, ErrorResponseToPgError(msg)
+ return nil, newPerDialConnectError("server error", ErrorResponseToPgError(msg))
default:
pgConn.conn.Close()
- return nil, &connectError{config: config, msg: "received unexpected message", err: err}
+ return nil, newPerDialConnectError("received unexpected message", err)
}
}
}
-func newContextWatcher(conn net.Conn) *ctxwatch.ContextWatcher {
- return ctxwatch.NewContextWatcher(
- func() { conn.SetDeadline(time.Date(1, 1, 1, 1, 1, 1, 1, time.UTC)) },
- func() { conn.SetDeadline(time.Time{}) },
- )
-}
-
func startTLS(conn net.Conn, tlsConfig *tls.Config) (net.Conn, error) {
err := binary.Write(conn, binary.BigEndian, []int32{8, 80877103})
if err != nil {
@@ -415,9 +461,8 @@ func startTLS(conn net.Conn, tlsConfig *tls.Config) (net.Conn, error) {
}
func (pgConn *PgConn) txPasswordMessage(password string) (err error) {
- msg := &pgproto3.PasswordMessage{Password: password}
- _, err = pgConn.conn.Write(msg.Encode(pgConn.wbuf))
- return err
+ pgConn.frontend.Send(&pgproto3.PasswordMessage{Password: password})
+ return pgConn.flushWithPotentialWriteReadDeadlock()
}
func hexMD5(s string) string {
@@ -444,36 +489,6 @@ func (pgConn *PgConn) signalMessage() chan struct{} {
return ch
}
-// SendBytes sends buf to the PostgreSQL server. It must only be used when the connection is not busy. e.g. It is as
-// error to call SendBytes while reading the result of a query.
-//
-// This is a very low level method that requires deep understanding of the PostgreSQL wire protocol to use correctly.
-// See https://www.postgresql.org/docs/current/protocol.html.
-func (pgConn *PgConn) SendBytes(ctx context.Context, buf []byte) error {
- if err := pgConn.lock(); err != nil {
- return err
- }
- defer pgConn.unlock()
-
- if ctx != context.Background() {
- select {
- case <-ctx.Done():
- return newContextAlreadyDoneError(ctx)
- default:
- }
- pgConn.contextWatcher.Watch(ctx)
- defer pgConn.contextWatcher.Unwatch()
- }
-
- n, err := pgConn.conn.Write(buf)
- if err != nil {
- pgConn.asyncClose()
- return &writeError{err: err, safeToRetry: n == 0}
- }
-
- return nil
-}
-
// ReceiveMessage receives one wire protocol message from the PostgreSQL server. It must only be used when the
// connection is not busy. e.g. It is an error to call ReceiveMessage while reading the result of a query. The messages
// are still handled by the core pgconn message handling system so receiving a NotificationResponse will still trigger
@@ -501,8 +516,9 @@ func (pgConn *PgConn) ReceiveMessage(ctx context.Context) (pgproto3.BackendMessa
if err != nil {
err = &pgconnError{
msg: "receive message failed",
- err: preferContextOverNetTimeoutError(ctx, err),
- safeToRetry: true}
+ err: normalizeTimeoutError(ctx, err),
+ safeToRetry: true,
+ }
}
return msg, err
}
@@ -550,13 +566,6 @@ func (pgConn *PgConn) peekMessage() (pgproto3.BackendMessage, error) {
func (pgConn *PgConn) receiveMessage() (pgproto3.BackendMessage, error) {
msg, err := pgConn.peekMessage()
if err != nil {
- // Close on anything other than timeout error - everything else is fatal
- var netErr net.Error
- isNetErr := errors.As(err, &netErr)
- if !(isNetErr && netErr.Timeout()) {
- pgConn.asyncClose()
- }
-
return nil, err
}
pgConn.peekedMsg = nil
@@ -567,11 +576,12 @@ func (pgConn *PgConn) receiveMessage() (pgproto3.BackendMessage, error) {
case *pgproto3.ParameterStatus:
pgConn.parameterStatuses[msg.Name] = msg.Value
case *pgproto3.ErrorResponse:
- if msg.Severity == "FATAL" {
+ err := ErrorResponseToPgError(msg)
+ if pgConn.config.OnPgError != nil && !pgConn.config.OnPgError(pgConn, err) {
pgConn.status = connStatusClosed
pgConn.conn.Close() // Ignore error as the connection is already broken and there is already an error to return.
close(pgConn.cleanupDone)
- return nil, ErrorResponseToPgError(msg)
+ return nil, err
}
case *pgproto3.NoticeResponse:
if pgConn.config.OnNotice != nil {
@@ -586,7 +596,8 @@ func (pgConn *PgConn) receiveMessage() (pgproto3.BackendMessage, error) {
return msg, nil
}
-// Conn returns the underlying net.Conn.
+// Conn returns the underlying net.Conn. This rarely necessary. If the connection will be directly used for reading or
+// writing then SyncConn should usually be called before Conn.
func (pgConn *PgConn) Conn() net.Conn {
return pgConn.conn
}
@@ -599,9 +610,10 @@ func (pgConn *PgConn) PID() uint32 {
// TxStatus returns the current TxStatus as reported by the server in the ReadyForQuery message.
//
// Possible return values:
-// 'I' - idle / not in transaction
-// 'T' - in a transaction
-// 'E' - in a failed transaction
+//
+// 'I' - idle / not in transaction
+// 'T' - in a transaction
+// 'E' - in a failed transaction
//
// See https://www.postgresql.org/docs/current/protocol-message-formats.html.
func (pgConn *PgConn) TxStatus() byte {
@@ -613,7 +625,12 @@ func (pgConn *PgConn) SecretKey() uint32 {
return pgConn.secretKey
}
-// Close closes a connection. It is safe to call Close on a already closed connection. Close attempts a clean close by
+// Frontend returns the underlying *pgproto3.Frontend. This rarely necessary.
+func (pgConn *PgConn) Frontend() *pgproto3.Frontend {
+ return pgConn.frontend
+}
+
+// Close closes a connection. It is safe to call Close on an already closed connection. Close attempts a clean close by
// sending the exit message to PostgreSQL. However, this could block so ctx is available to limit the time to wait. The
// underlying net.Conn.Close() will always be called regardless of any other errors.
func (pgConn *PgConn) Close(ctx context.Context) error {
@@ -642,7 +659,8 @@ func (pgConn *PgConn) Close(ctx context.Context) error {
// ignores errors.
//
// See https://github.com/jackc/pgx/issues/637
- pgConn.conn.Write([]byte{'X', 0, 0, 0, 4})
+ pgConn.frontend.Send(&pgproto3.Terminate{})
+ pgConn.flushWithPotentialWriteReadDeadlock()
return pgConn.conn.Close()
}
@@ -668,7 +686,8 @@ func (pgConn *PgConn) asyncClose() {
pgConn.conn.SetDeadline(deadline)
- pgConn.conn.Write([]byte{'X', 0, 0, 0, 4})
+ pgConn.frontend.Send(&pgproto3.Terminate{})
+ pgConn.flushWithPotentialWriteReadDeadlock()
}()
}
@@ -726,16 +745,23 @@ func (pgConn *PgConn) ParameterStatus(key string) string {
return pgConn.parameterStatuses[key]
}
-// CommandTag is the result of an Exec function
-type CommandTag []byte
+// CommandTag is the status text returned by PostgreSQL for a query.
+type CommandTag struct {
+ s string
+}
+
+// NewCommandTag makes a CommandTag from s.
+func NewCommandTag(s string) CommandTag {
+ return CommandTag{s: s}
+}
// RowsAffected returns the number of rows affected. If the CommandTag was not
// for a row affecting command (e.g. "CREATE TABLE") then it returns 0.
func (ct CommandTag) RowsAffected() int64 {
// Find last non-digit
idx := -1
- for i := len(ct) - 1; i >= 0; i-- {
- if ct[i] >= '0' && ct[i] <= '9' {
+ for i := len(ct.s) - 1; i >= 0; i-- {
+ if ct.s[i] >= '0' && ct.s[i] <= '9' {
idx = i
} else {
break
@@ -747,7 +773,7 @@ func (ct CommandTag) RowsAffected() int64 {
}
var n int64
- for _, b := range ct[idx:] {
+ for _, b := range ct.s[idx:] {
n = n*10 + int64(b-'0')
}
@@ -755,62 +781,71 @@ func (ct CommandTag) RowsAffected() int64 {
}
func (ct CommandTag) String() string {
- return string(ct)
+ return ct.s
}
// Insert is true if the command tag starts with "INSERT".
func (ct CommandTag) Insert() bool {
- return len(ct) >= 6 &&
- ct[0] == 'I' &&
- ct[1] == 'N' &&
- ct[2] == 'S' &&
- ct[3] == 'E' &&
- ct[4] == 'R' &&
- ct[5] == 'T'
+ return strings.HasPrefix(ct.s, "INSERT")
}
// Update is true if the command tag starts with "UPDATE".
func (ct CommandTag) Update() bool {
- return len(ct) >= 6 &&
- ct[0] == 'U' &&
- ct[1] == 'P' &&
- ct[2] == 'D' &&
- ct[3] == 'A' &&
- ct[4] == 'T' &&
- ct[5] == 'E'
+ return strings.HasPrefix(ct.s, "UPDATE")
}
// Delete is true if the command tag starts with "DELETE".
func (ct CommandTag) Delete() bool {
- return len(ct) >= 6 &&
- ct[0] == 'D' &&
- ct[1] == 'E' &&
- ct[2] == 'L' &&
- ct[3] == 'E' &&
- ct[4] == 'T' &&
- ct[5] == 'E'
+ return strings.HasPrefix(ct.s, "DELETE")
}
// Select is true if the command tag starts with "SELECT".
func (ct CommandTag) Select() bool {
- return len(ct) >= 6 &&
- ct[0] == 'S' &&
- ct[1] == 'E' &&
- ct[2] == 'L' &&
- ct[3] == 'E' &&
- ct[4] == 'C' &&
- ct[5] == 'T'
+ return strings.HasPrefix(ct.s, "SELECT")
+}
+
+type FieldDescription struct {
+ Name string
+ TableOID uint32
+ TableAttributeNumber uint16
+ DataTypeOID uint32
+ DataTypeSize int16
+ TypeModifier int32
+ Format int16
+}
+
+func (pgConn *PgConn) convertRowDescription(dst []FieldDescription, rd *pgproto3.RowDescription) []FieldDescription {
+ if cap(dst) >= len(rd.Fields) {
+ dst = dst[:len(rd.Fields):len(rd.Fields)]
+ } else {
+ dst = make([]FieldDescription, len(rd.Fields))
+ }
+
+ for i := range rd.Fields {
+ dst[i].Name = string(rd.Fields[i].Name)
+ dst[i].TableOID = rd.Fields[i].TableOID
+ dst[i].TableAttributeNumber = rd.Fields[i].TableAttributeNumber
+ dst[i].DataTypeOID = rd.Fields[i].DataTypeOID
+ dst[i].DataTypeSize = rd.Fields[i].DataTypeSize
+ dst[i].TypeModifier = rd.Fields[i].TypeModifier
+ dst[i].Format = rd.Fields[i].Format
+ }
+
+ return dst
}
type StatementDescription struct {
Name string
SQL string
ParamOIDs []uint32
- Fields []pgproto3.FieldDescription
+ Fields []FieldDescription
}
// Prepare creates a prepared statement. If the name is empty, the anonymous prepared statement will be used. This
// allows Prepare to also to describe statements without creating a server-side prepared statement.
+//
+// Prepare does not send a PREPARE statement to the server. It uses the PostgreSQL Parse and Describe protocol messages
+// directly.
func (pgConn *PgConn) Prepare(ctx context.Context, name, sql string, paramOIDs []uint32) (*StatementDescription, error) {
if err := pgConn.lock(); err != nil {
return nil, err
@@ -827,15 +862,13 @@ func (pgConn *PgConn) Prepare(ctx context.Context, name, sql string, paramOIDs [
defer pgConn.contextWatcher.Unwatch()
}
- buf := pgConn.wbuf
- buf = (&pgproto3.Parse{Name: name, Query: sql, ParameterOIDs: paramOIDs}).Encode(buf)
- buf = (&pgproto3.Describe{ObjectType: 'S', Name: name}).Encode(buf)
- buf = (&pgproto3.Sync{}).Encode(buf)
-
- n, err := pgConn.conn.Write(buf)
+ pgConn.frontend.SendParse(&pgproto3.Parse{Name: name, Query: sql, ParameterOIDs: paramOIDs})
+ pgConn.frontend.SendDescribe(&pgproto3.Describe{ObjectType: 'S', Name: name})
+ pgConn.frontend.SendSync(&pgproto3.Sync{})
+ err := pgConn.flushWithPotentialWriteReadDeadlock()
if err != nil {
pgConn.asyncClose()
- return nil, &writeError{err: err, safeToRetry: n == 0}
+ return nil, err
}
psd := &StatementDescription{Name: name, SQL: sql}
@@ -847,7 +880,7 @@ readloop:
msg, err := pgConn.receiveMessage()
if err != nil {
pgConn.asyncClose()
- return nil, preferContextOverNetTimeoutError(ctx, err)
+ return nil, normalizeTimeoutError(ctx, err)
}
switch msg := msg.(type) {
@@ -855,8 +888,7 @@ readloop:
psd.ParamOIDs = make([]uint32, len(msg.ParameterOIDs))
copy(psd.ParamOIDs, msg.ParameterOIDs)
case *pgproto3.RowDescription:
- psd.Fields = make([]pgproto3.FieldDescription, len(msg.Fields))
- copy(psd.Fields, msg.Fields)
+ psd.Fields = pgConn.convertRowDescription(nil, msg)
case *pgproto3.ErrorResponse:
parseErr = ErrorResponseToPgError(msg)
case *pgproto3.ReadyForQuery:
@@ -870,26 +902,73 @@ readloop:
return psd, nil
}
+// Deallocate deallocates a prepared statement.
+//
+// Deallocate does not send a DEALLOCATE statement to the server. It uses the PostgreSQL Close protocol message
+// directly. This has slightly different behavior than executing DEALLOCATE statement.
+// - Deallocate can succeed in an aborted transaction.
+// - Deallocating a non-existent prepared statement is not an error.
+func (pgConn *PgConn) Deallocate(ctx context.Context, name string) error {
+ if err := pgConn.lock(); err != nil {
+ return err
+ }
+ defer pgConn.unlock()
+
+ if ctx != context.Background() {
+ select {
+ case <-ctx.Done():
+ return newContextAlreadyDoneError(ctx)
+ default:
+ }
+ pgConn.contextWatcher.Watch(ctx)
+ defer pgConn.contextWatcher.Unwatch()
+ }
+
+ pgConn.frontend.SendClose(&pgproto3.Close{ObjectType: 'S', Name: name})
+ pgConn.frontend.SendSync(&pgproto3.Sync{})
+ err := pgConn.flushWithPotentialWriteReadDeadlock()
+ if err != nil {
+ pgConn.asyncClose()
+ return err
+ }
+
+ for {
+ msg, err := pgConn.receiveMessage()
+ if err != nil {
+ pgConn.asyncClose()
+ return normalizeTimeoutError(ctx, err)
+ }
+
+ switch msg := msg.(type) {
+ case *pgproto3.ErrorResponse:
+ return ErrorResponseToPgError(msg)
+ case *pgproto3.ReadyForQuery:
+ return nil
+ }
+ }
+}
+
// ErrorResponseToPgError converts a wire protocol error message to a *PgError.
func ErrorResponseToPgError(msg *pgproto3.ErrorResponse) *PgError {
return &PgError{
- Severity: msg.Severity,
- Code: string(msg.Code),
- Message: string(msg.Message),
- Detail: string(msg.Detail),
- Hint: msg.Hint,
- Position: msg.Position,
- InternalPosition: msg.InternalPosition,
- InternalQuery: string(msg.InternalQuery),
- Where: string(msg.Where),
- SchemaName: string(msg.SchemaName),
- TableName: string(msg.TableName),
- ColumnName: string(msg.ColumnName),
- DataTypeName: string(msg.DataTypeName),
- ConstraintName: msg.ConstraintName,
- File: string(msg.File),
- Line: msg.Line,
- Routine: string(msg.Routine),
+ Severity: msg.Severity,
+ SeverityUnlocalized: msg.SeverityUnlocalized,
+ Code: string(msg.Code),
+ Message: string(msg.Message),
+ Detail: string(msg.Detail),
+ Hint: msg.Hint,
+ Position: msg.Position,
+ InternalPosition: msg.InternalPosition,
+ InternalQuery: string(msg.InternalQuery),
+ Where: string(msg.Where),
+ SchemaName: string(msg.SchemaName),
+ TableName: string(msg.TableName),
+ ColumnName: string(msg.ColumnName),
+ DataTypeName: string(msg.DataTypeName),
+ ConstraintName: msg.ConstraintName,
+ File: string(msg.File),
+ Line: msg.Line,
+ Routine: string(msg.Routine),
}
}
@@ -906,17 +985,33 @@ func (pgConn *PgConn) CancelRequest(ctx context.Context) error {
// the connection config. This is important in high availability configurations where fallback connections may be
// specified or DNS may be used to load balance.
serverAddr := pgConn.conn.RemoteAddr()
- cancelConn, err := pgConn.config.DialFunc(ctx, serverAddr.Network(), serverAddr.String())
+ var serverNetwork string
+ var serverAddress string
+ if serverAddr.Network() == "unix" {
+ // for unix sockets, RemoteAddr() calls getpeername() which returns the name the
+ // server passed to bind(). For Postgres, this is always a relative path "./.s.PGSQL.5432"
+ // so connecting to it will fail. Fall back to the config's value
+ serverNetwork, serverAddress = NetworkAddress(pgConn.config.Host, pgConn.config.Port)
+ } else {
+ serverNetwork, serverAddress = serverAddr.Network(), serverAddr.String()
+ }
+ cancelConn, err := pgConn.config.DialFunc(ctx, serverNetwork, serverAddress)
if err != nil {
- return err
+ // In case of unix sockets, RemoteAddr() returns only the file part of the path. If the
+ // first connect failed, try the config.
+ if serverAddr.Network() != "unix" {
+ return err
+ }
+ serverNetwork, serverAddr := NetworkAddress(pgConn.config.Host, pgConn.config.Port)
+ cancelConn, err = pgConn.config.DialFunc(ctx, serverNetwork, serverAddr)
+ if err != nil {
+ return err
+ }
}
defer cancelConn.Close()
if ctx != context.Background() {
- contextWatcher := ctxwatch.NewContextWatcher(
- func() { cancelConn.SetDeadline(time.Date(1, 1, 1, 1, 1, 1, 1, time.UTC)) },
- func() { cancelConn.SetDeadline(time.Time{}) },
- )
+ contextWatcher := ctxwatch.NewContextWatcher(&DeadlineContextWatcherHandler{Conn: cancelConn})
contextWatcher.Watch(ctx)
defer contextWatcher.Unwatch()
}
@@ -924,22 +1019,21 @@ func (pgConn *PgConn) CancelRequest(ctx context.Context) error {
buf := make([]byte, 16)
binary.BigEndian.PutUint32(buf[0:4], 16)
binary.BigEndian.PutUint32(buf[4:8], 80877102)
- binary.BigEndian.PutUint32(buf[8:12], uint32(pgConn.pid))
- binary.BigEndian.PutUint32(buf[12:16], uint32(pgConn.secretKey))
- _, err = cancelConn.Write(buf)
- if err != nil {
- return err
- }
+ binary.BigEndian.PutUint32(buf[8:12], pgConn.pid)
+ binary.BigEndian.PutUint32(buf[12:16], pgConn.secretKey)
- _, err = cancelConn.Read(buf)
- if err != io.EOF {
- return err
+ if _, err := cancelConn.Write(buf); err != nil {
+ return fmt.Errorf("write to connection for cancellation: %w", err)
}
+ // Wait for the cancel request to be acknowledged by the server.
+ // It copies the behavior of the libpq: https://github.com/postgres/postgres/blob/REL_16_0/src/interfaces/libpq/fe-connect.c#L4946-L4960
+ _, _ = cancelConn.Read(buf)
+
return nil
}
-// WaitForNotification waits for a LISTON/NOTIFY message to be received. It returns an error if a notification was not
+// WaitForNotification waits for a LISTEN/NOTIFY message to be received. It returns an error if a notification was not
// received.
func (pgConn *PgConn) WaitForNotification(ctx context.Context) error {
if err := pgConn.lock(); err != nil {
@@ -961,7 +1055,7 @@ func (pgConn *PgConn) WaitForNotification(ctx context.Context) error {
for {
msg, err := pgConn.receiveMessage()
if err != nil {
- return preferContextOverNetTimeoutError(ctx, err)
+ return normalizeTimeoutError(ctx, err)
}
switch msg.(type) {
@@ -1001,15 +1095,13 @@ func (pgConn *PgConn) Exec(ctx context.Context, sql string) *MultiResultReader {
pgConn.contextWatcher.Watch(ctx)
}
- buf := pgConn.wbuf
- buf = (&pgproto3.Query{String: sql}).Encode(buf)
-
- n, err := pgConn.conn.Write(buf)
+ pgConn.frontend.SendQuery(&pgproto3.Query{String: sql})
+ err := pgConn.flushWithPotentialWriteReadDeadlock()
if err != nil {
pgConn.asyncClose()
pgConn.contextWatcher.Unwatch()
multiResult.closed = true
- multiResult.err = &writeError{err: err, safeToRetry: n == 0}
+ multiResult.err = err
pgConn.unlock()
return multiResult
}
@@ -1017,39 +1109,6 @@ func (pgConn *PgConn) Exec(ctx context.Context, sql string) *MultiResultReader {
return multiResult
}
-// ReceiveResults reads the result that might be returned by Postgres after a SendBytes
-// (e.a. after sending a CopyDone in a copy-both situation).
-//
-// This is a very low level method that requires deep understanding of the PostgreSQL wire protocol to use correctly.
-// See https://www.postgresql.org/docs/current/protocol.html.
-func (pgConn *PgConn) ReceiveResults(ctx context.Context) *MultiResultReader {
- if err := pgConn.lock(); err != nil {
- return &MultiResultReader{
- closed: true,
- err: err,
- }
- }
-
- pgConn.multiResultReader = MultiResultReader{
- pgConn: pgConn,
- ctx: ctx,
- }
- multiResult := &pgConn.multiResultReader
- if ctx != context.Background() {
- select {
- case <-ctx.Done():
- multiResult.closed = true
- multiResult.err = newContextAlreadyDoneError(ctx)
- pgConn.unlock()
- return multiResult
- default:
- }
- pgConn.contextWatcher.Watch(ctx)
- }
-
- return multiResult
-}
-
// ExecParams executes a command via the PostgreSQL extended query protocol.
//
// sql is a SQL command string. It may only contain one query. Parameter substitution is positional using $1, $2, $3,
@@ -1075,11 +1134,10 @@ func (pgConn *PgConn) ExecParams(ctx context.Context, sql string, paramValues []
return result
}
- buf := pgConn.wbuf
- buf = (&pgproto3.Parse{Query: sql, ParameterOIDs: paramOIDs}).Encode(buf)
- buf = (&pgproto3.Bind{ParameterFormatCodes: paramFormats, Parameters: paramValues, ResultFormatCodes: resultFormats}).Encode(buf)
+ pgConn.frontend.SendParse(&pgproto3.Parse{Query: sql, ParameterOIDs: paramOIDs})
+ pgConn.frontend.SendBind(&pgproto3.Bind{ParameterFormatCodes: paramFormats, Parameters: paramValues, ResultFormatCodes: resultFormats})
- pgConn.execExtendedSuffix(buf, result)
+ pgConn.execExtendedSuffix(result)
return result
}
@@ -1102,10 +1160,9 @@ func (pgConn *PgConn) ExecPrepared(ctx context.Context, stmtName string, paramVa
return result
}
- buf := pgConn.wbuf
- buf = (&pgproto3.Bind{PreparedStatement: stmtName, ParameterFormatCodes: paramFormats, Parameters: paramValues, ResultFormatCodes: resultFormats}).Encode(buf)
+ pgConn.frontend.SendBind(&pgproto3.Bind{PreparedStatement: stmtName, ParameterFormatCodes: paramFormats, Parameters: paramValues, ResultFormatCodes: resultFormats})
- pgConn.execExtendedSuffix(buf, result)
+ pgConn.execExtendedSuffix(result)
return result
}
@@ -1118,13 +1175,13 @@ func (pgConn *PgConn) execExtendedPrefix(ctx context.Context, paramValues [][]by
result := &pgConn.resultReader
if err := pgConn.lock(); err != nil {
- result.concludeCommand(nil, err)
+ result.concludeCommand(CommandTag{}, err)
result.closed = true
return result
}
if len(paramValues) > math.MaxUint16 {
- result.concludeCommand(nil, fmt.Errorf("extended protocol limited to %v parameters", math.MaxUint16))
+ result.concludeCommand(CommandTag{}, fmt.Errorf("extended protocol limited to %v parameters", math.MaxUint16))
result.closed = true
pgConn.unlock()
return result
@@ -1133,7 +1190,7 @@ func (pgConn *PgConn) execExtendedPrefix(ctx context.Context, paramValues [][]by
if ctx != context.Background() {
select {
case <-ctx.Done():
- result.concludeCommand(nil, newContextAlreadyDoneError(ctx))
+ result.concludeCommand(CommandTag{}, newContextAlreadyDoneError(ctx))
result.closed = true
pgConn.unlock()
return result
@@ -1145,15 +1202,15 @@ func (pgConn *PgConn) execExtendedPrefix(ctx context.Context, paramValues [][]by
return result
}
-func (pgConn *PgConn) execExtendedSuffix(buf []byte, result *ResultReader) {
- buf = (&pgproto3.Describe{ObjectType: 'P'}).Encode(buf)
- buf = (&pgproto3.Execute{}).Encode(buf)
- buf = (&pgproto3.Sync{}).Encode(buf)
+func (pgConn *PgConn) execExtendedSuffix(result *ResultReader) {
+ pgConn.frontend.SendDescribe(&pgproto3.Describe{ObjectType: 'P'})
+ pgConn.frontend.SendExecute(&pgproto3.Execute{})
+ pgConn.frontend.SendSync(&pgproto3.Sync{})
- n, err := pgConn.conn.Write(buf)
+ err := pgConn.flushWithPotentialWriteReadDeadlock()
if err != nil {
pgConn.asyncClose()
- result.concludeCommand(nil, &writeError{err: err, safeToRetry: n == 0})
+ result.concludeCommand(CommandTag{}, err)
pgConn.contextWatcher.Unwatch()
result.closed = true
pgConn.unlock()
@@ -1166,14 +1223,14 @@ func (pgConn *PgConn) execExtendedSuffix(buf []byte, result *ResultReader) {
// CopyTo executes the copy command sql and copies the results to w.
func (pgConn *PgConn) CopyTo(ctx context.Context, w io.Writer, sql string) (CommandTag, error) {
if err := pgConn.lock(); err != nil {
- return nil, err
+ return CommandTag{}, err
}
if ctx != context.Background() {
select {
case <-ctx.Done():
pgConn.unlock()
- return nil, newContextAlreadyDoneError(ctx)
+ return CommandTag{}, newContextAlreadyDoneError(ctx)
default:
}
pgConn.contextWatcher.Watch(ctx)
@@ -1181,14 +1238,13 @@ func (pgConn *PgConn) CopyTo(ctx context.Context, w io.Writer, sql string) (Comm
}
// Send copy to command
- buf := pgConn.wbuf
- buf = (&pgproto3.Query{String: sql}).Encode(buf)
+ pgConn.frontend.SendQuery(&pgproto3.Query{String: sql})
- n, err := pgConn.conn.Write(buf)
+ err := pgConn.flushWithPotentialWriteReadDeadlock()
if err != nil {
pgConn.asyncClose()
pgConn.unlock()
- return nil, &writeError{err: err, safeToRetry: n == 0}
+ return CommandTag{}, err
}
// Read results
@@ -1198,7 +1254,7 @@ func (pgConn *PgConn) CopyTo(ctx context.Context, w io.Writer, sql string) (Comm
msg, err := pgConn.receiveMessage()
if err != nil {
pgConn.asyncClose()
- return nil, preferContextOverNetTimeoutError(ctx, err)
+ return CommandTag{}, normalizeTimeoutError(ctx, err)
}
switch msg := msg.(type) {
@@ -1207,13 +1263,13 @@ func (pgConn *PgConn) CopyTo(ctx context.Context, w io.Writer, sql string) (Comm
_, err := w.Write(msg.Data)
if err != nil {
pgConn.asyncClose()
- return nil, err
+ return CommandTag{}, err
}
case *pgproto3.ReadyForQuery:
pgConn.unlock()
return commandTag, pgErr
case *pgproto3.CommandComplete:
- commandTag = CommandTag(msg.CommandTag)
+ commandTag = pgConn.makeCommandTag(msg.CommandTag)
case *pgproto3.ErrorResponse:
pgErr = ErrorResponseToPgError(msg)
}
@@ -1226,28 +1282,26 @@ func (pgConn *PgConn) CopyTo(ctx context.Context, w io.Writer, sql string) (Comm
// could still block.
func (pgConn *PgConn) CopyFrom(ctx context.Context, r io.Reader, sql string) (CommandTag, error) {
if err := pgConn.lock(); err != nil {
- return nil, err
+ return CommandTag{}, err
}
defer pgConn.unlock()
if ctx != context.Background() {
select {
case <-ctx.Done():
- return nil, newContextAlreadyDoneError(ctx)
+ return CommandTag{}, newContextAlreadyDoneError(ctx)
default:
}
pgConn.contextWatcher.Watch(ctx)
defer pgConn.contextWatcher.Unwatch()
}
- // Send copy to command
- buf := pgConn.wbuf
- buf = (&pgproto3.Query{String: sql}).Encode(buf)
-
- n, err := pgConn.conn.Write(buf)
+ // Send copy from query
+ pgConn.frontend.SendQuery(&pgproto3.Query{String: sql})
+ err := pgConn.flushWithPotentialWriteReadDeadlock()
if err != nil {
pgConn.asyncClose()
- return nil, &writeError{err: err, safeToRetry: n == 0}
+ return CommandTag{}, err
}
// Send copy data
@@ -1259,19 +1313,20 @@ func (pgConn *PgConn) CopyFrom(ctx context.Context, r io.Reader, sql string) (Co
go func() {
defer wg.Done()
- buf := make([]byte, 0, 65536)
- buf = append(buf, 'd')
- sp := len(buf)
+ buf := iobufpool.Get(65536)
+ defer iobufpool.Put(buf)
+ (*buf)[0] = 'd'
for {
- n, readErr := r.Read(buf[5:cap(buf)])
+ n, readErr := r.Read((*buf)[5:cap(*buf)])
if n > 0 {
- buf = buf[0 : n+5]
- pgio.SetInt32(buf[sp:], int32(n+4))
+ *buf = (*buf)[0 : n+5]
+ pgio.SetInt32((*buf)[1:], int32(n+4))
- _, writeErr := pgConn.conn.Write(buf)
+ writeErr := pgConn.frontend.SendUnbufferedEncodedCopyData(*buf)
if writeErr != nil {
- // Write errors are always fatal, but we can't use asyncClose because we are in a different goroutine.
+ // Write errors are always fatal, but we can't use asyncClose because we are in a different goroutine. Not
+ // setting pgConn.status or closing pgConn.cleanupDone for the same reason.
pgConn.conn.Close()
copyErrChan <- writeErr
@@ -1297,11 +1352,16 @@ func (pgConn *PgConn) CopyFrom(ctx context.Context, r io.Reader, sql string) (Co
select {
case copyErr = <-copyErrChan:
case <-signalMessageChan:
- msg, err := pgConn.receiveMessage()
- if err != nil {
- pgConn.asyncClose()
- return nil, preferContextOverNetTimeoutError(ctx, err)
+ // If pgConn.receiveMessage encounters an error it will call pgConn.asyncClose. But that is a race condition with
+ // the goroutine. So instead check pgConn.bufferingReceiveErr which will have been set by the signalMessage. If an
+ // error is found then forcibly close the connection without sending the Terminate message.
+ if err := pgConn.bufferingReceiveErr; err != nil {
+ pgConn.status = connStatusClosed
+ pgConn.conn.Close()
+ close(pgConn.cleanupDone)
+ return CommandTag{}, normalizeTimeoutError(ctx, err)
}
+ msg, _ := pgConn.receiveMessage()
switch msg := msg.(type) {
case *pgproto3.ErrorResponse:
@@ -1315,18 +1375,15 @@ func (pgConn *PgConn) CopyFrom(ctx context.Context, r io.Reader, sql string) (Co
// Make sure io goroutine finishes before writing.
wg.Wait()
- buf = buf[:0]
if copyErr == io.EOF || pgErr != nil {
- copyDone := &pgproto3.CopyDone{}
- buf = copyDone.Encode(buf)
+ pgConn.frontend.Send(&pgproto3.CopyDone{})
} else {
- copyFail := &pgproto3.CopyFail{Message: copyErr.Error()}
- buf = copyFail.Encode(buf)
+ pgConn.frontend.Send(&pgproto3.CopyFail{Message: copyErr.Error()})
}
- _, err = pgConn.conn.Write(buf)
+ err = pgConn.flushWithPotentialWriteReadDeadlock()
if err != nil {
pgConn.asyncClose()
- return nil, err
+ return CommandTag{}, err
}
// Read results
@@ -1335,14 +1392,14 @@ func (pgConn *PgConn) CopyFrom(ctx context.Context, r io.Reader, sql string) (Co
msg, err := pgConn.receiveMessage()
if err != nil {
pgConn.asyncClose()
- return nil, preferContextOverNetTimeoutError(ctx, err)
+ return CommandTag{}, normalizeTimeoutError(ctx, err)
}
switch msg := msg.(type) {
case *pgproto3.ReadyForQuery:
return commandTag, pgErr
case *pgproto3.CommandComplete:
- commandTag = CommandTag(msg.CommandTag)
+ commandTag = pgConn.makeCommandTag(msg.CommandTag)
case *pgproto3.ErrorResponse:
pgErr = ErrorResponseToPgError(msg)
}
@@ -1351,8 +1408,9 @@ func (pgConn *PgConn) CopyFrom(ctx context.Context, r io.Reader, sql string) (Co
// MultiResultReader is a reader for a command that could return multiple results such as Exec or ExecBatch.
type MultiResultReader struct {
- pgConn *PgConn
- ctx context.Context
+ pgConn *PgConn
+ ctx context.Context
+ pipeline *Pipeline
rr *ResultReader
@@ -1374,10 +1432,9 @@ func (mrr *MultiResultReader) ReadAll() ([]*Result, error) {
func (mrr *MultiResultReader) receiveMessage() (pgproto3.BackendMessage, error) {
msg, err := mrr.pgConn.receiveMessage()
-
if err != nil {
mrr.pgConn.contextWatcher.Unwatch()
- mrr.err = preferContextOverNetTimeoutError(mrr.ctx, err)
+ mrr.err = normalizeTimeoutError(mrr.ctx, err)
mrr.closed = true
mrr.pgConn.asyncClose()
return nil, mrr.err
@@ -1385,9 +1442,13 @@ func (mrr *MultiResultReader) receiveMessage() (pgproto3.BackendMessage, error)
switch msg := msg.(type) {
case *pgproto3.ReadyForQuery:
- mrr.pgConn.contextWatcher.Unwatch()
mrr.closed = true
- mrr.pgConn.unlock()
+ if mrr.pipeline != nil {
+ mrr.pipeline.expectedReadyForQueryCount--
+ } else {
+ mrr.pgConn.contextWatcher.Unwatch()
+ mrr.pgConn.unlock()
+ }
case *pgproto3.ErrorResponse:
mrr.err = ErrorResponseToPgError(msg)
}
@@ -1409,13 +1470,14 @@ func (mrr *MultiResultReader) NextResult() bool {
pgConn: mrr.pgConn,
multiResultReader: mrr,
ctx: mrr.ctx,
- fieldDescriptions: msg.Fields,
+ fieldDescriptions: mrr.pgConn.convertRowDescription(mrr.pgConn.fieldDescriptions[:], msg),
}
+
mrr.rr = &mrr.pgConn.resultReader
return true
case *pgproto3.CommandComplete:
mrr.pgConn.resultReader = ResultReader{
- commandTag: CommandTag(msg.CommandTag),
+ commandTag: mrr.pgConn.makeCommandTag(msg.CommandTag),
commandConcluded: true,
closed: true,
}
@@ -1450,9 +1512,10 @@ func (mrr *MultiResultReader) Close() error {
type ResultReader struct {
pgConn *PgConn
multiResultReader *MultiResultReader
+ pipeline *Pipeline
ctx context.Context
- fieldDescriptions []pgproto3.FieldDescription
+ fieldDescriptions []FieldDescription
rowValues [][]byte
commandTag CommandTag
commandConcluded bool
@@ -1462,7 +1525,7 @@ type ResultReader struct {
// Result is the saved query response that is returned by calling Read on a ResultReader.
type Result struct {
- FieldDescriptions []pgproto3.FieldDescription
+ FieldDescriptions []FieldDescription
Rows [][][]byte
CommandTag CommandTag
Err error
@@ -1474,12 +1537,18 @@ func (rr *ResultReader) Read() *Result {
for rr.NextRow() {
if br.FieldDescriptions == nil {
- br.FieldDescriptions = make([]pgproto3.FieldDescription, len(rr.FieldDescriptions()))
+ br.FieldDescriptions = make([]FieldDescription, len(rr.FieldDescriptions()))
copy(br.FieldDescriptions, rr.FieldDescriptions())
}
- row := make([][]byte, len(rr.Values()))
- copy(row, rr.Values())
+ values := rr.Values()
+ row := make([][]byte, len(values))
+ for i := range row {
+ if values[i] != nil {
+ row[i] = make([]byte, len(values[i]))
+ copy(row[i], values[i])
+ }
+ }
br.Rows = append(br.Rows, row)
}
@@ -1507,14 +1576,14 @@ func (rr *ResultReader) NextRow() bool {
}
// FieldDescriptions returns the field descriptions for the current result set. The returned slice is only valid until
-// the ResultReader is closed.
-func (rr *ResultReader) FieldDescriptions() []pgproto3.FieldDescription {
+// the ResultReader is closed. It may return nil (for example, if the query did not return a result set or an error was
+// encountered.)
+func (rr *ResultReader) FieldDescriptions() []FieldDescription {
return rr.fieldDescriptions
}
// Values returns the current row data. NextRow must have been previously been called. The returned [][]byte is only
-// valid until the next NextRow call or the ResultReader is closed. However, the underlying byte data is safe to
-// retain a reference to and mutate.
+// valid until the next NextRow call or the ResultReader is closed.
func (rr *ResultReader) Values() [][]byte {
return rr.rowValues
}
@@ -1530,15 +1599,15 @@ func (rr *ResultReader) Close() (CommandTag, error) {
for !rr.commandConcluded {
_, err := rr.receiveMessage()
if err != nil {
- return nil, rr.err
+ return CommandTag{}, rr.err
}
}
- if rr.multiResultReader == nil {
+ if rr.multiResultReader == nil && rr.pipeline == nil {
for {
msg, err := rr.receiveMessage()
if err != nil {
- return nil, rr.err
+ return CommandTag{}, rr.err
}
switch msg := msg.(type) {
@@ -1584,8 +1653,8 @@ func (rr *ResultReader) receiveMessage() (msg pgproto3.BackendMessage, err error
}
if err != nil {
- err = preferContextOverNetTimeoutError(rr.ctx, err)
- rr.concludeCommand(nil, err)
+ err = normalizeTimeoutError(rr.ctx, err)
+ rr.concludeCommand(CommandTag{}, err)
rr.pgConn.contextWatcher.Unwatch()
rr.closed = true
if rr.multiResultReader == nil {
@@ -1597,13 +1666,13 @@ func (rr *ResultReader) receiveMessage() (msg pgproto3.BackendMessage, err error
switch msg := msg.(type) {
case *pgproto3.RowDescription:
- rr.fieldDescriptions = msg.Fields
+ rr.fieldDescriptions = rr.pgConn.convertRowDescription(rr.pgConn.fieldDescriptions[:], msg)
case *pgproto3.CommandComplete:
- rr.concludeCommand(CommandTag(msg.CommandTag), nil)
+ rr.concludeCommand(rr.pgConn.makeCommandTag(msg.CommandTag), nil)
case *pgproto3.EmptyQueryResponse:
- rr.concludeCommand(nil, nil)
+ rr.concludeCommand(CommandTag{}, nil)
case *pgproto3.ErrorResponse:
- rr.concludeCommand(nil, ErrorResponseToPgError(msg))
+ rr.concludeCommand(CommandTag{}, ErrorResponseToPgError(msg))
}
return msg, nil
@@ -1628,24 +1697,55 @@ func (rr *ResultReader) concludeCommand(commandTag CommandTag, err error) {
// Batch is a collection of queries that can be sent to the PostgreSQL server in a single round-trip.
type Batch struct {
buf []byte
+ err error
}
// ExecParams appends an ExecParams command to the batch. See PgConn.ExecParams for parameter descriptions.
func (batch *Batch) ExecParams(sql string, paramValues [][]byte, paramOIDs []uint32, paramFormats []int16, resultFormats []int16) {
- batch.buf = (&pgproto3.Parse{Query: sql, ParameterOIDs: paramOIDs}).Encode(batch.buf)
+ if batch.err != nil {
+ return
+ }
+
+ batch.buf, batch.err = (&pgproto3.Parse{Query: sql, ParameterOIDs: paramOIDs}).Encode(batch.buf)
+ if batch.err != nil {
+ return
+ }
batch.ExecPrepared("", paramValues, paramFormats, resultFormats)
}
// ExecPrepared appends an ExecPrepared e command to the batch. See PgConn.ExecPrepared for parameter descriptions.
func (batch *Batch) ExecPrepared(stmtName string, paramValues [][]byte, paramFormats []int16, resultFormats []int16) {
- batch.buf = (&pgproto3.Bind{PreparedStatement: stmtName, ParameterFormatCodes: paramFormats, Parameters: paramValues, ResultFormatCodes: resultFormats}).Encode(batch.buf)
- batch.buf = (&pgproto3.Describe{ObjectType: 'P'}).Encode(batch.buf)
- batch.buf = (&pgproto3.Execute{}).Encode(batch.buf)
+ if batch.err != nil {
+ return
+ }
+
+ batch.buf, batch.err = (&pgproto3.Bind{PreparedStatement: stmtName, ParameterFormatCodes: paramFormats, Parameters: paramValues, ResultFormatCodes: resultFormats}).Encode(batch.buf)
+ if batch.err != nil {
+ return
+ }
+
+ batch.buf, batch.err = (&pgproto3.Describe{ObjectType: 'P'}).Encode(batch.buf)
+ if batch.err != nil {
+ return
+ }
+
+ batch.buf, batch.err = (&pgproto3.Execute{}).Encode(batch.buf)
+ if batch.err != nil {
+ return
+ }
}
// ExecBatch executes all the queries in batch in a single round-trip. Execution is implicitly transactional unless a
-// transaction is already in progress or SQL contains transaction control statements.
+// transaction is already in progress or SQL contains transaction control statements. This is a simpler way of executing
+// multiple queries in a single round trip than using pipeline mode.
func (pgConn *PgConn) ExecBatch(ctx context.Context, batch *Batch) *MultiResultReader {
+ if batch.err != nil {
+ return &MultiResultReader{
+ closed: true,
+ err: batch.err,
+ }
+ }
+
if err := pgConn.lock(); err != nil {
return &MultiResultReader{
closed: true,
@@ -1671,20 +1771,23 @@ func (pgConn *PgConn) ExecBatch(ctx context.Context, batch *Batch) *MultiResultR
pgConn.contextWatcher.Watch(ctx)
}
- batch.buf = (&pgproto3.Sync{}).Encode(batch.buf)
+ batch.buf, batch.err = (&pgproto3.Sync{}).Encode(batch.buf)
+ if batch.err != nil {
+ multiResult.closed = true
+ multiResult.err = batch.err
+ pgConn.unlock()
+ return multiResult
+ }
- // A large batch can deadlock without concurrent reading and writing. If the Write fails the underlying net.Conn is
- // closed. This is all that can be done without introducing a race condition or adding a concurrent safe communication
- // channel to relay the error back. The practical effect of this is that the underlying Write error is not reported.
- // The error the code reading the batch results receives will be a closed connection error.
- //
- // See https://github.com/jackc/pgx/issues/374.
- go func() {
- _, err := pgConn.conn.Write(batch.buf)
- if err != nil {
- pgConn.conn.Close()
- }
- }()
+ pgConn.enterPotentialWriteReadDeadlock()
+ defer pgConn.exitPotentialWriteReadDeadlock()
+ _, err := pgConn.conn.Write(batch.buf)
+ if err != nil {
+ multiResult.closed = true
+ multiResult.err = err
+ pgConn.unlock()
+ return multiResult
+ }
return multiResult
}
@@ -1706,23 +1809,122 @@ func (pgConn *PgConn) EscapeString(s string) (string, error) {
return strings.Replace(s, "'", "''", -1), nil
}
+// CheckConn checks the underlying connection without writing any bytes. This is currently implemented by doing a read
+// with a very short deadline. This can be useful because a TCP connection can be broken such that a write will appear
+// to succeed even though it will never actually reach the server. Reading immediately before a write will detect this
+// condition. If this is done immediately before sending a query it reduces the chances a query will be sent that fails
+// without the client knowing whether the server received it or not.
+//
+// Deprecated: CheckConn is deprecated in favor of Ping. CheckConn cannot detect all types of broken connections where
+// the write would still appear to succeed. Prefer Ping unless on a high latency connection.
+func (pgConn *PgConn) CheckConn() error {
+ ctx, cancel := context.WithTimeout(context.Background(), 1*time.Millisecond)
+ defer cancel()
+
+ _, err := pgConn.ReceiveMessage(ctx)
+ if err != nil {
+ if !Timeout(err) {
+ return err
+ }
+ }
+
+ return nil
+}
+
+// Ping pings the server. This can be useful because a TCP connection can be broken such that a write will appear to
+// succeed even though it will never actually reach the server. Pinging immediately before sending a query reduces the
+// chances a query will be sent that fails without the client knowing whether the server received it or not.
+func (pgConn *PgConn) Ping(ctx context.Context) error {
+ return pgConn.Exec(ctx, "-- ping").Close()
+}
+
+// makeCommandTag makes a CommandTag. It does not retain a reference to buf or buf's underlying memory.
+func (pgConn *PgConn) makeCommandTag(buf []byte) CommandTag {
+ return CommandTag{s: string(buf)}
+}
+
+// enterPotentialWriteReadDeadlock must be called before a write that could deadlock if the server is simultaneously
+// blocked writing to us.
+func (pgConn *PgConn) enterPotentialWriteReadDeadlock() {
+ // The time to wait is somewhat arbitrary. A Write should only take as long as the syscall and memcpy to the OS
+ // outbound network buffer unless the buffer is full (which potentially is a block). It needs to be long enough for
+ // the normal case, but short enough not to kill performance if a block occurs.
+ //
+ // In addition, on Windows the default timer resolution is 15.6ms. So setting the timer to less than that is
+ // ineffective.
+ if pgConn.slowWriteTimer.Reset(15 * time.Millisecond) {
+ panic("BUG: slow write timer already active")
+ }
+}
+
+// exitPotentialWriteReadDeadlock must be called after a call to enterPotentialWriteReadDeadlock.
+func (pgConn *PgConn) exitPotentialWriteReadDeadlock() {
+ if !pgConn.slowWriteTimer.Stop() {
+ // The timer starts its function in a separate goroutine. It is necessary to ensure the background reader has
+ // started before calling Stop. Otherwise, the background reader may not be stopped. That on its own is not a
+ // serious problem. But what is a serious problem is that the background reader may start at an inopportune time in
+ // a subsequent query. For example, if a subsequent query was canceled then a deadline may be set on the net.Conn to
+ // interrupt an in-progress read. After the read is interrupted, but before the deadline is cleared, the background
+ // reader could start and read a deadline error. Then the next query would receive the an unexpected deadline error.
+ <-pgConn.bgReaderStarted
+ pgConn.bgReader.Stop()
+ }
+}
+
+func (pgConn *PgConn) flushWithPotentialWriteReadDeadlock() error {
+ pgConn.enterPotentialWriteReadDeadlock()
+ defer pgConn.exitPotentialWriteReadDeadlock()
+ err := pgConn.frontend.Flush()
+ return err
+}
+
+// SyncConn prepares the underlying net.Conn for direct use. PgConn may internally buffer reads or use goroutines for
+// background IO. This means that any direct use of the underlying net.Conn may be corrupted if a read is already
+// buffered or a read is in progress. SyncConn drains read buffers and stops background IO. In some cases this may
+// require sending a ping to the server. ctx can be used to cancel this operation. This should be called before any
+// operation that will use the underlying net.Conn directly. e.g. Before Conn() or Hijack().
+//
+// This should not be confused with the PostgreSQL protocol Sync message.
+func (pgConn *PgConn) SyncConn(ctx context.Context) error {
+ for i := 0; i < 10; i++ {
+ if pgConn.bgReader.Status() == bgreader.StatusStopped && pgConn.frontend.ReadBufferLen() == 0 {
+ return nil
+ }
+
+ err := pgConn.Ping(ctx)
+ if err != nil {
+ return fmt.Errorf("SyncConn: Ping failed while syncing conn: %w", err)
+ }
+ }
+
+ // This should never happen. Only way I can imagine this occurring is if the server is constantly sending data such as
+ // LISTEN/NOTIFY or log notifications such that we never can get an empty buffer.
+ return errors.New("SyncConn: conn never synchronized")
+}
+
+// CustomData returns a map that can be used to associate custom data with the connection.
+func (pgConn *PgConn) CustomData() map[string]any {
+ return pgConn.customData
+}
+
// HijackedConn is the result of hijacking a connection.
//
// Due to the necessary exposure of internal implementation details, it is not covered by the semantic versioning
// compatibility.
type HijackedConn struct {
- Conn net.Conn // the underlying TCP or unix domain socket connection
+ Conn net.Conn
PID uint32 // backend pid
SecretKey uint32 // key to use to send a cancel query message to the server
ParameterStatuses map[string]string // parameters that have been reported by the server
TxStatus byte
- Frontend Frontend
+ Frontend *pgproto3.Frontend
Config *Config
+ CustomData map[string]any
}
-// Hijack extracts the internal connection data. pgConn must be in an idle state. pgConn is unusable after hijacking.
-// Hijacking is typically only useful when using pgconn to establish a connection, but taking complete control of the
-// raw connection after that (e.g. a load balancer or proxy).
+// Hijack extracts the internal connection data. pgConn must be in an idle state. SyncConn should be called immediately
+// before Hijack. pgConn is unusable after hijacking. Hijacking is typically only useful when using pgconn to establish
+// a connection, but taking complete control of the raw connection after that (e.g. a load balancer or proxy).
//
// Due to the necessary exposure of internal implementation details, it is not covered by the semantic versioning
// compatibility.
@@ -1740,12 +1942,15 @@ func (pgConn *PgConn) Hijack() (*HijackedConn, error) {
TxStatus: pgConn.txStatus,
Frontend: pgConn.frontend,
Config: pgConn.config,
+ CustomData: pgConn.customData,
}, nil
}
// Construct created a PgConn from an already established connection to a PostgreSQL server. This is the inverse of
// PgConn.Hijack. The connection must be in an idle state.
//
+// hc.Frontend is replaced by a new pgproto3.Frontend built by hc.Config.BuildFrontend.
+//
// Due to the necessary exposure of internal implementation details, it is not covered by the semantic versioning
// compatibility.
func Construct(hc *HijackedConn) (*PgConn, error) {
@@ -1757,14 +1962,385 @@ func Construct(hc *HijackedConn) (*PgConn, error) {
txStatus: hc.TxStatus,
frontend: hc.Frontend,
config: hc.Config,
+ customData: hc.CustomData,
status: connStatusIdle,
- wbuf: make([]byte, 0, wbufLen),
cleanupDone: make(chan struct{}),
}
- pgConn.contextWatcher = newContextWatcher(pgConn.conn)
+ pgConn.contextWatcher = ctxwatch.NewContextWatcher(hc.Config.BuildContextWatcherHandler(pgConn))
+ pgConn.bgReader = bgreader.New(pgConn.conn)
+ pgConn.slowWriteTimer = time.AfterFunc(time.Duration(math.MaxInt64),
+ func() {
+ pgConn.bgReader.Start()
+ pgConn.bgReaderStarted <- struct{}{}
+ },
+ )
+ pgConn.slowWriteTimer.Stop()
+ pgConn.bgReaderStarted = make(chan struct{})
+ pgConn.frontend = hc.Config.BuildFrontend(pgConn.bgReader, pgConn.conn)
return pgConn, nil
}
+
+// Pipeline represents a connection in pipeline mode.
+//
+// SendPrepare, SendQueryParams, and SendQueryPrepared queue requests to the server. These requests are not written until
+// pipeline is flushed by Flush or Sync. Sync must be called after the last request is queued. Requests between
+// synchronization points are implicitly transactional unless explicit transaction control statements have been issued.
+//
+// The context the pipeline was started with is in effect for the entire life of the Pipeline.
+//
+// For a deeper understanding of pipeline mode see the PostgreSQL documentation for the extended query protocol
+// (https://www.postgresql.org/docs/current/protocol-flow.html#PROTOCOL-FLOW-EXT-QUERY) and the libpq pipeline mode
+// (https://www.postgresql.org/docs/current/libpq-pipeline-mode.html).
+type Pipeline struct {
+ conn *PgConn
+ ctx context.Context
+
+ expectedReadyForQueryCount int
+ pendingSync bool
+
+ err error
+ closed bool
+}
+
+// PipelineSync is returned by GetResults when a ReadyForQuery message is received.
+type PipelineSync struct{}
+
+// CloseComplete is returned by GetResults when a CloseComplete message is received.
+type CloseComplete struct{}
+
+// StartPipeline switches the connection to pipeline mode and returns a *Pipeline. In pipeline mode requests can be sent
+// to the server without waiting for a response. Close must be called on the returned *Pipeline to return the connection
+// to normal mode. While in pipeline mode, no methods that communicate with the server may be called except
+// CancelRequest and Close. ctx is in effect for entire life of the *Pipeline.
+//
+// Prefer ExecBatch when only sending one group of queries at once.
+func (pgConn *PgConn) StartPipeline(ctx context.Context) *Pipeline {
+ if err := pgConn.lock(); err != nil {
+ return &Pipeline{
+ closed: true,
+ err: err,
+ }
+ }
+
+ pgConn.pipeline = Pipeline{
+ conn: pgConn,
+ ctx: ctx,
+ }
+ pipeline := &pgConn.pipeline
+
+ if ctx != context.Background() {
+ select {
+ case <-ctx.Done():
+ pipeline.closed = true
+ pipeline.err = newContextAlreadyDoneError(ctx)
+ pgConn.unlock()
+ return pipeline
+ default:
+ }
+ pgConn.contextWatcher.Watch(ctx)
+ }
+
+ return pipeline
+}
+
+// SendPrepare is the pipeline version of *PgConn.Prepare.
+func (p *Pipeline) SendPrepare(name, sql string, paramOIDs []uint32) {
+ if p.closed {
+ return
+ }
+ p.pendingSync = true
+
+ p.conn.frontend.SendParse(&pgproto3.Parse{Name: name, Query: sql, ParameterOIDs: paramOIDs})
+ p.conn.frontend.SendDescribe(&pgproto3.Describe{ObjectType: 'S', Name: name})
+}
+
+// SendDeallocate deallocates a prepared statement.
+func (p *Pipeline) SendDeallocate(name string) {
+ if p.closed {
+ return
+ }
+ p.pendingSync = true
+
+ p.conn.frontend.SendClose(&pgproto3.Close{ObjectType: 'S', Name: name})
+}
+
+// SendQueryParams is the pipeline version of *PgConn.QueryParams.
+func (p *Pipeline) SendQueryParams(sql string, paramValues [][]byte, paramOIDs []uint32, paramFormats []int16, resultFormats []int16) {
+ if p.closed {
+ return
+ }
+ p.pendingSync = true
+
+ p.conn.frontend.SendParse(&pgproto3.Parse{Query: sql, ParameterOIDs: paramOIDs})
+ p.conn.frontend.SendBind(&pgproto3.Bind{ParameterFormatCodes: paramFormats, Parameters: paramValues, ResultFormatCodes: resultFormats})
+ p.conn.frontend.SendDescribe(&pgproto3.Describe{ObjectType: 'P'})
+ p.conn.frontend.SendExecute(&pgproto3.Execute{})
+}
+
+// SendQueryPrepared is the pipeline version of *PgConn.QueryPrepared.
+func (p *Pipeline) SendQueryPrepared(stmtName string, paramValues [][]byte, paramFormats []int16, resultFormats []int16) {
+ if p.closed {
+ return
+ }
+ p.pendingSync = true
+
+ p.conn.frontend.SendBind(&pgproto3.Bind{PreparedStatement: stmtName, ParameterFormatCodes: paramFormats, Parameters: paramValues, ResultFormatCodes: resultFormats})
+ p.conn.frontend.SendDescribe(&pgproto3.Describe{ObjectType: 'P'})
+ p.conn.frontend.SendExecute(&pgproto3.Execute{})
+}
+
+// Flush flushes the queued requests without establishing a synchronization point.
+func (p *Pipeline) Flush() error {
+ if p.closed {
+ if p.err != nil {
+ return p.err
+ }
+ return errors.New("pipeline closed")
+ }
+
+ err := p.conn.flushWithPotentialWriteReadDeadlock()
+ if err != nil {
+ err = normalizeTimeoutError(p.ctx, err)
+
+ p.conn.asyncClose()
+
+ p.conn.contextWatcher.Unwatch()
+ p.conn.unlock()
+ p.closed = true
+ p.err = err
+ return err
+ }
+
+ return nil
+}
+
+// Sync establishes a synchronization point and flushes the queued requests.
+func (p *Pipeline) Sync() error {
+ if p.closed {
+ if p.err != nil {
+ return p.err
+ }
+ return errors.New("pipeline closed")
+ }
+
+ p.conn.frontend.SendSync(&pgproto3.Sync{})
+ err := p.Flush()
+ if err != nil {
+ return err
+ }
+
+ p.pendingSync = false
+ p.expectedReadyForQueryCount++
+
+ return nil
+}
+
+// GetResults gets the next results. If results are present, results may be a *ResultReader, *StatementDescription, or
+// *PipelineSync. If an ErrorResponse is received from the server, results will be nil and err will be a *PgError. If no
+// results are available, results and err will both be nil.
+func (p *Pipeline) GetResults() (results any, err error) {
+ if p.closed {
+ if p.err != nil {
+ return nil, p.err
+ }
+ return nil, errors.New("pipeline closed")
+ }
+
+ if p.expectedReadyForQueryCount == 0 {
+ return nil, nil
+ }
+
+ return p.getResults()
+}
+
+func (p *Pipeline) getResults() (results any, err error) {
+ for {
+ msg, err := p.conn.receiveMessage()
+ if err != nil {
+ p.closed = true
+ p.err = err
+ p.conn.asyncClose()
+ return nil, normalizeTimeoutError(p.ctx, err)
+ }
+
+ switch msg := msg.(type) {
+ case *pgproto3.RowDescription:
+ p.conn.resultReader = ResultReader{
+ pgConn: p.conn,
+ pipeline: p,
+ ctx: p.ctx,
+ fieldDescriptions: p.conn.convertRowDescription(p.conn.fieldDescriptions[:], msg),
+ }
+ return &p.conn.resultReader, nil
+ case *pgproto3.CommandComplete:
+ p.conn.resultReader = ResultReader{
+ commandTag: p.conn.makeCommandTag(msg.CommandTag),
+ commandConcluded: true,
+ closed: true,
+ }
+ return &p.conn.resultReader, nil
+ case *pgproto3.ParseComplete:
+ peekedMsg, err := p.conn.peekMessage()
+ if err != nil {
+ p.conn.asyncClose()
+ return nil, normalizeTimeoutError(p.ctx, err)
+ }
+ if _, ok := peekedMsg.(*pgproto3.ParameterDescription); ok {
+ return p.getResultsPrepare()
+ }
+ case *pgproto3.CloseComplete:
+ return &CloseComplete{}, nil
+ case *pgproto3.ReadyForQuery:
+ p.expectedReadyForQueryCount--
+ return &PipelineSync{}, nil
+ case *pgproto3.ErrorResponse:
+ pgErr := ErrorResponseToPgError(msg)
+ return nil, pgErr
+ }
+
+ }
+}
+
+func (p *Pipeline) getResultsPrepare() (*StatementDescription, error) {
+ psd := &StatementDescription{}
+
+ for {
+ msg, err := p.conn.receiveMessage()
+ if err != nil {
+ p.conn.asyncClose()
+ return nil, normalizeTimeoutError(p.ctx, err)
+ }
+
+ switch msg := msg.(type) {
+ case *pgproto3.ParameterDescription:
+ psd.ParamOIDs = make([]uint32, len(msg.ParameterOIDs))
+ copy(psd.ParamOIDs, msg.ParameterOIDs)
+ case *pgproto3.RowDescription:
+ psd.Fields = p.conn.convertRowDescription(nil, msg)
+ return psd, nil
+
+ // NoData is returned instead of RowDescription when there is no expected result. e.g. An INSERT without a RETURNING
+ // clause.
+ case *pgproto3.NoData:
+ return psd, nil
+
+ // These should never happen here. But don't take chances that could lead to a deadlock.
+ case *pgproto3.ErrorResponse:
+ pgErr := ErrorResponseToPgError(msg)
+ return nil, pgErr
+ case *pgproto3.CommandComplete:
+ p.conn.asyncClose()
+ return nil, errors.New("BUG: received CommandComplete while handling Describe")
+ case *pgproto3.ReadyForQuery:
+ p.conn.asyncClose()
+ return nil, errors.New("BUG: received ReadyForQuery while handling Describe")
+ }
+ }
+}
+
+// Close closes the pipeline and returns the connection to normal mode.
+func (p *Pipeline) Close() error {
+ if p.closed {
+ return p.err
+ }
+
+ p.closed = true
+
+ if p.pendingSync {
+ p.conn.asyncClose()
+ p.err = errors.New("pipeline has unsynced requests")
+ p.conn.contextWatcher.Unwatch()
+ p.conn.unlock()
+
+ return p.err
+ }
+
+ for p.expectedReadyForQueryCount > 0 {
+ _, err := p.getResults()
+ if err != nil {
+ p.err = err
+ var pgErr *PgError
+ if !errors.As(err, &pgErr) {
+ p.conn.asyncClose()
+ break
+ }
+ }
+ }
+
+ p.conn.contextWatcher.Unwatch()
+ p.conn.unlock()
+
+ return p.err
+}
+
+// DeadlineContextWatcherHandler handles canceled contexts by setting a deadline on a net.Conn.
+type DeadlineContextWatcherHandler struct {
+ Conn net.Conn
+
+ // DeadlineDelay is the delay to set on the deadline set on net.Conn when the context is canceled.
+ DeadlineDelay time.Duration
+}
+
+func (h *DeadlineContextWatcherHandler) HandleCancel(ctx context.Context) {
+ h.Conn.SetDeadline(time.Now().Add(h.DeadlineDelay))
+}
+
+func (h *DeadlineContextWatcherHandler) HandleUnwatchAfterCancel() {
+ h.Conn.SetDeadline(time.Time{})
+}
+
+// CancelRequestContextWatcherHandler handles canceled contexts by sending a cancel request to the server. It also sets
+// a deadline on a net.Conn as a fallback.
+type CancelRequestContextWatcherHandler struct {
+ Conn *PgConn
+
+ // CancelRequestDelay is the delay before sending the cancel request to the server.
+ CancelRequestDelay time.Duration
+
+ // DeadlineDelay is the delay to set on the deadline set on net.Conn when the context is canceled.
+ DeadlineDelay time.Duration
+
+ cancelFinishedChan chan struct{}
+ handleUnwatchAfterCancelCalled func()
+}
+
+func (h *CancelRequestContextWatcherHandler) HandleCancel(context.Context) {
+ h.cancelFinishedChan = make(chan struct{})
+ var handleUnwatchedAfterCancelCalledCtx context.Context
+ handleUnwatchedAfterCancelCalledCtx, h.handleUnwatchAfterCancelCalled = context.WithCancel(context.Background())
+
+ deadline := time.Now().Add(h.DeadlineDelay)
+ h.Conn.conn.SetDeadline(deadline)
+
+ go func() {
+ defer close(h.cancelFinishedChan)
+
+ select {
+ case <-handleUnwatchedAfterCancelCalledCtx.Done():
+ return
+ case <-time.After(h.CancelRequestDelay):
+ }
+
+ cancelRequestCtx, cancel := context.WithDeadline(handleUnwatchedAfterCancelCalledCtx, deadline)
+ defer cancel()
+ h.Conn.CancelRequest(cancelRequestCtx)
+
+ // CancelRequest is inherently racy. Even though the cancel request has been received by the server at this point,
+ // it hasn't necessarily been delivered to the other connection. If we immediately return and the connection is
+ // immediately used then it is possible the CancelRequest will actually cancel our next query. The
+ // TestCancelRequestContextWatcherHandler Stress test can produce this error without the sleep below. The sleep time
+ // is arbitrary, but should be sufficient to prevent this error case.
+ time.Sleep(100 * time.Millisecond)
+ }()
+}
+
+func (h *CancelRequestContextWatcherHandler) HandleUnwatchAfterCancel() {
+ h.handleUnwatchAfterCancelCalled()
+ <-h.cancelFinishedChan
+
+ h.Conn.conn.SetDeadline(time.Time{})
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/README.md b/vendor/github.com/jackc/pgx/v5/pgproto3/README.md
new file mode 100644
index 0000000..7a26f1c
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/README.md
@@ -0,0 +1,7 @@
+# pgproto3
+
+Package pgproto3 is an encoder and decoder of the PostgreSQL wire protocol version 3.
+
+pgproto3 can be used as a foundation for PostgreSQL drivers, proxies, mock servers, load balancers and more.
+
+See example/pgfortune for a playful example of a fake PostgreSQL server.
diff --git a/vendor/github.com/jackc/pgproto3/v2/authentication_cleartext_password.go b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_cleartext_password.go
index 241fa60..ac2962e 100644
--- a/vendor/github.com/jackc/pgproto3/v2/authentication_cleartext_password.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_cleartext_password.go
@@ -5,7 +5,7 @@ import (
"encoding/json"
"errors"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
// AuthenticationCleartextPassword is a message sent from the backend indicating that a clear-text password is required.
@@ -35,11 +35,10 @@ func (dst *AuthenticationCleartextPassword) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *AuthenticationCleartextPassword) Encode(dst []byte) []byte {
- dst = append(dst, 'R')
- dst = pgio.AppendInt32(dst, 8)
+func (src *AuthenticationCleartextPassword) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'R')
dst = pgio.AppendUint32(dst, AuthTypeCleartextPassword)
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/authentication_gss.go b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_gss.go
index 5a3f3b1..178ef31 100644
--- a/vendor/github.com/jackc/pgproto3/v2/authentication_gss.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_gss.go
@@ -4,7 +4,8 @@ import (
"encoding/binary"
"encoding/json"
"errors"
- "github.com/jackc/pgio"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
)
type AuthenticationGSS struct{}
@@ -26,11 +27,10 @@ func (a *AuthenticationGSS) Decode(src []byte) error {
return nil
}
-func (a *AuthenticationGSS) Encode(dst []byte) []byte {
- dst = append(dst, 'R')
- dst = pgio.AppendInt32(dst, 4)
+func (a *AuthenticationGSS) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'R')
dst = pgio.AppendUint32(dst, AuthTypeGSS)
- return dst
+ return finishMessage(dst, sp)
}
func (a *AuthenticationGSS) MarshalJSON() ([]byte, error) {
diff --git a/vendor/github.com/jackc/pgproto3/v2/authentication_gss_continue.go b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_gss_continue.go
index cf8b183..2ba3f3b 100644
--- a/vendor/github.com/jackc/pgproto3/v2/authentication_gss_continue.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_gss_continue.go
@@ -4,7 +4,8 @@ import (
"encoding/binary"
"encoding/json"
"errors"
- "github.com/jackc/pgio"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
)
type AuthenticationGSSContinue struct {
@@ -30,12 +31,11 @@ func (a *AuthenticationGSSContinue) Decode(src []byte) error {
return nil
}
-func (a *AuthenticationGSSContinue) Encode(dst []byte) []byte {
- dst = append(dst, 'R')
- dst = pgio.AppendInt32(dst, int32(len(a.Data))+8)
+func (a *AuthenticationGSSContinue) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'R')
dst = pgio.AppendUint32(dst, AuthTypeGSSCont)
dst = append(dst, a.Data...)
- return dst
+ return finishMessage(dst, sp)
}
func (a *AuthenticationGSSContinue) MarshalJSON() ([]byte, error) {
diff --git a/vendor/github.com/jackc/pgproto3/v2/authentication_md5_password.go b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_md5_password.go
index 32ec039..854c640 100644
--- a/vendor/github.com/jackc/pgproto3/v2/authentication_md5_password.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_md5_password.go
@@ -5,7 +5,7 @@ import (
"encoding/json"
"errors"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
// AuthenticationMD5Password is a message sent from the backend indicating that an MD5 hashed password is required.
@@ -38,12 +38,11 @@ func (dst *AuthenticationMD5Password) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *AuthenticationMD5Password) Encode(dst []byte) []byte {
- dst = append(dst, 'R')
- dst = pgio.AppendInt32(dst, 12)
+func (src *AuthenticationMD5Password) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'R')
dst = pgio.AppendUint32(dst, AuthTypeMD5Password)
dst = append(dst, src.Salt[:]...)
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/authentication_ok.go b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_ok.go
index 2b476fe..ec11d39 100644
--- a/vendor/github.com/jackc/pgproto3/v2/authentication_ok.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_ok.go
@@ -5,7 +5,7 @@ import (
"encoding/json"
"errors"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
// AuthenticationOk is a message sent from the backend indicating that authentication was successful.
@@ -35,11 +35,10 @@ func (dst *AuthenticationOk) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *AuthenticationOk) Encode(dst []byte) []byte {
- dst = append(dst, 'R')
- dst = pgio.AppendInt32(dst, 8)
+func (src *AuthenticationOk) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'R')
dst = pgio.AppendUint32(dst, AuthTypeOk)
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/authentication_sasl.go b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_sasl.go
index bdcb2c3..e66580f 100644
--- a/vendor/github.com/jackc/pgproto3/v2/authentication_sasl.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_sasl.go
@@ -6,7 +6,7 @@ import (
"encoding/json"
"errors"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
// AuthenticationSASL is a message sent from the backend indicating that SASL authentication is required.
@@ -36,20 +36,19 @@ func (dst *AuthenticationSASL) Decode(src []byte) error {
authMechanisms := src[4:]
for len(authMechanisms) > 1 {
idx := bytes.IndexByte(authMechanisms, 0)
- if idx > 0 {
- dst.AuthMechanisms = append(dst.AuthMechanisms, string(authMechanisms[:idx]))
- authMechanisms = authMechanisms[idx+1:]
+ if idx == -1 {
+ return &invalidMessageFormatErr{messageType: "AuthenticationSASL", details: "unterminated string"}
}
+ dst.AuthMechanisms = append(dst.AuthMechanisms, string(authMechanisms[:idx]))
+ authMechanisms = authMechanisms[idx+1:]
}
return nil
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *AuthenticationSASL) Encode(dst []byte) []byte {
- dst = append(dst, 'R')
- sp := len(dst)
- dst = pgio.AppendInt32(dst, -1)
+func (src *AuthenticationSASL) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'R')
dst = pgio.AppendUint32(dst, AuthTypeSASL)
for _, s := range src.AuthMechanisms {
@@ -58,9 +57,7 @@ func (src *AuthenticationSASL) Encode(dst []byte) []byte {
}
dst = append(dst, 0)
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/authentication_sasl_continue.go b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_sasl_continue.go
index 7f4a9c2..70fba4a 100644
--- a/vendor/github.com/jackc/pgproto3/v2/authentication_sasl_continue.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_sasl_continue.go
@@ -5,7 +5,7 @@ import (
"encoding/json"
"errors"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
// AuthenticationSASLContinue is a message sent from the backend containing a SASL challenge.
@@ -38,17 +38,11 @@ func (dst *AuthenticationSASLContinue) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *AuthenticationSASLContinue) Encode(dst []byte) []byte {
- dst = append(dst, 'R')
- sp := len(dst)
- dst = pgio.AppendInt32(dst, -1)
+func (src *AuthenticationSASLContinue) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'R')
dst = pgio.AppendUint32(dst, AuthTypeSASLContinue)
-
dst = append(dst, src.Data...)
-
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/authentication_sasl_final.go b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_sasl_final.go
index d82b9ee..84976c2 100644
--- a/vendor/github.com/jackc/pgproto3/v2/authentication_sasl_final.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/authentication_sasl_final.go
@@ -5,7 +5,7 @@ import (
"encoding/json"
"errors"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
// AuthenticationSASLFinal is a message sent from the backend indicating a SASL authentication has completed.
@@ -38,17 +38,11 @@ func (dst *AuthenticationSASLFinal) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *AuthenticationSASLFinal) Encode(dst []byte) []byte {
- dst = append(dst, 'R')
- sp := len(dst)
- dst = pgio.AppendInt32(dst, -1)
+func (src *AuthenticationSASLFinal) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'R')
dst = pgio.AppendUint32(dst, AuthTypeSASLFinal)
-
dst = append(dst, src.Data...)
-
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Unmarshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/backend.go b/vendor/github.com/jackc/pgx/v5/pgproto3/backend.go
index 1f14365..28cff04 100644
--- a/vendor/github.com/jackc/pgproto3/v2/backend.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/backend.go
@@ -1,17 +1,24 @@
package pgproto3
import (
+ "bytes"
"encoding/binary"
- "errors"
"fmt"
"io"
)
// Backend acts as a server for the PostgreSQL wire protocol version 3.
type Backend struct {
- cr ChunkReader
+ cr *chunkReader
w io.Writer
+ // tracer is used to trace messages when Send or Receive is called. This means an outbound message is traced
+ // before it is actually transmitted (i.e. before Flush).
+ tracer *tracer
+
+ wbuf []byte
+ encodeError error
+
// Frontend message flyweights
bind Bind
cancelRequest CancelRequest
@@ -32,6 +39,7 @@ type Backend struct {
terminate Terminate
bodyLen int
+ maxBodyLen int // maxBodyLen is the maximum length of a message body in octets. If a message body exceeds this length, Receive will return an error.
msgType byte
partialMsg bool
authType uint32
@@ -43,14 +51,68 @@ const (
)
// NewBackend creates a new Backend.
-func NewBackend(cr ChunkReader, w io.Writer) *Backend {
+func NewBackend(r io.Reader, w io.Writer) *Backend {
+ cr := newChunkReader(r, 0)
return &Backend{cr: cr, w: w}
}
-// Send sends a message to the frontend.
-func (b *Backend) Send(msg BackendMessage) error {
- _, err := b.w.Write(msg.Encode(nil))
- return err
+// Send sends a message to the frontend (i.e. the client). The message is buffered until Flush is called. Any error
+// encountered will be returned from Flush.
+func (b *Backend) Send(msg BackendMessage) {
+ if b.encodeError != nil {
+ return
+ }
+
+ prevLen := len(b.wbuf)
+ newBuf, err := msg.Encode(b.wbuf)
+ if err != nil {
+ b.encodeError = err
+ return
+ }
+ b.wbuf = newBuf
+
+ if b.tracer != nil {
+ b.tracer.traceMessage('B', int32(len(b.wbuf)-prevLen), msg)
+ }
+}
+
+// Flush writes any pending messages to the frontend (i.e. the client).
+func (b *Backend) Flush() error {
+ if err := b.encodeError; err != nil {
+ b.encodeError = nil
+ b.wbuf = b.wbuf[:0]
+ return &writeError{err: err, safeToRetry: true}
+ }
+
+ n, err := b.w.Write(b.wbuf)
+
+ const maxLen = 1024
+ if len(b.wbuf) > maxLen {
+ b.wbuf = make([]byte, 0, maxLen)
+ } else {
+ b.wbuf = b.wbuf[:0]
+ }
+
+ if err != nil {
+ return &writeError{err: err, safeToRetry: n == 0}
+ }
+
+ return nil
+}
+
+// Trace starts tracing the message traffic to w. It writes in a similar format to that produced by the libpq function
+// PQtrace.
+func (b *Backend) Trace(w io.Writer, options TracerOptions) {
+ b.tracer = &tracer{
+ w: w,
+ buf: &bytes.Buffer{},
+ TracerOptions: options,
+ }
+}
+
+// Untrace stops tracing.
+func (b *Backend) Untrace() {
+ b.tracer = nil
}
// ReceiveStartupMessage receives the initial connection message. This method is used of the normal Receive method
@@ -113,11 +175,17 @@ func (b *Backend) Receive() (FrontendMessage, error) {
}
b.msgType = header[0]
- b.bodyLen = int(binary.BigEndian.Uint32(header[1:])) - 4
- b.partialMsg = true
- if b.bodyLen < 0 {
- return nil, errors.New("invalid message with negative body length received")
+
+ msgLength := int(binary.BigEndian.Uint32(header[1:]))
+ if msgLength < 4 {
+ return nil, fmt.Errorf("invalid message length: %d", msgLength)
+ }
+
+ b.bodyLen = msgLength - 4
+ if b.maxBodyLen > 0 && b.bodyLen > b.maxBodyLen {
+ return nil, &ExceededMaxBodyLenErr{b.maxBodyLen, b.bodyLen}
}
+ b.partialMsg = true
}
var msg FrontendMessage
@@ -155,7 +223,7 @@ func (b *Backend) Receive() (FrontendMessage, error) {
case AuthTypeCleartextPassword, AuthTypeMD5Password:
fallthrough
default:
- // to maintain backwards compatability
+ // to maintain backwards compatibility
msg = &PasswordMessage{}
}
case 'Q':
@@ -176,7 +244,15 @@ func (b *Backend) Receive() (FrontendMessage, error) {
b.partialMsg = false
err = msg.Decode(msgBody)
- return msg, err
+ if err != nil {
+ return nil, err
+ }
+
+ if b.tracer != nil {
+ b.tracer.traceMessage('F', int32(5+len(msgBody)), msg)
+ }
+
+ return msg, nil
}
// SetAuthType sets the authentication type in the backend.
@@ -184,11 +260,11 @@ func (b *Backend) Receive() (FrontendMessage, error) {
// contextual identification of FrontendMessages. For example, in the
// PG message flow documentation for PasswordMessage:
//
-// Byte1('p')
+// Byte1('p')
//
-// Identifies the message as a password response. Note that this is also used for
-// GSSAPI, SSPI and SASL response messages. The exact message type can be deduced from
-// the context.
+// Identifies the message as a password response. Note that this is also used for
+// GSSAPI, SSPI and SASL response messages. The exact message type can be deduced from
+// the context.
//
// Since the Frontend does not know about the state of a backend, it is important
// to call SetAuthType() after an authentication request is received by the Frontend.
@@ -211,3 +287,13 @@ func (b *Backend) SetAuthType(authType uint32) error {
return nil
}
+
+// SetMaxBodyLen sets the maximum length of a message body in octets.
+// If a message body exceeds this length, Receive will return an error.
+// This is useful for protecting against malicious clients that send
+// large messages with the intent of causing memory exhaustion.
+// The default value is 0.
+// If maxBodyLen is 0, then no maximum is enforced.
+func (b *Backend) SetMaxBodyLen(maxBodyLen int) {
+ b.maxBodyLen = maxBodyLen
+}
diff --git a/vendor/github.com/jackc/pgproto3/v2/backend_key_data.go b/vendor/github.com/jackc/pgx/v5/pgproto3/backend_key_data.go
index ca20dd2..23f5da6 100644
--- a/vendor/github.com/jackc/pgproto3/v2/backend_key_data.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/backend_key_data.go
@@ -4,7 +4,7 @@ import (
"encoding/binary"
"encoding/json"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
type BackendKeyData struct {
@@ -29,12 +29,11 @@ func (dst *BackendKeyData) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *BackendKeyData) Encode(dst []byte) []byte {
- dst = append(dst, 'K')
- dst = pgio.AppendUint32(dst, 12)
+func (src *BackendKeyData) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'K')
dst = pgio.AppendUint32(dst, src.ProcessID)
dst = pgio.AppendUint32(dst, src.SecretKey)
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/big_endian.go b/vendor/github.com/jackc/pgx/v5/pgproto3/big_endian.go
index f7bdb97..f7bdb97 100644
--- a/vendor/github.com/jackc/pgproto3/v2/big_endian.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/big_endian.go
diff --git a/vendor/github.com/jackc/pgproto3/v2/bind.go b/vendor/github.com/jackc/pgx/v5/pgproto3/bind.go
index e9664f5..ad6ac48 100644
--- a/vendor/github.com/jackc/pgproto3/v2/bind.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/bind.go
@@ -5,9 +5,11 @@ import (
"encoding/binary"
"encoding/hex"
"encoding/json"
+ "errors"
"fmt"
+ "math"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
type Bind struct {
@@ -108,21 +110,25 @@ func (dst *Bind) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *Bind) Encode(dst []byte) []byte {
- dst = append(dst, 'B')
- sp := len(dst)
- dst = pgio.AppendInt32(dst, -1)
+func (src *Bind) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'B')
dst = append(dst, src.DestinationPortal...)
dst = append(dst, 0)
dst = append(dst, src.PreparedStatement...)
dst = append(dst, 0)
+ if len(src.ParameterFormatCodes) > math.MaxUint16 {
+ return nil, errors.New("too many parameter format codes")
+ }
dst = pgio.AppendUint16(dst, uint16(len(src.ParameterFormatCodes)))
for _, fc := range src.ParameterFormatCodes {
dst = pgio.AppendInt16(dst, fc)
}
+ if len(src.Parameters) > math.MaxUint16 {
+ return nil, errors.New("too many parameters")
+ }
dst = pgio.AppendUint16(dst, uint16(len(src.Parameters)))
for _, p := range src.Parameters {
if p == nil {
@@ -134,14 +140,15 @@ func (src *Bind) Encode(dst []byte) []byte {
dst = append(dst, p...)
}
+ if len(src.ResultFormatCodes) > math.MaxUint16 {
+ return nil, errors.New("too many result format codes")
+ }
dst = pgio.AppendUint16(dst, uint16(len(src.ResultFormatCodes)))
for _, fc := range src.ResultFormatCodes {
dst = pgio.AppendInt16(dst, fc)
}
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/bind_complete.go b/vendor/github.com/jackc/pgx/v5/pgproto3/bind_complete.go
index 3be256c..bacf30d 100644
--- a/vendor/github.com/jackc/pgproto3/v2/bind_complete.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/bind_complete.go
@@ -20,8 +20,8 @@ func (dst *BindComplete) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *BindComplete) Encode(dst []byte) []byte {
- return append(dst, '2', 0, 0, 0, 4)
+func (src *BindComplete) Encode(dst []byte) ([]byte, error) {
+ return append(dst, '2', 0, 0, 0, 4), nil
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/cancel_request.go b/vendor/github.com/jackc/pgx/v5/pgproto3/cancel_request.go
index 942e404..6b52dd9 100644
--- a/vendor/github.com/jackc/pgproto3/v2/cancel_request.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/cancel_request.go
@@ -5,7 +5,7 @@ import (
"encoding/json"
"errors"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
const cancelRequestCode = 80877102
@@ -36,12 +36,12 @@ func (dst *CancelRequest) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 4 byte message length.
-func (src *CancelRequest) Encode(dst []byte) []byte {
+func (src *CancelRequest) Encode(dst []byte) ([]byte, error) {
dst = pgio.AppendInt32(dst, 16)
dst = pgio.AppendInt32(dst, cancelRequestCode)
dst = pgio.AppendUint32(dst, src.ProcessID)
dst = pgio.AppendUint32(dst, src.SecretKey)
- return dst
+ return dst, nil
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/chunkreader.go b/vendor/github.com/jackc/pgx/v5/pgproto3/chunkreader.go
new file mode 100644
index 0000000..fc0fa61
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/chunkreader.go
@@ -0,0 +1,90 @@
+package pgproto3
+
+import (
+ "io"
+
+ "github.com/jackc/pgx/v5/internal/iobufpool"
+)
+
+// chunkReader is a io.Reader wrapper that minimizes IO reads and memory allocations. It allocates memory in chunks and
+// will read as much as will fit in the current buffer in a single call regardless of how large a read is actually
+// requested. The memory returned via Next is only valid until the next call to Next.
+//
+// This is roughly equivalent to a bufio.Reader that only uses Peek and Discard to never copy bytes.
+type chunkReader struct {
+ r io.Reader
+
+ buf *[]byte
+ rp, wp int // buf read position and write position
+
+ minBufSize int
+}
+
+// newChunkReader creates and returns a new chunkReader for r with default configuration. If minBufSize is <= 0 it uses
+// a default value.
+func newChunkReader(r io.Reader, minBufSize int) *chunkReader {
+ if minBufSize <= 0 {
+ // By historical reasons Postgres currently has 8KB send buffer inside,
+ // so here we want to have at least the same size buffer.
+ // @see https://github.com/postgres/postgres/blob/249d64999615802752940e017ee5166e726bc7cd/src/backend/libpq/pqcomm.c#L134
+ // @see https://www.postgresql.org/message-id/0cdc5485-cb3c-5e16-4a46-e3b2f7a41322%40ya.ru
+ //
+ // In addition, testing has found no benefit of any larger buffer.
+ minBufSize = 8192
+ }
+
+ return &chunkReader{
+ r: r,
+ minBufSize: minBufSize,
+ buf: iobufpool.Get(minBufSize),
+ }
+}
+
+// Next returns buf filled with the next n bytes. buf is only valid until next call of Next. If an error occurs, buf
+// will be nil.
+func (r *chunkReader) Next(n int) (buf []byte, err error) {
+ // Reset the buffer if it is empty
+ if r.rp == r.wp {
+ if len(*r.buf) != r.minBufSize {
+ iobufpool.Put(r.buf)
+ r.buf = iobufpool.Get(r.minBufSize)
+ }
+ r.rp = 0
+ r.wp = 0
+ }
+
+ // n bytes already in buf
+ if (r.wp - r.rp) >= n {
+ buf = (*r.buf)[r.rp : r.rp+n : r.rp+n]
+ r.rp += n
+ return buf, err
+ }
+
+ // buf is smaller than requested number of bytes
+ if len(*r.buf) < n {
+ bigBuf := iobufpool.Get(n)
+ r.wp = copy((*bigBuf), (*r.buf)[r.rp:r.wp])
+ r.rp = 0
+ iobufpool.Put(r.buf)
+ r.buf = bigBuf
+ }
+
+ // buf is large enough, but need to shift filled area to start to make enough contiguous space
+ minReadCount := n - (r.wp - r.rp)
+ if (len(*r.buf) - r.wp) < minReadCount {
+ r.wp = copy((*r.buf), (*r.buf)[r.rp:r.wp])
+ r.rp = 0
+ }
+
+ // Read at least the required number of bytes from the underlying io.Reader
+ readBytesCount, err := io.ReadAtLeast(r.r, (*r.buf)[r.wp:], minReadCount)
+ r.wp += readBytesCount
+ // fmt.Println("read", n)
+ if err != nil {
+ return nil, err
+ }
+
+ buf = (*r.buf)[r.rp : r.rp+n : r.rp+n]
+ r.rp += n
+ return buf, nil
+}
diff --git a/vendor/github.com/jackc/pgproto3/v2/close.go b/vendor/github.com/jackc/pgx/v5/pgproto3/close.go
index a45f2b9..0b50f27 100644
--- a/vendor/github.com/jackc/pgproto3/v2/close.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/close.go
@@ -4,8 +4,6 @@ import (
"bytes"
"encoding/json"
"errors"
-
- "github.com/jackc/pgio"
)
type Close struct {
@@ -37,18 +35,12 @@ func (dst *Close) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *Close) Encode(dst []byte) []byte {
- dst = append(dst, 'C')
- sp := len(dst)
- dst = pgio.AppendInt32(dst, -1)
-
+func (src *Close) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'C')
dst = append(dst, src.ObjectType)
dst = append(dst, src.Name...)
dst = append(dst, 0)
-
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/close_complete.go b/vendor/github.com/jackc/pgx/v5/pgproto3/close_complete.go
index 1d7b8f0..833f7a1 100644
--- a/vendor/github.com/jackc/pgproto3/v2/close_complete.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/close_complete.go
@@ -20,8 +20,8 @@ func (dst *CloseComplete) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *CloseComplete) Encode(dst []byte) []byte {
- return append(dst, '3', 0, 0, 0, 4)
+func (src *CloseComplete) Encode(dst []byte) ([]byte, error) {
+ return append(dst, '3', 0, 0, 0, 4), nil
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/command_complete.go b/vendor/github.com/jackc/pgx/v5/pgproto3/command_complete.go
index cdc49f3..eba7094 100644
--- a/vendor/github.com/jackc/pgproto3/v2/command_complete.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/command_complete.go
@@ -3,8 +3,6 @@ package pgproto3
import (
"bytes"
"encoding/json"
-
- "github.com/jackc/pgio"
)
type CommandComplete struct {
@@ -18,8 +16,11 @@ func (*CommandComplete) Backend() {}
// type identifier and 4 byte message length.
func (dst *CommandComplete) Decode(src []byte) error {
idx := bytes.IndexByte(src, 0)
+ if idx == -1 {
+ return &invalidMessageFormatErr{messageType: "CommandComplete", details: "unterminated string"}
+ }
if idx != len(src)-1 {
- return &invalidMessageFormatErr{messageType: "CommandComplete"}
+ return &invalidMessageFormatErr{messageType: "CommandComplete", details: "string terminated too early"}
}
dst.CommandTag = src[:idx]
@@ -28,17 +29,11 @@ func (dst *CommandComplete) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *CommandComplete) Encode(dst []byte) []byte {
- dst = append(dst, 'C')
- sp := len(dst)
- dst = pgio.AppendInt32(dst, -1)
-
+func (src *CommandComplete) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'C')
dst = append(dst, src.CommandTag...)
dst = append(dst, 0)
-
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/copy_both_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_both_response.go
index 4a1c3a0..99e1afe 100644
--- a/vendor/github.com/jackc/pgproto3/v2/copy_both_response.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_both_response.go
@@ -5,8 +5,9 @@ import (
"encoding/binary"
"encoding/json"
"errors"
+ "math"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
type CopyBothResponse struct {
@@ -44,19 +45,18 @@ func (dst *CopyBothResponse) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *CopyBothResponse) Encode(dst []byte) []byte {
- dst = append(dst, 'W')
- sp := len(dst)
- dst = pgio.AppendInt32(dst, -1)
+func (src *CopyBothResponse) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'W')
dst = append(dst, src.OverallFormat)
+ if len(src.ColumnFormatCodes) > math.MaxUint16 {
+ return nil, errors.New("too many column format codes")
+ }
dst = pgio.AppendUint16(dst, uint16(len(src.ColumnFormatCodes)))
for _, fc := range src.ColumnFormatCodes {
dst = pgio.AppendUint16(dst, fc)
}
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/copy_data.go b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_data.go
index 128aa19..89ecdd4 100644
--- a/vendor/github.com/jackc/pgproto3/v2/copy_data.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_data.go
@@ -3,8 +3,6 @@ package pgproto3
import (
"encoding/hex"
"encoding/json"
-
- "github.com/jackc/pgio"
)
type CopyData struct {
@@ -25,11 +23,10 @@ func (dst *CopyData) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *CopyData) Encode(dst []byte) []byte {
- dst = append(dst, 'd')
- dst = pgio.AppendInt32(dst, int32(4+len(src.Data)))
+func (src *CopyData) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'd')
dst = append(dst, src.Data...)
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/copy_done.go b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_done.go
index 0e13282..040814d 100644
--- a/vendor/github.com/jackc/pgproto3/v2/copy_done.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_done.go
@@ -24,8 +24,8 @@ func (dst *CopyDone) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *CopyDone) Encode(dst []byte) []byte {
- return append(dst, 'c', 0, 0, 0, 4)
+func (src *CopyDone) Encode(dst []byte) ([]byte, error) {
+ return append(dst, 'c', 0, 0, 0, 4), nil
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/copy_fail.go b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_fail.go
index 78ff0b3..72a85fd 100644
--- a/vendor/github.com/jackc/pgproto3/v2/copy_fail.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_fail.go
@@ -3,8 +3,6 @@ package pgproto3
import (
"bytes"
"encoding/json"
-
- "github.com/jackc/pgio"
)
type CopyFail struct {
@@ -28,17 +26,11 @@ func (dst *CopyFail) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *CopyFail) Encode(dst []byte) []byte {
- dst = append(dst, 'f')
- sp := len(dst)
- dst = pgio.AppendInt32(dst, -1)
-
+func (src *CopyFail) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'f')
dst = append(dst, src.Message...)
dst = append(dst, 0)
-
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/copy_in_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_in_response.go
index 80733ad..06cf99c 100644
--- a/vendor/github.com/jackc/pgproto3/v2/copy_in_response.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_in_response.go
@@ -5,8 +5,9 @@ import (
"encoding/binary"
"encoding/json"
"errors"
+ "math"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
type CopyInResponse struct {
@@ -44,20 +45,19 @@ func (dst *CopyInResponse) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *CopyInResponse) Encode(dst []byte) []byte {
- dst = append(dst, 'G')
- sp := len(dst)
- dst = pgio.AppendInt32(dst, -1)
+func (src *CopyInResponse) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'G')
dst = append(dst, src.OverallFormat)
+ if len(src.ColumnFormatCodes) > math.MaxUint16 {
+ return nil, errors.New("too many column format codes")
+ }
dst = pgio.AppendUint16(dst, uint16(len(src.ColumnFormatCodes)))
for _, fc := range src.ColumnFormatCodes {
dst = pgio.AppendUint16(dst, fc)
}
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/copy_out_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_out_response.go
index 5e607e3..549e916 100644
--- a/vendor/github.com/jackc/pgproto3/v2/copy_out_response.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/copy_out_response.go
@@ -5,8 +5,9 @@ import (
"encoding/binary"
"encoding/json"
"errors"
+ "math"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
type CopyOutResponse struct {
@@ -43,21 +44,20 @@ func (dst *CopyOutResponse) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *CopyOutResponse) Encode(dst []byte) []byte {
- dst = append(dst, 'H')
- sp := len(dst)
- dst = pgio.AppendInt32(dst, -1)
+func (src *CopyOutResponse) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'H')
dst = append(dst, src.OverallFormat)
+ if len(src.ColumnFormatCodes) > math.MaxUint16 {
+ return nil, errors.New("too many column format codes")
+ }
dst = pgio.AppendUint16(dst, uint16(len(src.ColumnFormatCodes)))
for _, fc := range src.ColumnFormatCodes {
dst = pgio.AppendUint16(dst, fc)
}
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/data_row.go b/vendor/github.com/jackc/pgx/v5/pgproto3/data_row.go
index 6376876..fdfb0f7 100644
--- a/vendor/github.com/jackc/pgproto3/v2/data_row.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/data_row.go
@@ -4,8 +4,10 @@ import (
"encoding/binary"
"encoding/hex"
"encoding/json"
+ "errors"
+ "math"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
type DataRow struct {
@@ -43,19 +45,19 @@ func (dst *DataRow) Decode(src []byte) error {
return &invalidMessageFormatErr{messageType: "DataRow"}
}
- msgSize := int(int32(binary.BigEndian.Uint32(src[rp:])))
+ valueLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
rp += 4
// null
- if msgSize == -1 {
+ if valueLen == -1 {
dst.Values[i] = nil
} else {
- if len(src[rp:]) < msgSize {
+ if len(src[rp:]) < valueLen || valueLen < 0 {
return &invalidMessageFormatErr{messageType: "DataRow"}
}
- dst.Values[i] = src[rp : rp+msgSize : rp+msgSize]
- rp += msgSize
+ dst.Values[i] = src[rp : rp+valueLen : rp+valueLen]
+ rp += valueLen
}
}
@@ -63,11 +65,12 @@ func (dst *DataRow) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *DataRow) Encode(dst []byte) []byte {
- dst = append(dst, 'D')
- sp := len(dst)
- dst = pgio.AppendInt32(dst, -1)
+func (src *DataRow) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'D')
+ if len(src.Values) > math.MaxUint16 {
+ return nil, errors.New("too many values")
+ }
dst = pgio.AppendUint16(dst, uint16(len(src.Values)))
for _, v := range src.Values {
if v == nil {
@@ -79,9 +82,7 @@ func (src *DataRow) Encode(dst []byte) []byte {
dst = append(dst, v...)
}
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/describe.go b/vendor/github.com/jackc/pgx/v5/pgproto3/describe.go
index 0d825db..89feff2 100644
--- a/vendor/github.com/jackc/pgproto3/v2/describe.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/describe.go
@@ -4,8 +4,6 @@ import (
"bytes"
"encoding/json"
"errors"
-
- "github.com/jackc/pgio"
)
type Describe struct {
@@ -37,18 +35,12 @@ func (dst *Describe) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *Describe) Encode(dst []byte) []byte {
- dst = append(dst, 'D')
- sp := len(dst)
- dst = pgio.AppendInt32(dst, -1)
-
+func (src *Describe) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'D')
dst = append(dst, src.ObjectType)
dst = append(dst, src.Name...)
dst = append(dst, 0)
-
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/doc.go b/vendor/github.com/jackc/pgx/v5/pgproto3/doc.go
new file mode 100644
index 0000000..0afd18e
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/doc.go
@@ -0,0 +1,11 @@
+// Package pgproto3 is an encoder and decoder of the PostgreSQL wire protocol version 3.
+//
+// The primary interfaces are Frontend and Backend. They correspond to a client and server respectively. Messages are
+// sent with Send (or a specialized Send variant). Messages are automatically buffered to minimize small writes. Call
+// Flush to ensure a message has actually been sent.
+//
+// The Trace method of Frontend and Backend can be used to examine the wire-level message traffic. It outputs in a
+// similar format to the PQtrace function in libpq.
+//
+// See https://www.postgresql.org/docs/current/protocol-message-formats.html for meanings of the different messages.
+package pgproto3
diff --git a/vendor/github.com/jackc/pgproto3/v2/empty_query_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/empty_query_response.go
index 2b85e74..cb6cca0 100644
--- a/vendor/github.com/jackc/pgproto3/v2/empty_query_response.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/empty_query_response.go
@@ -20,8 +20,8 @@ func (dst *EmptyQueryResponse) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *EmptyQueryResponse) Encode(dst []byte) []byte {
- return append(dst, 'I', 0, 0, 0, 4)
+func (src *EmptyQueryResponse) Encode(dst []byte) ([]byte, error) {
+ return append(dst, 'I', 0, 0, 0, 4), nil
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/error_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/error_response.go
index ec51e01..6ef9bd0 100644
--- a/vendor/github.com/jackc/pgproto3/v2/error_response.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/error_response.go
@@ -2,7 +2,6 @@ package pgproto3
import (
"bytes"
- "encoding/binary"
"encoding/json"
"strconv"
)
@@ -111,120 +110,113 @@ func (dst *ErrorResponse) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *ErrorResponse) Encode(dst []byte) []byte {
- return append(dst, src.marshalBinary('E')...)
+func (src *ErrorResponse) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'E')
+ dst = src.appendFields(dst)
+ return finishMessage(dst, sp)
}
-func (src *ErrorResponse) marshalBinary(typeByte byte) []byte {
- var bigEndian BigEndianBuf
- buf := &bytes.Buffer{}
-
- buf.WriteByte(typeByte)
- buf.Write(bigEndian.Uint32(0))
-
+func (src *ErrorResponse) appendFields(dst []byte) []byte {
if src.Severity != "" {
- buf.WriteByte('S')
- buf.WriteString(src.Severity)
- buf.WriteByte(0)
+ dst = append(dst, 'S')
+ dst = append(dst, src.Severity...)
+ dst = append(dst, 0)
}
if src.SeverityUnlocalized != "" {
- buf.WriteByte('V')
- buf.WriteString(src.SeverityUnlocalized)
- buf.WriteByte(0)
+ dst = append(dst, 'V')
+ dst = append(dst, src.SeverityUnlocalized...)
+ dst = append(dst, 0)
}
if src.Code != "" {
- buf.WriteByte('C')
- buf.WriteString(src.Code)
- buf.WriteByte(0)
+ dst = append(dst, 'C')
+ dst = append(dst, src.Code...)
+ dst = append(dst, 0)
}
if src.Message != "" {
- buf.WriteByte('M')
- buf.WriteString(src.Message)
- buf.WriteByte(0)
+ dst = append(dst, 'M')
+ dst = append(dst, src.Message...)
+ dst = append(dst, 0)
}
if src.Detail != "" {
- buf.WriteByte('D')
- buf.WriteString(src.Detail)
- buf.WriteByte(0)
+ dst = append(dst, 'D')
+ dst = append(dst, src.Detail...)
+ dst = append(dst, 0)
}
if src.Hint != "" {
- buf.WriteByte('H')
- buf.WriteString(src.Hint)
- buf.WriteByte(0)
+ dst = append(dst, 'H')
+ dst = append(dst, src.Hint...)
+ dst = append(dst, 0)
}
if src.Position != 0 {
- buf.WriteByte('P')
- buf.WriteString(strconv.Itoa(int(src.Position)))
- buf.WriteByte(0)
+ dst = append(dst, 'P')
+ dst = append(dst, strconv.Itoa(int(src.Position))...)
+ dst = append(dst, 0)
}
if src.InternalPosition != 0 {
- buf.WriteByte('p')
- buf.WriteString(strconv.Itoa(int(src.InternalPosition)))
- buf.WriteByte(0)
+ dst = append(dst, 'p')
+ dst = append(dst, strconv.Itoa(int(src.InternalPosition))...)
+ dst = append(dst, 0)
}
if src.InternalQuery != "" {
- buf.WriteByte('q')
- buf.WriteString(src.InternalQuery)
- buf.WriteByte(0)
+ dst = append(dst, 'q')
+ dst = append(dst, src.InternalQuery...)
+ dst = append(dst, 0)
}
if src.Where != "" {
- buf.WriteByte('W')
- buf.WriteString(src.Where)
- buf.WriteByte(0)
+ dst = append(dst, 'W')
+ dst = append(dst, src.Where...)
+ dst = append(dst, 0)
}
if src.SchemaName != "" {
- buf.WriteByte('s')
- buf.WriteString(src.SchemaName)
- buf.WriteByte(0)
+ dst = append(dst, 's')
+ dst = append(dst, src.SchemaName...)
+ dst = append(dst, 0)
}
if src.TableName != "" {
- buf.WriteByte('t')
- buf.WriteString(src.TableName)
- buf.WriteByte(0)
+ dst = append(dst, 't')
+ dst = append(dst, src.TableName...)
+ dst = append(dst, 0)
}
if src.ColumnName != "" {
- buf.WriteByte('c')
- buf.WriteString(src.ColumnName)
- buf.WriteByte(0)
+ dst = append(dst, 'c')
+ dst = append(dst, src.ColumnName...)
+ dst = append(dst, 0)
}
if src.DataTypeName != "" {
- buf.WriteByte('d')
- buf.WriteString(src.DataTypeName)
- buf.WriteByte(0)
+ dst = append(dst, 'd')
+ dst = append(dst, src.DataTypeName...)
+ dst = append(dst, 0)
}
if src.ConstraintName != "" {
- buf.WriteByte('n')
- buf.WriteString(src.ConstraintName)
- buf.WriteByte(0)
+ dst = append(dst, 'n')
+ dst = append(dst, src.ConstraintName...)
+ dst = append(dst, 0)
}
if src.File != "" {
- buf.WriteByte('F')
- buf.WriteString(src.File)
- buf.WriteByte(0)
+ dst = append(dst, 'F')
+ dst = append(dst, src.File...)
+ dst = append(dst, 0)
}
if src.Line != 0 {
- buf.WriteByte('L')
- buf.WriteString(strconv.Itoa(int(src.Line)))
- buf.WriteByte(0)
+ dst = append(dst, 'L')
+ dst = append(dst, strconv.Itoa(int(src.Line))...)
+ dst = append(dst, 0)
}
if src.Routine != "" {
- buf.WriteByte('R')
- buf.WriteString(src.Routine)
- buf.WriteByte(0)
+ dst = append(dst, 'R')
+ dst = append(dst, src.Routine...)
+ dst = append(dst, 0)
}
for k, v := range src.UnknownFields {
- buf.WriteByte(k)
- buf.WriteByte(0)
- buf.WriteString(v)
- buf.WriteByte(0)
+ dst = append(dst, k)
+ dst = append(dst, v...)
+ dst = append(dst, 0)
}
- buf.WriteByte(0)
-
- binary.BigEndian.PutUint32(buf.Bytes()[1:5], uint32(buf.Len()-1))
+ dst = append(dst, 0)
- return buf.Bytes()
+ return dst
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/execute.go b/vendor/github.com/jackc/pgx/v5/pgproto3/execute.go
index 8bae613..31bc714 100644
--- a/vendor/github.com/jackc/pgproto3/v2/execute.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/execute.go
@@ -5,7 +5,7 @@ import (
"encoding/binary"
"encoding/json"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
type Execute struct {
@@ -36,19 +36,12 @@ func (dst *Execute) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *Execute) Encode(dst []byte) []byte {
- dst = append(dst, 'E')
- sp := len(dst)
- dst = pgio.AppendInt32(dst, -1)
-
+func (src *Execute) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'E')
dst = append(dst, src.Portal...)
dst = append(dst, 0)
-
dst = pgio.AppendUint32(dst, src.MaxRows)
-
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/flush.go b/vendor/github.com/jackc/pgx/v5/pgproto3/flush.go
index 2725f68..e5dc1fb 100644
--- a/vendor/github.com/jackc/pgproto3/v2/flush.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/flush.go
@@ -20,8 +20,8 @@ func (dst *Flush) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *Flush) Encode(dst []byte) []byte {
- return append(dst, 'H', 0, 0, 0, 4)
+func (src *Flush) Encode(dst []byte) ([]byte, error) {
+ return append(dst, 'H', 0, 0, 0, 4), nil
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/frontend.go b/vendor/github.com/jackc/pgx/v5/pgproto3/frontend.go
new file mode 100644
index 0000000..056e547
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/frontend.go
@@ -0,0 +1,468 @@
+package pgproto3
+
+import (
+ "bytes"
+ "encoding/binary"
+ "errors"
+ "fmt"
+ "io"
+)
+
+// Frontend acts as a client for the PostgreSQL wire protocol version 3.
+type Frontend struct {
+ cr *chunkReader
+ w io.Writer
+
+ // tracer is used to trace messages when Send or Receive is called. This means an outbound message is traced
+ // before it is actually transmitted (i.e. before Flush). It is safe to change this variable when the Frontend is
+ // idle. Setting and unsetting tracer provides equivalent functionality to PQtrace and PQuntrace in libpq.
+ tracer *tracer
+
+ wbuf []byte
+ encodeError error
+
+ // Backend message flyweights
+ authenticationOk AuthenticationOk
+ authenticationCleartextPassword AuthenticationCleartextPassword
+ authenticationMD5Password AuthenticationMD5Password
+ authenticationGSS AuthenticationGSS
+ authenticationGSSContinue AuthenticationGSSContinue
+ authenticationSASL AuthenticationSASL
+ authenticationSASLContinue AuthenticationSASLContinue
+ authenticationSASLFinal AuthenticationSASLFinal
+ backendKeyData BackendKeyData
+ bindComplete BindComplete
+ closeComplete CloseComplete
+ commandComplete CommandComplete
+ copyBothResponse CopyBothResponse
+ copyData CopyData
+ copyInResponse CopyInResponse
+ copyOutResponse CopyOutResponse
+ copyDone CopyDone
+ dataRow DataRow
+ emptyQueryResponse EmptyQueryResponse
+ errorResponse ErrorResponse
+ functionCallResponse FunctionCallResponse
+ noData NoData
+ noticeResponse NoticeResponse
+ notificationResponse NotificationResponse
+ parameterDescription ParameterDescription
+ parameterStatus ParameterStatus
+ parseComplete ParseComplete
+ readyForQuery ReadyForQuery
+ rowDescription RowDescription
+ portalSuspended PortalSuspended
+
+ bodyLen int
+ maxBodyLen int // maxBodyLen is the maximum length of a message body in octets. If a message body exceeds this length, Receive will return an error.
+ msgType byte
+ partialMsg bool
+ authType uint32
+}
+
+// NewFrontend creates a new Frontend.
+func NewFrontend(r io.Reader, w io.Writer) *Frontend {
+ cr := newChunkReader(r, 0)
+ return &Frontend{cr: cr, w: w}
+}
+
+// Send sends a message to the backend (i.e. the server). The message is buffered until Flush is called. Any error
+// encountered will be returned from Flush.
+//
+// Send can work with any FrontendMessage. Some commonly used message types such as Bind have specialized send methods
+// such as SendBind. These methods should be preferred when the type of message is known up front (e.g. when building an
+// extended query protocol query) as they may be faster due to knowing the type of msg rather than it being hidden
+// behind an interface.
+func (f *Frontend) Send(msg FrontendMessage) {
+ if f.encodeError != nil {
+ return
+ }
+
+ prevLen := len(f.wbuf)
+ newBuf, err := msg.Encode(f.wbuf)
+ if err != nil {
+ f.encodeError = err
+ return
+ }
+ f.wbuf = newBuf
+
+ if f.tracer != nil {
+ f.tracer.traceMessage('F', int32(len(f.wbuf)-prevLen), msg)
+ }
+}
+
+// Flush writes any pending messages to the backend (i.e. the server).
+func (f *Frontend) Flush() error {
+ if err := f.encodeError; err != nil {
+ f.encodeError = nil
+ f.wbuf = f.wbuf[:0]
+ return &writeError{err: err, safeToRetry: true}
+ }
+
+ if len(f.wbuf) == 0 {
+ return nil
+ }
+
+ n, err := f.w.Write(f.wbuf)
+
+ const maxLen = 1024
+ if len(f.wbuf) > maxLen {
+ f.wbuf = make([]byte, 0, maxLen)
+ } else {
+ f.wbuf = f.wbuf[:0]
+ }
+
+ if err != nil {
+ return &writeError{err: err, safeToRetry: n == 0}
+ }
+
+ return nil
+}
+
+// Trace starts tracing the message traffic to w. It writes in a similar format to that produced by the libpq function
+// PQtrace.
+func (f *Frontend) Trace(w io.Writer, options TracerOptions) {
+ f.tracer = &tracer{
+ w: w,
+ buf: &bytes.Buffer{},
+ TracerOptions: options,
+ }
+}
+
+// Untrace stops tracing.
+func (f *Frontend) Untrace() {
+ f.tracer = nil
+}
+
+// SendBind sends a Bind message to the backend (i.e. the server). The message is buffered until Flush is called. Any
+// error encountered will be returned from Flush.
+func (f *Frontend) SendBind(msg *Bind) {
+ if f.encodeError != nil {
+ return
+ }
+
+ prevLen := len(f.wbuf)
+ newBuf, err := msg.Encode(f.wbuf)
+ if err != nil {
+ f.encodeError = err
+ return
+ }
+ f.wbuf = newBuf
+
+ if f.tracer != nil {
+ f.tracer.traceBind('F', int32(len(f.wbuf)-prevLen), msg)
+ }
+}
+
+// SendParse sends a Parse message to the backend (i.e. the server). The message is buffered until Flush is called. Any
+// error encountered will be returned from Flush.
+func (f *Frontend) SendParse(msg *Parse) {
+ if f.encodeError != nil {
+ return
+ }
+
+ prevLen := len(f.wbuf)
+ newBuf, err := msg.Encode(f.wbuf)
+ if err != nil {
+ f.encodeError = err
+ return
+ }
+ f.wbuf = newBuf
+
+ if f.tracer != nil {
+ f.tracer.traceParse('F', int32(len(f.wbuf)-prevLen), msg)
+ }
+}
+
+// SendClose sends a Close message to the backend (i.e. the server). The message is buffered until Flush is called. Any
+// error encountered will be returned from Flush.
+func (f *Frontend) SendClose(msg *Close) {
+ if f.encodeError != nil {
+ return
+ }
+
+ prevLen := len(f.wbuf)
+ newBuf, err := msg.Encode(f.wbuf)
+ if err != nil {
+ f.encodeError = err
+ return
+ }
+ f.wbuf = newBuf
+
+ if f.tracer != nil {
+ f.tracer.traceClose('F', int32(len(f.wbuf)-prevLen), msg)
+ }
+}
+
+// SendDescribe sends a Describe message to the backend (i.e. the server). The message is buffered until Flush is
+// called. Any error encountered will be returned from Flush.
+func (f *Frontend) SendDescribe(msg *Describe) {
+ if f.encodeError != nil {
+ return
+ }
+
+ prevLen := len(f.wbuf)
+ newBuf, err := msg.Encode(f.wbuf)
+ if err != nil {
+ f.encodeError = err
+ return
+ }
+ f.wbuf = newBuf
+
+ if f.tracer != nil {
+ f.tracer.traceDescribe('F', int32(len(f.wbuf)-prevLen), msg)
+ }
+}
+
+// SendExecute sends an Execute message to the backend (i.e. the server). The message is buffered until Flush is called.
+// Any error encountered will be returned from Flush.
+func (f *Frontend) SendExecute(msg *Execute) {
+ if f.encodeError != nil {
+ return
+ }
+
+ prevLen := len(f.wbuf)
+ newBuf, err := msg.Encode(f.wbuf)
+ if err != nil {
+ f.encodeError = err
+ return
+ }
+ f.wbuf = newBuf
+
+ if f.tracer != nil {
+ f.tracer.TraceQueryute('F', int32(len(f.wbuf)-prevLen), msg)
+ }
+}
+
+// SendSync sends a Sync message to the backend (i.e. the server). The message is buffered until Flush is called. Any
+// error encountered will be returned from Flush.
+func (f *Frontend) SendSync(msg *Sync) {
+ if f.encodeError != nil {
+ return
+ }
+
+ prevLen := len(f.wbuf)
+ newBuf, err := msg.Encode(f.wbuf)
+ if err != nil {
+ f.encodeError = err
+ return
+ }
+ f.wbuf = newBuf
+
+ if f.tracer != nil {
+ f.tracer.traceSync('F', int32(len(f.wbuf)-prevLen), msg)
+ }
+}
+
+// SendQuery sends a Query message to the backend (i.e. the server). The message is buffered until Flush is called. Any
+// error encountered will be returned from Flush.
+func (f *Frontend) SendQuery(msg *Query) {
+ if f.encodeError != nil {
+ return
+ }
+
+ prevLen := len(f.wbuf)
+ newBuf, err := msg.Encode(f.wbuf)
+ if err != nil {
+ f.encodeError = err
+ return
+ }
+ f.wbuf = newBuf
+
+ if f.tracer != nil {
+ f.tracer.traceQuery('F', int32(len(f.wbuf)-prevLen), msg)
+ }
+}
+
+// SendUnbufferedEncodedCopyData immediately sends an encoded CopyData message to the backend (i.e. the server). This method
+// is more efficient than sending a CopyData message with Send as the message data is not copied to the internal buffer
+// before being written out. The internal buffer is flushed before the message is sent.
+func (f *Frontend) SendUnbufferedEncodedCopyData(msg []byte) error {
+ err := f.Flush()
+ if err != nil {
+ return err
+ }
+
+ n, err := f.w.Write(msg)
+ if err != nil {
+ return &writeError{err: err, safeToRetry: n == 0}
+ }
+
+ if f.tracer != nil {
+ f.tracer.traceCopyData('F', int32(len(msg)-1), &CopyData{})
+ }
+
+ return nil
+}
+
+func translateEOFtoErrUnexpectedEOF(err error) error {
+ if err == io.EOF {
+ return io.ErrUnexpectedEOF
+ }
+ return err
+}
+
+// Receive receives a message from the backend. The returned message is only valid until the next call to Receive.
+func (f *Frontend) Receive() (BackendMessage, error) {
+ if !f.partialMsg {
+ header, err := f.cr.Next(5)
+ if err != nil {
+ return nil, translateEOFtoErrUnexpectedEOF(err)
+ }
+
+ f.msgType = header[0]
+
+ msgLength := int(binary.BigEndian.Uint32(header[1:]))
+ if msgLength < 4 {
+ return nil, fmt.Errorf("invalid message length: %d", msgLength)
+ }
+
+ f.bodyLen = msgLength - 4
+ if f.maxBodyLen > 0 && f.bodyLen > f.maxBodyLen {
+ return nil, &ExceededMaxBodyLenErr{f.maxBodyLen, f.bodyLen}
+ }
+ f.partialMsg = true
+ }
+
+ msgBody, err := f.cr.Next(f.bodyLen)
+ if err != nil {
+ return nil, translateEOFtoErrUnexpectedEOF(err)
+ }
+
+ f.partialMsg = false
+
+ var msg BackendMessage
+ switch f.msgType {
+ case '1':
+ msg = &f.parseComplete
+ case '2':
+ msg = &f.bindComplete
+ case '3':
+ msg = &f.closeComplete
+ case 'A':
+ msg = &f.notificationResponse
+ case 'c':
+ msg = &f.copyDone
+ case 'C':
+ msg = &f.commandComplete
+ case 'd':
+ msg = &f.copyData
+ case 'D':
+ msg = &f.dataRow
+ case 'E':
+ msg = &f.errorResponse
+ case 'G':
+ msg = &f.copyInResponse
+ case 'H':
+ msg = &f.copyOutResponse
+ case 'I':
+ msg = &f.emptyQueryResponse
+ case 'K':
+ msg = &f.backendKeyData
+ case 'n':
+ msg = &f.noData
+ case 'N':
+ msg = &f.noticeResponse
+ case 'R':
+ var err error
+ msg, err = f.findAuthenticationMessageType(msgBody)
+ if err != nil {
+ return nil, err
+ }
+ case 's':
+ msg = &f.portalSuspended
+ case 'S':
+ msg = &f.parameterStatus
+ case 't':
+ msg = &f.parameterDescription
+ case 'T':
+ msg = &f.rowDescription
+ case 'V':
+ msg = &f.functionCallResponse
+ case 'W':
+ msg = &f.copyBothResponse
+ case 'Z':
+ msg = &f.readyForQuery
+ default:
+ return nil, fmt.Errorf("unknown message type: %c", f.msgType)
+ }
+
+ err = msg.Decode(msgBody)
+ if err != nil {
+ return nil, err
+ }
+
+ if f.tracer != nil {
+ f.tracer.traceMessage('B', int32(5+len(msgBody)), msg)
+ }
+
+ return msg, nil
+}
+
+// Authentication message type constants.
+// See src/include/libpq/pqcomm.h for all
+// constants.
+const (
+ AuthTypeOk = 0
+ AuthTypeCleartextPassword = 3
+ AuthTypeMD5Password = 5
+ AuthTypeSCMCreds = 6
+ AuthTypeGSS = 7
+ AuthTypeGSSCont = 8
+ AuthTypeSSPI = 9
+ AuthTypeSASL = 10
+ AuthTypeSASLContinue = 11
+ AuthTypeSASLFinal = 12
+)
+
+func (f *Frontend) findAuthenticationMessageType(src []byte) (BackendMessage, error) {
+ if len(src) < 4 {
+ return nil, errors.New("authentication message too short")
+ }
+ f.authType = binary.BigEndian.Uint32(src[:4])
+
+ switch f.authType {
+ case AuthTypeOk:
+ return &f.authenticationOk, nil
+ case AuthTypeCleartextPassword:
+ return &f.authenticationCleartextPassword, nil
+ case AuthTypeMD5Password:
+ return &f.authenticationMD5Password, nil
+ case AuthTypeSCMCreds:
+ return nil, errors.New("AuthTypeSCMCreds is unimplemented")
+ case AuthTypeGSS:
+ return &f.authenticationGSS, nil
+ case AuthTypeGSSCont:
+ return &f.authenticationGSSContinue, nil
+ case AuthTypeSSPI:
+ return nil, errors.New("AuthTypeSSPI is unimplemented")
+ case AuthTypeSASL:
+ return &f.authenticationSASL, nil
+ case AuthTypeSASLContinue:
+ return &f.authenticationSASLContinue, nil
+ case AuthTypeSASLFinal:
+ return &f.authenticationSASLFinal, nil
+ default:
+ return nil, fmt.Errorf("unknown authentication type: %d", f.authType)
+ }
+}
+
+// GetAuthType returns the authType used in the current state of the frontend.
+// See SetAuthType for more information.
+func (f *Frontend) GetAuthType() uint32 {
+ return f.authType
+}
+
+func (f *Frontend) ReadBufferLen() int {
+ return f.cr.wp - f.cr.rp
+}
+
+// SetMaxBodyLen sets the maximum length of a message body in octets.
+// If a message body exceeds this length, Receive will return an error.
+// This is useful for protecting against a corrupted server that sends
+// messages with incorrect length, which can cause memory exhaustion.
+// The default value is 0.
+// If maxBodyLen is 0, then no maximum is enforced.
+func (f *Frontend) SetMaxBodyLen(maxBodyLen int) {
+ f.maxBodyLen = maxBodyLen
+}
diff --git a/vendor/github.com/jackc/pgproto3/v2/function_call.go b/vendor/github.com/jackc/pgx/v5/pgproto3/function_call.go
index b3a22c4..7d83579 100644
--- a/vendor/github.com/jackc/pgproto3/v2/function_call.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/function_call.go
@@ -2,7 +2,10 @@ package pgproto3
import (
"encoding/binary"
- "github.com/jackc/pgio"
+ "errors"
+ "math"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
)
type FunctionCall struct {
@@ -70,15 +73,21 @@ func (dst *FunctionCall) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *FunctionCall) Encode(dst []byte) []byte {
- dst = append(dst, 'F')
- sp := len(dst)
- dst = pgio.AppendUint32(dst, 0) // Unknown length, set it at the end
+func (src *FunctionCall) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'F')
dst = pgio.AppendUint32(dst, src.Function)
+
+ if len(src.ArgFormatCodes) > math.MaxUint16 {
+ return nil, errors.New("too many arg format codes")
+ }
dst = pgio.AppendUint16(dst, uint16(len(src.ArgFormatCodes)))
for _, argFormatCode := range src.ArgFormatCodes {
dst = pgio.AppendUint16(dst, argFormatCode)
}
+
+ if len(src.Arguments) > math.MaxUint16 {
+ return nil, errors.New("too many arguments")
+ }
dst = pgio.AppendUint16(dst, uint16(len(src.Arguments)))
for _, argument := range src.Arguments {
if argument == nil {
@@ -89,6 +98,5 @@ func (src *FunctionCall) Encode(dst []byte) []byte {
}
}
dst = pgio.AppendUint16(dst, src.ResultFormatCode)
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
- return dst
+ return finishMessage(dst, sp)
}
diff --git a/vendor/github.com/jackc/pgproto3/v2/function_call_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/function_call_response.go
index 53d6422..1f27349 100644
--- a/vendor/github.com/jackc/pgproto3/v2/function_call_response.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/function_call_response.go
@@ -5,7 +5,7 @@ import (
"encoding/hex"
"encoding/json"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
type FunctionCallResponse struct {
@@ -39,10 +39,8 @@ func (dst *FunctionCallResponse) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *FunctionCallResponse) Encode(dst []byte) []byte {
- dst = append(dst, 'V')
- sp := len(dst)
- dst = pgio.AppendInt32(dst, -1)
+func (src *FunctionCallResponse) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'V')
if src.Result == nil {
dst = pgio.AppendInt32(dst, -1)
@@ -51,9 +49,7 @@ func (src *FunctionCallResponse) Encode(dst []byte) []byte {
dst = append(dst, src.Result...)
}
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/gss_enc_request.go b/vendor/github.com/jackc/pgx/v5/pgproto3/gss_enc_request.go
index cf405a3..70cb20c 100644
--- a/vendor/github.com/jackc/pgproto3/v2/gss_enc_request.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/gss_enc_request.go
@@ -5,7 +5,7 @@ import (
"encoding/json"
"errors"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
const gssEncReqNumber = 80877104
@@ -31,10 +31,10 @@ func (dst *GSSEncRequest) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 4 byte message length.
-func (src *GSSEncRequest) Encode(dst []byte) []byte {
+func (src *GSSEncRequest) Encode(dst []byte) ([]byte, error) {
dst = pgio.AppendInt32(dst, 8)
dst = pgio.AppendInt32(dst, gssEncReqNumber)
- return dst
+ return dst, nil
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/gss_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/gss_response.go
index 62da99c..10d9377 100644
--- a/vendor/github.com/jackc/pgproto3/v2/gss_response.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/gss_response.go
@@ -2,7 +2,6 @@ package pgproto3
import (
"encoding/json"
- "github.com/jackc/pgio"
)
type GSSResponse struct {
@@ -17,11 +16,10 @@ func (g *GSSResponse) Decode(data []byte) error {
return nil
}
-func (g *GSSResponse) Encode(dst []byte) []byte {
- dst = append(dst, 'p')
- dst = pgio.AppendInt32(dst, int32(4+len(g.Data)))
+func (g *GSSResponse) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'p')
dst = append(dst, g.Data...)
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/no_data.go b/vendor/github.com/jackc/pgx/v5/pgproto3/no_data.go
index d8f85d3..cbcaad4 100644
--- a/vendor/github.com/jackc/pgproto3/v2/no_data.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/no_data.go
@@ -20,8 +20,8 @@ func (dst *NoData) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *NoData) Encode(dst []byte) []byte {
- return append(dst, 'n', 0, 0, 0, 4)
+func (src *NoData) Encode(dst []byte) ([]byte, error) {
+ return append(dst, 'n', 0, 0, 0, 4), nil
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/notice_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/notice_response.go
index 4ac28a7..497aba6 100644
--- a/vendor/github.com/jackc/pgproto3/v2/notice_response.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/notice_response.go
@@ -12,6 +12,8 @@ func (dst *NoticeResponse) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *NoticeResponse) Encode(dst []byte) []byte {
- return append(dst, (*ErrorResponse)(src).marshalBinary('N')...)
+func (src *NoticeResponse) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'N')
+ dst = (*ErrorResponse)(src).appendFields(dst)
+ return finishMessage(dst, sp)
}
diff --git a/vendor/github.com/jackc/pgproto3/v2/notification_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/notification_response.go
index e762eb9..243b6bf 100644
--- a/vendor/github.com/jackc/pgproto3/v2/notification_response.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/notification_response.go
@@ -5,7 +5,7 @@ import (
"encoding/binary"
"encoding/json"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
type NotificationResponse struct {
@@ -22,6 +22,10 @@ func (*NotificationResponse) Backend() {}
func (dst *NotificationResponse) Decode(src []byte) error {
buf := bytes.NewBuffer(src)
+ if buf.Len() < 4 {
+ return &invalidMessageFormatErr{messageType: "NotificationResponse", details: "too short"}
+ }
+
pid := binary.BigEndian.Uint32(buf.Next(4))
b, err := buf.ReadBytes(0)
@@ -41,20 +45,14 @@ func (dst *NotificationResponse) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *NotificationResponse) Encode(dst []byte) []byte {
- dst = append(dst, 'A')
- sp := len(dst)
- dst = pgio.AppendInt32(dst, -1)
-
+func (src *NotificationResponse) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'A')
dst = pgio.AppendUint32(dst, src.PID)
dst = append(dst, src.Channel...)
dst = append(dst, 0)
dst = append(dst, src.Payload...)
dst = append(dst, 0)
-
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/parameter_description.go b/vendor/github.com/jackc/pgx/v5/pgproto3/parameter_description.go
index e28965c..1ef27b7 100644
--- a/vendor/github.com/jackc/pgproto3/v2/parameter_description.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/parameter_description.go
@@ -4,8 +4,10 @@ import (
"bytes"
"encoding/binary"
"encoding/json"
+ "errors"
+ "math"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
type ParameterDescription struct {
@@ -39,19 +41,18 @@ func (dst *ParameterDescription) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *ParameterDescription) Encode(dst []byte) []byte {
- dst = append(dst, 't')
- sp := len(dst)
- dst = pgio.AppendInt32(dst, -1)
+func (src *ParameterDescription) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 't')
+ if len(src.ParameterOIDs) > math.MaxUint16 {
+ return nil, errors.New("too many parameter oids")
+ }
dst = pgio.AppendUint16(dst, uint16(len(src.ParameterOIDs)))
for _, oid := range src.ParameterOIDs {
dst = pgio.AppendUint32(dst, oid)
}
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/parameter_status.go b/vendor/github.com/jackc/pgx/v5/pgproto3/parameter_status.go
index c4021d9..9ee0720 100644
--- a/vendor/github.com/jackc/pgproto3/v2/parameter_status.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/parameter_status.go
@@ -3,8 +3,6 @@ package pgproto3
import (
"bytes"
"encoding/json"
-
- "github.com/jackc/pgio"
)
type ParameterStatus struct {
@@ -37,19 +35,13 @@ func (dst *ParameterStatus) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *ParameterStatus) Encode(dst []byte) []byte {
- dst = append(dst, 'S')
- sp := len(dst)
- dst = pgio.AppendInt32(dst, -1)
-
+func (src *ParameterStatus) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'S')
dst = append(dst, src.Name...)
dst = append(dst, 0)
dst = append(dst, src.Value...)
dst = append(dst, 0)
-
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/parse.go b/vendor/github.com/jackc/pgx/v5/pgproto3/parse.go
index 723885d..6ba3486 100644
--- a/vendor/github.com/jackc/pgproto3/v2/parse.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/parse.go
@@ -4,8 +4,10 @@ import (
"bytes"
"encoding/binary"
"encoding/json"
+ "errors"
+ "math"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
type Parse struct {
@@ -52,24 +54,23 @@ func (dst *Parse) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *Parse) Encode(dst []byte) []byte {
- dst = append(dst, 'P')
- sp := len(dst)
- dst = pgio.AppendInt32(dst, -1)
+func (src *Parse) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'P')
dst = append(dst, src.Name...)
dst = append(dst, 0)
dst = append(dst, src.Query...)
dst = append(dst, 0)
+ if len(src.ParameterOIDs) > math.MaxUint16 {
+ return nil, errors.New("too many parameter oids")
+ }
dst = pgio.AppendUint16(dst, uint16(len(src.ParameterOIDs)))
for _, oid := range src.ParameterOIDs {
dst = pgio.AppendUint32(dst, oid)
}
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/parse_complete.go b/vendor/github.com/jackc/pgx/v5/pgproto3/parse_complete.go
index 92c9498..cff9e27 100644
--- a/vendor/github.com/jackc/pgproto3/v2/parse_complete.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/parse_complete.go
@@ -20,8 +20,8 @@ func (dst *ParseComplete) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *ParseComplete) Encode(dst []byte) []byte {
- return append(dst, '1', 0, 0, 0, 4)
+func (src *ParseComplete) Encode(dst []byte) ([]byte, error) {
+ return append(dst, '1', 0, 0, 0, 4), nil
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/password_message.go b/vendor/github.com/jackc/pgx/v5/pgproto3/password_message.go
index cae76c5..d820d32 100644
--- a/vendor/github.com/jackc/pgproto3/v2/password_message.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/password_message.go
@@ -3,8 +3,6 @@ package pgproto3
import (
"bytes"
"encoding/json"
-
- "github.com/jackc/pgio"
)
type PasswordMessage struct {
@@ -32,14 +30,11 @@ func (dst *PasswordMessage) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *PasswordMessage) Encode(dst []byte) []byte {
- dst = append(dst, 'p')
- dst = pgio.AppendInt32(dst, int32(4+len(src.Password)+1))
-
+func (src *PasswordMessage) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'p')
dst = append(dst, src.Password...)
dst = append(dst, 0)
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/pgproto3.go b/vendor/github.com/jackc/pgx/v5/pgproto3/pgproto3.go
new file mode 100644
index 0000000..128f97f
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/pgproto3.go
@@ -0,0 +1,120 @@
+package pgproto3
+
+import (
+ "encoding/hex"
+ "errors"
+ "fmt"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+// maxMessageBodyLen is the maximum length of a message body in bytes. See PG_LARGE_MESSAGE_LIMIT in the PostgreSQL
+// source. It is defined as (MaxAllocSize - 1). MaxAllocSize is defined as 0x3fffffff.
+const maxMessageBodyLen = (0x3fffffff - 1)
+
+// Message is the interface implemented by an object that can decode and encode
+// a particular PostgreSQL message.
+type Message interface {
+ // Decode is allowed and expected to retain a reference to data after
+ // returning (unlike encoding.BinaryUnmarshaler).
+ Decode(data []byte) error
+
+ // Encode appends itself to dst and returns the new buffer.
+ Encode(dst []byte) ([]byte, error)
+}
+
+// FrontendMessage is a message sent by the frontend (i.e. the client).
+type FrontendMessage interface {
+ Message
+ Frontend() // no-op method to distinguish frontend from backend methods
+}
+
+// BackendMessage is a message sent by the backend (i.e. the server).
+type BackendMessage interface {
+ Message
+ Backend() // no-op method to distinguish frontend from backend methods
+}
+
+type AuthenticationResponseMessage interface {
+ BackendMessage
+ AuthenticationResponse() // no-op method to distinguish authentication responses
+}
+
+type invalidMessageLenErr struct {
+ messageType string
+ expectedLen int
+ actualLen int
+}
+
+func (e *invalidMessageLenErr) Error() string {
+ return fmt.Sprintf("%s body must have length of %d, but it is %d", e.messageType, e.expectedLen, e.actualLen)
+}
+
+type invalidMessageFormatErr struct {
+ messageType string
+ details string
+}
+
+func (e *invalidMessageFormatErr) Error() string {
+ return fmt.Sprintf("%s body is invalid %s", e.messageType, e.details)
+}
+
+type writeError struct {
+ err error
+ safeToRetry bool
+}
+
+func (e *writeError) Error() string {
+ return fmt.Sprintf("write failed: %s", e.err.Error())
+}
+
+func (e *writeError) SafeToRetry() bool {
+ return e.safeToRetry
+}
+
+func (e *writeError) Unwrap() error {
+ return e.err
+}
+
+type ExceededMaxBodyLenErr struct {
+ MaxExpectedBodyLen int
+ ActualBodyLen int
+}
+
+func (e *ExceededMaxBodyLenErr) Error() string {
+ return fmt.Sprintf("invalid body length: expected at most %d, but got %d", e.MaxExpectedBodyLen, e.ActualBodyLen)
+}
+
+// getValueFromJSON gets the value from a protocol message representation in JSON.
+func getValueFromJSON(v map[string]string) ([]byte, error) {
+ if v == nil {
+ return nil, nil
+ }
+ if text, ok := v["text"]; ok {
+ return []byte(text), nil
+ }
+ if binary, ok := v["binary"]; ok {
+ return hex.DecodeString(binary)
+ }
+ return nil, errors.New("unknown protocol representation")
+}
+
+// beginMessage begins a new message of type t. It appends the message type and a placeholder for the message length to
+// dst. It returns the new buffer and the position of the message length placeholder.
+func beginMessage(dst []byte, t byte) ([]byte, int) {
+ dst = append(dst, t)
+ sp := len(dst)
+ dst = pgio.AppendInt32(dst, -1)
+ return dst, sp
+}
+
+// finishMessage finishes a message that was started with beginMessage. It computes the message length and writes it to
+// dst[sp]. If the message length is too large it returns an error. Otherwise it returns the final message buffer.
+func finishMessage(dst []byte, sp int) ([]byte, error) {
+ messageBodyLen := len(dst[sp:])
+ if messageBodyLen > maxMessageBodyLen {
+ return nil, errors.New("message body too large")
+ }
+ pgio.SetInt32(dst[sp:], int32(messageBodyLen))
+ return dst, nil
+}
diff --git a/vendor/github.com/jackc/pgproto3/v2/portal_suspended.go b/vendor/github.com/jackc/pgx/v5/pgproto3/portal_suspended.go
index 1a9e7bf..9e2f8cb 100644
--- a/vendor/github.com/jackc/pgproto3/v2/portal_suspended.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/portal_suspended.go
@@ -20,8 +20,8 @@ func (dst *PortalSuspended) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *PortalSuspended) Encode(dst []byte) []byte {
- return append(dst, 's', 0, 0, 0, 4)
+func (src *PortalSuspended) Encode(dst []byte) ([]byte, error) {
+ return append(dst, 's', 0, 0, 0, 4), nil
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/query.go b/vendor/github.com/jackc/pgx/v5/pgproto3/query.go
index 41c93b4..aebdfde 100644
--- a/vendor/github.com/jackc/pgproto3/v2/query.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/query.go
@@ -3,8 +3,6 @@ package pgproto3
import (
"bytes"
"encoding/json"
-
- "github.com/jackc/pgio"
)
type Query struct {
@@ -28,14 +26,11 @@ func (dst *Query) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *Query) Encode(dst []byte) []byte {
- dst = append(dst, 'Q')
- dst = pgio.AppendInt32(dst, int32(4+len(src.String)+1))
-
+func (src *Query) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'Q')
dst = append(dst, src.String...)
dst = append(dst, 0)
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/ready_for_query.go b/vendor/github.com/jackc/pgx/v5/pgproto3/ready_for_query.go
index 67a39be..a56af9f 100644
--- a/vendor/github.com/jackc/pgproto3/v2/ready_for_query.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/ready_for_query.go
@@ -25,8 +25,8 @@ func (dst *ReadyForQuery) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *ReadyForQuery) Encode(dst []byte) []byte {
- return append(dst, 'Z', 0, 0, 0, 5, src.TxStatus)
+func (src *ReadyForQuery) Encode(dst []byte) ([]byte, error) {
+ return append(dst, 'Z', 0, 0, 0, 5, src.TxStatus), nil
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/row_description.go b/vendor/github.com/jackc/pgx/v5/pgproto3/row_description.go
index a2e0d28..dc2a4dd 100644
--- a/vendor/github.com/jackc/pgproto3/v2/row_description.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/row_description.go
@@ -4,8 +4,10 @@ import (
"bytes"
"encoding/binary"
"encoding/json"
+ "errors"
+ "math"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
const (
@@ -99,11 +101,12 @@ func (dst *RowDescription) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *RowDescription) Encode(dst []byte) []byte {
- dst = append(dst, 'T')
- sp := len(dst)
- dst = pgio.AppendInt32(dst, -1)
+func (src *RowDescription) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'T')
+ if len(src.Fields) > math.MaxUint16 {
+ return nil, errors.New("too many fields")
+ }
dst = pgio.AppendUint16(dst, uint16(len(src.Fields)))
for _, fd := range src.Fields {
dst = append(dst, fd.Name...)
@@ -117,9 +120,7 @@ func (src *RowDescription) Encode(dst []byte) []byte {
dst = pgio.AppendInt16(dst, fd.Format)
}
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/sasl_initial_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/sasl_initial_response.go
index a6b553e..9eb1b6a 100644
--- a/vendor/github.com/jackc/pgproto3/v2/sasl_initial_response.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/sasl_initial_response.go
@@ -2,10 +2,11 @@ package pgproto3
import (
"bytes"
+ "encoding/hex"
"encoding/json"
"errors"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
type SASLInitialResponse struct {
@@ -38,10 +39,8 @@ func (dst *SASLInitialResponse) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *SASLInitialResponse) Encode(dst []byte) []byte {
- dst = append(dst, 'p')
- sp := len(dst)
- dst = pgio.AppendInt32(dst, -1)
+func (src *SASLInitialResponse) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'p')
dst = append(dst, []byte(src.AuthMechanism)...)
dst = append(dst, 0)
@@ -49,9 +48,7 @@ func (src *SASLInitialResponse) Encode(dst []byte) []byte {
dst = pgio.AppendInt32(dst, int32(len(src.Data)))
dst = append(dst, src.Data...)
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
@@ -82,6 +79,12 @@ func (dst *SASLInitialResponse) UnmarshalJSON(data []byte) error {
return err
}
dst.AuthMechanism = msg.AuthMechanism
- dst.Data = []byte(msg.Data)
+ if msg.Data != "" {
+ decoded, err := hex.DecodeString(msg.Data)
+ if err != nil {
+ return err
+ }
+ dst.Data = decoded
+ }
return nil
}
diff --git a/vendor/github.com/jackc/pgproto3/v2/sasl_response.go b/vendor/github.com/jackc/pgx/v5/pgproto3/sasl_response.go
index d3e5d6a..1b604c2 100644
--- a/vendor/github.com/jackc/pgproto3/v2/sasl_response.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/sasl_response.go
@@ -1,9 +1,8 @@
package pgproto3
import (
+ "encoding/hex"
"encoding/json"
-
- "github.com/jackc/pgio"
)
type SASLResponse struct {
@@ -21,13 +20,10 @@ func (dst *SASLResponse) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *SASLResponse) Encode(dst []byte) []byte {
- dst = append(dst, 'p')
- dst = pgio.AppendInt32(dst, int32(4+len(src.Data)))
-
+func (src *SASLResponse) Encode(dst []byte) ([]byte, error) {
+ dst, sp := beginMessage(dst, 'p')
dst = append(dst, src.Data...)
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
@@ -49,6 +45,12 @@ func (dst *SASLResponse) UnmarshalJSON(data []byte) error {
if err := json.Unmarshal(data, &msg); err != nil {
return err
}
- dst.Data = []byte(msg.Data)
+ if msg.Data != "" {
+ decoded, err := hex.DecodeString(msg.Data)
+ if err != nil {
+ return err
+ }
+ dst.Data = decoded
+ }
return nil
}
diff --git a/vendor/github.com/jackc/pgproto3/v2/ssl_request.go b/vendor/github.com/jackc/pgx/v5/pgproto3/ssl_request.go
index 96ce489..b0fc284 100644
--- a/vendor/github.com/jackc/pgproto3/v2/ssl_request.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/ssl_request.go
@@ -5,7 +5,7 @@ import (
"encoding/json"
"errors"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
const sslRequestNumber = 80877103
@@ -31,10 +31,10 @@ func (dst *SSLRequest) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 4 byte message length.
-func (src *SSLRequest) Encode(dst []byte) []byte {
+func (src *SSLRequest) Encode(dst []byte) ([]byte, error) {
dst = pgio.AppendInt32(dst, 8)
dst = pgio.AppendInt32(dst, sslRequestNumber)
- return dst
+ return dst, nil
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/startup_message.go b/vendor/github.com/jackc/pgx/v5/pgproto3/startup_message.go
index 5f1cd24..3af4587 100644
--- a/vendor/github.com/jackc/pgproto3/v2/startup_message.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/startup_message.go
@@ -7,7 +7,7 @@ import (
"errors"
"fmt"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
const ProtocolVersionNumber = 196608 // 3.0
@@ -38,14 +38,14 @@ func (dst *StartupMessage) Decode(src []byte) error {
for {
idx := bytes.IndexByte(src[rp:], 0)
if idx < 0 {
- return &invalidMessageFormatErr{messageType: "StartupMesage"}
+ return &invalidMessageFormatErr{messageType: "StartupMessage"}
}
key := string(src[rp : rp+idx])
rp += idx + 1
idx = bytes.IndexByte(src[rp:], 0)
if idx < 0 {
- return &invalidMessageFormatErr{messageType: "StartupMesage"}
+ return &invalidMessageFormatErr{messageType: "StartupMessage"}
}
value := string(src[rp : rp+idx])
rp += idx + 1
@@ -64,7 +64,7 @@ func (dst *StartupMessage) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *StartupMessage) Encode(dst []byte) []byte {
+func (src *StartupMessage) Encode(dst []byte) ([]byte, error) {
sp := len(dst)
dst = pgio.AppendInt32(dst, -1)
@@ -77,9 +77,7 @@ func (src *StartupMessage) Encode(dst []byte) []byte {
}
dst = append(dst, 0)
- pgio.SetInt32(dst[sp:], int32(len(dst[sp:])))
-
- return dst
+ return finishMessage(dst, sp)
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/sync.go b/vendor/github.com/jackc/pgx/v5/pgproto3/sync.go
index 5db8e07..ea4fc95 100644
--- a/vendor/github.com/jackc/pgproto3/v2/sync.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/sync.go
@@ -20,8 +20,8 @@ func (dst *Sync) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *Sync) Encode(dst []byte) []byte {
- return append(dst, 'S', 0, 0, 0, 4)
+func (src *Sync) Encode(dst []byte) ([]byte, error) {
+ return append(dst, 'S', 0, 0, 0, 4), nil
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgproto3/v2/terminate.go b/vendor/github.com/jackc/pgx/v5/pgproto3/terminate.go
index 135191e..35a9dc8 100644
--- a/vendor/github.com/jackc/pgproto3/v2/terminate.go
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/terminate.go
@@ -20,8 +20,8 @@ func (dst *Terminate) Decode(src []byte) error {
}
// Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length.
-func (src *Terminate) Encode(dst []byte) []byte {
- return append(dst, 'X', 0, 0, 0, 4)
+func (src *Terminate) Encode(dst []byte) ([]byte, error) {
+ return append(dst, 'X', 0, 0, 0, 4), nil
}
// MarshalJSON implements encoding/json.Marshaler.
diff --git a/vendor/github.com/jackc/pgx/v5/pgproto3/trace.go b/vendor/github.com/jackc/pgx/v5/pgproto3/trace.go
new file mode 100644
index 0000000..6cc7d3e
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgproto3/trace.go
@@ -0,0 +1,416 @@
+package pgproto3
+
+import (
+ "bytes"
+ "fmt"
+ "io"
+ "strconv"
+ "strings"
+ "sync"
+ "time"
+)
+
+// tracer traces the messages send to and from a Backend or Frontend. The format it produces roughly mimics the
+// format produced by the libpq C function PQtrace.
+type tracer struct {
+ TracerOptions
+
+ mux sync.Mutex
+ w io.Writer
+ buf *bytes.Buffer
+}
+
+// TracerOptions controls tracing behavior. It is roughly equivalent to the libpq function PQsetTraceFlags.
+type TracerOptions struct {
+ // SuppressTimestamps prevents printing of timestamps.
+ SuppressTimestamps bool
+
+ // RegressMode redacts fields that may be vary between executions.
+ RegressMode bool
+}
+
+func (t *tracer) traceMessage(sender byte, encodedLen int32, msg Message) {
+ switch msg := msg.(type) {
+ case *AuthenticationCleartextPassword:
+ t.traceAuthenticationCleartextPassword(sender, encodedLen, msg)
+ case *AuthenticationGSS:
+ t.traceAuthenticationGSS(sender, encodedLen, msg)
+ case *AuthenticationGSSContinue:
+ t.traceAuthenticationGSSContinue(sender, encodedLen, msg)
+ case *AuthenticationMD5Password:
+ t.traceAuthenticationMD5Password(sender, encodedLen, msg)
+ case *AuthenticationOk:
+ t.traceAuthenticationOk(sender, encodedLen, msg)
+ case *AuthenticationSASL:
+ t.traceAuthenticationSASL(sender, encodedLen, msg)
+ case *AuthenticationSASLContinue:
+ t.traceAuthenticationSASLContinue(sender, encodedLen, msg)
+ case *AuthenticationSASLFinal:
+ t.traceAuthenticationSASLFinal(sender, encodedLen, msg)
+ case *BackendKeyData:
+ t.traceBackendKeyData(sender, encodedLen, msg)
+ case *Bind:
+ t.traceBind(sender, encodedLen, msg)
+ case *BindComplete:
+ t.traceBindComplete(sender, encodedLen, msg)
+ case *CancelRequest:
+ t.traceCancelRequest(sender, encodedLen, msg)
+ case *Close:
+ t.traceClose(sender, encodedLen, msg)
+ case *CloseComplete:
+ t.traceCloseComplete(sender, encodedLen, msg)
+ case *CommandComplete:
+ t.traceCommandComplete(sender, encodedLen, msg)
+ case *CopyBothResponse:
+ t.traceCopyBothResponse(sender, encodedLen, msg)
+ case *CopyData:
+ t.traceCopyData(sender, encodedLen, msg)
+ case *CopyDone:
+ t.traceCopyDone(sender, encodedLen, msg)
+ case *CopyFail:
+ t.traceCopyFail(sender, encodedLen, msg)
+ case *CopyInResponse:
+ t.traceCopyInResponse(sender, encodedLen, msg)
+ case *CopyOutResponse:
+ t.traceCopyOutResponse(sender, encodedLen, msg)
+ case *DataRow:
+ t.traceDataRow(sender, encodedLen, msg)
+ case *Describe:
+ t.traceDescribe(sender, encodedLen, msg)
+ case *EmptyQueryResponse:
+ t.traceEmptyQueryResponse(sender, encodedLen, msg)
+ case *ErrorResponse:
+ t.traceErrorResponse(sender, encodedLen, msg)
+ case *Execute:
+ t.TraceQueryute(sender, encodedLen, msg)
+ case *Flush:
+ t.traceFlush(sender, encodedLen, msg)
+ case *FunctionCall:
+ t.traceFunctionCall(sender, encodedLen, msg)
+ case *FunctionCallResponse:
+ t.traceFunctionCallResponse(sender, encodedLen, msg)
+ case *GSSEncRequest:
+ t.traceGSSEncRequest(sender, encodedLen, msg)
+ case *NoData:
+ t.traceNoData(sender, encodedLen, msg)
+ case *NoticeResponse:
+ t.traceNoticeResponse(sender, encodedLen, msg)
+ case *NotificationResponse:
+ t.traceNotificationResponse(sender, encodedLen, msg)
+ case *ParameterDescription:
+ t.traceParameterDescription(sender, encodedLen, msg)
+ case *ParameterStatus:
+ t.traceParameterStatus(sender, encodedLen, msg)
+ case *Parse:
+ t.traceParse(sender, encodedLen, msg)
+ case *ParseComplete:
+ t.traceParseComplete(sender, encodedLen, msg)
+ case *PortalSuspended:
+ t.tracePortalSuspended(sender, encodedLen, msg)
+ case *Query:
+ t.traceQuery(sender, encodedLen, msg)
+ case *ReadyForQuery:
+ t.traceReadyForQuery(sender, encodedLen, msg)
+ case *RowDescription:
+ t.traceRowDescription(sender, encodedLen, msg)
+ case *SSLRequest:
+ t.traceSSLRequest(sender, encodedLen, msg)
+ case *StartupMessage:
+ t.traceStartupMessage(sender, encodedLen, msg)
+ case *Sync:
+ t.traceSync(sender, encodedLen, msg)
+ case *Terminate:
+ t.traceTerminate(sender, encodedLen, msg)
+ default:
+ t.writeTrace(sender, encodedLen, "Unknown", nil)
+ }
+}
+
+func (t *tracer) traceAuthenticationCleartextPassword(sender byte, encodedLen int32, msg *AuthenticationCleartextPassword) {
+ t.writeTrace(sender, encodedLen, "AuthenticationCleartextPassword", nil)
+}
+
+func (t *tracer) traceAuthenticationGSS(sender byte, encodedLen int32, msg *AuthenticationGSS) {
+ t.writeTrace(sender, encodedLen, "AuthenticationGSS", nil)
+}
+
+func (t *tracer) traceAuthenticationGSSContinue(sender byte, encodedLen int32, msg *AuthenticationGSSContinue) {
+ t.writeTrace(sender, encodedLen, "AuthenticationGSSContinue", nil)
+}
+
+func (t *tracer) traceAuthenticationMD5Password(sender byte, encodedLen int32, msg *AuthenticationMD5Password) {
+ t.writeTrace(sender, encodedLen, "AuthenticationMD5Password", nil)
+}
+
+func (t *tracer) traceAuthenticationOk(sender byte, encodedLen int32, msg *AuthenticationOk) {
+ t.writeTrace(sender, encodedLen, "AuthenticationOk", nil)
+}
+
+func (t *tracer) traceAuthenticationSASL(sender byte, encodedLen int32, msg *AuthenticationSASL) {
+ t.writeTrace(sender, encodedLen, "AuthenticationSASL", nil)
+}
+
+func (t *tracer) traceAuthenticationSASLContinue(sender byte, encodedLen int32, msg *AuthenticationSASLContinue) {
+ t.writeTrace(sender, encodedLen, "AuthenticationSASLContinue", nil)
+}
+
+func (t *tracer) traceAuthenticationSASLFinal(sender byte, encodedLen int32, msg *AuthenticationSASLFinal) {
+ t.writeTrace(sender, encodedLen, "AuthenticationSASLFinal", nil)
+}
+
+func (t *tracer) traceBackendKeyData(sender byte, encodedLen int32, msg *BackendKeyData) {
+ t.writeTrace(sender, encodedLen, "BackendKeyData", func() {
+ if t.RegressMode {
+ t.buf.WriteString("\t NNNN NNNN")
+ } else {
+ fmt.Fprintf(t.buf, "\t %d %d", msg.ProcessID, msg.SecretKey)
+ }
+ })
+}
+
+func (t *tracer) traceBind(sender byte, encodedLen int32, msg *Bind) {
+ t.writeTrace(sender, encodedLen, "Bind", func() {
+ fmt.Fprintf(t.buf, "\t %s %s %d", traceDoubleQuotedString([]byte(msg.DestinationPortal)), traceDoubleQuotedString([]byte(msg.PreparedStatement)), len(msg.ParameterFormatCodes))
+ for _, fc := range msg.ParameterFormatCodes {
+ fmt.Fprintf(t.buf, " %d", fc)
+ }
+ fmt.Fprintf(t.buf, " %d", len(msg.Parameters))
+ for _, p := range msg.Parameters {
+ fmt.Fprintf(t.buf, " %s", traceSingleQuotedString(p))
+ }
+ fmt.Fprintf(t.buf, " %d", len(msg.ResultFormatCodes))
+ for _, fc := range msg.ResultFormatCodes {
+ fmt.Fprintf(t.buf, " %d", fc)
+ }
+ })
+}
+
+func (t *tracer) traceBindComplete(sender byte, encodedLen int32, msg *BindComplete) {
+ t.writeTrace(sender, encodedLen, "BindComplete", nil)
+}
+
+func (t *tracer) traceCancelRequest(sender byte, encodedLen int32, msg *CancelRequest) {
+ t.writeTrace(sender, encodedLen, "CancelRequest", nil)
+}
+
+func (t *tracer) traceClose(sender byte, encodedLen int32, msg *Close) {
+ t.writeTrace(sender, encodedLen, "Close", nil)
+}
+
+func (t *tracer) traceCloseComplete(sender byte, encodedLen int32, msg *CloseComplete) {
+ t.writeTrace(sender, encodedLen, "CloseComplete", nil)
+}
+
+func (t *tracer) traceCommandComplete(sender byte, encodedLen int32, msg *CommandComplete) {
+ t.writeTrace(sender, encodedLen, "CommandComplete", func() {
+ fmt.Fprintf(t.buf, "\t %s", traceDoubleQuotedString(msg.CommandTag))
+ })
+}
+
+func (t *tracer) traceCopyBothResponse(sender byte, encodedLen int32, msg *CopyBothResponse) {
+ t.writeTrace(sender, encodedLen, "CopyBothResponse", nil)
+}
+
+func (t *tracer) traceCopyData(sender byte, encodedLen int32, msg *CopyData) {
+ t.writeTrace(sender, encodedLen, "CopyData", nil)
+}
+
+func (t *tracer) traceCopyDone(sender byte, encodedLen int32, msg *CopyDone) {
+ t.writeTrace(sender, encodedLen, "CopyDone", nil)
+}
+
+func (t *tracer) traceCopyFail(sender byte, encodedLen int32, msg *CopyFail) {
+ t.writeTrace(sender, encodedLen, "CopyFail", func() {
+ fmt.Fprintf(t.buf, "\t %s", traceDoubleQuotedString([]byte(msg.Message)))
+ })
+}
+
+func (t *tracer) traceCopyInResponse(sender byte, encodedLen int32, msg *CopyInResponse) {
+ t.writeTrace(sender, encodedLen, "CopyInResponse", nil)
+}
+
+func (t *tracer) traceCopyOutResponse(sender byte, encodedLen int32, msg *CopyOutResponse) {
+ t.writeTrace(sender, encodedLen, "CopyOutResponse", nil)
+}
+
+func (t *tracer) traceDataRow(sender byte, encodedLen int32, msg *DataRow) {
+ t.writeTrace(sender, encodedLen, "DataRow", func() {
+ fmt.Fprintf(t.buf, "\t %d", len(msg.Values))
+ for _, v := range msg.Values {
+ if v == nil {
+ t.buf.WriteString(" -1")
+ } else {
+ fmt.Fprintf(t.buf, " %d %s", len(v), traceSingleQuotedString(v))
+ }
+ }
+ })
+}
+
+func (t *tracer) traceDescribe(sender byte, encodedLen int32, msg *Describe) {
+ t.writeTrace(sender, encodedLen, "Describe", func() {
+ fmt.Fprintf(t.buf, "\t %c %s", msg.ObjectType, traceDoubleQuotedString([]byte(msg.Name)))
+ })
+}
+
+func (t *tracer) traceEmptyQueryResponse(sender byte, encodedLen int32, msg *EmptyQueryResponse) {
+ t.writeTrace(sender, encodedLen, "EmptyQueryResponse", nil)
+}
+
+func (t *tracer) traceErrorResponse(sender byte, encodedLen int32, msg *ErrorResponse) {
+ t.writeTrace(sender, encodedLen, "ErrorResponse", nil)
+}
+
+func (t *tracer) TraceQueryute(sender byte, encodedLen int32, msg *Execute) {
+ t.writeTrace(sender, encodedLen, "Execute", func() {
+ fmt.Fprintf(t.buf, "\t %s %d", traceDoubleQuotedString([]byte(msg.Portal)), msg.MaxRows)
+ })
+}
+
+func (t *tracer) traceFlush(sender byte, encodedLen int32, msg *Flush) {
+ t.writeTrace(sender, encodedLen, "Flush", nil)
+}
+
+func (t *tracer) traceFunctionCall(sender byte, encodedLen int32, msg *FunctionCall) {
+ t.writeTrace(sender, encodedLen, "FunctionCall", nil)
+}
+
+func (t *tracer) traceFunctionCallResponse(sender byte, encodedLen int32, msg *FunctionCallResponse) {
+ t.writeTrace(sender, encodedLen, "FunctionCallResponse", nil)
+}
+
+func (t *tracer) traceGSSEncRequest(sender byte, encodedLen int32, msg *GSSEncRequest) {
+ t.writeTrace(sender, encodedLen, "GSSEncRequest", nil)
+}
+
+func (t *tracer) traceNoData(sender byte, encodedLen int32, msg *NoData) {
+ t.writeTrace(sender, encodedLen, "NoData", nil)
+}
+
+func (t *tracer) traceNoticeResponse(sender byte, encodedLen int32, msg *NoticeResponse) {
+ t.writeTrace(sender, encodedLen, "NoticeResponse", nil)
+}
+
+func (t *tracer) traceNotificationResponse(sender byte, encodedLen int32, msg *NotificationResponse) {
+ t.writeTrace(sender, encodedLen, "NotificationResponse", func() {
+ fmt.Fprintf(t.buf, "\t %d %s %s", msg.PID, traceDoubleQuotedString([]byte(msg.Channel)), traceDoubleQuotedString([]byte(msg.Payload)))
+ })
+}
+
+func (t *tracer) traceParameterDescription(sender byte, encodedLen int32, msg *ParameterDescription) {
+ t.writeTrace(sender, encodedLen, "ParameterDescription", nil)
+}
+
+func (t *tracer) traceParameterStatus(sender byte, encodedLen int32, msg *ParameterStatus) {
+ t.writeTrace(sender, encodedLen, "ParameterStatus", func() {
+ fmt.Fprintf(t.buf, "\t %s %s", traceDoubleQuotedString([]byte(msg.Name)), traceDoubleQuotedString([]byte(msg.Value)))
+ })
+}
+
+func (t *tracer) traceParse(sender byte, encodedLen int32, msg *Parse) {
+ t.writeTrace(sender, encodedLen, "Parse", func() {
+ fmt.Fprintf(t.buf, "\t %s %s %d", traceDoubleQuotedString([]byte(msg.Name)), traceDoubleQuotedString([]byte(msg.Query)), len(msg.ParameterOIDs))
+ for _, oid := range msg.ParameterOIDs {
+ fmt.Fprintf(t.buf, " %d", oid)
+ }
+ })
+}
+
+func (t *tracer) traceParseComplete(sender byte, encodedLen int32, msg *ParseComplete) {
+ t.writeTrace(sender, encodedLen, "ParseComplete", nil)
+}
+
+func (t *tracer) tracePortalSuspended(sender byte, encodedLen int32, msg *PortalSuspended) {
+ t.writeTrace(sender, encodedLen, "PortalSuspended", nil)
+}
+
+func (t *tracer) traceQuery(sender byte, encodedLen int32, msg *Query) {
+ t.writeTrace(sender, encodedLen, "Query", func() {
+ fmt.Fprintf(t.buf, "\t %s", traceDoubleQuotedString([]byte(msg.String)))
+ })
+}
+
+func (t *tracer) traceReadyForQuery(sender byte, encodedLen int32, msg *ReadyForQuery) {
+ t.writeTrace(sender, encodedLen, "ReadyForQuery", func() {
+ fmt.Fprintf(t.buf, "\t %c", msg.TxStatus)
+ })
+}
+
+func (t *tracer) traceRowDescription(sender byte, encodedLen int32, msg *RowDescription) {
+ t.writeTrace(sender, encodedLen, "RowDescription", func() {
+ fmt.Fprintf(t.buf, "\t %d", len(msg.Fields))
+ for _, fd := range msg.Fields {
+ fmt.Fprintf(t.buf, ` %s %d %d %d %d %d %d`, traceDoubleQuotedString(fd.Name), fd.TableOID, fd.TableAttributeNumber, fd.DataTypeOID, fd.DataTypeSize, fd.TypeModifier, fd.Format)
+ }
+ })
+}
+
+func (t *tracer) traceSSLRequest(sender byte, encodedLen int32, msg *SSLRequest) {
+ t.writeTrace(sender, encodedLen, "SSLRequest", nil)
+}
+
+func (t *tracer) traceStartupMessage(sender byte, encodedLen int32, msg *StartupMessage) {
+ t.writeTrace(sender, encodedLen, "StartupMessage", nil)
+}
+
+func (t *tracer) traceSync(sender byte, encodedLen int32, msg *Sync) {
+ t.writeTrace(sender, encodedLen, "Sync", nil)
+}
+
+func (t *tracer) traceTerminate(sender byte, encodedLen int32, msg *Terminate) {
+ t.writeTrace(sender, encodedLen, "Terminate", nil)
+}
+
+func (t *tracer) writeTrace(sender byte, encodedLen int32, msgType string, writeDetails func()) {
+ t.mux.Lock()
+ defer t.mux.Unlock()
+ defer func() {
+ if t.buf.Cap() > 1024 {
+ t.buf = &bytes.Buffer{}
+ } else {
+ t.buf.Reset()
+ }
+ }()
+
+ if !t.SuppressTimestamps {
+ now := time.Now()
+ t.buf.WriteString(now.Format("2006-01-02 15:04:05.000000"))
+ t.buf.WriteByte('\t')
+ }
+
+ t.buf.WriteByte(sender)
+ t.buf.WriteByte('\t')
+ t.buf.WriteString(msgType)
+ t.buf.WriteByte('\t')
+ t.buf.WriteString(strconv.FormatInt(int64(encodedLen), 10))
+
+ if writeDetails != nil {
+ writeDetails()
+ }
+
+ t.buf.WriteByte('\n')
+ t.buf.WriteTo(t.w)
+}
+
+// traceDoubleQuotedString returns t.buf as a double-quoted string without any escaping. It is roughly equivalent to
+// pqTraceOutputString in libpq.
+func traceDoubleQuotedString(buf []byte) string {
+ return `"` + string(buf) + `"`
+}
+
+// traceSingleQuotedString returns buf as a single-quoted string with non-printable characters hex-escaped. It is
+// roughly equivalent to pqTraceOutputNchar in libpq.
+func traceSingleQuotedString(buf []byte) string {
+ sb := &strings.Builder{}
+
+ sb.WriteByte('\'')
+ for _, b := range buf {
+ if b < 32 || b > 126 {
+ fmt.Fprintf(sb, `\x%x`, b)
+ } else {
+ sb.WriteByte(b)
+ }
+ }
+ sb.WriteByte('\'')
+
+ return sb.String()
+}
diff --git a/vendor/github.com/jackc/pgtype/array.go b/vendor/github.com/jackc/pgx/v5/pgtype/array.go
index 174007c..06b824a 100644
--- a/vendor/github.com/jackc/pgtype/array.go
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/array.go
@@ -5,21 +5,20 @@ import (
"encoding/binary"
"fmt"
"io"
- "reflect"
"strconv"
"strings"
"unicode"
- "github.com/jackc/pgio"
+ "github.com/jackc/pgx/v5/internal/pgio"
)
// Information on the internals of PostgreSQL arrays can be found in
// src/include/utils/array.h and src/backend/utils/adt/arrayfuncs.c. Of
// particular interest is the array_send function.
-type ArrayHeader struct {
+type arrayHeader struct {
ContainsNull bool
- ElementOID int32
+ ElementOID uint32
Dimensions []ArrayDimension
}
@@ -28,7 +27,21 @@ type ArrayDimension struct {
LowerBound int32
}
-func (dst *ArrayHeader) DecodeBinary(ci *ConnInfo, src []byte) (int, error) {
+// cardinality returns the number of elements in an array of dimensions size.
+func cardinality(dimensions []ArrayDimension) int {
+ if len(dimensions) == 0 {
+ return 0
+ }
+
+ elementCount := int(dimensions[0].Length)
+ for _, d := range dimensions[1:] {
+ elementCount *= int(d.Length)
+ }
+
+ return elementCount
+}
+
+func (dst *arrayHeader) DecodeBinary(m *Map, src []byte) (int, error) {
if len(src) < 12 {
return 0, fmt.Errorf("array header too short: %d", len(src))
}
@@ -41,12 +54,10 @@ func (dst *ArrayHeader) DecodeBinary(ci *ConnInfo, src []byte) (int, error) {
dst.ContainsNull = binary.BigEndian.Uint32(src[rp:]) == 1
rp += 4
- dst.ElementOID = int32(binary.BigEndian.Uint32(src[rp:]))
+ dst.ElementOID = binary.BigEndian.Uint32(src[rp:])
rp += 4
- if numDims > 0 {
- dst.Dimensions = make([]ArrayDimension, numDims)
- }
+ dst.Dimensions = make([]ArrayDimension, numDims)
if len(src) < 12+numDims*8 {
return 0, fmt.Errorf("array header too short for %d dimensions: %d", numDims, len(src))
}
@@ -61,7 +72,7 @@ func (dst *ArrayHeader) DecodeBinary(ci *ConnInfo, src []byte) (int, error) {
return rp, nil
}
-func (src ArrayHeader) EncodeBinary(ci *ConnInfo, buf []byte) []byte {
+func (src arrayHeader) EncodeBinary(buf []byte) []byte {
buf = pgio.AppendInt32(buf, int32(len(src.Dimensions)))
var containsNull int32
@@ -70,7 +81,7 @@ func (src ArrayHeader) EncodeBinary(ci *ConnInfo, buf []byte) []byte {
}
buf = pgio.AppendInt32(buf, containsNull)
- buf = pgio.AppendInt32(buf, src.ElementOID)
+ buf = pgio.AppendUint32(buf, src.ElementOID)
for i := range src.Dimensions {
buf = pgio.AppendInt32(buf, src.Dimensions[i].Length)
@@ -80,14 +91,18 @@ func (src ArrayHeader) EncodeBinary(ci *ConnInfo, buf []byte) []byte {
return buf
}
-type UntypedTextArray struct {
+type untypedTextArray struct {
Elements []string
Quoted []bool
Dimensions []ArrayDimension
}
-func ParseUntypedTextArray(src string) (*UntypedTextArray, error) {
- dst := &UntypedTextArray{}
+func parseUntypedTextArray(src string) (*untypedTextArray, error) {
+ dst := &untypedTextArray{
+ Elements: []string{},
+ Quoted: []bool{},
+ Dimensions: []ArrayDimension{},
+ }
buf := bytes.NewBufferString(src)
@@ -95,7 +110,7 @@ func ParseUntypedTextArray(src string) (*UntypedTextArray, error) {
r, _, err := buf.ReadRune()
if err != nil {
- return nil, fmt.Errorf("invalid array: %v", err)
+ return nil, fmt.Errorf("invalid array: %w", err)
}
var explicitDimensions []ArrayDimension
@@ -107,7 +122,7 @@ func ParseUntypedTextArray(src string) (*UntypedTextArray, error) {
for {
r, _, err = buf.ReadRune()
if err != nil {
- return nil, fmt.Errorf("invalid array: %v", err)
+ return nil, fmt.Errorf("invalid array: %w", err)
}
if r == '=' {
@@ -118,12 +133,12 @@ func ParseUntypedTextArray(src string) (*UntypedTextArray, error) {
lower, err := arrayParseInteger(buf)
if err != nil {
- return nil, fmt.Errorf("invalid array: %v", err)
+ return nil, fmt.Errorf("invalid array: %w", err)
}
r, _, err = buf.ReadRune()
if err != nil {
- return nil, fmt.Errorf("invalid array: %v", err)
+ return nil, fmt.Errorf("invalid array: %w", err)
}
if r != ':' {
@@ -132,12 +147,12 @@ func ParseUntypedTextArray(src string) (*UntypedTextArray, error) {
upper, err := arrayParseInteger(buf)
if err != nil {
- return nil, fmt.Errorf("invalid array: %v", err)
+ return nil, fmt.Errorf("invalid array: %w", err)
}
r, _, err = buf.ReadRune()
if err != nil {
- return nil, fmt.Errorf("invalid array: %v", err)
+ return nil, fmt.Errorf("invalid array: %w", err)
}
if r != ']' {
@@ -149,12 +164,12 @@ func ParseUntypedTextArray(src string) (*UntypedTextArray, error) {
r, _, err = buf.ReadRune()
if err != nil {
- return nil, fmt.Errorf("invalid array: %v", err)
+ return nil, fmt.Errorf("invalid array: %w", err)
}
}
if r != '{' {
- return nil, fmt.Errorf("invalid array, expected '{': %v", err)
+ return nil, fmt.Errorf("invalid array, expected '{' got %v", r)
}
implicitDimensions := []ArrayDimension{{LowerBound: 1, Length: 0}}
@@ -163,7 +178,7 @@ func ParseUntypedTextArray(src string) (*UntypedTextArray, error) {
for {
r, _, err = buf.ReadRune()
if err != nil {
- return nil, fmt.Errorf("invalid array: %v", err)
+ return nil, fmt.Errorf("invalid array: %w", err)
}
if r == '{' {
@@ -180,7 +195,7 @@ func ParseUntypedTextArray(src string) (*UntypedTextArray, error) {
for {
r, _, err = buf.ReadRune()
if err != nil {
- return nil, fmt.Errorf("invalid array: %v", err)
+ return nil, fmt.Errorf("invalid array: %w", err)
}
switch r {
@@ -199,7 +214,7 @@ func ParseUntypedTextArray(src string) (*UntypedTextArray, error) {
buf.UnreadRune()
value, quoted, err := arrayParseValue(buf)
if err != nil {
- return nil, fmt.Errorf("invalid array value: %v", err)
+ return nil, fmt.Errorf("invalid array value: %w", err)
}
if currentDim == counterDim {
implicitDimensions[currentDim].Length++
@@ -220,7 +235,6 @@ func ParseUntypedTextArray(src string) (*UntypedTextArray, error) {
}
if len(dst.Elements) == 0 {
- dst.Dimensions = nil
} else if len(explicitDimensions) > 0 {
dst.Dimensions = explicitDimensions
} else {
@@ -318,7 +332,7 @@ func arrayParseInteger(buf *bytes.Buffer) (int32, error) {
}
}
-func EncodeTextArrayDimensions(buf []byte, dimensions []ArrayDimension) []byte {
+func encodeTextArrayDimensions(buf []byte, dimensions []ArrayDimension) []byte {
var customDimensions bool
for _, dim := range dimensions {
if dim.LowerBound != 1 {
@@ -348,34 +362,99 @@ func quoteArrayElement(src string) string {
}
func isSpace(ch byte) bool {
- // see https://github.com/postgres/postgres/blob/REL_12_STABLE/src/backend/parser/scansup.c#L224
- return ch == ' ' || ch == '\t' || ch == '\n' || ch == '\r' || ch == '\f'
+ // see array_isspace:
+ // https://github.com/postgres/postgres/blob/master/src/backend/utils/adt/arrayfuncs.c
+ return ch == ' ' || ch == '\t' || ch == '\n' || ch == '\r' || ch == '\v' || ch == '\f'
}
-func QuoteArrayElementIfNeeded(src string) string {
- if src == "" || (len(src) == 4 && strings.ToLower(src) == "null") || isSpace(src[0]) || isSpace(src[len(src)-1]) || strings.ContainsAny(src, `{},"\`) {
+func quoteArrayElementIfNeeded(src string) string {
+ if src == "" || (len(src) == 4 && strings.EqualFold(src, "null")) || isSpace(src[0]) || isSpace(src[len(src)-1]) || strings.ContainsAny(src, `{},"\`) {
return quoteArrayElement(src)
}
return src
}
-func findDimensionsFromValue(value reflect.Value, dimensions []ArrayDimension, elementsLength int) ([]ArrayDimension, int, bool) {
- switch value.Kind() {
- case reflect.Array:
- fallthrough
- case reflect.Slice:
- length := value.Len()
- if 0 == elementsLength {
- elementsLength = length
- } else {
- elementsLength *= length
- }
- dimensions = append(dimensions, ArrayDimension{Length: int32(length), LowerBound: 1})
- for i := 0; i < length; i++ {
- if d, l, ok := findDimensionsFromValue(value.Index(i), dimensions, elementsLength); ok {
- return d, l, true
- }
- }
+// Array represents a PostgreSQL array for T. It implements the ArrayGetter and ArraySetter interfaces. It preserves
+// PostgreSQL dimensions and custom lower bounds. Use FlatArray if these are not needed.
+type Array[T any] struct {
+ Elements []T
+ Dims []ArrayDimension
+ Valid bool
+}
+
+func (a Array[T]) Dimensions() []ArrayDimension {
+ return a.Dims
+}
+
+func (a Array[T]) Index(i int) any {
+ return a.Elements[i]
+}
+
+func (a Array[T]) IndexType() any {
+ var el T
+ return el
+}
+
+func (a *Array[T]) SetDimensions(dimensions []ArrayDimension) error {
+ if dimensions == nil {
+ *a = Array[T]{}
+ return nil
+ }
+
+ elementCount := cardinality(dimensions)
+ *a = Array[T]{
+ Elements: make([]T, elementCount),
+ Dims: dimensions,
+ Valid: true,
}
- return dimensions, elementsLength, true
+
+ return nil
+}
+
+func (a Array[T]) ScanIndex(i int) any {
+ return &a.Elements[i]
+}
+
+func (a Array[T]) ScanIndexType() any {
+ return new(T)
+}
+
+// FlatArray implements the ArrayGetter and ArraySetter interfaces for any slice of T. It ignores PostgreSQL dimensions
+// and custom lower bounds. Use Array to preserve these.
+type FlatArray[T any] []T
+
+func (a FlatArray[T]) Dimensions() []ArrayDimension {
+ if a == nil {
+ return nil
+ }
+
+ return []ArrayDimension{{Length: int32(len(a)), LowerBound: 1}}
+}
+
+func (a FlatArray[T]) Index(i int) any {
+ return a[i]
+}
+
+func (a FlatArray[T]) IndexType() any {
+ var el T
+ return el
+}
+
+func (a *FlatArray[T]) SetDimensions(dimensions []ArrayDimension) error {
+ if dimensions == nil {
+ *a = nil
+ return nil
+ }
+
+ elementCount := cardinality(dimensions)
+ *a = make(FlatArray[T], elementCount)
+ return nil
+}
+
+func (a FlatArray[T]) ScanIndex(i int) any {
+ return &a[i]
+}
+
+func (a FlatArray[T]) ScanIndexType() any {
+ return new(T)
}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/array_codec.go b/vendor/github.com/jackc/pgx/v5/pgtype/array_codec.go
new file mode 100644
index 0000000..bf5f698
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/array_codec.go
@@ -0,0 +1,405 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "fmt"
+ "reflect"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+// ArrayGetter is a type that can be converted into a PostgreSQL array.
+type ArrayGetter interface {
+ // Dimensions returns the array dimensions. If array is nil then nil is returned.
+ Dimensions() []ArrayDimension
+
+ // Index returns the element at i.
+ Index(i int) any
+
+ // IndexType returns a non-nil scan target of the type Index will return. This is used by ArrayCodec.PlanEncode.
+ IndexType() any
+}
+
+// ArraySetter is a type can be set from a PostgreSQL array.
+type ArraySetter interface {
+ // SetDimensions prepares the value such that ScanIndex can be called for each element. This will remove any existing
+ // elements. dimensions may be nil to indicate a NULL array. If unable to exactly preserve dimensions SetDimensions
+ // may return an error or silently flatten the array dimensions.
+ SetDimensions(dimensions []ArrayDimension) error
+
+ // ScanIndex returns a value usable as a scan target for i. SetDimensions must be called before ScanIndex.
+ ScanIndex(i int) any
+
+ // ScanIndexType returns a non-nil scan target of the type ScanIndex will return. This is used by
+ // ArrayCodec.PlanScan.
+ ScanIndexType() any
+}
+
+// ArrayCodec is a codec for any array type.
+type ArrayCodec struct {
+ ElementType *Type
+}
+
+func (c *ArrayCodec) FormatSupported(format int16) bool {
+ return c.ElementType.Codec.FormatSupported(format)
+}
+
+func (c *ArrayCodec) PreferredFormat() int16 {
+ // The binary format should always be preferred for arrays if it is supported. Usually, this will happen automatically
+ // because most types that support binary prefer it. However, text, json, and jsonb support binary but prefer the text
+ // format. This is because it is simpler for jsonb and PostgreSQL can be significantly faster using the text format
+ // for text-like data types than binary. However, arrays appear to always be faster in binary.
+ //
+ // https://www.postgresql.org/message-id/CAMovtNoHFod2jMAKQjjxv209PCTJx5Kc66anwWvX0mEiaXwgmA%40mail.gmail.com
+ if c.ElementType.Codec.FormatSupported(BinaryFormatCode) {
+ return BinaryFormatCode
+ }
+ return TextFormatCode
+}
+
+func (c *ArrayCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ arrayValuer, ok := value.(ArrayGetter)
+ if !ok {
+ return nil
+ }
+
+ elementType := arrayValuer.IndexType()
+
+ elementEncodePlan := m.PlanEncode(c.ElementType.OID, format, elementType)
+ if elementEncodePlan == nil {
+ if reflect.TypeOf(elementType) != nil {
+ return nil
+ }
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ return &encodePlanArrayCodecBinary{ac: c, m: m, oid: oid}
+ case TextFormatCode:
+ return &encodePlanArrayCodecText{ac: c, m: m, oid: oid}
+ }
+
+ return nil
+}
+
+type encodePlanArrayCodecText struct {
+ ac *ArrayCodec
+ m *Map
+ oid uint32
+}
+
+func (p *encodePlanArrayCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ array := value.(ArrayGetter)
+
+ dimensions := array.Dimensions()
+ if dimensions == nil {
+ return nil, nil
+ }
+
+ elementCount := cardinality(dimensions)
+ if elementCount == 0 {
+ return append(buf, '{', '}'), nil
+ }
+
+ buf = encodeTextArrayDimensions(buf, dimensions)
+
+ // dimElemCounts is the multiples of elements that each array lies on. For
+ // example, a single dimension array of length 4 would have a dimElemCounts of
+ // [4]. A multi-dimensional array of lengths [3,5,2] would have a
+ // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{'
+ // or '}'.
+ dimElemCounts := make([]int, len(dimensions))
+ dimElemCounts[len(dimensions)-1] = int(dimensions[len(dimensions)-1].Length)
+ for i := len(dimensions) - 2; i > -1; i-- {
+ dimElemCounts[i] = int(dimensions[i].Length) * dimElemCounts[i+1]
+ }
+
+ var encodePlan EncodePlan
+ var lastElemType reflect.Type
+ inElemBuf := make([]byte, 0, 32)
+ for i := 0; i < elementCount; i++ {
+ if i > 0 {
+ buf = append(buf, ',')
+ }
+
+ for _, dec := range dimElemCounts {
+ if i%dec == 0 {
+ buf = append(buf, '{')
+ }
+ }
+
+ elem := array.Index(i)
+ var elemBuf []byte
+ if elem != nil {
+ elemType := reflect.TypeOf(elem)
+ if lastElemType != elemType {
+ lastElemType = elemType
+ encodePlan = p.m.PlanEncode(p.ac.ElementType.OID, TextFormatCode, elem)
+ if encodePlan == nil {
+ return nil, fmt.Errorf("unable to encode %v", array.Index(i))
+ }
+ }
+ elemBuf, err = encodePlan.Encode(elem, inElemBuf)
+ if err != nil {
+ return nil, err
+ }
+ }
+
+ if elemBuf == nil {
+ buf = append(buf, `NULL`...)
+ } else {
+ buf = append(buf, quoteArrayElementIfNeeded(string(elemBuf))...)
+ }
+
+ for _, dec := range dimElemCounts {
+ if (i+1)%dec == 0 {
+ buf = append(buf, '}')
+ }
+ }
+ }
+
+ return buf, nil
+}
+
+type encodePlanArrayCodecBinary struct {
+ ac *ArrayCodec
+ m *Map
+ oid uint32
+}
+
+func (p *encodePlanArrayCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ array := value.(ArrayGetter)
+
+ dimensions := array.Dimensions()
+ if dimensions == nil {
+ return nil, nil
+ }
+
+ arrayHeader := arrayHeader{
+ Dimensions: dimensions,
+ ElementOID: p.ac.ElementType.OID,
+ }
+
+ containsNullIndex := len(buf) + 4
+
+ buf = arrayHeader.EncodeBinary(buf)
+
+ elementCount := cardinality(dimensions)
+
+ var encodePlan EncodePlan
+ var lastElemType reflect.Type
+ for i := 0; i < elementCount; i++ {
+ sp := len(buf)
+ buf = pgio.AppendInt32(buf, -1)
+
+ elem := array.Index(i)
+ var elemBuf []byte
+ if elem != nil {
+ elemType := reflect.TypeOf(elem)
+ if lastElemType != elemType {
+ lastElemType = elemType
+ encodePlan = p.m.PlanEncode(p.ac.ElementType.OID, BinaryFormatCode, elem)
+ if encodePlan == nil {
+ return nil, fmt.Errorf("unable to encode %v", array.Index(i))
+ }
+ }
+ elemBuf, err = encodePlan.Encode(elem, buf)
+ if err != nil {
+ return nil, err
+ }
+ }
+
+ if elemBuf == nil {
+ pgio.SetInt32(buf[containsNullIndex:], 1)
+ } else {
+ buf = elemBuf
+ pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
+ }
+ }
+
+ return buf, nil
+}
+
+func (c *ArrayCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+ arrayScanner, ok := target.(ArraySetter)
+ if !ok {
+ return nil
+ }
+
+ // target / arrayScanner might be a pointer to a nil. If it is create one so we can call ScanIndexType to plan the
+ // scan of the elements.
+ if isNil, _ := isNilDriverValuer(target); isNil {
+ arrayScanner = reflect.New(reflect.TypeOf(target).Elem()).Interface().(ArraySetter)
+ }
+
+ elementType := arrayScanner.ScanIndexType()
+
+ elementScanPlan := m.PlanScan(c.ElementType.OID, format, elementType)
+ if _, ok := elementScanPlan.(*scanPlanFail); ok {
+ return nil
+ }
+
+ return &scanPlanArrayCodec{
+ arrayCodec: c,
+ m: m,
+ oid: oid,
+ formatCode: format,
+ }
+}
+
+func (c *ArrayCodec) decodeBinary(m *Map, arrayOID uint32, src []byte, array ArraySetter) error {
+ var arrayHeader arrayHeader
+ rp, err := arrayHeader.DecodeBinary(m, src)
+ if err != nil {
+ return err
+ }
+
+ err = array.SetDimensions(arrayHeader.Dimensions)
+ if err != nil {
+ return err
+ }
+
+ elementCount := cardinality(arrayHeader.Dimensions)
+ if elementCount == 0 {
+ return nil
+ }
+
+ elementScanPlan := c.ElementType.Codec.PlanScan(m, c.ElementType.OID, BinaryFormatCode, array.ScanIndex(0))
+ if elementScanPlan == nil {
+ elementScanPlan = m.PlanScan(c.ElementType.OID, BinaryFormatCode, array.ScanIndex(0))
+ }
+
+ for i := 0; i < elementCount; i++ {
+ elem := array.ScanIndex(i)
+ elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
+ rp += 4
+ var elemSrc []byte
+ if elemLen >= 0 {
+ elemSrc = src[rp : rp+elemLen]
+ rp += elemLen
+ }
+ err = elementScanPlan.Scan(elemSrc, elem)
+ if err != nil {
+ return fmt.Errorf("failed to scan array element %d: %w", i, err)
+ }
+ }
+
+ return nil
+}
+
+func (c *ArrayCodec) decodeText(m *Map, arrayOID uint32, src []byte, array ArraySetter) error {
+ uta, err := parseUntypedTextArray(string(src))
+ if err != nil {
+ return err
+ }
+
+ err = array.SetDimensions(uta.Dimensions)
+ if err != nil {
+ return err
+ }
+
+ if len(uta.Elements) == 0 {
+ return nil
+ }
+
+ elementScanPlan := c.ElementType.Codec.PlanScan(m, c.ElementType.OID, TextFormatCode, array.ScanIndex(0))
+ if elementScanPlan == nil {
+ elementScanPlan = m.PlanScan(c.ElementType.OID, TextFormatCode, array.ScanIndex(0))
+ }
+
+ for i, s := range uta.Elements {
+ elem := array.ScanIndex(i)
+ var elemSrc []byte
+ if s != "NULL" || uta.Quoted[i] {
+ elemSrc = []byte(s)
+ }
+
+ err = elementScanPlan.Scan(elemSrc, elem)
+ if err != nil {
+ return err
+ }
+ }
+
+ return nil
+}
+
+type scanPlanArrayCodec struct {
+ arrayCodec *ArrayCodec
+ m *Map
+ oid uint32
+ formatCode int16
+ elementScanPlan ScanPlan
+}
+
+func (spac *scanPlanArrayCodec) Scan(src []byte, dst any) error {
+ c := spac.arrayCodec
+ m := spac.m
+ oid := spac.oid
+ formatCode := spac.formatCode
+
+ array := dst.(ArraySetter)
+
+ if src == nil {
+ return array.SetDimensions(nil)
+ }
+
+ switch formatCode {
+ case BinaryFormatCode:
+ return c.decodeBinary(m, oid, src, array)
+ case TextFormatCode:
+ return c.decodeText(m, oid, src, array)
+ default:
+ return fmt.Errorf("unknown format code %d", formatCode)
+ }
+}
+
+func (c *ArrayCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ switch format {
+ case TextFormatCode:
+ return string(src), nil
+ case BinaryFormatCode:
+ buf := make([]byte, len(src))
+ copy(buf, src)
+ return buf, nil
+ default:
+ return nil, fmt.Errorf("unknown format code %d", format)
+ }
+}
+
+func (c *ArrayCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var slice []any
+ err := m.PlanScan(oid, format, &slice).Scan(src, &slice)
+ return slice, err
+}
+
+func isRagged(slice reflect.Value) bool {
+ if slice.Type().Elem().Kind() != reflect.Slice {
+ return false
+ }
+
+ sliceLen := slice.Len()
+ innerLen := 0
+ for i := 0; i < sliceLen; i++ {
+ if i == 0 {
+ innerLen = slice.Index(i).Len()
+ } else {
+ if slice.Index(i).Len() != innerLen {
+ return true
+ }
+ }
+ if isRagged(slice.Index(i)) {
+ return true
+ }
+ }
+
+ return false
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/bits.go b/vendor/github.com/jackc/pgx/v5/pgtype/bits.go
new file mode 100644
index 0000000..e7a1d01
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/bits.go
@@ -0,0 +1,210 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "fmt"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+type BitsScanner interface {
+ ScanBits(v Bits) error
+}
+
+type BitsValuer interface {
+ BitsValue() (Bits, error)
+}
+
+// Bits represents the PostgreSQL bit and varbit types.
+type Bits struct {
+ Bytes []byte
+ Len int32 // Number of bits
+ Valid bool
+}
+
+func (b *Bits) ScanBits(v Bits) error {
+ *b = v
+ return nil
+}
+
+func (b Bits) BitsValue() (Bits, error) {
+ return b, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (dst *Bits) Scan(src any) error {
+ if src == nil {
+ *dst = Bits{}
+ return nil
+ }
+
+ switch src := src.(type) {
+ case string:
+ return scanPlanTextAnyToBitsScanner{}.Scan([]byte(src), dst)
+ }
+
+ return fmt.Errorf("cannot scan %T", src)
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (src Bits) Value() (driver.Value, error) {
+ if !src.Valid {
+ return nil, nil
+ }
+
+ buf, err := BitsCodec{}.PlanEncode(nil, 0, TextFormatCode, src).Encode(src, nil)
+ if err != nil {
+ return nil, err
+ }
+ return string(buf), err
+}
+
+type BitsCodec struct{}
+
+func (BitsCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (BitsCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (BitsCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ if _, ok := value.(BitsValuer); !ok {
+ return nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ return encodePlanBitsCodecBinary{}
+ case TextFormatCode:
+ return encodePlanBitsCodecText{}
+ }
+
+ return nil
+}
+
+type encodePlanBitsCodecBinary struct{}
+
+func (encodePlanBitsCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ bits, err := value.(BitsValuer).BitsValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !bits.Valid {
+ return nil, nil
+ }
+
+ buf = pgio.AppendInt32(buf, bits.Len)
+ return append(buf, bits.Bytes...), nil
+}
+
+type encodePlanBitsCodecText struct{}
+
+func (encodePlanBitsCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ bits, err := value.(BitsValuer).BitsValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !bits.Valid {
+ return nil, nil
+ }
+
+ for i := int32(0); i < bits.Len; i++ {
+ byteIdx := i / 8
+ bitMask := byte(128 >> byte(i%8))
+ char := byte('0')
+ if bits.Bytes[byteIdx]&bitMask > 0 {
+ char = '1'
+ }
+ buf = append(buf, char)
+ }
+
+ return buf, nil
+}
+
+func (BitsCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case BitsScanner:
+ return scanPlanBinaryBitsToBitsScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case BitsScanner:
+ return scanPlanTextAnyToBitsScanner{}
+ }
+ }
+
+ return nil
+}
+
+func (c BitsCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ return codecDecodeToTextFormat(c, m, oid, format, src)
+}
+
+func (c BitsCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var box Bits
+ err := codecScan(c, m, oid, format, src, &box)
+ if err != nil {
+ return nil, err
+ }
+ return box, nil
+}
+
+type scanPlanBinaryBitsToBitsScanner struct{}
+
+func (scanPlanBinaryBitsToBitsScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(BitsScanner)
+
+ if src == nil {
+ return scanner.ScanBits(Bits{})
+ }
+
+ if len(src) < 4 {
+ return fmt.Errorf("invalid length for bit/varbit: %v", len(src))
+ }
+
+ bitLen := int32(binary.BigEndian.Uint32(src))
+ rp := 4
+ buf := make([]byte, len(src[rp:]))
+ copy(buf, src[rp:])
+
+ return scanner.ScanBits(Bits{Bytes: buf, Len: bitLen, Valid: true})
+}
+
+type scanPlanTextAnyToBitsScanner struct{}
+
+func (scanPlanTextAnyToBitsScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(BitsScanner)
+
+ if src == nil {
+ return scanner.ScanBits(Bits{})
+ }
+
+ bitLen := len(src)
+ byteLen := bitLen / 8
+ if bitLen%8 > 0 {
+ byteLen++
+ }
+ buf := make([]byte, byteLen)
+
+ for i, b := range src {
+ if b == '1' {
+ byteIdx := i / 8
+ bitIdx := uint(i % 8)
+ buf[byteIdx] = buf[byteIdx] | (128 >> bitIdx)
+ }
+ }
+
+ return scanner.ScanBits(Bits{Bytes: buf, Len: int32(bitLen), Valid: true})
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/bool.go b/vendor/github.com/jackc/pgx/v5/pgtype/bool.go
new file mode 100644
index 0000000..71caffa
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/bool.go
@@ -0,0 +1,343 @@
+package pgtype
+
+import (
+ "bytes"
+ "database/sql/driver"
+ "encoding/json"
+ "fmt"
+ "strconv"
+ "strings"
+)
+
+type BoolScanner interface {
+ ScanBool(v Bool) error
+}
+
+type BoolValuer interface {
+ BoolValue() (Bool, error)
+}
+
+type Bool struct {
+ Bool bool
+ Valid bool
+}
+
+func (b *Bool) ScanBool(v Bool) error {
+ *b = v
+ return nil
+}
+
+func (b Bool) BoolValue() (Bool, error) {
+ return b, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (dst *Bool) Scan(src any) error {
+ if src == nil {
+ *dst = Bool{}
+ return nil
+ }
+
+ switch src := src.(type) {
+ case bool:
+ *dst = Bool{Bool: src, Valid: true}
+ return nil
+ case string:
+ b, err := strconv.ParseBool(src)
+ if err != nil {
+ return err
+ }
+ *dst = Bool{Bool: b, Valid: true}
+ return nil
+ case []byte:
+ b, err := strconv.ParseBool(string(src))
+ if err != nil {
+ return err
+ }
+ *dst = Bool{Bool: b, Valid: true}
+ return nil
+ }
+
+ return fmt.Errorf("cannot scan %T", src)
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (src Bool) Value() (driver.Value, error) {
+ if !src.Valid {
+ return nil, nil
+ }
+
+ return src.Bool, nil
+}
+
+func (src Bool) MarshalJSON() ([]byte, error) {
+ if !src.Valid {
+ return []byte("null"), nil
+ }
+
+ if src.Bool {
+ return []byte("true"), nil
+ } else {
+ return []byte("false"), nil
+ }
+}
+
+func (dst *Bool) UnmarshalJSON(b []byte) error {
+ var v *bool
+ err := json.Unmarshal(b, &v)
+ if err != nil {
+ return err
+ }
+
+ if v == nil {
+ *dst = Bool{}
+ } else {
+ *dst = Bool{Bool: *v, Valid: true}
+ }
+
+ return nil
+}
+
+type BoolCodec struct{}
+
+func (BoolCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (BoolCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (BoolCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ switch format {
+ case BinaryFormatCode:
+ switch value.(type) {
+ case bool:
+ return encodePlanBoolCodecBinaryBool{}
+ case BoolValuer:
+ return encodePlanBoolCodecBinaryBoolValuer{}
+ }
+ case TextFormatCode:
+ switch value.(type) {
+ case bool:
+ return encodePlanBoolCodecTextBool{}
+ case BoolValuer:
+ return encodePlanBoolCodecTextBoolValuer{}
+ }
+ }
+
+ return nil
+}
+
+type encodePlanBoolCodecBinaryBool struct{}
+
+func (encodePlanBoolCodecBinaryBool) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ v := value.(bool)
+
+ if v {
+ buf = append(buf, 1)
+ } else {
+ buf = append(buf, 0)
+ }
+
+ return buf, nil
+}
+
+type encodePlanBoolCodecTextBoolValuer struct{}
+
+func (encodePlanBoolCodecTextBoolValuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ b, err := value.(BoolValuer).BoolValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !b.Valid {
+ return nil, nil
+ }
+
+ if b.Bool {
+ buf = append(buf, 't')
+ } else {
+ buf = append(buf, 'f')
+ }
+
+ return buf, nil
+}
+
+type encodePlanBoolCodecBinaryBoolValuer struct{}
+
+func (encodePlanBoolCodecBinaryBoolValuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ b, err := value.(BoolValuer).BoolValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !b.Valid {
+ return nil, nil
+ }
+
+ if b.Bool {
+ buf = append(buf, 1)
+ } else {
+ buf = append(buf, 0)
+ }
+
+ return buf, nil
+}
+
+type encodePlanBoolCodecTextBool struct{}
+
+func (encodePlanBoolCodecTextBool) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ v := value.(bool)
+
+ if v {
+ buf = append(buf, 't')
+ } else {
+ buf = append(buf, 'f')
+ }
+
+ return buf, nil
+}
+
+func (BoolCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case *bool:
+ return scanPlanBinaryBoolToBool{}
+ case BoolScanner:
+ return scanPlanBinaryBoolToBoolScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case *bool:
+ return scanPlanTextAnyToBool{}
+ case BoolScanner:
+ return scanPlanTextAnyToBoolScanner{}
+ }
+ }
+
+ return nil
+}
+
+func (c BoolCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ return c.DecodeValue(m, oid, format, src)
+}
+
+func (c BoolCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var b bool
+ err := codecScan(c, m, oid, format, src, &b)
+ if err != nil {
+ return nil, err
+ }
+ return b, nil
+}
+
+type scanPlanBinaryBoolToBool struct{}
+
+func (scanPlanBinaryBoolToBool) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 1 {
+ return fmt.Errorf("invalid length for bool: %v", len(src))
+ }
+
+ p, ok := (dst).(*bool)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ *p = src[0] == 1
+
+ return nil
+}
+
+type scanPlanTextAnyToBool struct{}
+
+func (scanPlanTextAnyToBool) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) == 0 {
+ return fmt.Errorf("cannot scan empty string into %T", dst)
+ }
+
+ p, ok := (dst).(*bool)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ v, err := planTextToBool(src)
+ if err != nil {
+ return err
+ }
+
+ *p = v
+
+ return nil
+}
+
+type scanPlanBinaryBoolToBoolScanner struct{}
+
+func (scanPlanBinaryBoolToBoolScanner) Scan(src []byte, dst any) error {
+ s, ok := (dst).(BoolScanner)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ if src == nil {
+ return s.ScanBool(Bool{})
+ }
+
+ if len(src) != 1 {
+ return fmt.Errorf("invalid length for bool: %v", len(src))
+ }
+
+ return s.ScanBool(Bool{Bool: src[0] == 1, Valid: true})
+}
+
+type scanPlanTextAnyToBoolScanner struct{}
+
+func (scanPlanTextAnyToBoolScanner) Scan(src []byte, dst any) error {
+ s, ok := (dst).(BoolScanner)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ if src == nil {
+ return s.ScanBool(Bool{})
+ }
+
+ if len(src) == 0 {
+ return fmt.Errorf("cannot scan empty string into %T", dst)
+ }
+
+ v, err := planTextToBool(src)
+ if err != nil {
+ return err
+ }
+
+ return s.ScanBool(Bool{Bool: v, Valid: true})
+}
+
+// https://www.postgresql.org/docs/11/datatype-boolean.html
+func planTextToBool(src []byte) (bool, error) {
+ s := string(bytes.ToLower(bytes.TrimSpace(src)))
+
+ switch {
+ case strings.HasPrefix("true", s), strings.HasPrefix("yes", s), s == "on", s == "1":
+ return true, nil
+ case strings.HasPrefix("false", s), strings.HasPrefix("no", s), strings.HasPrefix("off", s), s == "0":
+ return false, nil
+ default:
+ return false, fmt.Errorf("unknown boolean string representation %q", src)
+ }
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/box.go b/vendor/github.com/jackc/pgx/v5/pgtype/box.go
new file mode 100644
index 0000000..887d268
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/box.go
@@ -0,0 +1,238 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "fmt"
+ "math"
+ "strconv"
+ "strings"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+type BoxScanner interface {
+ ScanBox(v Box) error
+}
+
+type BoxValuer interface {
+ BoxValue() (Box, error)
+}
+
+type Box struct {
+ P [2]Vec2
+ Valid bool
+}
+
+func (b *Box) ScanBox(v Box) error {
+ *b = v
+ return nil
+}
+
+func (b Box) BoxValue() (Box, error) {
+ return b, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (dst *Box) Scan(src any) error {
+ if src == nil {
+ *dst = Box{}
+ return nil
+ }
+
+ switch src := src.(type) {
+ case string:
+ return scanPlanTextAnyToBoxScanner{}.Scan([]byte(src), dst)
+ }
+
+ return fmt.Errorf("cannot scan %T", src)
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (src Box) Value() (driver.Value, error) {
+ if !src.Valid {
+ return nil, nil
+ }
+
+ buf, err := BoxCodec{}.PlanEncode(nil, 0, TextFormatCode, src).Encode(src, nil)
+ if err != nil {
+ return nil, err
+ }
+ return string(buf), err
+}
+
+type BoxCodec struct{}
+
+func (BoxCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (BoxCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (BoxCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ if _, ok := value.(BoxValuer); !ok {
+ return nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ return encodePlanBoxCodecBinary{}
+ case TextFormatCode:
+ return encodePlanBoxCodecText{}
+ }
+
+ return nil
+}
+
+type encodePlanBoxCodecBinary struct{}
+
+func (encodePlanBoxCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ box, err := value.(BoxValuer).BoxValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !box.Valid {
+ return nil, nil
+ }
+
+ buf = pgio.AppendUint64(buf, math.Float64bits(box.P[0].X))
+ buf = pgio.AppendUint64(buf, math.Float64bits(box.P[0].Y))
+ buf = pgio.AppendUint64(buf, math.Float64bits(box.P[1].X))
+ buf = pgio.AppendUint64(buf, math.Float64bits(box.P[1].Y))
+ return buf, nil
+}
+
+type encodePlanBoxCodecText struct{}
+
+func (encodePlanBoxCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ box, err := value.(BoxValuer).BoxValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !box.Valid {
+ return nil, nil
+ }
+
+ buf = append(buf, fmt.Sprintf(`(%s,%s),(%s,%s)`,
+ strconv.FormatFloat(box.P[0].X, 'f', -1, 64),
+ strconv.FormatFloat(box.P[0].Y, 'f', -1, 64),
+ strconv.FormatFloat(box.P[1].X, 'f', -1, 64),
+ strconv.FormatFloat(box.P[1].Y, 'f', -1, 64),
+ )...)
+ return buf, nil
+}
+
+func (BoxCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case BoxScanner:
+ return scanPlanBinaryBoxToBoxScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case BoxScanner:
+ return scanPlanTextAnyToBoxScanner{}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryBoxToBoxScanner struct{}
+
+func (scanPlanBinaryBoxToBoxScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(BoxScanner)
+
+ if src == nil {
+ return scanner.ScanBox(Box{})
+ }
+
+ if len(src) != 32 {
+ return fmt.Errorf("invalid length for Box: %v", len(src))
+ }
+
+ x1 := binary.BigEndian.Uint64(src)
+ y1 := binary.BigEndian.Uint64(src[8:])
+ x2 := binary.BigEndian.Uint64(src[16:])
+ y2 := binary.BigEndian.Uint64(src[24:])
+
+ return scanner.ScanBox(Box{
+ P: [2]Vec2{
+ {math.Float64frombits(x1), math.Float64frombits(y1)},
+ {math.Float64frombits(x2), math.Float64frombits(y2)},
+ },
+ Valid: true,
+ })
+}
+
+type scanPlanTextAnyToBoxScanner struct{}
+
+func (scanPlanTextAnyToBoxScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(BoxScanner)
+
+ if src == nil {
+ return scanner.ScanBox(Box{})
+ }
+
+ if len(src) < 11 {
+ return fmt.Errorf("invalid length for Box: %v", len(src))
+ }
+
+ str := string(src[1:])
+
+ var end int
+ end = strings.IndexByte(str, ',')
+
+ x1, err := strconv.ParseFloat(str[:end], 64)
+ if err != nil {
+ return err
+ }
+
+ str = str[end+1:]
+ end = strings.IndexByte(str, ')')
+
+ y1, err := strconv.ParseFloat(str[:end], 64)
+ if err != nil {
+ return err
+ }
+
+ str = str[end+3:]
+ end = strings.IndexByte(str, ',')
+
+ x2, err := strconv.ParseFloat(str[:end], 64)
+ if err != nil {
+ return err
+ }
+
+ str = str[end+1 : len(str)-1]
+
+ y2, err := strconv.ParseFloat(str, 64)
+ if err != nil {
+ return err
+ }
+
+ return scanner.ScanBox(Box{P: [2]Vec2{{x1, y1}, {x2, y2}}, Valid: true})
+}
+
+func (c BoxCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ return codecDecodeToTextFormat(c, m, oid, format, src)
+}
+
+func (c BoxCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var box Box
+ err := codecScan(c, m, oid, format, src, &box)
+ if err != nil {
+ return nil, err
+ }
+ return box, nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/builtin_wrappers.go b/vendor/github.com/jackc/pgx/v5/pgtype/builtin_wrappers.go
new file mode 100644
index 0000000..b39d3fa
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/builtin_wrappers.go
@@ -0,0 +1,952 @@
+package pgtype
+
+import (
+ "errors"
+ "fmt"
+ "math"
+ "math/big"
+ "net"
+ "net/netip"
+ "reflect"
+ "time"
+)
+
+type int8Wrapper int8
+
+func (w int8Wrapper) SkipUnderlyingTypePlan() {}
+
+func (w *int8Wrapper) ScanInt64(v Int8) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *int8")
+ }
+
+ if v.Int64 < math.MinInt8 {
+ return fmt.Errorf("%d is less than minimum value for int8", v.Int64)
+ }
+ if v.Int64 > math.MaxInt8 {
+ return fmt.Errorf("%d is greater than maximum value for int8", v.Int64)
+ }
+ *w = int8Wrapper(v.Int64)
+
+ return nil
+}
+
+func (w int8Wrapper) Int64Value() (Int8, error) {
+ return Int8{Int64: int64(w), Valid: true}, nil
+}
+
+type int16Wrapper int16
+
+func (w int16Wrapper) SkipUnderlyingTypePlan() {}
+
+func (w *int16Wrapper) ScanInt64(v Int8) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *int16")
+ }
+
+ if v.Int64 < math.MinInt16 {
+ return fmt.Errorf("%d is less than minimum value for int16", v.Int64)
+ }
+ if v.Int64 > math.MaxInt16 {
+ return fmt.Errorf("%d is greater than maximum value for int16", v.Int64)
+ }
+ *w = int16Wrapper(v.Int64)
+
+ return nil
+}
+
+func (w int16Wrapper) Int64Value() (Int8, error) {
+ return Int8{Int64: int64(w), Valid: true}, nil
+}
+
+type int32Wrapper int32
+
+func (w int32Wrapper) SkipUnderlyingTypePlan() {}
+
+func (w *int32Wrapper) ScanInt64(v Int8) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *int32")
+ }
+
+ if v.Int64 < math.MinInt32 {
+ return fmt.Errorf("%d is less than minimum value for int32", v.Int64)
+ }
+ if v.Int64 > math.MaxInt32 {
+ return fmt.Errorf("%d is greater than maximum value for int32", v.Int64)
+ }
+ *w = int32Wrapper(v.Int64)
+
+ return nil
+}
+
+func (w int32Wrapper) Int64Value() (Int8, error) {
+ return Int8{Int64: int64(w), Valid: true}, nil
+}
+
+type int64Wrapper int64
+
+func (w int64Wrapper) SkipUnderlyingTypePlan() {}
+
+func (w *int64Wrapper) ScanInt64(v Int8) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *int64")
+ }
+
+ *w = int64Wrapper(v.Int64)
+
+ return nil
+}
+
+func (w int64Wrapper) Int64Value() (Int8, error) {
+ return Int8{Int64: int64(w), Valid: true}, nil
+}
+
+type intWrapper int
+
+func (w intWrapper) SkipUnderlyingTypePlan() {}
+
+func (w *intWrapper) ScanInt64(v Int8) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *int")
+ }
+
+ if v.Int64 < math.MinInt {
+ return fmt.Errorf("%d is less than minimum value for int", v.Int64)
+ }
+ if v.Int64 > math.MaxInt {
+ return fmt.Errorf("%d is greater than maximum value for int", v.Int64)
+ }
+
+ *w = intWrapper(v.Int64)
+
+ return nil
+}
+
+func (w intWrapper) Int64Value() (Int8, error) {
+ return Int8{Int64: int64(w), Valid: true}, nil
+}
+
+type uint8Wrapper uint8
+
+func (w uint8Wrapper) SkipUnderlyingTypePlan() {}
+
+func (w *uint8Wrapper) ScanInt64(v Int8) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *uint8")
+ }
+
+ if v.Int64 < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint8", v.Int64)
+ }
+ if v.Int64 > math.MaxUint8 {
+ return fmt.Errorf("%d is greater than maximum value for uint8", v.Int64)
+ }
+ *w = uint8Wrapper(v.Int64)
+
+ return nil
+}
+
+func (w uint8Wrapper) Int64Value() (Int8, error) {
+ return Int8{Int64: int64(w), Valid: true}, nil
+}
+
+type uint16Wrapper uint16
+
+func (w uint16Wrapper) SkipUnderlyingTypePlan() {}
+
+func (w *uint16Wrapper) ScanInt64(v Int8) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *uint16")
+ }
+
+ if v.Int64 < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint16", v.Int64)
+ }
+ if v.Int64 > math.MaxUint16 {
+ return fmt.Errorf("%d is greater than maximum value for uint16", v.Int64)
+ }
+ *w = uint16Wrapper(v.Int64)
+
+ return nil
+}
+
+func (w uint16Wrapper) Int64Value() (Int8, error) {
+ return Int8{Int64: int64(w), Valid: true}, nil
+}
+
+type uint32Wrapper uint32
+
+func (w uint32Wrapper) SkipUnderlyingTypePlan() {}
+
+func (w *uint32Wrapper) ScanInt64(v Int8) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *uint32")
+ }
+
+ if v.Int64 < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint32", v.Int64)
+ }
+ if v.Int64 > math.MaxUint32 {
+ return fmt.Errorf("%d is greater than maximum value for uint32", v.Int64)
+ }
+ *w = uint32Wrapper(v.Int64)
+
+ return nil
+}
+
+func (w uint32Wrapper) Int64Value() (Int8, error) {
+ return Int8{Int64: int64(w), Valid: true}, nil
+}
+
+type uint64Wrapper uint64
+
+func (w uint64Wrapper) SkipUnderlyingTypePlan() {}
+
+func (w *uint64Wrapper) ScanInt64(v Int8) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *uint64")
+ }
+
+ if v.Int64 < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint64", v.Int64)
+ }
+
+ *w = uint64Wrapper(v.Int64)
+
+ return nil
+}
+
+func (w uint64Wrapper) Int64Value() (Int8, error) {
+ if uint64(w) > uint64(math.MaxInt64) {
+ return Int8{}, fmt.Errorf("%d is greater than maximum value for int64", w)
+ }
+
+ return Int8{Int64: int64(w), Valid: true}, nil
+}
+
+func (w *uint64Wrapper) ScanNumeric(v Numeric) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *uint64")
+ }
+
+ bi, err := v.toBigInt()
+ if err != nil {
+ return fmt.Errorf("cannot scan into *uint64: %w", err)
+ }
+
+ if !bi.IsUint64() {
+ return fmt.Errorf("cannot scan %v into *uint64", bi.String())
+ }
+
+ *w = uint64Wrapper(bi.Uint64())
+
+ return nil
+}
+
+func (w uint64Wrapper) NumericValue() (Numeric, error) {
+ return Numeric{Int: new(big.Int).SetUint64(uint64(w)), Valid: true}, nil
+}
+
+type uintWrapper uint
+
+func (w uintWrapper) SkipUnderlyingTypePlan() {}
+
+func (w *uintWrapper) ScanInt64(v Int8) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *uint64")
+ }
+
+ if v.Int64 < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint64", v.Int64)
+ }
+
+ if uint64(v.Int64) > math.MaxUint {
+ return fmt.Errorf("%d is greater than maximum value for uint", v.Int64)
+ }
+
+ *w = uintWrapper(v.Int64)
+
+ return nil
+}
+
+func (w uintWrapper) Int64Value() (Int8, error) {
+ if uint64(w) > uint64(math.MaxInt64) {
+ return Int8{}, fmt.Errorf("%d is greater than maximum value for int64", w)
+ }
+
+ return Int8{Int64: int64(w), Valid: true}, nil
+}
+
+func (w *uintWrapper) ScanNumeric(v Numeric) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *uint")
+ }
+
+ bi, err := v.toBigInt()
+ if err != nil {
+ return fmt.Errorf("cannot scan into *uint: %w", err)
+ }
+
+ if !bi.IsUint64() {
+ return fmt.Errorf("cannot scan %v into *uint", bi.String())
+ }
+
+ ui := bi.Uint64()
+
+ if math.MaxUint < ui {
+ return fmt.Errorf("cannot scan %v into *uint", ui)
+ }
+
+ *w = uintWrapper(ui)
+
+ return nil
+}
+
+func (w uintWrapper) NumericValue() (Numeric, error) {
+ return Numeric{Int: new(big.Int).SetUint64(uint64(w)), Valid: true}, nil
+}
+
+type float32Wrapper float32
+
+func (w float32Wrapper) SkipUnderlyingTypePlan() {}
+
+func (w *float32Wrapper) ScanInt64(v Int8) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *float32")
+ }
+
+ *w = float32Wrapper(v.Int64)
+
+ return nil
+}
+
+func (w float32Wrapper) Int64Value() (Int8, error) {
+ if w > math.MaxInt64 {
+ return Int8{}, fmt.Errorf("%f is greater than maximum value for int64", w)
+ }
+
+ return Int8{Int64: int64(w), Valid: true}, nil
+}
+
+func (w *float32Wrapper) ScanFloat64(v Float8) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *float32")
+ }
+
+ *w = float32Wrapper(v.Float64)
+
+ return nil
+}
+
+func (w float32Wrapper) Float64Value() (Float8, error) {
+ return Float8{Float64: float64(w), Valid: true}, nil
+}
+
+type float64Wrapper float64
+
+func (w float64Wrapper) SkipUnderlyingTypePlan() {}
+
+func (w *float64Wrapper) ScanInt64(v Int8) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *float64")
+ }
+
+ *w = float64Wrapper(v.Int64)
+
+ return nil
+}
+
+func (w float64Wrapper) Int64Value() (Int8, error) {
+ if w > math.MaxInt64 {
+ return Int8{}, fmt.Errorf("%f is greater than maximum value for int64", w)
+ }
+
+ return Int8{Int64: int64(w), Valid: true}, nil
+}
+
+func (w *float64Wrapper) ScanFloat64(v Float8) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *float64")
+ }
+
+ *w = float64Wrapper(v.Float64)
+
+ return nil
+}
+
+func (w float64Wrapper) Float64Value() (Float8, error) {
+ return Float8{Float64: float64(w), Valid: true}, nil
+}
+
+type stringWrapper string
+
+func (w stringWrapper) SkipUnderlyingTypePlan() {}
+
+func (w *stringWrapper) ScanText(v Text) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *string")
+ }
+
+ *w = stringWrapper(v.String)
+ return nil
+}
+
+func (w stringWrapper) TextValue() (Text, error) {
+ return Text{String: string(w), Valid: true}, nil
+}
+
+type timeWrapper time.Time
+
+func (w *timeWrapper) ScanDate(v Date) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *time.Time")
+ }
+
+ switch v.InfinityModifier {
+ case Finite:
+ *w = timeWrapper(v.Time)
+ return nil
+ case Infinity:
+ return fmt.Errorf("cannot scan Infinity into *time.Time")
+ case NegativeInfinity:
+ return fmt.Errorf("cannot scan -Infinity into *time.Time")
+ default:
+ return fmt.Errorf("invalid InfinityModifier: %v", v.InfinityModifier)
+ }
+}
+
+func (w timeWrapper) DateValue() (Date, error) {
+ return Date{Time: time.Time(w), Valid: true}, nil
+}
+
+func (w *timeWrapper) ScanTimestamp(v Timestamp) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *time.Time")
+ }
+
+ switch v.InfinityModifier {
+ case Finite:
+ *w = timeWrapper(v.Time)
+ return nil
+ case Infinity:
+ return fmt.Errorf("cannot scan Infinity into *time.Time")
+ case NegativeInfinity:
+ return fmt.Errorf("cannot scan -Infinity into *time.Time")
+ default:
+ return fmt.Errorf("invalid InfinityModifier: %v", v.InfinityModifier)
+ }
+}
+
+func (w timeWrapper) TimestampValue() (Timestamp, error) {
+ return Timestamp{Time: time.Time(w), Valid: true}, nil
+}
+
+func (w *timeWrapper) ScanTimestamptz(v Timestamptz) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *time.Time")
+ }
+
+ switch v.InfinityModifier {
+ case Finite:
+ *w = timeWrapper(v.Time)
+ return nil
+ case Infinity:
+ return fmt.Errorf("cannot scan Infinity into *time.Time")
+ case NegativeInfinity:
+ return fmt.Errorf("cannot scan -Infinity into *time.Time")
+ default:
+ return fmt.Errorf("invalid InfinityModifier: %v", v.InfinityModifier)
+ }
+}
+
+func (w timeWrapper) TimestamptzValue() (Timestamptz, error) {
+ return Timestamptz{Time: time.Time(w), Valid: true}, nil
+}
+
+func (w *timeWrapper) ScanTime(v Time) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *time.Time")
+ }
+
+ // 24:00:00 is max allowed time in PostgreSQL, but time.Time will normalize that to 00:00:00 the next day.
+ var maxRepresentableByTime int64 = 24*60*60*1000000 - 1
+ if v.Microseconds > maxRepresentableByTime {
+ return fmt.Errorf("%d microseconds cannot be represented as time.Time", v.Microseconds)
+ }
+
+ usec := v.Microseconds
+ hours := usec / microsecondsPerHour
+ usec -= hours * microsecondsPerHour
+ minutes := usec / microsecondsPerMinute
+ usec -= minutes * microsecondsPerMinute
+ seconds := usec / microsecondsPerSecond
+ usec -= seconds * microsecondsPerSecond
+ ns := usec * 1000
+ *w = timeWrapper(time.Date(2000, 1, 1, int(hours), int(minutes), int(seconds), int(ns), time.UTC))
+ return nil
+}
+
+func (w timeWrapper) TimeValue() (Time, error) {
+ t := time.Time(w)
+ usec := int64(t.Hour())*microsecondsPerHour +
+ int64(t.Minute())*microsecondsPerMinute +
+ int64(t.Second())*microsecondsPerSecond +
+ int64(t.Nanosecond())/1000
+ return Time{Microseconds: usec, Valid: true}, nil
+}
+
+type durationWrapper time.Duration
+
+func (w durationWrapper) SkipUnderlyingTypePlan() {}
+
+func (w *durationWrapper) ScanInterval(v Interval) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *time.Interval")
+ }
+
+ us := int64(v.Months)*microsecondsPerMonth + int64(v.Days)*microsecondsPerDay + v.Microseconds
+ *w = durationWrapper(time.Duration(us) * time.Microsecond)
+ return nil
+}
+
+func (w durationWrapper) IntervalValue() (Interval, error) {
+ return Interval{Microseconds: int64(w) / 1000, Valid: true}, nil
+}
+
+type netIPNetWrapper net.IPNet
+
+func (w *netIPNetWrapper) ScanNetipPrefix(v netip.Prefix) error {
+ if !v.IsValid() {
+ return fmt.Errorf("cannot scan NULL into *net.IPNet")
+ }
+
+ *w = netIPNetWrapper{
+ IP: v.Addr().AsSlice(),
+ Mask: net.CIDRMask(v.Bits(), v.Addr().BitLen()),
+ }
+
+ return nil
+}
+func (w netIPNetWrapper) NetipPrefixValue() (netip.Prefix, error) {
+ ip, ok := netip.AddrFromSlice(w.IP)
+ if !ok {
+ return netip.Prefix{}, errors.New("invalid net.IPNet")
+ }
+
+ ones, _ := w.Mask.Size()
+
+ return netip.PrefixFrom(ip, ones), nil
+}
+
+type netIPWrapper net.IP
+
+func (w netIPWrapper) SkipUnderlyingTypePlan() {}
+
+func (w *netIPWrapper) ScanNetipPrefix(v netip.Prefix) error {
+ if !v.IsValid() {
+ *w = nil
+ return nil
+ }
+
+ if v.Addr().BitLen() != v.Bits() {
+ return fmt.Errorf("cannot scan %v to *net.IP", v)
+ }
+
+ *w = netIPWrapper(v.Addr().AsSlice())
+ return nil
+}
+
+func (w netIPWrapper) NetipPrefixValue() (netip.Prefix, error) {
+ if w == nil {
+ return netip.Prefix{}, nil
+ }
+
+ addr, ok := netip.AddrFromSlice([]byte(w))
+ if !ok {
+ return netip.Prefix{}, errors.New("invalid net.IP")
+ }
+
+ return netip.PrefixFrom(addr, addr.BitLen()), nil
+}
+
+type netipPrefixWrapper netip.Prefix
+
+func (w *netipPrefixWrapper) ScanNetipPrefix(v netip.Prefix) error {
+ *w = netipPrefixWrapper(v)
+ return nil
+}
+
+func (w netipPrefixWrapper) NetipPrefixValue() (netip.Prefix, error) {
+ return netip.Prefix(w), nil
+}
+
+type netipAddrWrapper netip.Addr
+
+func (w *netipAddrWrapper) ScanNetipPrefix(v netip.Prefix) error {
+ if !v.IsValid() {
+ *w = netipAddrWrapper(netip.Addr{})
+ return nil
+ }
+
+ if v.Addr().BitLen() != v.Bits() {
+ return fmt.Errorf("cannot scan %v to netip.Addr", v)
+ }
+
+ *w = netipAddrWrapper(v.Addr())
+
+ return nil
+}
+
+func (w netipAddrWrapper) NetipPrefixValue() (netip.Prefix, error) {
+ addr := (netip.Addr)(w)
+ if !addr.IsValid() {
+ return netip.Prefix{}, nil
+ }
+
+ return netip.PrefixFrom(addr, addr.BitLen()), nil
+}
+
+type mapStringToPointerStringWrapper map[string]*string
+
+func (w *mapStringToPointerStringWrapper) ScanHstore(v Hstore) error {
+ *w = mapStringToPointerStringWrapper(v)
+ return nil
+}
+
+func (w mapStringToPointerStringWrapper) HstoreValue() (Hstore, error) {
+ return Hstore(w), nil
+}
+
+type mapStringToStringWrapper map[string]string
+
+func (w *mapStringToStringWrapper) ScanHstore(v Hstore) error {
+ *w = make(mapStringToStringWrapper, len(v))
+ for k, v := range v {
+ if v == nil {
+ return fmt.Errorf("cannot scan NULL to string")
+ }
+ (*w)[k] = *v
+ }
+ return nil
+}
+
+func (w mapStringToStringWrapper) HstoreValue() (Hstore, error) {
+ if w == nil {
+ return nil, nil
+ }
+
+ hstore := make(Hstore, len(w))
+ for k, v := range w {
+ s := v
+ hstore[k] = &s
+ }
+ return hstore, nil
+}
+
+type fmtStringerWrapper struct {
+ s fmt.Stringer
+}
+
+func (w fmtStringerWrapper) TextValue() (Text, error) {
+ return Text{String: w.s.String(), Valid: true}, nil
+}
+
+type byte16Wrapper [16]byte
+
+func (w *byte16Wrapper) ScanUUID(v UUID) error {
+ if !v.Valid {
+ return fmt.Errorf("cannot scan NULL into *[16]byte")
+ }
+ *w = byte16Wrapper(v.Bytes)
+ return nil
+}
+
+func (w byte16Wrapper) UUIDValue() (UUID, error) {
+ return UUID{Bytes: [16]byte(w), Valid: true}, nil
+}
+
+type byteSliceWrapper []byte
+
+func (w byteSliceWrapper) SkipUnderlyingTypePlan() {}
+
+func (w *byteSliceWrapper) ScanText(v Text) error {
+ if !v.Valid {
+ *w = nil
+ return nil
+ }
+
+ *w = byteSliceWrapper(v.String)
+ return nil
+}
+
+func (w byteSliceWrapper) TextValue() (Text, error) {
+ if w == nil {
+ return Text{}, nil
+ }
+
+ return Text{String: string(w), Valid: true}, nil
+}
+
+func (w *byteSliceWrapper) ScanUUID(v UUID) error {
+ if !v.Valid {
+ *w = nil
+ return nil
+ }
+ *w = make(byteSliceWrapper, 16)
+ copy(*w, v.Bytes[:])
+ return nil
+}
+
+func (w byteSliceWrapper) UUIDValue() (UUID, error) {
+ if w == nil {
+ return UUID{}, nil
+ }
+
+ uuid := UUID{Valid: true}
+ copy(uuid.Bytes[:], w)
+ return uuid, nil
+}
+
+// structWrapper implements CompositeIndexGetter for a struct.
+type structWrapper struct {
+ s any
+ exportedFields []reflect.Value
+}
+
+func (w structWrapper) IsNull() bool {
+ return w.s == nil
+}
+
+func (w structWrapper) Index(i int) any {
+ if i >= len(w.exportedFields) {
+ return fmt.Errorf("%#v only has %d public fields - %d is out of bounds", w.s, len(w.exportedFields), i)
+ }
+
+ return w.exportedFields[i].Interface()
+}
+
+// ptrStructWrapper implements CompositeIndexScanner for a pointer to a struct.
+type ptrStructWrapper struct {
+ s any
+ exportedFields []reflect.Value
+}
+
+func (w *ptrStructWrapper) ScanNull() error {
+ return fmt.Errorf("cannot scan NULL into %#v", w.s)
+}
+
+func (w *ptrStructWrapper) ScanIndex(i int) any {
+ if i >= len(w.exportedFields) {
+ return fmt.Errorf("%#v only has %d public fields - %d is out of bounds", w.s, len(w.exportedFields), i)
+ }
+
+ return w.exportedFields[i].Addr().Interface()
+}
+
+type anySliceArrayReflect struct {
+ slice reflect.Value
+}
+
+func (a anySliceArrayReflect) Dimensions() []ArrayDimension {
+ if a.slice.IsNil() {
+ return nil
+ }
+
+ return []ArrayDimension{{Length: int32(a.slice.Len()), LowerBound: 1}}
+}
+
+func (a anySliceArrayReflect) Index(i int) any {
+ return a.slice.Index(i).Interface()
+}
+
+func (a anySliceArrayReflect) IndexType() any {
+ return reflect.New(a.slice.Type().Elem()).Elem().Interface()
+}
+
+func (a *anySliceArrayReflect) SetDimensions(dimensions []ArrayDimension) error {
+ sliceType := a.slice.Type()
+
+ if dimensions == nil {
+ a.slice.Set(reflect.Zero(sliceType))
+ return nil
+ }
+
+ elementCount := cardinality(dimensions)
+ slice := reflect.MakeSlice(sliceType, elementCount, elementCount)
+ a.slice.Set(slice)
+ return nil
+}
+
+func (a *anySliceArrayReflect) ScanIndex(i int) any {
+ return a.slice.Index(i).Addr().Interface()
+}
+
+func (a *anySliceArrayReflect) ScanIndexType() any {
+ return reflect.New(a.slice.Type().Elem()).Interface()
+}
+
+type anyMultiDimSliceArray struct {
+ slice reflect.Value
+ dims []ArrayDimension
+}
+
+func (a *anyMultiDimSliceArray) Dimensions() []ArrayDimension {
+ if a.slice.IsNil() {
+ return nil
+ }
+
+ s := a.slice
+ for {
+ a.dims = append(a.dims, ArrayDimension{Length: int32(s.Len()), LowerBound: 1})
+ if s.Len() > 0 {
+ s = s.Index(0)
+ } else {
+ break
+ }
+ if s.Type().Kind() == reflect.Slice {
+ } else {
+ break
+ }
+ }
+
+ return a.dims
+}
+
+func (a *anyMultiDimSliceArray) Index(i int) any {
+ if len(a.dims) == 1 {
+ return a.slice.Index(i).Interface()
+ }
+
+ indexes := make([]int, len(a.dims))
+ for j := len(a.dims) - 1; j >= 0; j-- {
+ dimLen := int(a.dims[j].Length)
+ indexes[j] = i % dimLen
+ i = i / dimLen
+ }
+
+ v := a.slice
+ for _, si := range indexes {
+ v = v.Index(si)
+ }
+
+ return v.Interface()
+}
+
+func (a *anyMultiDimSliceArray) IndexType() any {
+ lowestSliceType := a.slice.Type()
+ for ; lowestSliceType.Elem().Kind() == reflect.Slice; lowestSliceType = lowestSliceType.Elem() {
+ }
+ return reflect.New(lowestSliceType.Elem()).Elem().Interface()
+}
+
+func (a *anyMultiDimSliceArray) SetDimensions(dimensions []ArrayDimension) error {
+ sliceType := a.slice.Type()
+
+ if dimensions == nil {
+ a.slice.Set(reflect.Zero(sliceType))
+ return nil
+ }
+
+ switch len(dimensions) {
+ case 0:
+ // Empty, but non-nil array
+ slice := reflect.MakeSlice(sliceType, 0, 0)
+ a.slice.Set(slice)
+ return nil
+ case 1:
+ elementCount := cardinality(dimensions)
+ slice := reflect.MakeSlice(sliceType, elementCount, elementCount)
+ a.slice.Set(slice)
+ return nil
+ default:
+ sliceDimensionCount := 1
+ lowestSliceType := sliceType
+ for ; lowestSliceType.Elem().Kind() == reflect.Slice; lowestSliceType = lowestSliceType.Elem() {
+ sliceDimensionCount++
+ }
+
+ if sliceDimensionCount != len(dimensions) {
+ return fmt.Errorf("PostgreSQL array has %d dimensions but slice has %d dimensions", len(dimensions), sliceDimensionCount)
+ }
+
+ elementCount := cardinality(dimensions)
+ flatSlice := reflect.MakeSlice(lowestSliceType, elementCount, elementCount)
+
+ multiDimSlice := a.makeMultidimensionalSlice(sliceType, dimensions, flatSlice, 0)
+ a.slice.Set(multiDimSlice)
+
+ // Now that a.slice is a multi-dimensional slice with the underlying data pointed at flatSlice change a.slice to
+ // flatSlice so ScanIndex only has to handle simple one dimensional slices.
+ a.slice = flatSlice
+
+ return nil
+ }
+
+}
+
+func (a *anyMultiDimSliceArray) makeMultidimensionalSlice(sliceType reflect.Type, dimensions []ArrayDimension, flatSlice reflect.Value, flatSliceIdx int) reflect.Value {
+ if len(dimensions) == 1 {
+ endIdx := flatSliceIdx + int(dimensions[0].Length)
+ return flatSlice.Slice3(flatSliceIdx, endIdx, endIdx)
+ }
+
+ sliceLen := int(dimensions[0].Length)
+ slice := reflect.MakeSlice(sliceType, sliceLen, sliceLen)
+ for i := 0; i < sliceLen; i++ {
+ subSlice := a.makeMultidimensionalSlice(sliceType.Elem(), dimensions[1:], flatSlice, flatSliceIdx+(i*int(dimensions[1].Length)))
+ slice.Index(i).Set(subSlice)
+ }
+
+ return slice
+}
+
+func (a *anyMultiDimSliceArray) ScanIndex(i int) any {
+ return a.slice.Index(i).Addr().Interface()
+}
+
+func (a *anyMultiDimSliceArray) ScanIndexType() any {
+ lowestSliceType := a.slice.Type()
+ for ; lowestSliceType.Elem().Kind() == reflect.Slice; lowestSliceType = lowestSliceType.Elem() {
+ }
+ return reflect.New(lowestSliceType.Elem()).Interface()
+}
+
+type anyArrayArrayReflect struct {
+ array reflect.Value
+}
+
+func (a anyArrayArrayReflect) Dimensions() []ArrayDimension {
+ return []ArrayDimension{{Length: int32(a.array.Len()), LowerBound: 1}}
+}
+
+func (a anyArrayArrayReflect) Index(i int) any {
+ return a.array.Index(i).Interface()
+}
+
+func (a anyArrayArrayReflect) IndexType() any {
+ return reflect.New(a.array.Type().Elem()).Elem().Interface()
+}
+
+func (a *anyArrayArrayReflect) SetDimensions(dimensions []ArrayDimension) error {
+ if dimensions == nil {
+ return fmt.Errorf("anyArrayArrayReflect: cannot scan NULL into %v", a.array.Type().String())
+ }
+
+ if len(dimensions) != 1 {
+ return fmt.Errorf("anyArrayArrayReflect: cannot scan multi-dimensional array into %v", a.array.Type().String())
+ }
+
+ if int(dimensions[0].Length) != a.array.Len() {
+ return fmt.Errorf("anyArrayArrayReflect: cannot scan array with length %v into %v", dimensions[0].Length, a.array.Type().String())
+ }
+
+ return nil
+}
+
+func (a *anyArrayArrayReflect) ScanIndex(i int) any {
+ return a.array.Index(i).Addr().Interface()
+}
+
+func (a *anyArrayArrayReflect) ScanIndexType() any {
+ return reflect.New(a.array.Type().Elem()).Interface()
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/bytea.go b/vendor/github.com/jackc/pgx/v5/pgtype/bytea.go
new file mode 100644
index 0000000..a247705
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/bytea.go
@@ -0,0 +1,255 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/hex"
+ "fmt"
+)
+
+type BytesScanner interface {
+ // ScanBytes receives a byte slice of driver memory that is only valid until the next database method call.
+ ScanBytes(v []byte) error
+}
+
+type BytesValuer interface {
+ // BytesValue returns a byte slice of the byte data. The caller must not change the returned slice.
+ BytesValue() ([]byte, error)
+}
+
+// DriverBytes is a byte slice that holds a reference to memory owned by the driver. It is only valid from the time it
+// is scanned until Rows.Next or Rows.Close is called. It is never safe to use DriverBytes with QueryRow as Row.Scan
+// internally calls Rows.Close before returning.
+type DriverBytes []byte
+
+func (b *DriverBytes) ScanBytes(v []byte) error {
+ *b = v
+ return nil
+}
+
+// PreallocBytes is a byte slice of preallocated memory that scanned bytes will be copied to. If it is too small a new
+// slice will be allocated.
+type PreallocBytes []byte
+
+func (b *PreallocBytes) ScanBytes(v []byte) error {
+ if v == nil {
+ *b = nil
+ return nil
+ }
+
+ if len(v) <= len(*b) {
+ *b = (*b)[:len(v)]
+ } else {
+ *b = make(PreallocBytes, len(v))
+ }
+ copy(*b, v)
+ return nil
+}
+
+// UndecodedBytes can be used as a scan target to get the raw bytes from PostgreSQL without any decoding.
+type UndecodedBytes []byte
+
+type scanPlanAnyToUndecodedBytes struct{}
+
+func (scanPlanAnyToUndecodedBytes) Scan(src []byte, dst any) error {
+ dstBuf := dst.(*UndecodedBytes)
+ if src == nil {
+ *dstBuf = nil
+ return nil
+ }
+
+ *dstBuf = make([]byte, len(src))
+ copy(*dstBuf, src)
+ return nil
+}
+
+type ByteaCodec struct{}
+
+func (ByteaCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (ByteaCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (ByteaCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ switch format {
+ case BinaryFormatCode:
+ switch value.(type) {
+ case []byte:
+ return encodePlanBytesCodecBinaryBytes{}
+ case BytesValuer:
+ return encodePlanBytesCodecBinaryBytesValuer{}
+ }
+ case TextFormatCode:
+ switch value.(type) {
+ case []byte:
+ return encodePlanBytesCodecTextBytes{}
+ case BytesValuer:
+ return encodePlanBytesCodecTextBytesValuer{}
+ }
+ }
+
+ return nil
+}
+
+type encodePlanBytesCodecBinaryBytes struct{}
+
+func (encodePlanBytesCodecBinaryBytes) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ b := value.([]byte)
+ if b == nil {
+ return nil, nil
+ }
+
+ return append(buf, b...), nil
+}
+
+type encodePlanBytesCodecBinaryBytesValuer struct{}
+
+func (encodePlanBytesCodecBinaryBytesValuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ b, err := value.(BytesValuer).BytesValue()
+ if err != nil {
+ return nil, err
+ }
+ if b == nil {
+ return nil, nil
+ }
+
+ return append(buf, b...), nil
+}
+
+type encodePlanBytesCodecTextBytes struct{}
+
+func (encodePlanBytesCodecTextBytes) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ b := value.([]byte)
+ if b == nil {
+ return nil, nil
+ }
+
+ buf = append(buf, `\x`...)
+ buf = append(buf, hex.EncodeToString(b)...)
+ return buf, nil
+}
+
+type encodePlanBytesCodecTextBytesValuer struct{}
+
+func (encodePlanBytesCodecTextBytesValuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ b, err := value.(BytesValuer).BytesValue()
+ if err != nil {
+ return nil, err
+ }
+ if b == nil {
+ return nil, nil
+ }
+
+ buf = append(buf, `\x`...)
+ buf = append(buf, hex.EncodeToString(b)...)
+ return buf, nil
+}
+
+func (ByteaCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case *[]byte:
+ return scanPlanBinaryBytesToBytes{}
+ case BytesScanner:
+ return scanPlanBinaryBytesToBytesScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case *[]byte:
+ return scanPlanTextByteaToBytes{}
+ case BytesScanner:
+ return scanPlanTextByteaToBytesScanner{}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryBytesToBytes struct{}
+
+func (scanPlanBinaryBytesToBytes) Scan(src []byte, dst any) error {
+ dstBuf := dst.(*[]byte)
+ if src == nil {
+ *dstBuf = nil
+ return nil
+ }
+
+ *dstBuf = make([]byte, len(src))
+ copy(*dstBuf, src)
+ return nil
+}
+
+type scanPlanBinaryBytesToBytesScanner struct{}
+
+func (scanPlanBinaryBytesToBytesScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(BytesScanner)
+ return scanner.ScanBytes(src)
+}
+
+type scanPlanTextByteaToBytes struct{}
+
+func (scanPlanTextByteaToBytes) Scan(src []byte, dst any) error {
+ dstBuf := dst.(*[]byte)
+ if src == nil {
+ *dstBuf = nil
+ return nil
+ }
+
+ buf, err := decodeHexBytea(src)
+ if err != nil {
+ return err
+ }
+ *dstBuf = buf
+
+ return nil
+}
+
+type scanPlanTextByteaToBytesScanner struct{}
+
+func (scanPlanTextByteaToBytesScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(BytesScanner)
+ buf, err := decodeHexBytea(src)
+ if err != nil {
+ return err
+ }
+ return scanner.ScanBytes(buf)
+}
+
+func decodeHexBytea(src []byte) ([]byte, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ if len(src) < 2 || src[0] != '\\' || src[1] != 'x' {
+ return nil, fmt.Errorf("invalid hex format")
+ }
+
+ buf := make([]byte, (len(src)-2)/2)
+ _, err := hex.Decode(buf, src[2:])
+ if err != nil {
+ return nil, err
+ }
+
+ return buf, nil
+}
+
+func (c ByteaCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ return c.DecodeValue(m, oid, format, src)
+}
+
+func (c ByteaCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var buf []byte
+ err := codecScan(c, m, oid, format, src, &buf)
+ if err != nil {
+ return nil, err
+ }
+ return buf, nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/circle.go b/vendor/github.com/jackc/pgx/v5/pgtype/circle.go
new file mode 100644
index 0000000..e8f118c
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/circle.go
@@ -0,0 +1,222 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "fmt"
+ "math"
+ "strconv"
+ "strings"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+type CircleScanner interface {
+ ScanCircle(v Circle) error
+}
+
+type CircleValuer interface {
+ CircleValue() (Circle, error)
+}
+
+type Circle struct {
+ P Vec2
+ R float64
+ Valid bool
+}
+
+func (c *Circle) ScanCircle(v Circle) error {
+ *c = v
+ return nil
+}
+
+func (c Circle) CircleValue() (Circle, error) {
+ return c, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (dst *Circle) Scan(src any) error {
+ if src == nil {
+ *dst = Circle{}
+ return nil
+ }
+
+ switch src := src.(type) {
+ case string:
+ return scanPlanTextAnyToCircleScanner{}.Scan([]byte(src), dst)
+ }
+
+ return fmt.Errorf("cannot scan %T", src)
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (src Circle) Value() (driver.Value, error) {
+ if !src.Valid {
+ return nil, nil
+ }
+
+ buf, err := CircleCodec{}.PlanEncode(nil, 0, TextFormatCode, src).Encode(src, nil)
+ if err != nil {
+ return nil, err
+ }
+ return string(buf), err
+}
+
+type CircleCodec struct{}
+
+func (CircleCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (CircleCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (CircleCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ if _, ok := value.(CircleValuer); !ok {
+ return nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ return encodePlanCircleCodecBinary{}
+ case TextFormatCode:
+ return encodePlanCircleCodecText{}
+ }
+
+ return nil
+}
+
+type encodePlanCircleCodecBinary struct{}
+
+func (encodePlanCircleCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ circle, err := value.(CircleValuer).CircleValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !circle.Valid {
+ return nil, nil
+ }
+
+ buf = pgio.AppendUint64(buf, math.Float64bits(circle.P.X))
+ buf = pgio.AppendUint64(buf, math.Float64bits(circle.P.Y))
+ buf = pgio.AppendUint64(buf, math.Float64bits(circle.R))
+ return buf, nil
+}
+
+type encodePlanCircleCodecText struct{}
+
+func (encodePlanCircleCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ circle, err := value.(CircleValuer).CircleValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !circle.Valid {
+ return nil, nil
+ }
+
+ buf = append(buf, fmt.Sprintf(`<(%s,%s),%s>`,
+ strconv.FormatFloat(circle.P.X, 'f', -1, 64),
+ strconv.FormatFloat(circle.P.Y, 'f', -1, 64),
+ strconv.FormatFloat(circle.R, 'f', -1, 64),
+ )...)
+ return buf, nil
+}
+
+func (CircleCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case CircleScanner:
+ return scanPlanBinaryCircleToCircleScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case CircleScanner:
+ return scanPlanTextAnyToCircleScanner{}
+ }
+ }
+
+ return nil
+}
+
+func (c CircleCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ return codecDecodeToTextFormat(c, m, oid, format, src)
+}
+
+func (c CircleCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var circle Circle
+ err := codecScan(c, m, oid, format, src, &circle)
+ if err != nil {
+ return nil, err
+ }
+ return circle, nil
+}
+
+type scanPlanBinaryCircleToCircleScanner struct{}
+
+func (scanPlanBinaryCircleToCircleScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(CircleScanner)
+
+ if src == nil {
+ return scanner.ScanCircle(Circle{})
+ }
+
+ if len(src) != 24 {
+ return fmt.Errorf("invalid length for Circle: %v", len(src))
+ }
+
+ x := binary.BigEndian.Uint64(src)
+ y := binary.BigEndian.Uint64(src[8:])
+ r := binary.BigEndian.Uint64(src[16:])
+
+ return scanner.ScanCircle(Circle{
+ P: Vec2{math.Float64frombits(x), math.Float64frombits(y)},
+ R: math.Float64frombits(r),
+ Valid: true,
+ })
+}
+
+type scanPlanTextAnyToCircleScanner struct{}
+
+func (scanPlanTextAnyToCircleScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(CircleScanner)
+
+ if src == nil {
+ return scanner.ScanCircle(Circle{})
+ }
+
+ if len(src) < 9 {
+ return fmt.Errorf("invalid length for Circle: %v", len(src))
+ }
+
+ str := string(src[2:])
+ end := strings.IndexByte(str, ',')
+ x, err := strconv.ParseFloat(str[:end], 64)
+ if err != nil {
+ return err
+ }
+
+ str = str[end+1:]
+ end = strings.IndexByte(str, ')')
+
+ y, err := strconv.ParseFloat(str[:end], 64)
+ if err != nil {
+ return err
+ }
+
+ str = str[end+2 : len(str)-1]
+
+ r, err := strconv.ParseFloat(str, 64)
+ if err != nil {
+ return err
+ }
+
+ return scanner.ScanCircle(Circle{P: Vec2{x, y}, R: r, Valid: true})
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/composite.go b/vendor/github.com/jackc/pgx/v5/pgtype/composite.go
new file mode 100644
index 0000000..fb37232
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/composite.go
@@ -0,0 +1,602 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "errors"
+ "fmt"
+ "strings"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+// CompositeIndexGetter is a type accessed by index that can be converted into a PostgreSQL composite.
+type CompositeIndexGetter interface {
+ // IsNull returns true if the value is SQL NULL.
+ IsNull() bool
+
+ // Index returns the element at i.
+ Index(i int) any
+}
+
+// CompositeIndexScanner is a type accessed by index that can be scanned from a PostgreSQL composite.
+type CompositeIndexScanner interface {
+ // ScanNull sets the value to SQL NULL.
+ ScanNull() error
+
+ // ScanIndex returns a value usable as a scan target for i.
+ ScanIndex(i int) any
+}
+
+type CompositeCodecField struct {
+ Name string
+ Type *Type
+}
+
+type CompositeCodec struct {
+ Fields []CompositeCodecField
+}
+
+func (c *CompositeCodec) FormatSupported(format int16) bool {
+ for _, f := range c.Fields {
+ if !f.Type.Codec.FormatSupported(format) {
+ return false
+ }
+ }
+
+ return true
+}
+
+func (c *CompositeCodec) PreferredFormat() int16 {
+ if c.FormatSupported(BinaryFormatCode) {
+ return BinaryFormatCode
+ }
+ return TextFormatCode
+}
+
+func (c *CompositeCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ if _, ok := value.(CompositeIndexGetter); !ok {
+ return nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ return &encodePlanCompositeCodecCompositeIndexGetterToBinary{cc: c, m: m}
+ case TextFormatCode:
+ return &encodePlanCompositeCodecCompositeIndexGetterToText{cc: c, m: m}
+ }
+
+ return nil
+}
+
+type encodePlanCompositeCodecCompositeIndexGetterToBinary struct {
+ cc *CompositeCodec
+ m *Map
+}
+
+func (plan *encodePlanCompositeCodecCompositeIndexGetterToBinary) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ getter := value.(CompositeIndexGetter)
+
+ if getter.IsNull() {
+ return nil, nil
+ }
+
+ builder := NewCompositeBinaryBuilder(plan.m, buf)
+ for i, field := range plan.cc.Fields {
+ builder.AppendValue(field.Type.OID, getter.Index(i))
+ }
+
+ return builder.Finish()
+}
+
+type encodePlanCompositeCodecCompositeIndexGetterToText struct {
+ cc *CompositeCodec
+ m *Map
+}
+
+func (plan *encodePlanCompositeCodecCompositeIndexGetterToText) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ getter := value.(CompositeIndexGetter)
+
+ if getter.IsNull() {
+ return nil, nil
+ }
+
+ b := NewCompositeTextBuilder(plan.m, buf)
+ for i, field := range plan.cc.Fields {
+ b.AppendValue(field.Type.OID, getter.Index(i))
+ }
+
+ return b.Finish()
+}
+
+func (c *CompositeCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case CompositeIndexScanner:
+ return &scanPlanBinaryCompositeToCompositeIndexScanner{cc: c, m: m}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case CompositeIndexScanner:
+ return &scanPlanTextCompositeToCompositeIndexScanner{cc: c, m: m}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryCompositeToCompositeIndexScanner struct {
+ cc *CompositeCodec
+ m *Map
+}
+
+func (plan *scanPlanBinaryCompositeToCompositeIndexScanner) Scan(src []byte, target any) error {
+ targetScanner := (target).(CompositeIndexScanner)
+
+ if src == nil {
+ return targetScanner.ScanNull()
+ }
+
+ scanner := NewCompositeBinaryScanner(plan.m, src)
+ for i, field := range plan.cc.Fields {
+ if scanner.Next() {
+ fieldTarget := targetScanner.ScanIndex(i)
+ if fieldTarget != nil {
+ fieldPlan := plan.m.PlanScan(field.Type.OID, BinaryFormatCode, fieldTarget)
+ if fieldPlan == nil {
+ return fmt.Errorf("unable to encode %v into OID %d in binary format", field, field.Type.OID)
+ }
+
+ err := fieldPlan.Scan(scanner.Bytes(), fieldTarget)
+ if err != nil {
+ return err
+ }
+ }
+ } else {
+ return errors.New("read past end of composite")
+ }
+ }
+
+ if err := scanner.Err(); err != nil {
+ return err
+ }
+
+ return nil
+}
+
+type scanPlanTextCompositeToCompositeIndexScanner struct {
+ cc *CompositeCodec
+ m *Map
+}
+
+func (plan *scanPlanTextCompositeToCompositeIndexScanner) Scan(src []byte, target any) error {
+ targetScanner := (target).(CompositeIndexScanner)
+
+ if src == nil {
+ return targetScanner.ScanNull()
+ }
+
+ scanner := NewCompositeTextScanner(plan.m, src)
+ for i, field := range plan.cc.Fields {
+ if scanner.Next() {
+ fieldTarget := targetScanner.ScanIndex(i)
+ if fieldTarget != nil {
+ fieldPlan := plan.m.PlanScan(field.Type.OID, TextFormatCode, fieldTarget)
+ if fieldPlan == nil {
+ return fmt.Errorf("unable to encode %v into OID %d in text format", field, field.Type.OID)
+ }
+
+ err := fieldPlan.Scan(scanner.Bytes(), fieldTarget)
+ if err != nil {
+ return err
+ }
+ }
+ } else {
+ return errors.New("read past end of composite")
+ }
+ }
+
+ if err := scanner.Err(); err != nil {
+ return err
+ }
+
+ return nil
+}
+
+func (c *CompositeCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ switch format {
+ case TextFormatCode:
+ return string(src), nil
+ case BinaryFormatCode:
+ buf := make([]byte, len(src))
+ copy(buf, src)
+ return buf, nil
+ default:
+ return nil, fmt.Errorf("unknown format code %d", format)
+ }
+}
+
+func (c *CompositeCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ switch format {
+ case TextFormatCode:
+ scanner := NewCompositeTextScanner(m, src)
+ values := make(map[string]any, len(c.Fields))
+ for i := 0; scanner.Next() && i < len(c.Fields); i++ {
+ var v any
+ fieldPlan := m.PlanScan(c.Fields[i].Type.OID, TextFormatCode, &v)
+ if fieldPlan == nil {
+ return nil, fmt.Errorf("unable to scan OID %d in text format into %v", c.Fields[i].Type.OID, v)
+ }
+
+ err := fieldPlan.Scan(scanner.Bytes(), &v)
+ if err != nil {
+ return nil, err
+ }
+
+ values[c.Fields[i].Name] = v
+ }
+
+ if err := scanner.Err(); err != nil {
+ return nil, err
+ }
+
+ return values, nil
+ case BinaryFormatCode:
+ scanner := NewCompositeBinaryScanner(m, src)
+ values := make(map[string]any, len(c.Fields))
+ for i := 0; scanner.Next() && i < len(c.Fields); i++ {
+ var v any
+ fieldPlan := m.PlanScan(scanner.OID(), BinaryFormatCode, &v)
+ if fieldPlan == nil {
+ return nil, fmt.Errorf("unable to scan OID %d in binary format into %v", scanner.OID(), v)
+ }
+
+ err := fieldPlan.Scan(scanner.Bytes(), &v)
+ if err != nil {
+ return nil, err
+ }
+
+ values[c.Fields[i].Name] = v
+ }
+
+ if err := scanner.Err(); err != nil {
+ return nil, err
+ }
+
+ return values, nil
+ default:
+ return nil, fmt.Errorf("unknown format code %d", format)
+ }
+
+}
+
+type CompositeBinaryScanner struct {
+ m *Map
+ rp int
+ src []byte
+
+ fieldCount int32
+ fieldBytes []byte
+ fieldOID uint32
+ err error
+}
+
+// NewCompositeBinaryScanner a scanner over a binary encoded composite balue.
+func NewCompositeBinaryScanner(m *Map, src []byte) *CompositeBinaryScanner {
+ rp := 0
+ if len(src[rp:]) < 4 {
+ return &CompositeBinaryScanner{err: fmt.Errorf("Record incomplete %v", src)}
+ }
+
+ fieldCount := int32(binary.BigEndian.Uint32(src[rp:]))
+ rp += 4
+
+ return &CompositeBinaryScanner{
+ m: m,
+ rp: rp,
+ src: src,
+ fieldCount: fieldCount,
+ }
+}
+
+// Next advances the scanner to the next field. It returns false after the last field is read or an error occurs. After
+// Next returns false, the Err method can be called to check if any errors occurred.
+func (cfs *CompositeBinaryScanner) Next() bool {
+ if cfs.err != nil {
+ return false
+ }
+
+ if cfs.rp == len(cfs.src) {
+ return false
+ }
+
+ if len(cfs.src[cfs.rp:]) < 8 {
+ cfs.err = fmt.Errorf("Record incomplete %v", cfs.src)
+ return false
+ }
+ cfs.fieldOID = binary.BigEndian.Uint32(cfs.src[cfs.rp:])
+ cfs.rp += 4
+
+ fieldLen := int(int32(binary.BigEndian.Uint32(cfs.src[cfs.rp:])))
+ cfs.rp += 4
+
+ if fieldLen >= 0 {
+ if len(cfs.src[cfs.rp:]) < fieldLen {
+ cfs.err = fmt.Errorf("Record incomplete rp=%d src=%v", cfs.rp, cfs.src)
+ return false
+ }
+ cfs.fieldBytes = cfs.src[cfs.rp : cfs.rp+fieldLen]
+ cfs.rp += fieldLen
+ } else {
+ cfs.fieldBytes = nil
+ }
+
+ return true
+}
+
+func (cfs *CompositeBinaryScanner) FieldCount() int {
+ return int(cfs.fieldCount)
+}
+
+// Bytes returns the bytes of the field most recently read by Scan().
+func (cfs *CompositeBinaryScanner) Bytes() []byte {
+ return cfs.fieldBytes
+}
+
+// OID returns the OID of the field most recently read by Scan().
+func (cfs *CompositeBinaryScanner) OID() uint32 {
+ return cfs.fieldOID
+}
+
+// Err returns any error encountered by the scanner.
+func (cfs *CompositeBinaryScanner) Err() error {
+ return cfs.err
+}
+
+type CompositeTextScanner struct {
+ m *Map
+ rp int
+ src []byte
+
+ fieldBytes []byte
+ err error
+}
+
+// NewCompositeTextScanner a scanner over a text encoded composite value.
+func NewCompositeTextScanner(m *Map, src []byte) *CompositeTextScanner {
+ if len(src) < 2 {
+ return &CompositeTextScanner{err: fmt.Errorf("Record incomplete %v", src)}
+ }
+
+ if src[0] != '(' {
+ return &CompositeTextScanner{err: fmt.Errorf("composite text format must start with '('")}
+ }
+
+ if src[len(src)-1] != ')' {
+ return &CompositeTextScanner{err: fmt.Errorf("composite text format must end with ')'")}
+ }
+
+ return &CompositeTextScanner{
+ m: m,
+ rp: 1,
+ src: src,
+ }
+}
+
+// Next advances the scanner to the next field. It returns false after the last field is read or an error occurs. After
+// Next returns false, the Err method can be called to check if any errors occurred.
+func (cfs *CompositeTextScanner) Next() bool {
+ if cfs.err != nil {
+ return false
+ }
+
+ if cfs.rp == len(cfs.src) {
+ return false
+ }
+
+ switch cfs.src[cfs.rp] {
+ case ',', ')': // null
+ cfs.rp++
+ cfs.fieldBytes = nil
+ return true
+ case '"': // quoted value
+ cfs.rp++
+ cfs.fieldBytes = make([]byte, 0, 16)
+ for {
+ ch := cfs.src[cfs.rp]
+
+ if ch == '"' {
+ cfs.rp++
+ if cfs.src[cfs.rp] == '"' {
+ cfs.fieldBytes = append(cfs.fieldBytes, '"')
+ cfs.rp++
+ } else {
+ break
+ }
+ } else if ch == '\\' {
+ cfs.rp++
+ cfs.fieldBytes = append(cfs.fieldBytes, cfs.src[cfs.rp])
+ cfs.rp++
+ } else {
+ cfs.fieldBytes = append(cfs.fieldBytes, ch)
+ cfs.rp++
+ }
+ }
+ cfs.rp++
+ return true
+ default: // unquoted value
+ start := cfs.rp
+ for {
+ ch := cfs.src[cfs.rp]
+ if ch == ',' || ch == ')' {
+ break
+ }
+ cfs.rp++
+ }
+ cfs.fieldBytes = cfs.src[start:cfs.rp]
+ cfs.rp++
+ return true
+ }
+}
+
+// Bytes returns the bytes of the field most recently read by Scan().
+func (cfs *CompositeTextScanner) Bytes() []byte {
+ return cfs.fieldBytes
+}
+
+// Err returns any error encountered by the scanner.
+func (cfs *CompositeTextScanner) Err() error {
+ return cfs.err
+}
+
+type CompositeBinaryBuilder struct {
+ m *Map
+ buf []byte
+ startIdx int
+ fieldCount uint32
+ err error
+}
+
+func NewCompositeBinaryBuilder(m *Map, buf []byte) *CompositeBinaryBuilder {
+ startIdx := len(buf)
+ buf = append(buf, 0, 0, 0, 0) // allocate room for number of fields
+ return &CompositeBinaryBuilder{m: m, buf: buf, startIdx: startIdx}
+}
+
+func (b *CompositeBinaryBuilder) AppendValue(oid uint32, field any) {
+ if b.err != nil {
+ return
+ }
+
+ if field == nil {
+ b.buf = pgio.AppendUint32(b.buf, oid)
+ b.buf = pgio.AppendInt32(b.buf, -1)
+ b.fieldCount++
+ return
+ }
+
+ plan := b.m.PlanEncode(oid, BinaryFormatCode, field)
+ if plan == nil {
+ b.err = fmt.Errorf("unable to encode %v into OID %d in binary format", field, oid)
+ return
+ }
+
+ b.buf = pgio.AppendUint32(b.buf, oid)
+ lengthPos := len(b.buf)
+ b.buf = pgio.AppendInt32(b.buf, -1)
+ fieldBuf, err := plan.Encode(field, b.buf)
+ if err != nil {
+ b.err = err
+ return
+ }
+ if fieldBuf != nil {
+ binary.BigEndian.PutUint32(fieldBuf[lengthPos:], uint32(len(fieldBuf)-len(b.buf)))
+ b.buf = fieldBuf
+ }
+
+ b.fieldCount++
+}
+
+func (b *CompositeBinaryBuilder) Finish() ([]byte, error) {
+ if b.err != nil {
+ return nil, b.err
+ }
+
+ binary.BigEndian.PutUint32(b.buf[b.startIdx:], b.fieldCount)
+ return b.buf, nil
+}
+
+type CompositeTextBuilder struct {
+ m *Map
+ buf []byte
+ startIdx int
+ fieldCount uint32
+ err error
+ fieldBuf [32]byte
+}
+
+func NewCompositeTextBuilder(m *Map, buf []byte) *CompositeTextBuilder {
+ buf = append(buf, '(') // allocate room for number of fields
+ return &CompositeTextBuilder{m: m, buf: buf}
+}
+
+func (b *CompositeTextBuilder) AppendValue(oid uint32, field any) {
+ if b.err != nil {
+ return
+ }
+
+ if field == nil {
+ b.buf = append(b.buf, ',')
+ return
+ }
+
+ plan := b.m.PlanEncode(oid, TextFormatCode, field)
+ if plan == nil {
+ b.err = fmt.Errorf("unable to encode %v into OID %d in text format", field, oid)
+ return
+ }
+
+ fieldBuf, err := plan.Encode(field, b.fieldBuf[0:0])
+ if err != nil {
+ b.err = err
+ return
+ }
+ if fieldBuf != nil {
+ b.buf = append(b.buf, quoteCompositeFieldIfNeeded(string(fieldBuf))...)
+ }
+
+ b.buf = append(b.buf, ',')
+}
+
+func (b *CompositeTextBuilder) Finish() ([]byte, error) {
+ if b.err != nil {
+ return nil, b.err
+ }
+
+ b.buf[len(b.buf)-1] = ')'
+ return b.buf, nil
+}
+
+var quoteCompositeReplacer = strings.NewReplacer(`\`, `\\`, `"`, `\"`)
+
+func quoteCompositeField(src string) string {
+ return `"` + quoteCompositeReplacer.Replace(src) + `"`
+}
+
+func quoteCompositeFieldIfNeeded(src string) string {
+ if src == "" || src[0] == ' ' || src[len(src)-1] == ' ' || strings.ContainsAny(src, `(),"\`) {
+ return quoteCompositeField(src)
+ }
+ return src
+}
+
+// CompositeFields represents the values of a composite value. It can be used as an encoding source or as a scan target.
+// It cannot scan a NULL, but the composite fields can be NULL.
+type CompositeFields []any
+
+func (cf CompositeFields) SkipUnderlyingTypePlan() {}
+
+func (cf CompositeFields) IsNull() bool {
+ return cf == nil
+}
+
+func (cf CompositeFields) Index(i int) any {
+ return cf[i]
+}
+
+func (cf CompositeFields) ScanNull() error {
+ return fmt.Errorf("cannot scan NULL into CompositeFields")
+}
+
+func (cf CompositeFields) ScanIndex(i int) any {
+ return cf[i]
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/convert.go b/vendor/github.com/jackc/pgx/v5/pgtype/convert.go
new file mode 100644
index 0000000..8a9cee9
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/convert.go
@@ -0,0 +1,108 @@
+package pgtype
+
+import (
+ "reflect"
+)
+
+func NullAssignTo(dst any) error {
+ dstPtr := reflect.ValueOf(dst)
+
+ // AssignTo dst must always be a pointer
+ if dstPtr.Kind() != reflect.Ptr {
+ return &nullAssignmentError{dst: dst}
+ }
+
+ dstVal := dstPtr.Elem()
+
+ switch dstVal.Kind() {
+ case reflect.Ptr, reflect.Slice, reflect.Map:
+ dstVal.Set(reflect.Zero(dstVal.Type()))
+ return nil
+ }
+
+ return &nullAssignmentError{dst: dst}
+}
+
+var kindTypes map[reflect.Kind]reflect.Type
+
+func toInterface(dst reflect.Value, t reflect.Type) (any, bool) {
+ nextDst := dst.Convert(t)
+ return nextDst.Interface(), dst.Type() != nextDst.Type()
+}
+
+// GetAssignToDstType attempts to convert dst to something AssignTo can assign
+// to. If dst is a pointer to pointer it allocates a value and returns the
+// dereferences pointer. If dst is a named type such as *Foo where Foo is type
+// Foo int16, it converts dst to *int16.
+//
+// GetAssignToDstType returns the converted dst and a bool representing if any
+// change was made.
+func GetAssignToDstType(dst any) (any, bool) {
+ dstPtr := reflect.ValueOf(dst)
+
+ // AssignTo dst must always be a pointer
+ if dstPtr.Kind() != reflect.Ptr {
+ return nil, false
+ }
+
+ dstVal := dstPtr.Elem()
+
+ // if dst is a pointer to pointer, allocate space try again with the dereferenced pointer
+ if dstVal.Kind() == reflect.Ptr {
+ dstVal.Set(reflect.New(dstVal.Type().Elem()))
+ return dstVal.Interface(), true
+ }
+
+ // if dst is pointer to a base type that has been renamed
+ if baseValType, ok := kindTypes[dstVal.Kind()]; ok {
+ return toInterface(dstPtr, reflect.PtrTo(baseValType))
+ }
+
+ if dstVal.Kind() == reflect.Slice {
+ if baseElemType, ok := kindTypes[dstVal.Type().Elem().Kind()]; ok {
+ return toInterface(dstPtr, reflect.PtrTo(reflect.SliceOf(baseElemType)))
+ }
+ }
+
+ if dstVal.Kind() == reflect.Array {
+ if baseElemType, ok := kindTypes[dstVal.Type().Elem().Kind()]; ok {
+ return toInterface(dstPtr, reflect.PtrTo(reflect.ArrayOf(dstVal.Len(), baseElemType)))
+ }
+ }
+
+ if dstVal.Kind() == reflect.Struct {
+ if dstVal.Type().NumField() == 1 && dstVal.Type().Field(0).Anonymous {
+ dstPtr = dstVal.Field(0).Addr()
+ nested := dstVal.Type().Field(0).Type
+ if nested.Kind() == reflect.Array {
+ if baseElemType, ok := kindTypes[nested.Elem().Kind()]; ok {
+ return toInterface(dstPtr, reflect.PtrTo(reflect.ArrayOf(nested.Len(), baseElemType)))
+ }
+ }
+ if _, ok := kindTypes[nested.Kind()]; ok && dstPtr.CanInterface() {
+ return dstPtr.Interface(), true
+ }
+ }
+ }
+
+ return nil, false
+}
+
+func init() {
+ kindTypes = map[reflect.Kind]reflect.Type{
+ reflect.Bool: reflect.TypeOf(false),
+ reflect.Float32: reflect.TypeOf(float32(0)),
+ reflect.Float64: reflect.TypeOf(float64(0)),
+ reflect.Int: reflect.TypeOf(int(0)),
+ reflect.Int8: reflect.TypeOf(int8(0)),
+ reflect.Int16: reflect.TypeOf(int16(0)),
+ reflect.Int32: reflect.TypeOf(int32(0)),
+ reflect.Int64: reflect.TypeOf(int64(0)),
+ reflect.Uint: reflect.TypeOf(uint(0)),
+ reflect.Uint8: reflect.TypeOf(uint8(0)),
+ reflect.Uint16: reflect.TypeOf(uint16(0)),
+ reflect.Uint32: reflect.TypeOf(uint32(0)),
+ reflect.Uint64: reflect.TypeOf(uint64(0)),
+ reflect.String: reflect.TypeOf(""),
+ }
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/date.go b/vendor/github.com/jackc/pgx/v5/pgtype/date.go
new file mode 100644
index 0000000..784b16d
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/date.go
@@ -0,0 +1,351 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "encoding/json"
+ "fmt"
+ "regexp"
+ "strconv"
+ "time"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+type DateScanner interface {
+ ScanDate(v Date) error
+}
+
+type DateValuer interface {
+ DateValue() (Date, error)
+}
+
+type Date struct {
+ Time time.Time
+ InfinityModifier InfinityModifier
+ Valid bool
+}
+
+func (d *Date) ScanDate(v Date) error {
+ *d = v
+ return nil
+}
+
+func (d Date) DateValue() (Date, error) {
+ return d, nil
+}
+
+const (
+ negativeInfinityDayOffset = -2147483648
+ infinityDayOffset = 2147483647
+)
+
+// Scan implements the database/sql Scanner interface.
+func (dst *Date) Scan(src any) error {
+ if src == nil {
+ *dst = Date{}
+ return nil
+ }
+
+ switch src := src.(type) {
+ case string:
+ return scanPlanTextAnyToDateScanner{}.Scan([]byte(src), dst)
+ case time.Time:
+ *dst = Date{Time: src, Valid: true}
+ return nil
+ }
+
+ return fmt.Errorf("cannot scan %T", src)
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (src Date) Value() (driver.Value, error) {
+ if !src.Valid {
+ return nil, nil
+ }
+
+ if src.InfinityModifier != Finite {
+ return src.InfinityModifier.String(), nil
+ }
+ return src.Time, nil
+}
+
+func (src Date) MarshalJSON() ([]byte, error) {
+ if !src.Valid {
+ return []byte("null"), nil
+ }
+
+ var s string
+
+ switch src.InfinityModifier {
+ case Finite:
+ s = src.Time.Format("2006-01-02")
+ case Infinity:
+ s = "infinity"
+ case NegativeInfinity:
+ s = "-infinity"
+ }
+
+ return json.Marshal(s)
+}
+
+func (dst *Date) UnmarshalJSON(b []byte) error {
+ var s *string
+ err := json.Unmarshal(b, &s)
+ if err != nil {
+ return err
+ }
+
+ if s == nil {
+ *dst = Date{}
+ return nil
+ }
+
+ switch *s {
+ case "infinity":
+ *dst = Date{Valid: true, InfinityModifier: Infinity}
+ case "-infinity":
+ *dst = Date{Valid: true, InfinityModifier: -Infinity}
+ default:
+ t, err := time.ParseInLocation("2006-01-02", *s, time.UTC)
+ if err != nil {
+ return err
+ }
+
+ *dst = Date{Time: t, Valid: true}
+ }
+
+ return nil
+}
+
+type DateCodec struct{}
+
+func (DateCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (DateCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (DateCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ if _, ok := value.(DateValuer); !ok {
+ return nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ return encodePlanDateCodecBinary{}
+ case TextFormatCode:
+ return encodePlanDateCodecText{}
+ }
+
+ return nil
+}
+
+type encodePlanDateCodecBinary struct{}
+
+func (encodePlanDateCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ date, err := value.(DateValuer).DateValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !date.Valid {
+ return nil, nil
+ }
+
+ var daysSinceDateEpoch int32
+ switch date.InfinityModifier {
+ case Finite:
+ tUnix := time.Date(date.Time.Year(), date.Time.Month(), date.Time.Day(), 0, 0, 0, 0, time.UTC).Unix()
+ dateEpoch := time.Date(2000, 1, 1, 0, 0, 0, 0, time.UTC).Unix()
+
+ secSinceDateEpoch := tUnix - dateEpoch
+ daysSinceDateEpoch = int32(secSinceDateEpoch / 86400)
+ case Infinity:
+ daysSinceDateEpoch = infinityDayOffset
+ case NegativeInfinity:
+ daysSinceDateEpoch = negativeInfinityDayOffset
+ }
+
+ return pgio.AppendInt32(buf, daysSinceDateEpoch), nil
+}
+
+type encodePlanDateCodecText struct{}
+
+func (encodePlanDateCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ date, err := value.(DateValuer).DateValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !date.Valid {
+ return nil, nil
+ }
+
+ switch date.InfinityModifier {
+ case Finite:
+ // Year 0000 is 1 BC
+ bc := false
+ year := date.Time.Year()
+ if year <= 0 {
+ year = -year + 1
+ bc = true
+ }
+
+ yearBytes := strconv.AppendInt(make([]byte, 0, 6), int64(year), 10)
+ for i := len(yearBytes); i < 4; i++ {
+ buf = append(buf, '0')
+ }
+ buf = append(buf, yearBytes...)
+ buf = append(buf, '-')
+ if date.Time.Month() < 10 {
+ buf = append(buf, '0')
+ }
+ buf = strconv.AppendInt(buf, int64(date.Time.Month()), 10)
+ buf = append(buf, '-')
+ if date.Time.Day() < 10 {
+ buf = append(buf, '0')
+ }
+ buf = strconv.AppendInt(buf, int64(date.Time.Day()), 10)
+
+ if bc {
+ buf = append(buf, " BC"...)
+ }
+ case Infinity:
+ buf = append(buf, "infinity"...)
+ case NegativeInfinity:
+ buf = append(buf, "-infinity"...)
+ }
+
+ return buf, nil
+}
+
+func (DateCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case DateScanner:
+ return scanPlanBinaryDateToDateScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case DateScanner:
+ return scanPlanTextAnyToDateScanner{}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryDateToDateScanner struct{}
+
+func (scanPlanBinaryDateToDateScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(DateScanner)
+
+ if src == nil {
+ return scanner.ScanDate(Date{})
+ }
+
+ if len(src) != 4 {
+ return fmt.Errorf("invalid length for date: %v", len(src))
+ }
+
+ dayOffset := int32(binary.BigEndian.Uint32(src))
+
+ switch dayOffset {
+ case infinityDayOffset:
+ return scanner.ScanDate(Date{InfinityModifier: Infinity, Valid: true})
+ case negativeInfinityDayOffset:
+ return scanner.ScanDate(Date{InfinityModifier: -Infinity, Valid: true})
+ default:
+ t := time.Date(2000, 1, int(1+dayOffset), 0, 0, 0, 0, time.UTC)
+ return scanner.ScanDate(Date{Time: t, Valid: true})
+ }
+}
+
+type scanPlanTextAnyToDateScanner struct{}
+
+var dateRegexp = regexp.MustCompile(`^(\d{4,})-(\d\d)-(\d\d)( BC)?$`)
+
+func (scanPlanTextAnyToDateScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(DateScanner)
+
+ if src == nil {
+ return scanner.ScanDate(Date{})
+ }
+
+ sbuf := string(src)
+ match := dateRegexp.FindStringSubmatch(sbuf)
+ if match != nil {
+ year, err := strconv.ParseInt(match[1], 10, 32)
+ if err != nil {
+ return fmt.Errorf("BUG: cannot parse date that regexp matched (year): %w", err)
+ }
+
+ month, err := strconv.ParseInt(match[2], 10, 32)
+ if err != nil {
+ return fmt.Errorf("BUG: cannot parse date that regexp matched (month): %w", err)
+ }
+
+ day, err := strconv.ParseInt(match[3], 10, 32)
+ if err != nil {
+ return fmt.Errorf("BUG: cannot parse date that regexp matched (month): %w", err)
+ }
+
+ // BC matched
+ if len(match[4]) > 0 {
+ year = -year + 1
+ }
+
+ t := time.Date(int(year), time.Month(month), int(day), 0, 0, 0, 0, time.UTC)
+ return scanner.ScanDate(Date{Time: t, Valid: true})
+ }
+
+ switch sbuf {
+ case "infinity":
+ return scanner.ScanDate(Date{InfinityModifier: Infinity, Valid: true})
+ case "-infinity":
+ return scanner.ScanDate(Date{InfinityModifier: -Infinity, Valid: true})
+ default:
+ return fmt.Errorf("invalid date format")
+ }
+}
+
+func (c DateCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var date Date
+ err := codecScan(c, m, oid, format, src, &date)
+ if err != nil {
+ return nil, err
+ }
+
+ if date.InfinityModifier != Finite {
+ return date.InfinityModifier.String(), nil
+ }
+
+ return date.Time, nil
+}
+
+func (c DateCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var date Date
+ err := codecScan(c, m, oid, format, src, &date)
+ if err != nil {
+ return nil, err
+ }
+
+ if date.InfinityModifier != Finite {
+ return date.InfinityModifier, nil
+ }
+
+ return date.Time, nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/doc.go b/vendor/github.com/jackc/pgx/v5/pgtype/doc.go
new file mode 100644
index 0000000..7687ea8
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/doc.go
@@ -0,0 +1,191 @@
+// Package pgtype converts between Go and PostgreSQL values.
+/*
+The primary type is the Map type. It is a map of PostgreSQL types identified by OID (object ID) to a Codec. A Codec is
+responsible for converting between Go and PostgreSQL values. NewMap creates a Map with all supported standard PostgreSQL
+types already registered. Additional types can be registered with Map.RegisterType.
+
+Use Map.Scan and Map.Encode to decode PostgreSQL values to Go and encode Go values to PostgreSQL respectively.
+
+Base Type Mapping
+
+pgtype maps between all common base types directly between Go and PostgreSQL. In particular:
+
+ Go PostgreSQL
+ -----------------------
+ string varchar
+ text
+
+ // Integers are automatically be converted to any other integer type if
+ // it can be done without overflow or underflow.
+ int8
+ int16 smallint
+ int32 int
+ int64 bigint
+ int
+ uint8
+ uint16
+ uint32
+ uint64
+ uint
+
+ // Floats are strict and do not automatically convert like integers.
+ float32 float4
+ float64 float8
+
+ time.Time date
+ timestamp
+ timestamptz
+
+ netip.Addr inet
+ netip.Prefix cidr
+
+ []byte bytea
+
+Null Values
+
+pgtype can map NULLs in two ways. The first is types that can directly represent NULL such as Int4. They work in a
+similar fashion to database/sql. The second is to use a pointer to a pointer.
+
+ var foo pgtype.Text
+ var bar *string
+ err := conn.QueryRow("select foo, bar from widgets where id=$1", 42).Scan(&foo, &bar)
+ if err != nil {
+ return err
+ }
+
+When using nullable pgtype types as parameters for queries, one has to remember
+to explicitly set their Valid field to true, otherwise the parameter's value will be NULL.
+
+JSON Support
+
+pgtype automatically marshals and unmarshals data from json and jsonb PostgreSQL types.
+
+Extending Existing PostgreSQL Type Support
+
+Generally, all Codecs will support interfaces that can be implemented to enable scanning and encoding. For example,
+PointCodec can use any Go type that implements the PointScanner and PointValuer interfaces. So rather than use
+pgtype.Point and application can directly use its own point type with pgtype as long as it implements those interfaces.
+
+See example_custom_type_test.go for an example of a custom type for the PostgreSQL point type.
+
+Sometimes pgx supports a PostgreSQL type such as numeric but the Go type is in an external package that does not have
+pgx support such as github.com/shopspring/decimal. These types can be registered with pgtype with custom conversion
+logic. See https://github.com/jackc/pgx-shopspring-decimal and https://github.com/jackc/pgx-gofrs-uuid for example
+integrations.
+
+New PostgreSQL Type Support
+
+pgtype uses the PostgreSQL OID to determine how to encode or decode a value. pgtype supports array, composite, domain,
+and enum types. However, any type created in PostgreSQL with CREATE TYPE will receive a new OID. This means that the OID
+of each new PostgreSQL type must be registered for pgtype to handle values of that type with the correct Codec.
+
+The pgx.Conn LoadType method can return a *Type for array, composite, domain, and enum types by inspecting the database
+metadata. This *Type can then be registered with Map.RegisterType.
+
+For example, the following function could be called after a connection is established:
+
+ func RegisterDataTypes(ctx context.Context, conn *pgx.Conn) error {
+ dataTypeNames := []string{
+ "foo",
+ "_foo",
+ "bar",
+ "_bar",
+ }
+
+ for _, typeName := range dataTypeNames {
+ dataType, err := conn.LoadType(ctx, typeName)
+ if err != nil {
+ return err
+ }
+ conn.TypeMap().RegisterType(dataType)
+ }
+
+ return nil
+ }
+
+A type cannot be registered unless all types it depends on are already registered. e.g. An array type cannot be
+registered until its element type is registered.
+
+ArrayCodec implements support for arrays. If pgtype supports type T then it can easily support []T by registering an
+ArrayCodec for the appropriate PostgreSQL OID. In addition, Array[T] type can support multi-dimensional arrays.
+
+CompositeCodec implements support for PostgreSQL composite types. Go structs can be scanned into if the public fields of
+the struct are in the exact order and type of the PostgreSQL type or by implementing CompositeIndexScanner and
+CompositeIndexGetter.
+
+Domain types are treated as their underlying type if the underlying type and the domain type are registered.
+
+PostgreSQL enums can usually be treated as text. However, EnumCodec implements support for interning strings which can
+reduce memory usage.
+
+While pgtype will often still work with unregistered types it is highly recommended that all types be registered due to
+an improvement in performance and the elimination of certain edge cases.
+
+If an entirely new PostgreSQL type (e.g. PostGIS types) is used then the application or a library can create a new
+Codec. Then the OID / Codec mapping can be registered with Map.RegisterType. There is no difference between a Codec
+defined and registered by the application and a Codec built in to pgtype. See any of the Codecs in pgtype for Codec
+examples and for examples of type registration.
+
+Encoding Unknown Types
+
+pgtype works best when the OID of the PostgreSQL type is known. But in some cases such as using the simple protocol the
+OID is unknown. In this case Map.RegisterDefaultPgType can be used to register an assumed OID for a particular Go type.
+
+Renamed Types
+
+If pgtype does not recognize a type and that type is a renamed simple type simple (e.g. type MyInt32 int32) pgtype acts
+as if it is the underlying type. It currently cannot automatically detect the underlying type of renamed structs (eg.g.
+type MyTime time.Time).
+
+Compatibility with database/sql
+
+pgtype also includes support for custom types implementing the database/sql.Scanner and database/sql/driver.Valuer
+interfaces.
+
+Encoding Typed Nils
+
+pgtype encodes untyped and typed nils (e.g. nil and []byte(nil)) to the SQL NULL value without going through the Codec
+system. This means that Codecs and other encoding logic do not have to handle nil or *T(nil).
+
+However, database/sql compatibility requires Value to be called on T(nil) when T implements driver.Valuer. Therefore,
+driver.Valuer values are only considered NULL when *T(nil) where driver.Valuer is implemented on T not on *T. See
+https://github.com/golang/go/issues/8415 and
+https://github.com/golang/go/commit/0ce1d79a6a771f7449ec493b993ed2a720917870.
+
+Child Records
+
+pgtype's support for arrays and composite records can be used to load records and their children in a single query. See
+example_child_records_test.go for an example.
+
+Overview of Scanning Implementation
+
+The first step is to use the OID to lookup the correct Codec. If the OID is unavailable, Map will try to find the OID
+from previous calls of Map.RegisterDefaultPgType. The Map will call the Codec's PlanScan method to get a plan for
+scanning into the Go value. A Codec will support scanning into one or more Go types. Oftentime these Go types are
+interfaces rather than explicit types. For example, PointCodec can use any Go type that implements the PointScanner and
+PointValuer interfaces.
+
+If a Go value is not supported directly by a Codec then Map will try wrapping it with additional logic and try again.
+For example, Int8Codec does not support scanning into a renamed type (e.g. type myInt64 int64). But Map will detect that
+myInt64 is a renamed type and create a plan that converts the value to the underlying int64 type and then passes that to
+the Codec (see TryFindUnderlyingTypeScanPlan).
+
+These plan wrappers are contained in Map.TryWrapScanPlanFuncs. By default these contain shared logic to handle renamed
+types, pointers to pointers, slices, composite types, etc. Additional plan wrappers can be added to seamlessly integrate
+types that do not support pgx directly. For example, the before mentioned
+https://github.com/jackc/pgx-shopspring-decimal package detects decimal.Decimal values, wraps them in something
+implementing NumericScanner and passes that to the Codec.
+
+Map.Scan and Map.Encode are convenience methods that wrap Map.PlanScan and Map.PlanEncode. Determining how to scan or
+encode a particular type may be a time consuming operation. Hence the planning and execution steps of a conversion are
+internally separated.
+
+Reducing Compiled Binary Size
+
+pgx.QueryExecModeExec and pgx.QueryExecModeSimpleProtocol require the default PostgreSQL type to be registered for each
+Go type used as a query parameter. By default pgx does this for all supported types and their array variants. If an
+application does not use those query execution modes or manually registers the default PostgreSQL type for the types it
+uses as query parameters it can use the build tag nopgxregisterdefaulttypes. This omits the default type registration
+and reduces the compiled binary size by ~2MB.
+*/
+package pgtype
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/enum_codec.go b/vendor/github.com/jackc/pgx/v5/pgtype/enum_codec.go
new file mode 100644
index 0000000..5e787c1
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/enum_codec.go
@@ -0,0 +1,109 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "fmt"
+)
+
+// EnumCodec is a codec that caches the strings it decodes. If the same string is read multiple times only one copy is
+// allocated. These strings are only garbage collected when the EnumCodec is garbage collected. EnumCodec can be used
+// for any text type not only enums, but it should only be used when there are a small number of possible values.
+type EnumCodec struct {
+ membersMap map[string]string // map to quickly lookup member and reuse string instead of allocating
+}
+
+func (EnumCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (EnumCodec) PreferredFormat() int16 {
+ return TextFormatCode
+}
+
+func (EnumCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ switch format {
+ case TextFormatCode, BinaryFormatCode:
+ switch value.(type) {
+ case string:
+ return encodePlanTextCodecString{}
+ case []byte:
+ return encodePlanTextCodecByteSlice{}
+ case TextValuer:
+ return encodePlanTextCodecTextValuer{}
+ }
+ }
+
+ return nil
+}
+
+func (c *EnumCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+ switch format {
+ case TextFormatCode, BinaryFormatCode:
+ switch target.(type) {
+ case *string:
+ return &scanPlanTextAnyToEnumString{codec: c}
+ case *[]byte:
+ return scanPlanAnyToNewByteSlice{}
+ case TextScanner:
+ return &scanPlanTextAnyToEnumTextScanner{codec: c}
+ }
+ }
+
+ return nil
+}
+
+func (c *EnumCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ return c.DecodeValue(m, oid, format, src)
+}
+
+func (c *EnumCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ return c.lookupAndCacheString(src), nil
+}
+
+// lookupAndCacheString looks for src in the members map. If it is not found it is added to the map.
+func (c *EnumCodec) lookupAndCacheString(src []byte) string {
+ if c.membersMap == nil {
+ c.membersMap = make(map[string]string)
+ }
+
+ if s, found := c.membersMap[string(src)]; found {
+ return s
+ }
+
+ s := string(src)
+ c.membersMap[s] = s
+ return s
+}
+
+type scanPlanTextAnyToEnumString struct {
+ codec *EnumCodec
+}
+
+func (plan *scanPlanTextAnyToEnumString) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ p := (dst).(*string)
+ *p = plan.codec.lookupAndCacheString(src)
+
+ return nil
+}
+
+type scanPlanTextAnyToEnumTextScanner struct {
+ codec *EnumCodec
+}
+
+func (plan *scanPlanTextAnyToEnumTextScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(TextScanner)
+
+ if src == nil {
+ return scanner.ScanText(Text{})
+ }
+
+ return scanner.ScanText(Text{String: plan.codec.lookupAndCacheString(src), Valid: true})
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/float4.go b/vendor/github.com/jackc/pgx/v5/pgtype/float4.go
new file mode 100644
index 0000000..8646d9d
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/float4.go
@@ -0,0 +1,319 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "encoding/json"
+ "fmt"
+ "math"
+ "strconv"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+type Float4 struct {
+ Float32 float32
+ Valid bool
+}
+
+// ScanFloat64 implements the Float64Scanner interface.
+func (f *Float4) ScanFloat64(n Float8) error {
+ *f = Float4{Float32: float32(n.Float64), Valid: n.Valid}
+ return nil
+}
+
+func (f Float4) Float64Value() (Float8, error) {
+ return Float8{Float64: float64(f.Float32), Valid: f.Valid}, nil
+}
+
+func (f *Float4) ScanInt64(n Int8) error {
+ *f = Float4{Float32: float32(n.Int64), Valid: n.Valid}
+ return nil
+}
+
+func (f Float4) Int64Value() (Int8, error) {
+ return Int8{Int64: int64(f.Float32), Valid: f.Valid}, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (f *Float4) Scan(src any) error {
+ if src == nil {
+ *f = Float4{}
+ return nil
+ }
+
+ switch src := src.(type) {
+ case float64:
+ *f = Float4{Float32: float32(src), Valid: true}
+ return nil
+ case string:
+ n, err := strconv.ParseFloat(string(src), 32)
+ if err != nil {
+ return err
+ }
+ *f = Float4{Float32: float32(n), Valid: true}
+ return nil
+ }
+
+ return fmt.Errorf("cannot scan %T", src)
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (f Float4) Value() (driver.Value, error) {
+ if !f.Valid {
+ return nil, nil
+ }
+ return float64(f.Float32), nil
+}
+
+func (f Float4) MarshalJSON() ([]byte, error) {
+ if !f.Valid {
+ return []byte("null"), nil
+ }
+ return json.Marshal(f.Float32)
+}
+
+func (f *Float4) UnmarshalJSON(b []byte) error {
+ var n *float32
+ err := json.Unmarshal(b, &n)
+ if err != nil {
+ return err
+ }
+
+ if n == nil {
+ *f = Float4{}
+ } else {
+ *f = Float4{Float32: *n, Valid: true}
+ }
+
+ return nil
+}
+
+type Float4Codec struct{}
+
+func (Float4Codec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (Float4Codec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (Float4Codec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ switch format {
+ case BinaryFormatCode:
+ switch value.(type) {
+ case float32:
+ return encodePlanFloat4CodecBinaryFloat32{}
+ case Float64Valuer:
+ return encodePlanFloat4CodecBinaryFloat64Valuer{}
+ case Int64Valuer:
+ return encodePlanFloat4CodecBinaryInt64Valuer{}
+ }
+ case TextFormatCode:
+ switch value.(type) {
+ case float32:
+ return encodePlanTextFloat32{}
+ case Float64Valuer:
+ return encodePlanTextFloat64Valuer{}
+ case Int64Valuer:
+ return encodePlanTextInt64Valuer{}
+ }
+ }
+
+ return nil
+}
+
+type encodePlanFloat4CodecBinaryFloat32 struct{}
+
+func (encodePlanFloat4CodecBinaryFloat32) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n := value.(float32)
+ return pgio.AppendUint32(buf, math.Float32bits(n)), nil
+}
+
+type encodePlanTextFloat32 struct{}
+
+func (encodePlanTextFloat32) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n := value.(float32)
+ return append(buf, strconv.FormatFloat(float64(n), 'f', -1, 32)...), nil
+}
+
+type encodePlanFloat4CodecBinaryFloat64Valuer struct{}
+
+func (encodePlanFloat4CodecBinaryFloat64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n, err := value.(Float64Valuer).Float64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !n.Valid {
+ return nil, nil
+ }
+
+ return pgio.AppendUint32(buf, math.Float32bits(float32(n.Float64))), nil
+}
+
+type encodePlanFloat4CodecBinaryInt64Valuer struct{}
+
+func (encodePlanFloat4CodecBinaryInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n, err := value.(Int64Valuer).Int64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !n.Valid {
+ return nil, nil
+ }
+
+ f := float32(n.Int64)
+ return pgio.AppendUint32(buf, math.Float32bits(f)), nil
+}
+
+func (Float4Codec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case *float32:
+ return scanPlanBinaryFloat4ToFloat32{}
+ case Float64Scanner:
+ return scanPlanBinaryFloat4ToFloat64Scanner{}
+ case Int64Scanner:
+ return scanPlanBinaryFloat4ToInt64Scanner{}
+ case TextScanner:
+ return scanPlanBinaryFloat4ToTextScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case *float32:
+ return scanPlanTextAnyToFloat32{}
+ case Float64Scanner:
+ return scanPlanTextAnyToFloat64Scanner{}
+ case Int64Scanner:
+ return scanPlanTextAnyToInt64Scanner{}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryFloat4ToFloat32 struct{}
+
+func (scanPlanBinaryFloat4ToFloat32) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 4 {
+ return fmt.Errorf("invalid length for float4: %v", len(src))
+ }
+
+ n := int32(binary.BigEndian.Uint32(src))
+ f := (dst).(*float32)
+ *f = math.Float32frombits(uint32(n))
+
+ return nil
+}
+
+type scanPlanBinaryFloat4ToFloat64Scanner struct{}
+
+func (scanPlanBinaryFloat4ToFloat64Scanner) Scan(src []byte, dst any) error {
+ s := (dst).(Float64Scanner)
+
+ if src == nil {
+ return s.ScanFloat64(Float8{})
+ }
+
+ if len(src) != 4 {
+ return fmt.Errorf("invalid length for float4: %v", len(src))
+ }
+
+ n := int32(binary.BigEndian.Uint32(src))
+ return s.ScanFloat64(Float8{Float64: float64(math.Float32frombits(uint32(n))), Valid: true})
+}
+
+type scanPlanBinaryFloat4ToInt64Scanner struct{}
+
+func (scanPlanBinaryFloat4ToInt64Scanner) Scan(src []byte, dst any) error {
+ s := (dst).(Int64Scanner)
+
+ if src == nil {
+ return s.ScanInt64(Int8{})
+ }
+
+ if len(src) != 4 {
+ return fmt.Errorf("invalid length for float4: %v", len(src))
+ }
+
+ ui32 := int32(binary.BigEndian.Uint32(src))
+ f32 := math.Float32frombits(uint32(ui32))
+ i64 := int64(f32)
+ if f32 != float32(i64) {
+ return fmt.Errorf("cannot losslessly convert %v to int64", f32)
+ }
+
+ return s.ScanInt64(Int8{Int64: i64, Valid: true})
+}
+
+type scanPlanBinaryFloat4ToTextScanner struct{}
+
+func (scanPlanBinaryFloat4ToTextScanner) Scan(src []byte, dst any) error {
+ s := (dst).(TextScanner)
+
+ if src == nil {
+ return s.ScanText(Text{})
+ }
+
+ if len(src) != 4 {
+ return fmt.Errorf("invalid length for float4: %v", len(src))
+ }
+
+ ui32 := int32(binary.BigEndian.Uint32(src))
+ f32 := math.Float32frombits(uint32(ui32))
+
+ return s.ScanText(Text{String: strconv.FormatFloat(float64(f32), 'f', -1, 32), Valid: true})
+}
+
+type scanPlanTextAnyToFloat32 struct{}
+
+func (scanPlanTextAnyToFloat32) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ n, err := strconv.ParseFloat(string(src), 32)
+ if err != nil {
+ return err
+ }
+
+ f := (dst).(*float32)
+ *f = float32(n)
+
+ return nil
+}
+
+func (c Float4Codec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var n float32
+ err := codecScan(c, m, oid, format, src, &n)
+ if err != nil {
+ return nil, err
+ }
+ return float64(n), nil
+}
+
+func (c Float4Codec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var n float32
+ err := codecScan(c, m, oid, format, src, &n)
+ if err != nil {
+ return nil, err
+ }
+ return n, nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/float8.go b/vendor/github.com/jackc/pgx/v5/pgtype/float8.go
new file mode 100644
index 0000000..9c923c9
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/float8.go
@@ -0,0 +1,365 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "encoding/json"
+ "fmt"
+ "math"
+ "strconv"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+type Float64Scanner interface {
+ ScanFloat64(Float8) error
+}
+
+type Float64Valuer interface {
+ Float64Value() (Float8, error)
+}
+
+type Float8 struct {
+ Float64 float64
+ Valid bool
+}
+
+// ScanFloat64 implements the Float64Scanner interface.
+func (f *Float8) ScanFloat64(n Float8) error {
+ *f = n
+ return nil
+}
+
+func (f Float8) Float64Value() (Float8, error) {
+ return f, nil
+}
+
+func (f *Float8) ScanInt64(n Int8) error {
+ *f = Float8{Float64: float64(n.Int64), Valid: n.Valid}
+ return nil
+}
+
+func (f Float8) Int64Value() (Int8, error) {
+ return Int8{Int64: int64(f.Float64), Valid: f.Valid}, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (f *Float8) Scan(src any) error {
+ if src == nil {
+ *f = Float8{}
+ return nil
+ }
+
+ switch src := src.(type) {
+ case float64:
+ *f = Float8{Float64: src, Valid: true}
+ return nil
+ case string:
+ n, err := strconv.ParseFloat(string(src), 64)
+ if err != nil {
+ return err
+ }
+ *f = Float8{Float64: n, Valid: true}
+ return nil
+ }
+
+ return fmt.Errorf("cannot scan %T", src)
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (f Float8) Value() (driver.Value, error) {
+ if !f.Valid {
+ return nil, nil
+ }
+ return f.Float64, nil
+}
+
+func (f Float8) MarshalJSON() ([]byte, error) {
+ if !f.Valid {
+ return []byte("null"), nil
+ }
+ return json.Marshal(f.Float64)
+}
+
+func (f *Float8) UnmarshalJSON(b []byte) error {
+ var n *float64
+ err := json.Unmarshal(b, &n)
+ if err != nil {
+ return err
+ }
+
+ if n == nil {
+ *f = Float8{}
+ } else {
+ *f = Float8{Float64: *n, Valid: true}
+ }
+
+ return nil
+}
+
+type Float8Codec struct{}
+
+func (Float8Codec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (Float8Codec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (Float8Codec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ switch format {
+ case BinaryFormatCode:
+ switch value.(type) {
+ case float64:
+ return encodePlanFloat8CodecBinaryFloat64{}
+ case Float64Valuer:
+ return encodePlanFloat8CodecBinaryFloat64Valuer{}
+ case Int64Valuer:
+ return encodePlanFloat8CodecBinaryInt64Valuer{}
+ }
+ case TextFormatCode:
+ switch value.(type) {
+ case float64:
+ return encodePlanTextFloat64{}
+ case Float64Valuer:
+ return encodePlanTextFloat64Valuer{}
+ case Int64Valuer:
+ return encodePlanTextInt64Valuer{}
+ }
+ }
+
+ return nil
+}
+
+type encodePlanFloat8CodecBinaryFloat64 struct{}
+
+func (encodePlanFloat8CodecBinaryFloat64) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n := value.(float64)
+ return pgio.AppendUint64(buf, math.Float64bits(n)), nil
+}
+
+type encodePlanTextFloat64 struct{}
+
+func (encodePlanTextFloat64) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n := value.(float64)
+ return append(buf, strconv.FormatFloat(n, 'f', -1, 64)...), nil
+}
+
+type encodePlanFloat8CodecBinaryFloat64Valuer struct{}
+
+func (encodePlanFloat8CodecBinaryFloat64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n, err := value.(Float64Valuer).Float64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !n.Valid {
+ return nil, nil
+ }
+
+ return pgio.AppendUint64(buf, math.Float64bits(n.Float64)), nil
+}
+
+type encodePlanTextFloat64Valuer struct{}
+
+func (encodePlanTextFloat64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n, err := value.(Float64Valuer).Float64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !n.Valid {
+ return nil, nil
+ }
+
+ return append(buf, strconv.FormatFloat(n.Float64, 'f', -1, 64)...), nil
+}
+
+type encodePlanFloat8CodecBinaryInt64Valuer struct{}
+
+func (encodePlanFloat8CodecBinaryInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n, err := value.(Int64Valuer).Int64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !n.Valid {
+ return nil, nil
+ }
+
+ f := float64(n.Int64)
+ return pgio.AppendUint64(buf, math.Float64bits(f)), nil
+}
+
+type encodePlanTextInt64Valuer struct{}
+
+func (encodePlanTextInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n, err := value.(Int64Valuer).Int64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !n.Valid {
+ return nil, nil
+ }
+
+ return append(buf, strconv.FormatInt(n.Int64, 10)...), nil
+}
+
+func (Float8Codec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case *float64:
+ return scanPlanBinaryFloat8ToFloat64{}
+ case Float64Scanner:
+ return scanPlanBinaryFloat8ToFloat64Scanner{}
+ case Int64Scanner:
+ return scanPlanBinaryFloat8ToInt64Scanner{}
+ case TextScanner:
+ return scanPlanBinaryFloat8ToTextScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case *float64:
+ return scanPlanTextAnyToFloat64{}
+ case Float64Scanner:
+ return scanPlanTextAnyToFloat64Scanner{}
+ case Int64Scanner:
+ return scanPlanTextAnyToInt64Scanner{}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryFloat8ToFloat64 struct{}
+
+func (scanPlanBinaryFloat8ToFloat64) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for float8: %v", len(src))
+ }
+
+ n := int64(binary.BigEndian.Uint64(src))
+ f := (dst).(*float64)
+ *f = math.Float64frombits(uint64(n))
+
+ return nil
+}
+
+type scanPlanBinaryFloat8ToFloat64Scanner struct{}
+
+func (scanPlanBinaryFloat8ToFloat64Scanner) Scan(src []byte, dst any) error {
+ s := (dst).(Float64Scanner)
+
+ if src == nil {
+ return s.ScanFloat64(Float8{})
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for float8: %v", len(src))
+ }
+
+ n := int64(binary.BigEndian.Uint64(src))
+ return s.ScanFloat64(Float8{Float64: math.Float64frombits(uint64(n)), Valid: true})
+}
+
+type scanPlanBinaryFloat8ToInt64Scanner struct{}
+
+func (scanPlanBinaryFloat8ToInt64Scanner) Scan(src []byte, dst any) error {
+ s := (dst).(Int64Scanner)
+
+ if src == nil {
+ return s.ScanInt64(Int8{})
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for float8: %v", len(src))
+ }
+
+ ui64 := int64(binary.BigEndian.Uint64(src))
+ f64 := math.Float64frombits(uint64(ui64))
+ i64 := int64(f64)
+ if f64 != float64(i64) {
+ return fmt.Errorf("cannot losslessly convert %v to int64", f64)
+ }
+
+ return s.ScanInt64(Int8{Int64: i64, Valid: true})
+}
+
+type scanPlanBinaryFloat8ToTextScanner struct{}
+
+func (scanPlanBinaryFloat8ToTextScanner) Scan(src []byte, dst any) error {
+ s := (dst).(TextScanner)
+
+ if src == nil {
+ return s.ScanText(Text{})
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for float8: %v", len(src))
+ }
+
+ ui64 := int64(binary.BigEndian.Uint64(src))
+ f64 := math.Float64frombits(uint64(ui64))
+
+ return s.ScanText(Text{String: strconv.FormatFloat(f64, 'f', -1, 64), Valid: true})
+}
+
+type scanPlanTextAnyToFloat64 struct{}
+
+func (scanPlanTextAnyToFloat64) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ n, err := strconv.ParseFloat(string(src), 64)
+ if err != nil {
+ return err
+ }
+
+ f := (dst).(*float64)
+ *f = n
+
+ return nil
+}
+
+type scanPlanTextAnyToFloat64Scanner struct{}
+
+func (scanPlanTextAnyToFloat64Scanner) Scan(src []byte, dst any) error {
+ s := (dst).(Float64Scanner)
+
+ if src == nil {
+ return s.ScanFloat64(Float8{})
+ }
+
+ n, err := strconv.ParseFloat(string(src), 64)
+ if err != nil {
+ return err
+ }
+
+ return s.ScanFloat64(Float8{Float64: n, Valid: true})
+}
+
+func (c Float8Codec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ return c.DecodeValue(m, oid, format, src)
+}
+
+func (c Float8Codec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var n float64
+ err := codecScan(c, m, oid, format, src, &n)
+ if err != nil {
+ return nil, err
+ }
+ return n, nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/hstore.go b/vendor/github.com/jackc/pgx/v5/pgtype/hstore.go
new file mode 100644
index 0000000..2f34f4c
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/hstore.go
@@ -0,0 +1,486 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "errors"
+ "fmt"
+ "strings"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+type HstoreScanner interface {
+ ScanHstore(v Hstore) error
+}
+
+type HstoreValuer interface {
+ HstoreValue() (Hstore, error)
+}
+
+// Hstore represents an hstore column that can be null or have null values
+// associated with its keys.
+type Hstore map[string]*string
+
+func (h *Hstore) ScanHstore(v Hstore) error {
+ *h = v
+ return nil
+}
+
+func (h Hstore) HstoreValue() (Hstore, error) {
+ return h, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (h *Hstore) Scan(src any) error {
+ if src == nil {
+ *h = nil
+ return nil
+ }
+
+ switch src := src.(type) {
+ case string:
+ return scanPlanTextAnyToHstoreScanner{}.scanString(src, h)
+ }
+
+ return fmt.Errorf("cannot scan %T", src)
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (h Hstore) Value() (driver.Value, error) {
+ if h == nil {
+ return nil, nil
+ }
+
+ buf, err := HstoreCodec{}.PlanEncode(nil, 0, TextFormatCode, h).Encode(h, nil)
+ if err != nil {
+ return nil, err
+ }
+ return string(buf), err
+}
+
+type HstoreCodec struct{}
+
+func (HstoreCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (HstoreCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (HstoreCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ if _, ok := value.(HstoreValuer); !ok {
+ return nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ return encodePlanHstoreCodecBinary{}
+ case TextFormatCode:
+ return encodePlanHstoreCodecText{}
+ }
+
+ return nil
+}
+
+type encodePlanHstoreCodecBinary struct{}
+
+func (encodePlanHstoreCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ hstore, err := value.(HstoreValuer).HstoreValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if hstore == nil {
+ return nil, nil
+ }
+
+ buf = pgio.AppendInt32(buf, int32(len(hstore)))
+
+ for k, v := range hstore {
+ buf = pgio.AppendInt32(buf, int32(len(k)))
+ buf = append(buf, k...)
+
+ if v == nil {
+ buf = pgio.AppendInt32(buf, -1)
+ } else {
+ buf = pgio.AppendInt32(buf, int32(len(*v)))
+ buf = append(buf, (*v)...)
+ }
+ }
+
+ return buf, nil
+}
+
+type encodePlanHstoreCodecText struct{}
+
+func (encodePlanHstoreCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ hstore, err := value.(HstoreValuer).HstoreValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if len(hstore) == 0 {
+ // distinguish between empty and nil: Not strictly required by Postgres, since its protocol
+ // explicitly marks NULL column values separately. However, the Binary codec does this, and
+ // this means we can "round trip" Encode and Scan without data loss.
+ // nil: []byte(nil); empty: []byte{}
+ if hstore == nil {
+ return nil, nil
+ }
+ return []byte{}, nil
+ }
+
+ firstPair := true
+
+ for k, v := range hstore {
+ if firstPair {
+ firstPair = false
+ } else {
+ buf = append(buf, ',', ' ')
+ }
+
+ // unconditionally quote hstore keys/values like Postgres does
+ // this avoids a Mac OS X Postgres hstore parsing bug:
+ // https://www.postgresql.org/message-id/CA%2BHWA9awUW0%2BRV_gO9r1ABZwGoZxPztcJxPy8vMFSTbTfi4jig%40mail.gmail.com
+ buf = append(buf, '"')
+ buf = append(buf, quoteArrayReplacer.Replace(k)...)
+ buf = append(buf, '"')
+ buf = append(buf, "=>"...)
+
+ if v == nil {
+ buf = append(buf, "NULL"...)
+ } else {
+ buf = append(buf, '"')
+ buf = append(buf, quoteArrayReplacer.Replace(*v)...)
+ buf = append(buf, '"')
+ }
+ }
+
+ return buf, nil
+}
+
+func (HstoreCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case HstoreScanner:
+ return scanPlanBinaryHstoreToHstoreScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case HstoreScanner:
+ return scanPlanTextAnyToHstoreScanner{}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryHstoreToHstoreScanner struct{}
+
+func (scanPlanBinaryHstoreToHstoreScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(HstoreScanner)
+
+ if src == nil {
+ return scanner.ScanHstore(Hstore(nil))
+ }
+
+ rp := 0
+
+ const uint32Len = 4
+ if len(src[rp:]) < uint32Len {
+ return fmt.Errorf("hstore incomplete %v", src)
+ }
+ pairCount := int(int32(binary.BigEndian.Uint32(src[rp:])))
+ rp += uint32Len
+
+ hstore := make(Hstore, pairCount)
+ // one allocation for all *string, rather than one per string, just like text parsing
+ valueStrings := make([]string, pairCount)
+
+ for i := 0; i < pairCount; i++ {
+ if len(src[rp:]) < uint32Len {
+ return fmt.Errorf("hstore incomplete %v", src)
+ }
+ keyLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
+ rp += uint32Len
+
+ if len(src[rp:]) < keyLen {
+ return fmt.Errorf("hstore incomplete %v", src)
+ }
+ key := string(src[rp : rp+keyLen])
+ rp += keyLen
+
+ if len(src[rp:]) < uint32Len {
+ return fmt.Errorf("hstore incomplete %v", src)
+ }
+ valueLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
+ rp += 4
+
+ if valueLen >= 0 {
+ valueStrings[i] = string(src[rp : rp+valueLen])
+ rp += valueLen
+
+ hstore[key] = &valueStrings[i]
+ } else {
+ hstore[key] = nil
+ }
+ }
+
+ return scanner.ScanHstore(hstore)
+}
+
+type scanPlanTextAnyToHstoreScanner struct{}
+
+func (s scanPlanTextAnyToHstoreScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(HstoreScanner)
+
+ if src == nil {
+ return scanner.ScanHstore(Hstore(nil))
+ }
+ return s.scanString(string(src), scanner)
+}
+
+// scanString does not return nil hstore values because string cannot be nil.
+func (scanPlanTextAnyToHstoreScanner) scanString(src string, scanner HstoreScanner) error {
+ hstore, err := parseHstore(src)
+ if err != nil {
+ return err
+ }
+ return scanner.ScanHstore(hstore)
+}
+
+func (c HstoreCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ return codecDecodeToTextFormat(c, m, oid, format, src)
+}
+
+func (c HstoreCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var hstore Hstore
+ err := codecScan(c, m, oid, format, src, &hstore)
+ if err != nil {
+ return nil, err
+ }
+ return hstore, nil
+}
+
+type hstoreParser struct {
+ str string
+ pos int
+ nextBackslash int
+}
+
+func newHSP(in string) *hstoreParser {
+ return &hstoreParser{
+ pos: 0,
+ str: in,
+ nextBackslash: strings.IndexByte(in, '\\'),
+ }
+}
+
+func (p *hstoreParser) atEnd() bool {
+ return p.pos >= len(p.str)
+}
+
+// consume returns the next byte of the string, or end if the string is done.
+func (p *hstoreParser) consume() (b byte, end bool) {
+ if p.pos >= len(p.str) {
+ return 0, true
+ }
+ b = p.str[p.pos]
+ p.pos++
+ return b, false
+}
+
+func unexpectedByteErr(actualB byte, expectedB byte) error {
+ return fmt.Errorf("expected '%c' ('%#v'); found '%c' ('%#v')", expectedB, expectedB, actualB, actualB)
+}
+
+// consumeExpectedByte consumes expectedB from the string, or returns an error.
+func (p *hstoreParser) consumeExpectedByte(expectedB byte) error {
+ nextB, end := p.consume()
+ if end {
+ return fmt.Errorf("expected '%c' ('%#v'); found end", expectedB, expectedB)
+ }
+ if nextB != expectedB {
+ return unexpectedByteErr(nextB, expectedB)
+ }
+ return nil
+}
+
+// consumeExpected2 consumes two expected bytes or returns an error.
+// This was a bit faster than using a string argument (better inlining? Not sure).
+func (p *hstoreParser) consumeExpected2(one byte, two byte) error {
+ if p.pos+2 > len(p.str) {
+ return errors.New("unexpected end of string")
+ }
+ if p.str[p.pos] != one {
+ return unexpectedByteErr(p.str[p.pos], one)
+ }
+ if p.str[p.pos+1] != two {
+ return unexpectedByteErr(p.str[p.pos+1], two)
+ }
+ p.pos += 2
+ return nil
+}
+
+var errEOSInQuoted = errors.New(`found end before closing double-quote ('"')`)
+
+// consumeDoubleQuoted consumes a double-quoted string from p. The double quote must have been
+// parsed already. This copies the string from the backing string so it can be garbage collected.
+func (p *hstoreParser) consumeDoubleQuoted() (string, error) {
+ // fast path: assume most keys/values do not contain escapes
+ nextDoubleQuote := strings.IndexByte(p.str[p.pos:], '"')
+ if nextDoubleQuote == -1 {
+ return "", errEOSInQuoted
+ }
+ nextDoubleQuote += p.pos
+ if p.nextBackslash == -1 || p.nextBackslash > nextDoubleQuote {
+ // clone the string from the source string to ensure it can be garbage collected separately
+ // TODO: use strings.Clone on Go 1.20; this could get optimized away
+ s := strings.Clone(p.str[p.pos:nextDoubleQuote])
+ p.pos = nextDoubleQuote + 1
+ return s, nil
+ }
+
+ // slow path: string contains escapes
+ s, err := p.consumeDoubleQuotedWithEscapes(p.nextBackslash)
+ p.nextBackslash = strings.IndexByte(p.str[p.pos:], '\\')
+ if p.nextBackslash != -1 {
+ p.nextBackslash += p.pos
+ }
+ return s, err
+}
+
+// consumeDoubleQuotedWithEscapes consumes a double-quoted string containing escapes, starting
+// at p.pos, and with the first backslash at firstBackslash. This copies the string so it can be
+// garbage collected separately.
+func (p *hstoreParser) consumeDoubleQuotedWithEscapes(firstBackslash int) (string, error) {
+ // copy the prefix that does not contain backslashes
+ var builder strings.Builder
+ builder.WriteString(p.str[p.pos:firstBackslash])
+
+ // skip to the backslash
+ p.pos = firstBackslash
+
+ // copy bytes until the end, unescaping backslashes
+ for {
+ nextB, end := p.consume()
+ if end {
+ return "", errEOSInQuoted
+ } else if nextB == '"' {
+ break
+ } else if nextB == '\\' {
+ // escape: skip the backslash and copy the char
+ nextB, end = p.consume()
+ if end {
+ return "", errEOSInQuoted
+ }
+ if !(nextB == '\\' || nextB == '"') {
+ return "", fmt.Errorf("unexpected escape in quoted string: found '%#v'", nextB)
+ }
+ builder.WriteByte(nextB)
+ } else {
+ // normal byte: copy it
+ builder.WriteByte(nextB)
+ }
+ }
+ return builder.String(), nil
+}
+
+// consumePairSeparator consumes the Hstore pair separator ", " or returns an error.
+func (p *hstoreParser) consumePairSeparator() error {
+ return p.consumeExpected2(',', ' ')
+}
+
+// consumeKVSeparator consumes the Hstore key/value separator "=>" or returns an error.
+func (p *hstoreParser) consumeKVSeparator() error {
+ return p.consumeExpected2('=', '>')
+}
+
+// consumeDoubleQuotedOrNull consumes the Hstore key/value separator "=>" or returns an error.
+func (p *hstoreParser) consumeDoubleQuotedOrNull() (Text, error) {
+ // peek at the next byte
+ if p.atEnd() {
+ return Text{}, errors.New("found end instead of value")
+ }
+ next := p.str[p.pos]
+ if next == 'N' {
+ // must be the exact string NULL: use consumeExpected2 twice
+ err := p.consumeExpected2('N', 'U')
+ if err != nil {
+ return Text{}, err
+ }
+ err = p.consumeExpected2('L', 'L')
+ if err != nil {
+ return Text{}, err
+ }
+ return Text{String: "", Valid: false}, nil
+ } else if next != '"' {
+ return Text{}, unexpectedByteErr(next, '"')
+ }
+
+ // skip the double quote
+ p.pos += 1
+ s, err := p.consumeDoubleQuoted()
+ if err != nil {
+ return Text{}, err
+ }
+ return Text{String: s, Valid: true}, nil
+}
+
+func parseHstore(s string) (Hstore, error) {
+ p := newHSP(s)
+
+ // This is an over-estimate of the number of key/value pairs. Use '>' because I am guessing it
+ // is less likely to occur in keys/values than '=' or ','.
+ numPairsEstimate := strings.Count(s, ">")
+ // makes one allocation of strings for the entire Hstore, rather than one allocation per value.
+ valueStrings := make([]string, 0, numPairsEstimate)
+ result := make(Hstore, numPairsEstimate)
+ first := true
+ for !p.atEnd() {
+ if !first {
+ err := p.consumePairSeparator()
+ if err != nil {
+ return nil, err
+ }
+ } else {
+ first = false
+ }
+
+ err := p.consumeExpectedByte('"')
+ if err != nil {
+ return nil, err
+ }
+
+ key, err := p.consumeDoubleQuoted()
+ if err != nil {
+ return nil, err
+ }
+
+ err = p.consumeKVSeparator()
+ if err != nil {
+ return nil, err
+ }
+
+ value, err := p.consumeDoubleQuotedOrNull()
+ if err != nil {
+ return nil, err
+ }
+ if value.Valid {
+ valueStrings = append(valueStrings, value.String)
+ result[key] = &valueStrings[len(valueStrings)-1]
+ } else {
+ result[key] = nil
+ }
+ }
+
+ return result, nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/inet.go b/vendor/github.com/jackc/pgx/v5/pgtype/inet.go
new file mode 100644
index 0000000..6ca10ea
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/inet.go
@@ -0,0 +1,200 @@
+package pgtype
+
+import (
+ "bytes"
+ "database/sql/driver"
+ "errors"
+ "fmt"
+ "net/netip"
+)
+
+// Network address family is dependent on server socket.h value for AF_INET.
+// In practice, all platforms appear to have the same value. See
+// src/include/utils/inet.h for more information.
+const (
+ defaultAFInet = 2
+ defaultAFInet6 = 3
+)
+
+type NetipPrefixScanner interface {
+ ScanNetipPrefix(v netip.Prefix) error
+}
+
+type NetipPrefixValuer interface {
+ NetipPrefixValue() (netip.Prefix, error)
+}
+
+// InetCodec handles both inet and cidr PostgreSQL types. The preferred Go types are netip.Prefix and netip.Addr. If
+// IsValid() is false then they are treated as SQL NULL.
+type InetCodec struct{}
+
+func (InetCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (InetCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (InetCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ if _, ok := value.(NetipPrefixValuer); !ok {
+ return nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ return encodePlanInetCodecBinary{}
+ case TextFormatCode:
+ return encodePlanInetCodecText{}
+ }
+
+ return nil
+}
+
+type encodePlanInetCodecBinary struct{}
+
+func (encodePlanInetCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ prefix, err := value.(NetipPrefixValuer).NetipPrefixValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !prefix.IsValid() {
+ return nil, nil
+ }
+
+ var family byte
+ if prefix.Addr().Is4() {
+ family = defaultAFInet
+ } else {
+ family = defaultAFInet6
+ }
+
+ buf = append(buf, family)
+
+ ones := prefix.Bits()
+ buf = append(buf, byte(ones))
+
+ // is_cidr is ignored on server
+ buf = append(buf, 0)
+
+ if family == defaultAFInet {
+ buf = append(buf, byte(4))
+ b := prefix.Addr().As4()
+ buf = append(buf, b[:]...)
+ } else {
+ buf = append(buf, byte(16))
+ b := prefix.Addr().As16()
+ buf = append(buf, b[:]...)
+ }
+
+ return buf, nil
+}
+
+type encodePlanInetCodecText struct{}
+
+func (encodePlanInetCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ prefix, err := value.(NetipPrefixValuer).NetipPrefixValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !prefix.IsValid() {
+ return nil, nil
+ }
+
+ return append(buf, prefix.String()...), nil
+}
+
+func (InetCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case NetipPrefixScanner:
+ return scanPlanBinaryInetToNetipPrefixScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case NetipPrefixScanner:
+ return scanPlanTextAnyToNetipPrefixScanner{}
+ }
+ }
+
+ return nil
+}
+
+func (c InetCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ return codecDecodeToTextFormat(c, m, oid, format, src)
+}
+
+func (c InetCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var prefix netip.Prefix
+ err := codecScan(c, m, oid, format, src, (*netipPrefixWrapper)(&prefix))
+ if err != nil {
+ return nil, err
+ }
+
+ if !prefix.IsValid() {
+ return nil, nil
+ }
+
+ return prefix, nil
+}
+
+type scanPlanBinaryInetToNetipPrefixScanner struct{}
+
+func (scanPlanBinaryInetToNetipPrefixScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(NetipPrefixScanner)
+
+ if src == nil {
+ return scanner.ScanNetipPrefix(netip.Prefix{})
+ }
+
+ if len(src) != 8 && len(src) != 20 {
+ return fmt.Errorf("Received an invalid size for an inet: %d", len(src))
+ }
+
+ // ignore family
+ bits := src[1]
+ // ignore is_cidr
+ // ignore addressLength - implicit in length of message
+
+ addr, ok := netip.AddrFromSlice(src[4:])
+ if !ok {
+ return errors.New("netip.AddrFromSlice failed")
+ }
+
+ return scanner.ScanNetipPrefix(netip.PrefixFrom(addr, int(bits)))
+}
+
+type scanPlanTextAnyToNetipPrefixScanner struct{}
+
+func (scanPlanTextAnyToNetipPrefixScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(NetipPrefixScanner)
+
+ if src == nil {
+ return scanner.ScanNetipPrefix(netip.Prefix{})
+ }
+
+ var prefix netip.Prefix
+ if bytes.IndexByte(src, '/') == -1 {
+ addr, err := netip.ParseAddr(string(src))
+ if err != nil {
+ return err
+ }
+ prefix = netip.PrefixFrom(addr, addr.BitLen())
+ } else {
+ var err error
+ prefix, err = netip.ParsePrefix(string(src))
+ if err != nil {
+ return err
+ }
+ }
+
+ return scanner.ScanNetipPrefix(prefix)
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/int.go b/vendor/github.com/jackc/pgx/v5/pgtype/int.go
new file mode 100644
index 0000000..90a20a2
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/int.go
@@ -0,0 +1,1980 @@
+// Do not edit. Generated from pgtype/int.go.erb
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "encoding/json"
+ "fmt"
+ "math"
+ "strconv"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+type Int64Scanner interface {
+ ScanInt64(Int8) error
+}
+
+type Int64Valuer interface {
+ Int64Value() (Int8, error)
+}
+
+type Int2 struct {
+ Int16 int16
+ Valid bool
+}
+
+// ScanInt64 implements the Int64Scanner interface.
+func (dst *Int2) ScanInt64(n Int8) error {
+ if !n.Valid {
+ *dst = Int2{}
+ return nil
+ }
+
+ if n.Int64 < math.MinInt16 {
+ return fmt.Errorf("%d is less than minimum value for Int2", n.Int64)
+ }
+ if n.Int64 > math.MaxInt16 {
+ return fmt.Errorf("%d is greater than maximum value for Int2", n.Int64)
+ }
+ *dst = Int2{Int16: int16(n.Int64), Valid: true}
+
+ return nil
+}
+
+func (n Int2) Int64Value() (Int8, error) {
+ return Int8{Int64: int64(n.Int16), Valid: n.Valid}, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (dst *Int2) Scan(src any) error {
+ if src == nil {
+ *dst = Int2{}
+ return nil
+ }
+
+ var n int64
+
+ switch src := src.(type) {
+ case int64:
+ n = src
+ case string:
+ var err error
+ n, err = strconv.ParseInt(src, 10, 16)
+ if err != nil {
+ return err
+ }
+ case []byte:
+ var err error
+ n, err = strconv.ParseInt(string(src), 10, 16)
+ if err != nil {
+ return err
+ }
+ default:
+ return fmt.Errorf("cannot scan %T", src)
+ }
+
+ if n < math.MinInt16 {
+ return fmt.Errorf("%d is greater than maximum value for Int2", n)
+ }
+ if n > math.MaxInt16 {
+ return fmt.Errorf("%d is greater than maximum value for Int2", n)
+ }
+ *dst = Int2{Int16: int16(n), Valid: true}
+
+ return nil
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (src Int2) Value() (driver.Value, error) {
+ if !src.Valid {
+ return nil, nil
+ }
+ return int64(src.Int16), nil
+}
+
+func (src Int2) MarshalJSON() ([]byte, error) {
+ if !src.Valid {
+ return []byte("null"), nil
+ }
+ return []byte(strconv.FormatInt(int64(src.Int16), 10)), nil
+}
+
+func (dst *Int2) UnmarshalJSON(b []byte) error {
+ var n *int16
+ err := json.Unmarshal(b, &n)
+ if err != nil {
+ return err
+ }
+
+ if n == nil {
+ *dst = Int2{}
+ } else {
+ *dst = Int2{Int16: *n, Valid: true}
+ }
+
+ return nil
+}
+
+type Int2Codec struct{}
+
+func (Int2Codec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (Int2Codec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (Int2Codec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ switch format {
+ case BinaryFormatCode:
+ switch value.(type) {
+ case int16:
+ return encodePlanInt2CodecBinaryInt16{}
+ case Int64Valuer:
+ return encodePlanInt2CodecBinaryInt64Valuer{}
+ }
+ case TextFormatCode:
+ switch value.(type) {
+ case int16:
+ return encodePlanInt2CodecTextInt16{}
+ case Int64Valuer:
+ return encodePlanInt2CodecTextInt64Valuer{}
+ }
+ }
+
+ return nil
+}
+
+type encodePlanInt2CodecBinaryInt16 struct{}
+
+func (encodePlanInt2CodecBinaryInt16) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n := value.(int16)
+ return pgio.AppendInt16(buf, int16(n)), nil
+}
+
+type encodePlanInt2CodecTextInt16 struct{}
+
+func (encodePlanInt2CodecTextInt16) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n := value.(int16)
+ return append(buf, strconv.FormatInt(int64(n), 10)...), nil
+}
+
+type encodePlanInt2CodecBinaryInt64Valuer struct{}
+
+func (encodePlanInt2CodecBinaryInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n, err := value.(Int64Valuer).Int64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !n.Valid {
+ return nil, nil
+ }
+
+ if n.Int64 > math.MaxInt16 {
+ return nil, fmt.Errorf("%d is greater than maximum value for int2", n.Int64)
+ }
+ if n.Int64 < math.MinInt16 {
+ return nil, fmt.Errorf("%d is less than minimum value for int2", n.Int64)
+ }
+
+ return pgio.AppendInt16(buf, int16(n.Int64)), nil
+}
+
+type encodePlanInt2CodecTextInt64Valuer struct{}
+
+func (encodePlanInt2CodecTextInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n, err := value.(Int64Valuer).Int64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !n.Valid {
+ return nil, nil
+ }
+
+ if n.Int64 > math.MaxInt16 {
+ return nil, fmt.Errorf("%d is greater than maximum value for int2", n.Int64)
+ }
+ if n.Int64 < math.MinInt16 {
+ return nil, fmt.Errorf("%d is less than minimum value for int2", n.Int64)
+ }
+
+ return append(buf, strconv.FormatInt(n.Int64, 10)...), nil
+}
+
+func (Int2Codec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case *int8:
+ return scanPlanBinaryInt2ToInt8{}
+ case *int16:
+ return scanPlanBinaryInt2ToInt16{}
+ case *int32:
+ return scanPlanBinaryInt2ToInt32{}
+ case *int64:
+ return scanPlanBinaryInt2ToInt64{}
+ case *int:
+ return scanPlanBinaryInt2ToInt{}
+ case *uint8:
+ return scanPlanBinaryInt2ToUint8{}
+ case *uint16:
+ return scanPlanBinaryInt2ToUint16{}
+ case *uint32:
+ return scanPlanBinaryInt2ToUint32{}
+ case *uint64:
+ return scanPlanBinaryInt2ToUint64{}
+ case *uint:
+ return scanPlanBinaryInt2ToUint{}
+ case Int64Scanner:
+ return scanPlanBinaryInt2ToInt64Scanner{}
+ case TextScanner:
+ return scanPlanBinaryInt2ToTextScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case *int8:
+ return scanPlanTextAnyToInt8{}
+ case *int16:
+ return scanPlanTextAnyToInt16{}
+ case *int32:
+ return scanPlanTextAnyToInt32{}
+ case *int64:
+ return scanPlanTextAnyToInt64{}
+ case *int:
+ return scanPlanTextAnyToInt{}
+ case *uint8:
+ return scanPlanTextAnyToUint8{}
+ case *uint16:
+ return scanPlanTextAnyToUint16{}
+ case *uint32:
+ return scanPlanTextAnyToUint32{}
+ case *uint64:
+ return scanPlanTextAnyToUint64{}
+ case *uint:
+ return scanPlanTextAnyToUint{}
+ case Int64Scanner:
+ return scanPlanTextAnyToInt64Scanner{}
+ }
+ }
+
+ return nil
+}
+
+func (c Int2Codec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var n int64
+ err := codecScan(c, m, oid, format, src, &n)
+ if err != nil {
+ return nil, err
+ }
+ return n, nil
+}
+
+func (c Int2Codec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var n int16
+ err := codecScan(c, m, oid, format, src, &n)
+ if err != nil {
+ return nil, err
+ }
+ return n, nil
+}
+
+type scanPlanBinaryInt2ToInt8 struct{}
+
+func (scanPlanBinaryInt2ToInt8) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 2 {
+ return fmt.Errorf("invalid length for int2: %v", len(src))
+ }
+
+ p, ok := (dst).(*int8)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int16(binary.BigEndian.Uint16(src))
+ if n < math.MinInt8 {
+ return fmt.Errorf("%d is less than minimum value for int8", n)
+ } else if n > math.MaxInt8 {
+ return fmt.Errorf("%d is greater than maximum value for int8", n)
+ }
+
+ *p = int8(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt2ToUint8 struct{}
+
+func (scanPlanBinaryInt2ToUint8) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 2 {
+ return fmt.Errorf("invalid length for uint2: %v", len(src))
+ }
+
+ p, ok := (dst).(*uint8)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int16(binary.BigEndian.Uint16(src))
+ if n < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint8", n)
+ }
+
+ if n > math.MaxUint8 {
+ return fmt.Errorf("%d is greater than maximum value for uint8", n)
+ }
+
+ *p = uint8(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt2ToInt16 struct{}
+
+func (scanPlanBinaryInt2ToInt16) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 2 {
+ return fmt.Errorf("invalid length for int2: %v", len(src))
+ }
+
+ p, ok := (dst).(*int16)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ *p = int16(binary.BigEndian.Uint16(src))
+
+ return nil
+}
+
+type scanPlanBinaryInt2ToUint16 struct{}
+
+func (scanPlanBinaryInt2ToUint16) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 2 {
+ return fmt.Errorf("invalid length for uint2: %v", len(src))
+ }
+
+ p, ok := (dst).(*uint16)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int16(binary.BigEndian.Uint16(src))
+ if n < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint16", n)
+ }
+
+ *p = uint16(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt2ToInt32 struct{}
+
+func (scanPlanBinaryInt2ToInt32) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 2 {
+ return fmt.Errorf("invalid length for int2: %v", len(src))
+ }
+
+ p, ok := (dst).(*int32)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ *p = int32(int16(binary.BigEndian.Uint16(src)))
+
+ return nil
+}
+
+type scanPlanBinaryInt2ToUint32 struct{}
+
+func (scanPlanBinaryInt2ToUint32) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 2 {
+ return fmt.Errorf("invalid length for uint2: %v", len(src))
+ }
+
+ p, ok := (dst).(*uint32)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int16(binary.BigEndian.Uint16(src))
+ if n < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint32", n)
+ }
+
+ *p = uint32(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt2ToInt64 struct{}
+
+func (scanPlanBinaryInt2ToInt64) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 2 {
+ return fmt.Errorf("invalid length for int2: %v", len(src))
+ }
+
+ p, ok := (dst).(*int64)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ *p = int64(int16(binary.BigEndian.Uint16(src)))
+
+ return nil
+}
+
+type scanPlanBinaryInt2ToUint64 struct{}
+
+func (scanPlanBinaryInt2ToUint64) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 2 {
+ return fmt.Errorf("invalid length for uint2: %v", len(src))
+ }
+
+ p, ok := (dst).(*uint64)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int16(binary.BigEndian.Uint16(src))
+ if n < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint64", n)
+ }
+
+ *p = uint64(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt2ToInt struct{}
+
+func (scanPlanBinaryInt2ToInt) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 2 {
+ return fmt.Errorf("invalid length for int2: %v", len(src))
+ }
+
+ p, ok := (dst).(*int)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ *p = int(int16(binary.BigEndian.Uint16(src)))
+
+ return nil
+}
+
+type scanPlanBinaryInt2ToUint struct{}
+
+func (scanPlanBinaryInt2ToUint) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 2 {
+ return fmt.Errorf("invalid length for uint2: %v", len(src))
+ }
+
+ p, ok := (dst).(*uint)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int64(int16(binary.BigEndian.Uint16(src)))
+ if n < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint", n)
+ }
+
+ *p = uint(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt2ToInt64Scanner struct{}
+
+func (scanPlanBinaryInt2ToInt64Scanner) Scan(src []byte, dst any) error {
+ s, ok := (dst).(Int64Scanner)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ if src == nil {
+ return s.ScanInt64(Int8{})
+ }
+
+ if len(src) != 2 {
+ return fmt.Errorf("invalid length for int2: %v", len(src))
+ }
+
+ n := int64(int16(binary.BigEndian.Uint16(src)))
+
+ return s.ScanInt64(Int8{Int64: n, Valid: true})
+}
+
+type scanPlanBinaryInt2ToTextScanner struct{}
+
+func (scanPlanBinaryInt2ToTextScanner) Scan(src []byte, dst any) error {
+ s, ok := (dst).(TextScanner)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ if src == nil {
+ return s.ScanText(Text{})
+ }
+
+ if len(src) != 2 {
+ return fmt.Errorf("invalid length for int2: %v", len(src))
+ }
+
+ n := int64(int16(binary.BigEndian.Uint16(src)))
+
+ return s.ScanText(Text{String: strconv.FormatInt(n, 10), Valid: true})
+}
+
+type Int4 struct {
+ Int32 int32
+ Valid bool
+}
+
+// ScanInt64 implements the Int64Scanner interface.
+func (dst *Int4) ScanInt64(n Int8) error {
+ if !n.Valid {
+ *dst = Int4{}
+ return nil
+ }
+
+ if n.Int64 < math.MinInt32 {
+ return fmt.Errorf("%d is less than minimum value for Int4", n.Int64)
+ }
+ if n.Int64 > math.MaxInt32 {
+ return fmt.Errorf("%d is greater than maximum value for Int4", n.Int64)
+ }
+ *dst = Int4{Int32: int32(n.Int64), Valid: true}
+
+ return nil
+}
+
+func (n Int4) Int64Value() (Int8, error) {
+ return Int8{Int64: int64(n.Int32), Valid: n.Valid}, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (dst *Int4) Scan(src any) error {
+ if src == nil {
+ *dst = Int4{}
+ return nil
+ }
+
+ var n int64
+
+ switch src := src.(type) {
+ case int64:
+ n = src
+ case string:
+ var err error
+ n, err = strconv.ParseInt(src, 10, 32)
+ if err != nil {
+ return err
+ }
+ case []byte:
+ var err error
+ n, err = strconv.ParseInt(string(src), 10, 32)
+ if err != nil {
+ return err
+ }
+ default:
+ return fmt.Errorf("cannot scan %T", src)
+ }
+
+ if n < math.MinInt32 {
+ return fmt.Errorf("%d is greater than maximum value for Int4", n)
+ }
+ if n > math.MaxInt32 {
+ return fmt.Errorf("%d is greater than maximum value for Int4", n)
+ }
+ *dst = Int4{Int32: int32(n), Valid: true}
+
+ return nil
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (src Int4) Value() (driver.Value, error) {
+ if !src.Valid {
+ return nil, nil
+ }
+ return int64(src.Int32), nil
+}
+
+func (src Int4) MarshalJSON() ([]byte, error) {
+ if !src.Valid {
+ return []byte("null"), nil
+ }
+ return []byte(strconv.FormatInt(int64(src.Int32), 10)), nil
+}
+
+func (dst *Int4) UnmarshalJSON(b []byte) error {
+ var n *int32
+ err := json.Unmarshal(b, &n)
+ if err != nil {
+ return err
+ }
+
+ if n == nil {
+ *dst = Int4{}
+ } else {
+ *dst = Int4{Int32: *n, Valid: true}
+ }
+
+ return nil
+}
+
+type Int4Codec struct{}
+
+func (Int4Codec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (Int4Codec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (Int4Codec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ switch format {
+ case BinaryFormatCode:
+ switch value.(type) {
+ case int32:
+ return encodePlanInt4CodecBinaryInt32{}
+ case Int64Valuer:
+ return encodePlanInt4CodecBinaryInt64Valuer{}
+ }
+ case TextFormatCode:
+ switch value.(type) {
+ case int32:
+ return encodePlanInt4CodecTextInt32{}
+ case Int64Valuer:
+ return encodePlanInt4CodecTextInt64Valuer{}
+ }
+ }
+
+ return nil
+}
+
+type encodePlanInt4CodecBinaryInt32 struct{}
+
+func (encodePlanInt4CodecBinaryInt32) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n := value.(int32)
+ return pgio.AppendInt32(buf, int32(n)), nil
+}
+
+type encodePlanInt4CodecTextInt32 struct{}
+
+func (encodePlanInt4CodecTextInt32) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n := value.(int32)
+ return append(buf, strconv.FormatInt(int64(n), 10)...), nil
+}
+
+type encodePlanInt4CodecBinaryInt64Valuer struct{}
+
+func (encodePlanInt4CodecBinaryInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n, err := value.(Int64Valuer).Int64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !n.Valid {
+ return nil, nil
+ }
+
+ if n.Int64 > math.MaxInt32 {
+ return nil, fmt.Errorf("%d is greater than maximum value for int4", n.Int64)
+ }
+ if n.Int64 < math.MinInt32 {
+ return nil, fmt.Errorf("%d is less than minimum value for int4", n.Int64)
+ }
+
+ return pgio.AppendInt32(buf, int32(n.Int64)), nil
+}
+
+type encodePlanInt4CodecTextInt64Valuer struct{}
+
+func (encodePlanInt4CodecTextInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n, err := value.(Int64Valuer).Int64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !n.Valid {
+ return nil, nil
+ }
+
+ if n.Int64 > math.MaxInt32 {
+ return nil, fmt.Errorf("%d is greater than maximum value for int4", n.Int64)
+ }
+ if n.Int64 < math.MinInt32 {
+ return nil, fmt.Errorf("%d is less than minimum value for int4", n.Int64)
+ }
+
+ return append(buf, strconv.FormatInt(n.Int64, 10)...), nil
+}
+
+func (Int4Codec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case *int8:
+ return scanPlanBinaryInt4ToInt8{}
+ case *int16:
+ return scanPlanBinaryInt4ToInt16{}
+ case *int32:
+ return scanPlanBinaryInt4ToInt32{}
+ case *int64:
+ return scanPlanBinaryInt4ToInt64{}
+ case *int:
+ return scanPlanBinaryInt4ToInt{}
+ case *uint8:
+ return scanPlanBinaryInt4ToUint8{}
+ case *uint16:
+ return scanPlanBinaryInt4ToUint16{}
+ case *uint32:
+ return scanPlanBinaryInt4ToUint32{}
+ case *uint64:
+ return scanPlanBinaryInt4ToUint64{}
+ case *uint:
+ return scanPlanBinaryInt4ToUint{}
+ case Int64Scanner:
+ return scanPlanBinaryInt4ToInt64Scanner{}
+ case TextScanner:
+ return scanPlanBinaryInt4ToTextScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case *int8:
+ return scanPlanTextAnyToInt8{}
+ case *int16:
+ return scanPlanTextAnyToInt16{}
+ case *int32:
+ return scanPlanTextAnyToInt32{}
+ case *int64:
+ return scanPlanTextAnyToInt64{}
+ case *int:
+ return scanPlanTextAnyToInt{}
+ case *uint8:
+ return scanPlanTextAnyToUint8{}
+ case *uint16:
+ return scanPlanTextAnyToUint16{}
+ case *uint32:
+ return scanPlanTextAnyToUint32{}
+ case *uint64:
+ return scanPlanTextAnyToUint64{}
+ case *uint:
+ return scanPlanTextAnyToUint{}
+ case Int64Scanner:
+ return scanPlanTextAnyToInt64Scanner{}
+ }
+ }
+
+ return nil
+}
+
+func (c Int4Codec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var n int64
+ err := codecScan(c, m, oid, format, src, &n)
+ if err != nil {
+ return nil, err
+ }
+ return n, nil
+}
+
+func (c Int4Codec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var n int32
+ err := codecScan(c, m, oid, format, src, &n)
+ if err != nil {
+ return nil, err
+ }
+ return n, nil
+}
+
+type scanPlanBinaryInt4ToInt8 struct{}
+
+func (scanPlanBinaryInt4ToInt8) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 4 {
+ return fmt.Errorf("invalid length for int4: %v", len(src))
+ }
+
+ p, ok := (dst).(*int8)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int32(binary.BigEndian.Uint32(src))
+ if n < math.MinInt8 {
+ return fmt.Errorf("%d is less than minimum value for int8", n)
+ } else if n > math.MaxInt8 {
+ return fmt.Errorf("%d is greater than maximum value for int8", n)
+ }
+
+ *p = int8(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt4ToUint8 struct{}
+
+func (scanPlanBinaryInt4ToUint8) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 4 {
+ return fmt.Errorf("invalid length for uint4: %v", len(src))
+ }
+
+ p, ok := (dst).(*uint8)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int32(binary.BigEndian.Uint32(src))
+ if n < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint8", n)
+ }
+
+ if n > math.MaxUint8 {
+ return fmt.Errorf("%d is greater than maximum value for uint8", n)
+ }
+
+ *p = uint8(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt4ToInt16 struct{}
+
+func (scanPlanBinaryInt4ToInt16) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 4 {
+ return fmt.Errorf("invalid length for int4: %v", len(src))
+ }
+
+ p, ok := (dst).(*int16)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int32(binary.BigEndian.Uint32(src))
+ if n < math.MinInt16 {
+ return fmt.Errorf("%d is less than minimum value for int16", n)
+ } else if n > math.MaxInt16 {
+ return fmt.Errorf("%d is greater than maximum value for int16", n)
+ }
+
+ *p = int16(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt4ToUint16 struct{}
+
+func (scanPlanBinaryInt4ToUint16) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 4 {
+ return fmt.Errorf("invalid length for uint4: %v", len(src))
+ }
+
+ p, ok := (dst).(*uint16)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int32(binary.BigEndian.Uint32(src))
+ if n < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint16", n)
+ }
+
+ if n > math.MaxUint16 {
+ return fmt.Errorf("%d is greater than maximum value for uint16", n)
+ }
+
+ *p = uint16(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt4ToInt32 struct{}
+
+func (scanPlanBinaryInt4ToInt32) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 4 {
+ return fmt.Errorf("invalid length for int4: %v", len(src))
+ }
+
+ p, ok := (dst).(*int32)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ *p = int32(binary.BigEndian.Uint32(src))
+
+ return nil
+}
+
+type scanPlanBinaryInt4ToUint32 struct{}
+
+func (scanPlanBinaryInt4ToUint32) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 4 {
+ return fmt.Errorf("invalid length for uint4: %v", len(src))
+ }
+
+ p, ok := (dst).(*uint32)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int32(binary.BigEndian.Uint32(src))
+ if n < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint32", n)
+ }
+
+ *p = uint32(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt4ToInt64 struct{}
+
+func (scanPlanBinaryInt4ToInt64) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 4 {
+ return fmt.Errorf("invalid length for int4: %v", len(src))
+ }
+
+ p, ok := (dst).(*int64)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ *p = int64(int32(binary.BigEndian.Uint32(src)))
+
+ return nil
+}
+
+type scanPlanBinaryInt4ToUint64 struct{}
+
+func (scanPlanBinaryInt4ToUint64) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 4 {
+ return fmt.Errorf("invalid length for uint4: %v", len(src))
+ }
+
+ p, ok := (dst).(*uint64)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int32(binary.BigEndian.Uint32(src))
+ if n < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint64", n)
+ }
+
+ *p = uint64(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt4ToInt struct{}
+
+func (scanPlanBinaryInt4ToInt) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 4 {
+ return fmt.Errorf("invalid length for int4: %v", len(src))
+ }
+
+ p, ok := (dst).(*int)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ *p = int(int32(binary.BigEndian.Uint32(src)))
+
+ return nil
+}
+
+type scanPlanBinaryInt4ToUint struct{}
+
+func (scanPlanBinaryInt4ToUint) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 4 {
+ return fmt.Errorf("invalid length for uint4: %v", len(src))
+ }
+
+ p, ok := (dst).(*uint)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int64(int32(binary.BigEndian.Uint32(src)))
+ if n < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint", n)
+ }
+
+ *p = uint(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt4ToInt64Scanner struct{}
+
+func (scanPlanBinaryInt4ToInt64Scanner) Scan(src []byte, dst any) error {
+ s, ok := (dst).(Int64Scanner)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ if src == nil {
+ return s.ScanInt64(Int8{})
+ }
+
+ if len(src) != 4 {
+ return fmt.Errorf("invalid length for int4: %v", len(src))
+ }
+
+ n := int64(int32(binary.BigEndian.Uint32(src)))
+
+ return s.ScanInt64(Int8{Int64: n, Valid: true})
+}
+
+type scanPlanBinaryInt4ToTextScanner struct{}
+
+func (scanPlanBinaryInt4ToTextScanner) Scan(src []byte, dst any) error {
+ s, ok := (dst).(TextScanner)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ if src == nil {
+ return s.ScanText(Text{})
+ }
+
+ if len(src) != 4 {
+ return fmt.Errorf("invalid length for int4: %v", len(src))
+ }
+
+ n := int64(int32(binary.BigEndian.Uint32(src)))
+
+ return s.ScanText(Text{String: strconv.FormatInt(n, 10), Valid: true})
+}
+
+type Int8 struct {
+ Int64 int64
+ Valid bool
+}
+
+// ScanInt64 implements the Int64Scanner interface.
+func (dst *Int8) ScanInt64(n Int8) error {
+ if !n.Valid {
+ *dst = Int8{}
+ return nil
+ }
+
+ if n.Int64 < math.MinInt64 {
+ return fmt.Errorf("%d is less than minimum value for Int8", n.Int64)
+ }
+ if n.Int64 > math.MaxInt64 {
+ return fmt.Errorf("%d is greater than maximum value for Int8", n.Int64)
+ }
+ *dst = Int8{Int64: int64(n.Int64), Valid: true}
+
+ return nil
+}
+
+func (n Int8) Int64Value() (Int8, error) {
+ return Int8{Int64: int64(n.Int64), Valid: n.Valid}, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (dst *Int8) Scan(src any) error {
+ if src == nil {
+ *dst = Int8{}
+ return nil
+ }
+
+ var n int64
+
+ switch src := src.(type) {
+ case int64:
+ n = src
+ case string:
+ var err error
+ n, err = strconv.ParseInt(src, 10, 64)
+ if err != nil {
+ return err
+ }
+ case []byte:
+ var err error
+ n, err = strconv.ParseInt(string(src), 10, 64)
+ if err != nil {
+ return err
+ }
+ default:
+ return fmt.Errorf("cannot scan %T", src)
+ }
+
+ if n < math.MinInt64 {
+ return fmt.Errorf("%d is greater than maximum value for Int8", n)
+ }
+ if n > math.MaxInt64 {
+ return fmt.Errorf("%d is greater than maximum value for Int8", n)
+ }
+ *dst = Int8{Int64: int64(n), Valid: true}
+
+ return nil
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (src Int8) Value() (driver.Value, error) {
+ if !src.Valid {
+ return nil, nil
+ }
+ return int64(src.Int64), nil
+}
+
+func (src Int8) MarshalJSON() ([]byte, error) {
+ if !src.Valid {
+ return []byte("null"), nil
+ }
+ return []byte(strconv.FormatInt(int64(src.Int64), 10)), nil
+}
+
+func (dst *Int8) UnmarshalJSON(b []byte) error {
+ var n *int64
+ err := json.Unmarshal(b, &n)
+ if err != nil {
+ return err
+ }
+
+ if n == nil {
+ *dst = Int8{}
+ } else {
+ *dst = Int8{Int64: *n, Valid: true}
+ }
+
+ return nil
+}
+
+type Int8Codec struct{}
+
+func (Int8Codec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (Int8Codec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (Int8Codec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ switch format {
+ case BinaryFormatCode:
+ switch value.(type) {
+ case int64:
+ return encodePlanInt8CodecBinaryInt64{}
+ case Int64Valuer:
+ return encodePlanInt8CodecBinaryInt64Valuer{}
+ }
+ case TextFormatCode:
+ switch value.(type) {
+ case int64:
+ return encodePlanInt8CodecTextInt64{}
+ case Int64Valuer:
+ return encodePlanInt8CodecTextInt64Valuer{}
+ }
+ }
+
+ return nil
+}
+
+type encodePlanInt8CodecBinaryInt64 struct{}
+
+func (encodePlanInt8CodecBinaryInt64) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n := value.(int64)
+ return pgio.AppendInt64(buf, int64(n)), nil
+}
+
+type encodePlanInt8CodecTextInt64 struct{}
+
+func (encodePlanInt8CodecTextInt64) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n := value.(int64)
+ return append(buf, strconv.FormatInt(int64(n), 10)...), nil
+}
+
+type encodePlanInt8CodecBinaryInt64Valuer struct{}
+
+func (encodePlanInt8CodecBinaryInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n, err := value.(Int64Valuer).Int64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !n.Valid {
+ return nil, nil
+ }
+
+ if n.Int64 > math.MaxInt64 {
+ return nil, fmt.Errorf("%d is greater than maximum value for int8", n.Int64)
+ }
+ if n.Int64 < math.MinInt64 {
+ return nil, fmt.Errorf("%d is less than minimum value for int8", n.Int64)
+ }
+
+ return pgio.AppendInt64(buf, int64(n.Int64)), nil
+}
+
+type encodePlanInt8CodecTextInt64Valuer struct{}
+
+func (encodePlanInt8CodecTextInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n, err := value.(Int64Valuer).Int64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !n.Valid {
+ return nil, nil
+ }
+
+ if n.Int64 > math.MaxInt64 {
+ return nil, fmt.Errorf("%d is greater than maximum value for int8", n.Int64)
+ }
+ if n.Int64 < math.MinInt64 {
+ return nil, fmt.Errorf("%d is less than minimum value for int8", n.Int64)
+ }
+
+ return append(buf, strconv.FormatInt(n.Int64, 10)...), nil
+}
+
+func (Int8Codec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case *int8:
+ return scanPlanBinaryInt8ToInt8{}
+ case *int16:
+ return scanPlanBinaryInt8ToInt16{}
+ case *int32:
+ return scanPlanBinaryInt8ToInt32{}
+ case *int64:
+ return scanPlanBinaryInt8ToInt64{}
+ case *int:
+ return scanPlanBinaryInt8ToInt{}
+ case *uint8:
+ return scanPlanBinaryInt8ToUint8{}
+ case *uint16:
+ return scanPlanBinaryInt8ToUint16{}
+ case *uint32:
+ return scanPlanBinaryInt8ToUint32{}
+ case *uint64:
+ return scanPlanBinaryInt8ToUint64{}
+ case *uint:
+ return scanPlanBinaryInt8ToUint{}
+ case Int64Scanner:
+ return scanPlanBinaryInt8ToInt64Scanner{}
+ case TextScanner:
+ return scanPlanBinaryInt8ToTextScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case *int8:
+ return scanPlanTextAnyToInt8{}
+ case *int16:
+ return scanPlanTextAnyToInt16{}
+ case *int32:
+ return scanPlanTextAnyToInt32{}
+ case *int64:
+ return scanPlanTextAnyToInt64{}
+ case *int:
+ return scanPlanTextAnyToInt{}
+ case *uint8:
+ return scanPlanTextAnyToUint8{}
+ case *uint16:
+ return scanPlanTextAnyToUint16{}
+ case *uint32:
+ return scanPlanTextAnyToUint32{}
+ case *uint64:
+ return scanPlanTextAnyToUint64{}
+ case *uint:
+ return scanPlanTextAnyToUint{}
+ case Int64Scanner:
+ return scanPlanTextAnyToInt64Scanner{}
+ }
+ }
+
+ return nil
+}
+
+func (c Int8Codec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var n int64
+ err := codecScan(c, m, oid, format, src, &n)
+ if err != nil {
+ return nil, err
+ }
+ return n, nil
+}
+
+func (c Int8Codec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var n int64
+ err := codecScan(c, m, oid, format, src, &n)
+ if err != nil {
+ return nil, err
+ }
+ return n, nil
+}
+
+type scanPlanBinaryInt8ToInt8 struct{}
+
+func (scanPlanBinaryInt8ToInt8) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for int8: %v", len(src))
+ }
+
+ p, ok := (dst).(*int8)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int64(binary.BigEndian.Uint64(src))
+ if n < math.MinInt8 {
+ return fmt.Errorf("%d is less than minimum value for int8", n)
+ } else if n > math.MaxInt8 {
+ return fmt.Errorf("%d is greater than maximum value for int8", n)
+ }
+
+ *p = int8(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt8ToUint8 struct{}
+
+func (scanPlanBinaryInt8ToUint8) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for uint8: %v", len(src))
+ }
+
+ p, ok := (dst).(*uint8)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int64(binary.BigEndian.Uint64(src))
+ if n < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint8", n)
+ }
+
+ if n > math.MaxUint8 {
+ return fmt.Errorf("%d is greater than maximum value for uint8", n)
+ }
+
+ *p = uint8(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt8ToInt16 struct{}
+
+func (scanPlanBinaryInt8ToInt16) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for int8: %v", len(src))
+ }
+
+ p, ok := (dst).(*int16)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int64(binary.BigEndian.Uint64(src))
+ if n < math.MinInt16 {
+ return fmt.Errorf("%d is less than minimum value for int16", n)
+ } else if n > math.MaxInt16 {
+ return fmt.Errorf("%d is greater than maximum value for int16", n)
+ }
+
+ *p = int16(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt8ToUint16 struct{}
+
+func (scanPlanBinaryInt8ToUint16) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for uint8: %v", len(src))
+ }
+
+ p, ok := (dst).(*uint16)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int64(binary.BigEndian.Uint64(src))
+ if n < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint16", n)
+ }
+
+ if n > math.MaxUint16 {
+ return fmt.Errorf("%d is greater than maximum value for uint16", n)
+ }
+
+ *p = uint16(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt8ToInt32 struct{}
+
+func (scanPlanBinaryInt8ToInt32) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for int8: %v", len(src))
+ }
+
+ p, ok := (dst).(*int32)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int64(binary.BigEndian.Uint64(src))
+ if n < math.MinInt32 {
+ return fmt.Errorf("%d is less than minimum value for int32", n)
+ } else if n > math.MaxInt32 {
+ return fmt.Errorf("%d is greater than maximum value for int32", n)
+ }
+
+ *p = int32(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt8ToUint32 struct{}
+
+func (scanPlanBinaryInt8ToUint32) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for uint8: %v", len(src))
+ }
+
+ p, ok := (dst).(*uint32)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int64(binary.BigEndian.Uint64(src))
+ if n < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint32", n)
+ }
+
+ if n > math.MaxUint32 {
+ return fmt.Errorf("%d is greater than maximum value for uint32", n)
+ }
+
+ *p = uint32(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt8ToInt64 struct{}
+
+func (scanPlanBinaryInt8ToInt64) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for int8: %v", len(src))
+ }
+
+ p, ok := (dst).(*int64)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ *p = int64(binary.BigEndian.Uint64(src))
+
+ return nil
+}
+
+type scanPlanBinaryInt8ToUint64 struct{}
+
+func (scanPlanBinaryInt8ToUint64) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for uint8: %v", len(src))
+ }
+
+ p, ok := (dst).(*uint64)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int64(binary.BigEndian.Uint64(src))
+ if n < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint64", n)
+ }
+
+ *p = uint64(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt8ToInt struct{}
+
+func (scanPlanBinaryInt8ToInt) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for int8: %v", len(src))
+ }
+
+ p, ok := (dst).(*int)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int64(binary.BigEndian.Uint64(src))
+ if n < math.MinInt {
+ return fmt.Errorf("%d is less than minimum value for int", n)
+ } else if n > math.MaxInt {
+ return fmt.Errorf("%d is greater than maximum value for int", n)
+ }
+
+ *p = int(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt8ToUint struct{}
+
+func (scanPlanBinaryInt8ToUint) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for uint8: %v", len(src))
+ }
+
+ p, ok := (dst).(*uint)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int64(int64(binary.BigEndian.Uint64(src)))
+ if n < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint", n)
+ }
+
+ if uint64(n) > math.MaxUint {
+ return fmt.Errorf("%d is greater than maximum value for uint", n)
+ }
+
+ *p = uint(n)
+
+ return nil
+}
+
+type scanPlanBinaryInt8ToInt64Scanner struct{}
+
+func (scanPlanBinaryInt8ToInt64Scanner) Scan(src []byte, dst any) error {
+ s, ok := (dst).(Int64Scanner)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ if src == nil {
+ return s.ScanInt64(Int8{})
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for int8: %v", len(src))
+ }
+
+ n := int64(int64(binary.BigEndian.Uint64(src)))
+
+ return s.ScanInt64(Int8{Int64: n, Valid: true})
+}
+
+type scanPlanBinaryInt8ToTextScanner struct{}
+
+func (scanPlanBinaryInt8ToTextScanner) Scan(src []byte, dst any) error {
+ s, ok := (dst).(TextScanner)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ if src == nil {
+ return s.ScanText(Text{})
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for int8: %v", len(src))
+ }
+
+ n := int64(int64(binary.BigEndian.Uint64(src)))
+
+ return s.ScanText(Text{String: strconv.FormatInt(n, 10), Valid: true})
+}
+
+type scanPlanTextAnyToInt8 struct{}
+
+func (scanPlanTextAnyToInt8) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ p, ok := (dst).(*int8)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n, err := strconv.ParseInt(string(src), 10, 8)
+ if err != nil {
+ return err
+ }
+
+ *p = int8(n)
+ return nil
+}
+
+type scanPlanTextAnyToUint8 struct{}
+
+func (scanPlanTextAnyToUint8) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ p, ok := (dst).(*uint8)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n, err := strconv.ParseUint(string(src), 10, 8)
+ if err != nil {
+ return err
+ }
+
+ *p = uint8(n)
+ return nil
+}
+
+type scanPlanTextAnyToInt16 struct{}
+
+func (scanPlanTextAnyToInt16) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ p, ok := (dst).(*int16)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n, err := strconv.ParseInt(string(src), 10, 16)
+ if err != nil {
+ return err
+ }
+
+ *p = int16(n)
+ return nil
+}
+
+type scanPlanTextAnyToUint16 struct{}
+
+func (scanPlanTextAnyToUint16) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ p, ok := (dst).(*uint16)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n, err := strconv.ParseUint(string(src), 10, 16)
+ if err != nil {
+ return err
+ }
+
+ *p = uint16(n)
+ return nil
+}
+
+type scanPlanTextAnyToInt32 struct{}
+
+func (scanPlanTextAnyToInt32) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ p, ok := (dst).(*int32)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n, err := strconv.ParseInt(string(src), 10, 32)
+ if err != nil {
+ return err
+ }
+
+ *p = int32(n)
+ return nil
+}
+
+type scanPlanTextAnyToUint32 struct{}
+
+func (scanPlanTextAnyToUint32) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ p, ok := (dst).(*uint32)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n, err := strconv.ParseUint(string(src), 10, 32)
+ if err != nil {
+ return err
+ }
+
+ *p = uint32(n)
+ return nil
+}
+
+type scanPlanTextAnyToInt64 struct{}
+
+func (scanPlanTextAnyToInt64) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ p, ok := (dst).(*int64)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n, err := strconv.ParseInt(string(src), 10, 64)
+ if err != nil {
+ return err
+ }
+
+ *p = int64(n)
+ return nil
+}
+
+type scanPlanTextAnyToUint64 struct{}
+
+func (scanPlanTextAnyToUint64) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ p, ok := (dst).(*uint64)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n, err := strconv.ParseUint(string(src), 10, 64)
+ if err != nil {
+ return err
+ }
+
+ *p = uint64(n)
+ return nil
+}
+
+type scanPlanTextAnyToInt struct{}
+
+func (scanPlanTextAnyToInt) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ p, ok := (dst).(*int)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n, err := strconv.ParseInt(string(src), 10, 0)
+ if err != nil {
+ return err
+ }
+
+ *p = int(n)
+ return nil
+}
+
+type scanPlanTextAnyToUint struct{}
+
+func (scanPlanTextAnyToUint) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ p, ok := (dst).(*uint)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n, err := strconv.ParseUint(string(src), 10, 0)
+ if err != nil {
+ return err
+ }
+
+ *p = uint(n)
+ return nil
+}
+
+type scanPlanTextAnyToInt64Scanner struct{}
+
+func (scanPlanTextAnyToInt64Scanner) Scan(src []byte, dst any) error {
+ s, ok := (dst).(Int64Scanner)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ if src == nil {
+ return s.ScanInt64(Int8{})
+ }
+
+ n, err := strconv.ParseInt(string(src), 10, 64)
+ if err != nil {
+ return err
+ }
+
+ err = s.ScanInt64(Int8{Int64: n, Valid: true})
+ if err != nil {
+ return err
+ }
+
+ return nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/int.go.erb b/vendor/github.com/jackc/pgx/v5/pgtype/int.go.erb
new file mode 100644
index 0000000..e0c8b7a
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/int.go.erb
@@ -0,0 +1,548 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "encoding/json"
+ "fmt"
+ "math"
+ "strconv"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+type Int64Scanner interface {
+ ScanInt64(Int8) error
+}
+
+type Int64Valuer interface {
+ Int64Value() (Int8, error)
+}
+
+
+<% [2, 4, 8].each do |pg_byte_size| %>
+<% pg_bit_size = pg_byte_size * 8 %>
+type Int<%= pg_byte_size %> struct {
+ Int<%= pg_bit_size %> int<%= pg_bit_size %>
+ Valid bool
+}
+
+// ScanInt64 implements the Int64Scanner interface.
+func (dst *Int<%= pg_byte_size %>) ScanInt64(n Int8) error {
+ if !n.Valid {
+ *dst = Int<%= pg_byte_size %>{}
+ return nil
+ }
+
+ if n.Int64 < math.MinInt<%= pg_bit_size %> {
+ return fmt.Errorf("%d is less than minimum value for Int<%= pg_byte_size %>", n.Int64)
+ }
+ if n.Int64 > math.MaxInt<%= pg_bit_size %> {
+ return fmt.Errorf("%d is greater than maximum value for Int<%= pg_byte_size %>", n.Int64)
+ }
+ *dst = Int<%= pg_byte_size %>{Int<%= pg_bit_size %>: int<%= pg_bit_size %>(n.Int64), Valid: true}
+
+ return nil
+}
+
+func (n Int<%= pg_byte_size %>) Int64Value() (Int8, error) {
+ return Int8{Int64: int64(n.Int<%= pg_bit_size %>), Valid: n.Valid}, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (dst *Int<%= pg_byte_size %>) Scan(src any) error {
+ if src == nil {
+ *dst = Int<%= pg_byte_size %>{}
+ return nil
+ }
+
+ var n int64
+
+ switch src := src.(type) {
+ case int64:
+ n = src
+ case string:
+ var err error
+ n, err = strconv.ParseInt(src, 10, <%= pg_bit_size %>)
+ if err != nil {
+ return err
+ }
+ case []byte:
+ var err error
+ n, err = strconv.ParseInt(string(src), 10, <%= pg_bit_size %>)
+ if err != nil {
+ return err
+ }
+ default:
+ return fmt.Errorf("cannot scan %T", src)
+ }
+
+ if n < math.MinInt<%= pg_bit_size %> {
+ return fmt.Errorf("%d is greater than maximum value for Int<%= pg_byte_size %>", n)
+ }
+ if n > math.MaxInt<%= pg_bit_size %> {
+ return fmt.Errorf("%d is greater than maximum value for Int<%= pg_byte_size %>", n)
+ }
+ *dst = Int<%= pg_byte_size %>{Int<%= pg_bit_size %>: int<%= pg_bit_size %>(n), Valid: true}
+
+ return nil
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (src Int<%= pg_byte_size %>) Value() (driver.Value, error) {
+ if !src.Valid {
+ return nil, nil
+ }
+ return int64(src.Int<%= pg_bit_size %>), nil
+}
+
+func (src Int<%= pg_byte_size %>) MarshalJSON() ([]byte, error) {
+ if !src.Valid {
+ return []byte("null"), nil
+ }
+ return []byte(strconv.FormatInt(int64(src.Int<%= pg_bit_size %>), 10)), nil
+}
+
+func (dst *Int<%= pg_byte_size %>) UnmarshalJSON(b []byte) error {
+ var n *int<%= pg_bit_size %>
+ err := json.Unmarshal(b, &n)
+ if err != nil {
+ return err
+ }
+
+ if n == nil {
+ *dst = Int<%= pg_byte_size %>{}
+ } else {
+ *dst = Int<%= pg_byte_size %>{Int<%= pg_bit_size %>: *n, Valid: true}
+ }
+
+ return nil
+}
+
+type Int<%= pg_byte_size %>Codec struct{}
+
+func (Int<%= pg_byte_size %>Codec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (Int<%= pg_byte_size %>Codec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (Int<%= pg_byte_size %>Codec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ switch format {
+ case BinaryFormatCode:
+ switch value.(type) {
+ case int<%= pg_bit_size %>:
+ return encodePlanInt<%= pg_byte_size %>CodecBinaryInt<%= pg_bit_size %>{}
+ case Int64Valuer:
+ return encodePlanInt<%= pg_byte_size %>CodecBinaryInt64Valuer{}
+ }
+ case TextFormatCode:
+ switch value.(type) {
+ case int<%= pg_bit_size %>:
+ return encodePlanInt<%= pg_byte_size %>CodecTextInt<%= pg_bit_size %>{}
+ case Int64Valuer:
+ return encodePlanInt<%= pg_byte_size %>CodecTextInt64Valuer{}
+ }
+ }
+
+ return nil
+}
+
+type encodePlanInt<%= pg_byte_size %>CodecBinaryInt<%= pg_bit_size %> struct{}
+
+func (encodePlanInt<%= pg_byte_size %>CodecBinaryInt<%= pg_bit_size %>) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n := value.(int<%= pg_bit_size %>)
+ return pgio.AppendInt<%= pg_bit_size %>(buf, int<%= pg_bit_size %>(n)), nil
+}
+
+type encodePlanInt<%= pg_byte_size %>CodecTextInt<%= pg_bit_size %> struct{}
+
+func (encodePlanInt<%= pg_byte_size %>CodecTextInt<%= pg_bit_size %>) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n := value.(int<%= pg_bit_size %>)
+ return append(buf, strconv.FormatInt(int64(n), 10)...), nil
+}
+
+type encodePlanInt<%= pg_byte_size %>CodecBinaryInt64Valuer struct{}
+
+func (encodePlanInt<%= pg_byte_size %>CodecBinaryInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n, err := value.(Int64Valuer).Int64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !n.Valid {
+ return nil, nil
+ }
+
+ if n.Int64 > math.MaxInt<%= pg_bit_size %> {
+ return nil, fmt.Errorf("%d is greater than maximum value for int<%= pg_byte_size %>", n.Int64)
+ }
+ if n.Int64 < math.MinInt<%= pg_bit_size %> {
+ return nil, fmt.Errorf("%d is less than minimum value for int<%= pg_byte_size %>", n.Int64)
+ }
+
+ return pgio.AppendInt<%= pg_bit_size %>(buf, int<%= pg_bit_size %>(n.Int64)), nil
+}
+
+type encodePlanInt<%= pg_byte_size %>CodecTextInt64Valuer struct{}
+
+func (encodePlanInt<%= pg_byte_size %>CodecTextInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n, err := value.(Int64Valuer).Int64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !n.Valid {
+ return nil, nil
+ }
+
+ if n.Int64 > math.MaxInt<%= pg_bit_size %> {
+ return nil, fmt.Errorf("%d is greater than maximum value for int<%= pg_byte_size %>", n.Int64)
+ }
+ if n.Int64 < math.MinInt<%= pg_bit_size %> {
+ return nil, fmt.Errorf("%d is less than minimum value for int<%= pg_byte_size %>", n.Int64)
+ }
+
+ return append(buf, strconv.FormatInt(n.Int64, 10)...), nil
+}
+
+func (Int<%= pg_byte_size %>Codec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case *int8:
+ return scanPlanBinaryInt<%= pg_byte_size %>ToInt8{}
+ case *int16:
+ return scanPlanBinaryInt<%= pg_byte_size %>ToInt16{}
+ case *int32:
+ return scanPlanBinaryInt<%= pg_byte_size %>ToInt32{}
+ case *int64:
+ return scanPlanBinaryInt<%= pg_byte_size %>ToInt64{}
+ case *int:
+ return scanPlanBinaryInt<%= pg_byte_size %>ToInt{}
+ case *uint8:
+ return scanPlanBinaryInt<%= pg_byte_size %>ToUint8{}
+ case *uint16:
+ return scanPlanBinaryInt<%= pg_byte_size %>ToUint16{}
+ case *uint32:
+ return scanPlanBinaryInt<%= pg_byte_size %>ToUint32{}
+ case *uint64:
+ return scanPlanBinaryInt<%= pg_byte_size %>ToUint64{}
+ case *uint:
+ return scanPlanBinaryInt<%= pg_byte_size %>ToUint{}
+ case Int64Scanner:
+ return scanPlanBinaryInt<%= pg_byte_size %>ToInt64Scanner{}
+ case TextScanner:
+ return scanPlanBinaryInt<%= pg_byte_size %>ToTextScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case *int8:
+ return scanPlanTextAnyToInt8{}
+ case *int16:
+ return scanPlanTextAnyToInt16{}
+ case *int32:
+ return scanPlanTextAnyToInt32{}
+ case *int64:
+ return scanPlanTextAnyToInt64{}
+ case *int:
+ return scanPlanTextAnyToInt{}
+ case *uint8:
+ return scanPlanTextAnyToUint8{}
+ case *uint16:
+ return scanPlanTextAnyToUint16{}
+ case *uint32:
+ return scanPlanTextAnyToUint32{}
+ case *uint64:
+ return scanPlanTextAnyToUint64{}
+ case *uint:
+ return scanPlanTextAnyToUint{}
+ case Int64Scanner:
+ return scanPlanTextAnyToInt64Scanner{}
+ }
+ }
+
+ return nil
+}
+
+func (c Int<%= pg_byte_size %>Codec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var n int64
+ err := codecScan(c, m, oid, format, src, &n)
+ if err != nil {
+ return nil, err
+ }
+ return n, nil
+}
+
+func (c Int<%= pg_byte_size %>Codec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var n int<%= pg_bit_size %>
+ err := codecScan(c, m, oid, format, src, &n)
+ if err != nil {
+ return nil, err
+ }
+ return n, nil
+}
+
+<%# PostgreSQL binary format integer to fixed size Go integers %>
+<% [8, 16, 32, 64].each do |dst_bit_size| %>
+type scanPlanBinaryInt<%= pg_byte_size %>ToInt<%= dst_bit_size %> struct{}
+
+func (scanPlanBinaryInt<%= pg_byte_size %>ToInt<%= dst_bit_size %>) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != <%= pg_byte_size %> {
+ return fmt.Errorf("invalid length for int<%= pg_byte_size %>: %v", len(src))
+ }
+
+ p, ok := (dst).(*int<%= dst_bit_size %>)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ <% if dst_bit_size < pg_bit_size %>
+ n := int<%= pg_bit_size %>(binary.BigEndian.Uint<%= pg_bit_size %>(src))
+ if n < math.MinInt<%= dst_bit_size %> {
+ return fmt.Errorf("%d is less than minimum value for int<%= dst_bit_size %>", n)
+ } else if n > math.MaxInt<%= dst_bit_size %> {
+ return fmt.Errorf("%d is greater than maximum value for int<%= dst_bit_size %>", n)
+ }
+
+ *p = int<%= dst_bit_size %>(n)
+ <% elsif dst_bit_size == pg_bit_size %>
+ *p = int<%= dst_bit_size %>(binary.BigEndian.Uint<%= pg_bit_size %>(src))
+ <% else %>
+ *p = int<%= dst_bit_size %>(int<%= pg_bit_size %>(binary.BigEndian.Uint<%= pg_bit_size %>(src)))
+ <% end %>
+
+ return nil
+}
+
+type scanPlanBinaryInt<%= pg_byte_size %>ToUint<%= dst_bit_size %> struct{}
+
+func (scanPlanBinaryInt<%= pg_byte_size %>ToUint<%= dst_bit_size %>) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != <%= pg_byte_size %> {
+ return fmt.Errorf("invalid length for uint<%= pg_byte_size %>: %v", len(src))
+ }
+
+ p, ok := (dst).(*uint<%= dst_bit_size %>)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int<%= pg_bit_size %>(binary.BigEndian.Uint<%= pg_bit_size %>(src))
+ if n < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint<%= dst_bit_size %>", n)
+ }
+ <% if dst_bit_size < pg_bit_size %>
+ if n > math.MaxUint<%= dst_bit_size %> {
+ return fmt.Errorf("%d is greater than maximum value for uint<%= dst_bit_size %>", n)
+ }
+ <% end %>
+ *p = uint<%= dst_bit_size %>(n)
+
+ return nil
+}
+<% end %>
+
+<%# PostgreSQL binary format integer to Go machine integers %>
+type scanPlanBinaryInt<%= pg_byte_size %>ToInt struct{}
+
+func (scanPlanBinaryInt<%= pg_byte_size %>ToInt) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != <%= pg_byte_size %> {
+ return fmt.Errorf("invalid length for int<%= pg_byte_size %>: %v", len(src))
+ }
+
+ p, ok := (dst).(*int)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ <% if 32 < pg_bit_size %>
+ n := int64(binary.BigEndian.Uint<%= pg_bit_size %>(src))
+ if n < math.MinInt {
+ return fmt.Errorf("%d is less than minimum value for int", n)
+ } else if n > math.MaxInt {
+ return fmt.Errorf("%d is greater than maximum value for int", n)
+ }
+
+ *p = int(n)
+ <% else %>
+ *p = int(int<%= pg_bit_size %>(binary.BigEndian.Uint<%= pg_bit_size %>(src)))
+ <% end %>
+
+ return nil
+}
+
+type scanPlanBinaryInt<%= pg_byte_size %>ToUint struct{}
+
+func (scanPlanBinaryInt<%= pg_byte_size %>ToUint) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != <%= pg_byte_size %> {
+ return fmt.Errorf("invalid length for uint<%= pg_byte_size %>: %v", len(src))
+ }
+
+ p, ok := (dst).(*uint)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n := int64(int<%= pg_bit_size %>(binary.BigEndian.Uint<%= pg_bit_size %>(src)))
+ if n < 0 {
+ return fmt.Errorf("%d is less than minimum value for uint", n)
+ }
+ <% if 32 < pg_bit_size %>
+ if uint64(n) > math.MaxUint {
+ return fmt.Errorf("%d is greater than maximum value for uint", n)
+ }
+ <% end %>
+ *p = uint(n)
+
+ return nil
+}
+
+<%# PostgreSQL binary format integer to Go Int64Scanner %>
+type scanPlanBinaryInt<%= pg_byte_size %>ToInt64Scanner struct{}
+
+func (scanPlanBinaryInt<%= pg_byte_size %>ToInt64Scanner) Scan(src []byte, dst any) error {
+ s, ok := (dst).(Int64Scanner)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ if src == nil {
+ return s.ScanInt64(Int8{})
+ }
+
+ if len(src) != <%= pg_byte_size %> {
+ return fmt.Errorf("invalid length for int<%= pg_byte_size %>: %v", len(src))
+ }
+
+
+ n := int64(int<%= pg_bit_size %>(binary.BigEndian.Uint<%= pg_bit_size %>(src)))
+
+ return s.ScanInt64(Int8{Int64: n, Valid: true})
+}
+
+<%# PostgreSQL binary format integer to Go TextScanner %>
+type scanPlanBinaryInt<%= pg_byte_size %>ToTextScanner struct{}
+
+func (scanPlanBinaryInt<%= pg_byte_size %>ToTextScanner) Scan(src []byte, dst any) error {
+ s, ok := (dst).(TextScanner)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ if src == nil {
+ return s.ScanText(Text{})
+ }
+
+ if len(src) != <%= pg_byte_size %> {
+ return fmt.Errorf("invalid length for int<%= pg_byte_size %>: %v", len(src))
+ }
+
+
+ n := int64(int<%= pg_bit_size %>(binary.BigEndian.Uint<%= pg_bit_size %>(src)))
+
+ return s.ScanText(Text{String: strconv.FormatInt(n, 10), Valid: true})
+}
+<% end %>
+
+<%# Any text to all integer types %>
+<% [
+ ["8", 8],
+ ["16", 16],
+ ["32", 32],
+ ["64", 64],
+ ["", 0]
+].each do |type_suffix, bit_size| %>
+type scanPlanTextAnyToInt<%= type_suffix %> struct{}
+
+func (scanPlanTextAnyToInt<%= type_suffix %>) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ p, ok := (dst).(*int<%= type_suffix %>)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n, err := strconv.ParseInt(string(src), 10, <%= bit_size %>)
+ if err != nil {
+ return err
+ }
+
+ *p = int<%= type_suffix %>(n)
+ return nil
+}
+
+type scanPlanTextAnyToUint<%= type_suffix %> struct{}
+
+func (scanPlanTextAnyToUint<%= type_suffix %>) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ p, ok := (dst).(*uint<%= type_suffix %>)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ n, err := strconv.ParseUint(string(src), 10, <%= bit_size %>)
+ if err != nil {
+ return err
+ }
+
+ *p = uint<%= type_suffix %>(n)
+ return nil
+}
+<% end %>
+
+type scanPlanTextAnyToInt64Scanner struct{}
+
+func (scanPlanTextAnyToInt64Scanner) Scan(src []byte, dst any) error {
+ s, ok := (dst).(Int64Scanner)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ if src == nil {
+ return s.ScanInt64(Int8{})
+ }
+
+ n, err := strconv.ParseInt(string(src), 10, 64)
+ if err != nil {
+ return err
+ }
+
+ err = s.ScanInt64(Int8{Int64: n, Valid: true})
+ if err != nil {
+ return err
+ }
+
+ return nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/int_test.go.erb b/vendor/github.com/jackc/pgx/v5/pgtype/int_test.go.erb
new file mode 100644
index 0000000..ac9a3f1
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/int_test.go.erb
@@ -0,0 +1,93 @@
+package pgtype_test
+
+import (
+ "math"
+ "testing"
+
+ "github.com/jackc/pgx/v5/pgtype"
+)
+
+<% [2, 4, 8].each do |pg_byte_size| %>
+<% pg_bit_size = pg_byte_size * 8 %>
+func TestInt<%= pg_byte_size %>Codec(t *testing.T) {
+ pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "int<%= pg_byte_size %>", []pgxtest.ValueRoundTripTest{
+ {int8(1), new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))},
+ {int16(1), new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))},
+ {int32(1), new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))},
+ {int64(1), new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))},
+ {uint8(1), new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))},
+ {uint16(1), new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))},
+ {uint32(1), new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))},
+ {uint64(1), new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))},
+ {int(1), new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))},
+ {uint(1), new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))},
+ {pgtype.Int<%= pg_byte_size %>{Int<%= pg_bit_size %>: 1, Valid: true}, new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))},
+ {int32(-1), new(pgtype.Int<%= pg_byte_size %>), isExpectedEq(pgtype.Int<%= pg_byte_size %>{Int<%= pg_bit_size %>: -1, Valid: true})},
+ {1, new(int8), isExpectedEq(int8(1))},
+ {1, new(int16), isExpectedEq(int16(1))},
+ {1, new(int32), isExpectedEq(int32(1))},
+ {1, new(int64), isExpectedEq(int64(1))},
+ {1, new(uint8), isExpectedEq(uint8(1))},
+ {1, new(uint16), isExpectedEq(uint16(1))},
+ {1, new(uint32), isExpectedEq(uint32(1))},
+ {1, new(uint64), isExpectedEq(uint64(1))},
+ {1, new(int), isExpectedEq(int(1))},
+ {1, new(uint), isExpectedEq(uint(1))},
+ {-1, new(int8), isExpectedEq(int8(-1))},
+ {-1, new(int16), isExpectedEq(int16(-1))},
+ {-1, new(int32), isExpectedEq(int32(-1))},
+ {-1, new(int64), isExpectedEq(int64(-1))},
+ {-1, new(int), isExpectedEq(int(-1))},
+ {math.MinInt<%= pg_bit_size %>, new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(math.MinInt<%= pg_bit_size %>))},
+ {-1, new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(-1))},
+ {0, new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(0))},
+ {1, new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))},
+ {math.MaxInt<%= pg_bit_size %>, new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(math.MaxInt<%= pg_bit_size %>))},
+ {1, new(pgtype.Int<%= pg_byte_size %>), isExpectedEq(pgtype.Int<%= pg_byte_size %>{Int<%= pg_bit_size %>: 1, Valid: true})},
+ {"1", new(string), isExpectedEq("1")},
+ {pgtype.Int<%= pg_byte_size %>{}, new(pgtype.Int<%= pg_byte_size %>), isExpectedEq(pgtype.Int<%= pg_byte_size %>{})},
+ {nil, new(*int<%= pg_bit_size %>), isExpectedEq((*int<%= pg_bit_size %>)(nil))},
+ })
+}
+
+func TestInt<%= pg_byte_size %>MarshalJSON(t *testing.T) {
+ successfulTests := []struct {
+ source pgtype.Int<%= pg_byte_size %>
+ result string
+ }{
+ {source: pgtype.Int<%= pg_byte_size %>{Int<%= pg_bit_size %>: 0}, result: "null"},
+ {source: pgtype.Int<%= pg_byte_size %>{Int<%= pg_bit_size %>: 1, Valid: true}, result: "1"},
+ }
+ for i, tt := range successfulTests {
+ r, err := tt.source.MarshalJSON()
+ if err != nil {
+ t.Errorf("%d: %v", i, err)
+ }
+
+ if string(r) != tt.result {
+ t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, string(r))
+ }
+ }
+}
+
+func TestInt<%= pg_byte_size %>UnmarshalJSON(t *testing.T) {
+ successfulTests := []struct {
+ source string
+ result pgtype.Int<%= pg_byte_size %>
+ }{
+ {source: "null", result: pgtype.Int<%= pg_byte_size %>{Int<%= pg_bit_size %>: 0}},
+ {source: "1", result: pgtype.Int<%= pg_byte_size %>{Int<%= pg_bit_size %>: 1, Valid: true}},
+ }
+ for i, tt := range successfulTests {
+ var r pgtype.Int<%= pg_byte_size %>
+ err := r.UnmarshalJSON([]byte(tt.source))
+ if err != nil {
+ t.Errorf("%d: %v", i, err)
+ }
+
+ if r != tt.result {
+ t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, r)
+ }
+ }
+}
+<% end %>
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/integration_benchmark_test.go.erb b/vendor/github.com/jackc/pgx/v5/pgtype/integration_benchmark_test.go.erb
new file mode 100644
index 0000000..6f40115
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/integration_benchmark_test.go.erb
@@ -0,0 +1,62 @@
+package pgtype_test
+
+import (
+ "context"
+ "testing"
+
+ "github.com/jackc/pgx/v5/pgtype/testutil"
+ "github.com/jackc/pgx/v5"
+)
+
+<%
+ [
+ ["int4", ["int16", "int32", "int64", "uint64", "pgtype.Int4"], [[1, 1], [1, 10], [10, 1], [100, 10]]],
+ ["numeric", ["int64", "float64", "pgtype.Numeric"], [[1, 1], [1, 10], [10, 1], [100, 10]]],
+ ].each do |pg_type, go_types, rows_columns|
+%>
+<% go_types.each do |go_type| %>
+<% rows_columns.each do |rows, columns| %>
+<% [["Text", "pgx.TextFormatCode"], ["Binary", "pgx.BinaryFormatCode"]].each do |format_name, format_code| %>
+func BenchmarkQuery<%= format_name %>FormatDecode_PG_<%= pg_type %>_to_Go_<%= go_type.gsub(/\W/, "_") %>_<%= rows %>_rows_<%= columns %>_columns(b *testing.B) {
+ defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) {
+ b.ResetTimer()
+ var v [<%= columns %>]<%= go_type %>
+ for i := 0; i < b.N; i++ {
+ rows, _ := conn.Query(
+ ctx,
+ `select <% columns.times do |col_idx| %><% if col_idx != 0 %>, <% end %>n::<%= pg_type %> + <%= col_idx%><% end %> from generate_series(1, <%= rows %>) n`,
+ pgx.QueryResultFormats{<%= format_code %>},
+ )
+ _, err := pgx.ForEachRow(rows, []any{<% columns.times do |col_idx| %><% if col_idx != 0 %>, <% end %>&v[<%= col_idx%>]<% end %>}, func() error { return nil })
+ if err != nil {
+ b.Fatal(err)
+ }
+ }
+ })
+}
+<% end %>
+<% end %>
+<% end %>
+<% end %>
+
+<% [10, 100, 1000].each do |array_size| %>
+<% [["Text", "pgx.TextFormatCode"], ["Binary", "pgx.BinaryFormatCode"]].each do |format_name, format_code| %>
+func BenchmarkQuery<%= format_name %>FormatDecode_PG_Int4Array_With_Go_Int4Array_<%= array_size %>(b *testing.B) {
+ defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) {
+ b.ResetTimer()
+ var v []int32
+ for i := 0; i < b.N; i++ {
+ rows, _ := conn.Query(
+ ctx,
+ `select array_agg(n) from generate_series(1, <%= array_size %>) n`,
+ pgx.QueryResultFormats{<%= format_code %>},
+ )
+ _, err := pgx.ForEachRow(rows, []any{&v}, func() error { return nil })
+ if err != nil {
+ b.Fatal(err)
+ }
+ }
+ })
+}
+<% end %>
+<% end %>
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/integration_benchmark_test_gen.sh b/vendor/github.com/jackc/pgx/v5/pgtype/integration_benchmark_test_gen.sh
new file mode 100644
index 0000000..22ac01a
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/integration_benchmark_test_gen.sh
@@ -0,0 +1,2 @@
+erb integration_benchmark_test.go.erb > integration_benchmark_test.go
+goimports -w integration_benchmark_test.go
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/interval.go b/vendor/github.com/jackc/pgx/v5/pgtype/interval.go
new file mode 100644
index 0000000..4b51162
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/interval.go
@@ -0,0 +1,297 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "fmt"
+ "strconv"
+ "strings"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+const (
+ microsecondsPerSecond = 1000000
+ microsecondsPerMinute = 60 * microsecondsPerSecond
+ microsecondsPerHour = 60 * microsecondsPerMinute
+ microsecondsPerDay = 24 * microsecondsPerHour
+ microsecondsPerMonth = 30 * microsecondsPerDay
+)
+
+type IntervalScanner interface {
+ ScanInterval(v Interval) error
+}
+
+type IntervalValuer interface {
+ IntervalValue() (Interval, error)
+}
+
+type Interval struct {
+ Microseconds int64
+ Days int32
+ Months int32
+ Valid bool
+}
+
+func (interval *Interval) ScanInterval(v Interval) error {
+ *interval = v
+ return nil
+}
+
+func (interval Interval) IntervalValue() (Interval, error) {
+ return interval, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (interval *Interval) Scan(src any) error {
+ if src == nil {
+ *interval = Interval{}
+ return nil
+ }
+
+ switch src := src.(type) {
+ case string:
+ return scanPlanTextAnyToIntervalScanner{}.Scan([]byte(src), interval)
+ }
+
+ return fmt.Errorf("cannot scan %T", src)
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (interval Interval) Value() (driver.Value, error) {
+ if !interval.Valid {
+ return nil, nil
+ }
+
+ buf, err := IntervalCodec{}.PlanEncode(nil, 0, TextFormatCode, interval).Encode(interval, nil)
+ if err != nil {
+ return nil, err
+ }
+ return string(buf), err
+}
+
+type IntervalCodec struct{}
+
+func (IntervalCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (IntervalCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (IntervalCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ if _, ok := value.(IntervalValuer); !ok {
+ return nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ return encodePlanIntervalCodecBinary{}
+ case TextFormatCode:
+ return encodePlanIntervalCodecText{}
+ }
+
+ return nil
+}
+
+type encodePlanIntervalCodecBinary struct{}
+
+func (encodePlanIntervalCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ interval, err := value.(IntervalValuer).IntervalValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !interval.Valid {
+ return nil, nil
+ }
+
+ buf = pgio.AppendInt64(buf, interval.Microseconds)
+ buf = pgio.AppendInt32(buf, interval.Days)
+ buf = pgio.AppendInt32(buf, interval.Months)
+ return buf, nil
+}
+
+type encodePlanIntervalCodecText struct{}
+
+func (encodePlanIntervalCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ interval, err := value.(IntervalValuer).IntervalValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !interval.Valid {
+ return nil, nil
+ }
+
+ if interval.Months != 0 {
+ buf = append(buf, strconv.FormatInt(int64(interval.Months), 10)...)
+ buf = append(buf, " mon "...)
+ }
+
+ if interval.Days != 0 {
+ buf = append(buf, strconv.FormatInt(int64(interval.Days), 10)...)
+ buf = append(buf, " day "...)
+ }
+
+ absMicroseconds := interval.Microseconds
+ if absMicroseconds < 0 {
+ absMicroseconds = -absMicroseconds
+ buf = append(buf, '-')
+ }
+
+ hours := absMicroseconds / microsecondsPerHour
+ minutes := (absMicroseconds % microsecondsPerHour) / microsecondsPerMinute
+ seconds := (absMicroseconds % microsecondsPerMinute) / microsecondsPerSecond
+
+ timeStr := fmt.Sprintf("%02d:%02d:%02d", hours, minutes, seconds)
+ buf = append(buf, timeStr...)
+
+ microseconds := absMicroseconds % microsecondsPerSecond
+ if microseconds != 0 {
+ buf = append(buf, fmt.Sprintf(".%06d", microseconds)...)
+ }
+
+ return buf, nil
+}
+
+func (IntervalCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case IntervalScanner:
+ return scanPlanBinaryIntervalToIntervalScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case IntervalScanner:
+ return scanPlanTextAnyToIntervalScanner{}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryIntervalToIntervalScanner struct{}
+
+func (scanPlanBinaryIntervalToIntervalScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(IntervalScanner)
+
+ if src == nil {
+ return scanner.ScanInterval(Interval{})
+ }
+
+ if len(src) != 16 {
+ return fmt.Errorf("Received an invalid size for an interval: %d", len(src))
+ }
+
+ microseconds := int64(binary.BigEndian.Uint64(src))
+ days := int32(binary.BigEndian.Uint32(src[8:]))
+ months := int32(binary.BigEndian.Uint32(src[12:]))
+
+ return scanner.ScanInterval(Interval{Microseconds: microseconds, Days: days, Months: months, Valid: true})
+}
+
+type scanPlanTextAnyToIntervalScanner struct{}
+
+func (scanPlanTextAnyToIntervalScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(IntervalScanner)
+
+ if src == nil {
+ return scanner.ScanInterval(Interval{})
+ }
+
+ var microseconds int64
+ var days int32
+ var months int32
+
+ parts := strings.Split(string(src), " ")
+
+ for i := 0; i < len(parts)-1; i += 2 {
+ scalar, err := strconv.ParseInt(parts[i], 10, 64)
+ if err != nil {
+ return fmt.Errorf("bad interval format")
+ }
+
+ switch parts[i+1] {
+ case "year", "years":
+ months += int32(scalar * 12)
+ case "mon", "mons":
+ months += int32(scalar)
+ case "day", "days":
+ days = int32(scalar)
+ }
+ }
+
+ if len(parts)%2 == 1 {
+ timeParts := strings.SplitN(parts[len(parts)-1], ":", 3)
+ if len(timeParts) != 3 {
+ return fmt.Errorf("bad interval format")
+ }
+
+ var negative bool
+ if timeParts[0][0] == '-' {
+ negative = true
+ timeParts[0] = timeParts[0][1:]
+ }
+
+ hours, err := strconv.ParseInt(timeParts[0], 10, 64)
+ if err != nil {
+ return fmt.Errorf("bad interval hour format: %s", timeParts[0])
+ }
+
+ minutes, err := strconv.ParseInt(timeParts[1], 10, 64)
+ if err != nil {
+ return fmt.Errorf("bad interval minute format: %s", timeParts[1])
+ }
+
+ sec, secFrac, secFracFound := strings.Cut(timeParts[2], ".")
+
+ seconds, err := strconv.ParseInt(sec, 10, 64)
+ if err != nil {
+ return fmt.Errorf("bad interval second format: %s", sec)
+ }
+
+ var uSeconds int64
+ if secFracFound {
+ uSeconds, err = strconv.ParseInt(secFrac, 10, 64)
+ if err != nil {
+ return fmt.Errorf("bad interval decimal format: %s", secFrac)
+ }
+
+ for i := 0; i < 6-len(secFrac); i++ {
+ uSeconds *= 10
+ }
+ }
+
+ microseconds = hours * microsecondsPerHour
+ microseconds += minutes * microsecondsPerMinute
+ microseconds += seconds * microsecondsPerSecond
+ microseconds += uSeconds
+
+ if negative {
+ microseconds = -microseconds
+ }
+ }
+
+ return scanner.ScanInterval(Interval{Months: months, Days: days, Microseconds: microseconds, Valid: true})
+}
+
+func (c IntervalCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ return codecDecodeToTextFormat(c, m, oid, format, src)
+}
+
+func (c IntervalCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var interval Interval
+ err := codecScan(c, m, oid, format, src, &interval)
+ if err != nil {
+ return nil, err
+ }
+ return interval, nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/json.go b/vendor/github.com/jackc/pgx/v5/pgtype/json.go
new file mode 100644
index 0000000..48b9f97
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/json.go
@@ -0,0 +1,239 @@
+package pgtype
+
+import (
+ "database/sql"
+ "database/sql/driver"
+ "encoding/json"
+ "fmt"
+ "reflect"
+)
+
+type JSONCodec struct {
+ Marshal func(v any) ([]byte, error)
+ Unmarshal func(data []byte, v any) error
+}
+
+func (*JSONCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (*JSONCodec) PreferredFormat() int16 {
+ return TextFormatCode
+}
+
+func (c *JSONCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ switch value.(type) {
+ case string:
+ return encodePlanJSONCodecEitherFormatString{}
+ case []byte:
+ return encodePlanJSONCodecEitherFormatByteSlice{}
+
+ // Handle json.RawMessage specifically because if it is run through json.Marshal it may be mutated.
+ // e.g. `{"foo": "bar"}` -> `{"foo":"bar"}`.
+ case json.RawMessage:
+ return encodePlanJSONCodecEitherFormatJSONRawMessage{}
+
+ // Cannot rely on driver.Valuer being handled later because anything can be marshalled.
+ //
+ // https://github.com/jackc/pgx/issues/1430
+ //
+ // Check for driver.Valuer must come before json.Marshaler so that it is guaranteed to be used
+ // when both are implemented https://github.com/jackc/pgx/issues/1805
+ case driver.Valuer:
+ return &encodePlanDriverValuer{m: m, oid: oid, formatCode: format}
+
+ // Must come before trying wrap encode plans because a pointer to a struct may be unwrapped to a struct that can be
+ // marshalled.
+ //
+ // https://github.com/jackc/pgx/issues/1681
+ case json.Marshaler:
+ return &encodePlanJSONCodecEitherFormatMarshal{
+ marshal: c.Marshal,
+ }
+ }
+
+ // Because anything can be marshalled the normal wrapping in Map.PlanScan doesn't get a chance to run. So try the
+ // appropriate wrappers here.
+ for _, f := range []TryWrapEncodePlanFunc{
+ TryWrapDerefPointerEncodePlan,
+ TryWrapFindUnderlyingTypeEncodePlan,
+ } {
+ if wrapperPlan, nextValue, ok := f(value); ok {
+ if nextPlan := c.PlanEncode(m, oid, format, nextValue); nextPlan != nil {
+ wrapperPlan.SetNext(nextPlan)
+ return wrapperPlan
+ }
+ }
+ }
+
+ return &encodePlanJSONCodecEitherFormatMarshal{
+ marshal: c.Marshal,
+ }
+}
+
+type encodePlanJSONCodecEitherFormatString struct{}
+
+func (encodePlanJSONCodecEitherFormatString) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ jsonString := value.(string)
+ buf = append(buf, jsonString...)
+ return buf, nil
+}
+
+type encodePlanJSONCodecEitherFormatByteSlice struct{}
+
+func (encodePlanJSONCodecEitherFormatByteSlice) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ jsonBytes := value.([]byte)
+ if jsonBytes == nil {
+ return nil, nil
+ }
+
+ buf = append(buf, jsonBytes...)
+ return buf, nil
+}
+
+type encodePlanJSONCodecEitherFormatJSONRawMessage struct{}
+
+func (encodePlanJSONCodecEitherFormatJSONRawMessage) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ jsonBytes := value.(json.RawMessage)
+ if jsonBytes == nil {
+ return nil, nil
+ }
+
+ buf = append(buf, jsonBytes...)
+ return buf, nil
+}
+
+type encodePlanJSONCodecEitherFormatMarshal struct {
+ marshal func(v any) ([]byte, error)
+}
+
+func (e *encodePlanJSONCodecEitherFormatMarshal) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ jsonBytes, err := e.marshal(value)
+ if err != nil {
+ return nil, err
+ }
+
+ buf = append(buf, jsonBytes...)
+ return buf, nil
+}
+
+func (c *JSONCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+ switch target.(type) {
+ case *string:
+ return scanPlanAnyToString{}
+
+ case **string:
+ // This is to fix **string scanning. It seems wrong to special case **string, but it's not clear what a better
+ // solution would be.
+ //
+ // https://github.com/jackc/pgx/issues/1470 -- **string
+ // https://github.com/jackc/pgx/issues/1691 -- ** anything else
+
+ if wrapperPlan, nextDst, ok := TryPointerPointerScanPlan(target); ok {
+ if nextPlan := m.planScan(oid, format, nextDst, 0); nextPlan != nil {
+ if _, failed := nextPlan.(*scanPlanFail); !failed {
+ wrapperPlan.SetNext(nextPlan)
+ return wrapperPlan
+ }
+ }
+ }
+
+ case *[]byte:
+ return scanPlanJSONToByteSlice{}
+ case BytesScanner:
+ return scanPlanBinaryBytesToBytesScanner{}
+
+ }
+
+ // Cannot rely on sql.Scanner being handled later because scanPlanJSONToJSONUnmarshal will take precedence.
+ //
+ // https://github.com/jackc/pgx/issues/1418
+ if isSQLScanner(target) {
+ return &scanPlanSQLScanner{formatCode: format}
+ }
+
+ return &scanPlanJSONToJSONUnmarshal{
+ unmarshal: c.Unmarshal,
+ }
+}
+
+// we need to check if the target is a pointer to a sql.Scanner (or any of the pointer ref tree implements a sql.Scanner).
+//
+// https://github.com/jackc/pgx/issues/2146
+func isSQLScanner(v any) bool {
+ val := reflect.ValueOf(v)
+ for val.Kind() == reflect.Ptr {
+ if _, ok := val.Interface().(sql.Scanner); ok {
+ return true
+ }
+ val = val.Elem()
+ }
+ return false
+}
+
+type scanPlanAnyToString struct{}
+
+func (scanPlanAnyToString) Scan(src []byte, dst any) error {
+ p := dst.(*string)
+ *p = string(src)
+ return nil
+}
+
+type scanPlanJSONToByteSlice struct{}
+
+func (scanPlanJSONToByteSlice) Scan(src []byte, dst any) error {
+ dstBuf := dst.(*[]byte)
+ if src == nil {
+ *dstBuf = nil
+ return nil
+ }
+
+ *dstBuf = make([]byte, len(src))
+ copy(*dstBuf, src)
+ return nil
+}
+
+type scanPlanJSONToJSONUnmarshal struct {
+ unmarshal func(data []byte, v any) error
+}
+
+func (s *scanPlanJSONToJSONUnmarshal) Scan(src []byte, dst any) error {
+ if src == nil {
+ dstValue := reflect.ValueOf(dst)
+ if dstValue.Kind() == reflect.Ptr {
+ el := dstValue.Elem()
+ switch el.Kind() {
+ case reflect.Ptr, reflect.Slice, reflect.Map, reflect.Interface:
+ el.Set(reflect.Zero(el.Type()))
+ return nil
+ }
+ }
+
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ elem := reflect.ValueOf(dst).Elem()
+ elem.Set(reflect.Zero(elem.Type()))
+
+ return s.unmarshal(src, dst)
+}
+
+func (c *JSONCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ dstBuf := make([]byte, len(src))
+ copy(dstBuf, src)
+ return dstBuf, nil
+}
+
+func (c *JSONCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var dst any
+ err := c.Unmarshal(src, &dst)
+ return dst, err
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/jsonb.go b/vendor/github.com/jackc/pgx/v5/pgtype/jsonb.go
new file mode 100644
index 0000000..4d4eb58
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/jsonb.go
@@ -0,0 +1,129 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "fmt"
+)
+
+type JSONBCodec struct {
+ Marshal func(v any) ([]byte, error)
+ Unmarshal func(data []byte, v any) error
+}
+
+func (*JSONBCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (*JSONBCodec) PreferredFormat() int16 {
+ return TextFormatCode
+}
+
+func (c *JSONBCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ switch format {
+ case BinaryFormatCode:
+ plan := (&JSONCodec{Marshal: c.Marshal, Unmarshal: c.Unmarshal}).PlanEncode(m, oid, TextFormatCode, value)
+ if plan != nil {
+ return &encodePlanJSONBCodecBinaryWrapper{textPlan: plan}
+ }
+ case TextFormatCode:
+ return (&JSONCodec{Marshal: c.Marshal, Unmarshal: c.Unmarshal}).PlanEncode(m, oid, format, value)
+ }
+
+ return nil
+}
+
+type encodePlanJSONBCodecBinaryWrapper struct {
+ textPlan EncodePlan
+}
+
+func (plan *encodePlanJSONBCodecBinaryWrapper) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ buf = append(buf, 1)
+ return plan.textPlan.Encode(value, buf)
+}
+
+func (c *JSONBCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+ switch format {
+ case BinaryFormatCode:
+ plan := (&JSONCodec{Marshal: c.Marshal, Unmarshal: c.Unmarshal}).PlanScan(m, oid, TextFormatCode, target)
+ if plan != nil {
+ return &scanPlanJSONBCodecBinaryUnwrapper{textPlan: plan}
+ }
+ case TextFormatCode:
+ return (&JSONCodec{Marshal: c.Marshal, Unmarshal: c.Unmarshal}).PlanScan(m, oid, format, target)
+ }
+
+ return nil
+}
+
+type scanPlanJSONBCodecBinaryUnwrapper struct {
+ textPlan ScanPlan
+}
+
+func (plan *scanPlanJSONBCodecBinaryUnwrapper) Scan(src []byte, dst any) error {
+ if src == nil {
+ return plan.textPlan.Scan(src, dst)
+ }
+
+ if len(src) == 0 {
+ return fmt.Errorf("jsonb too short")
+ }
+
+ if src[0] != 1 {
+ return fmt.Errorf("unknown jsonb version number %d", src[0])
+ }
+
+ return plan.textPlan.Scan(src[1:], dst)
+}
+
+func (c *JSONBCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ if len(src) == 0 {
+ return nil, fmt.Errorf("jsonb too short")
+ }
+
+ if src[0] != 1 {
+ return nil, fmt.Errorf("unknown jsonb version number %d", src[0])
+ }
+
+ dstBuf := make([]byte, len(src)-1)
+ copy(dstBuf, src[1:])
+ return dstBuf, nil
+ case TextFormatCode:
+ dstBuf := make([]byte, len(src))
+ copy(dstBuf, src)
+ return dstBuf, nil
+ default:
+ return nil, fmt.Errorf("unknown format code: %v", format)
+ }
+}
+
+func (c *JSONBCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ if len(src) == 0 {
+ return nil, fmt.Errorf("jsonb too short")
+ }
+
+ if src[0] != 1 {
+ return nil, fmt.Errorf("unknown jsonb version number %d", src[0])
+ }
+
+ src = src[1:]
+ case TextFormatCode:
+ default:
+ return nil, fmt.Errorf("unknown format code: %v", format)
+ }
+
+ var dst any
+ err := c.Unmarshal(src, &dst)
+ return dst, err
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/line.go b/vendor/github.com/jackc/pgx/v5/pgtype/line.go
new file mode 100644
index 0000000..4ae8003
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/line.go
@@ -0,0 +1,225 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "fmt"
+ "math"
+ "strconv"
+ "strings"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+type LineScanner interface {
+ ScanLine(v Line) error
+}
+
+type LineValuer interface {
+ LineValue() (Line, error)
+}
+
+type Line struct {
+ A, B, C float64
+ Valid bool
+}
+
+func (line *Line) ScanLine(v Line) error {
+ *line = v
+ return nil
+}
+
+func (line Line) LineValue() (Line, error) {
+ return line, nil
+}
+
+func (line *Line) Set(src any) error {
+ return fmt.Errorf("cannot convert %v to Line", src)
+}
+
+// Scan implements the database/sql Scanner interface.
+func (line *Line) Scan(src any) error {
+ if src == nil {
+ *line = Line{}
+ return nil
+ }
+
+ switch src := src.(type) {
+ case string:
+ return scanPlanTextAnyToLineScanner{}.Scan([]byte(src), line)
+ }
+
+ return fmt.Errorf("cannot scan %T", src)
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (line Line) Value() (driver.Value, error) {
+ if !line.Valid {
+ return nil, nil
+ }
+
+ buf, err := LineCodec{}.PlanEncode(nil, 0, TextFormatCode, line).Encode(line, nil)
+ if err != nil {
+ return nil, err
+ }
+ return string(buf), err
+}
+
+type LineCodec struct{}
+
+func (LineCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (LineCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (LineCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ if _, ok := value.(LineValuer); !ok {
+ return nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ return encodePlanLineCodecBinary{}
+ case TextFormatCode:
+ return encodePlanLineCodecText{}
+ }
+
+ return nil
+}
+
+type encodePlanLineCodecBinary struct{}
+
+func (encodePlanLineCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ line, err := value.(LineValuer).LineValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !line.Valid {
+ return nil, nil
+ }
+
+ buf = pgio.AppendUint64(buf, math.Float64bits(line.A))
+ buf = pgio.AppendUint64(buf, math.Float64bits(line.B))
+ buf = pgio.AppendUint64(buf, math.Float64bits(line.C))
+ return buf, nil
+}
+
+type encodePlanLineCodecText struct{}
+
+func (encodePlanLineCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ line, err := value.(LineValuer).LineValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !line.Valid {
+ return nil, nil
+ }
+
+ buf = append(buf, fmt.Sprintf(`{%s,%s,%s}`,
+ strconv.FormatFloat(line.A, 'f', -1, 64),
+ strconv.FormatFloat(line.B, 'f', -1, 64),
+ strconv.FormatFloat(line.C, 'f', -1, 64),
+ )...)
+ return buf, nil
+}
+
+func (LineCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case LineScanner:
+ return scanPlanBinaryLineToLineScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case LineScanner:
+ return scanPlanTextAnyToLineScanner{}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryLineToLineScanner struct{}
+
+func (scanPlanBinaryLineToLineScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(LineScanner)
+
+ if src == nil {
+ return scanner.ScanLine(Line{})
+ }
+
+ if len(src) != 24 {
+ return fmt.Errorf("invalid length for line: %v", len(src))
+ }
+
+ a := binary.BigEndian.Uint64(src)
+ b := binary.BigEndian.Uint64(src[8:])
+ c := binary.BigEndian.Uint64(src[16:])
+
+ return scanner.ScanLine(Line{
+ A: math.Float64frombits(a),
+ B: math.Float64frombits(b),
+ C: math.Float64frombits(c),
+ Valid: true,
+ })
+}
+
+type scanPlanTextAnyToLineScanner struct{}
+
+func (scanPlanTextAnyToLineScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(LineScanner)
+
+ if src == nil {
+ return scanner.ScanLine(Line{})
+ }
+
+ if len(src) < 7 {
+ return fmt.Errorf("invalid length for line: %v", len(src))
+ }
+
+ parts := strings.SplitN(string(src[1:len(src)-1]), ",", 3)
+ if len(parts) < 3 {
+ return fmt.Errorf("invalid format for line")
+ }
+
+ a, err := strconv.ParseFloat(parts[0], 64)
+ if err != nil {
+ return err
+ }
+
+ b, err := strconv.ParseFloat(parts[1], 64)
+ if err != nil {
+ return err
+ }
+
+ c, err := strconv.ParseFloat(parts[2], 64)
+ if err != nil {
+ return err
+ }
+
+ return scanner.ScanLine(Line{A: a, B: b, C: c, Valid: true})
+}
+
+func (c LineCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ return codecDecodeToTextFormat(c, m, oid, format, src)
+}
+
+func (c LineCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var line Line
+ err := codecScan(c, m, oid, format, src, &line)
+ if err != nil {
+ return nil, err
+ }
+ return line, nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/lseg.go b/vendor/github.com/jackc/pgx/v5/pgtype/lseg.go
new file mode 100644
index 0000000..05a86e1
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/lseg.go
@@ -0,0 +1,238 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "fmt"
+ "math"
+ "strconv"
+ "strings"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+type LsegScanner interface {
+ ScanLseg(v Lseg) error
+}
+
+type LsegValuer interface {
+ LsegValue() (Lseg, error)
+}
+
+type Lseg struct {
+ P [2]Vec2
+ Valid bool
+}
+
+func (lseg *Lseg) ScanLseg(v Lseg) error {
+ *lseg = v
+ return nil
+}
+
+func (lseg Lseg) LsegValue() (Lseg, error) {
+ return lseg, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (lseg *Lseg) Scan(src any) error {
+ if src == nil {
+ *lseg = Lseg{}
+ return nil
+ }
+
+ switch src := src.(type) {
+ case string:
+ return scanPlanTextAnyToLsegScanner{}.Scan([]byte(src), lseg)
+ }
+
+ return fmt.Errorf("cannot scan %T", src)
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (lseg Lseg) Value() (driver.Value, error) {
+ if !lseg.Valid {
+ return nil, nil
+ }
+
+ buf, err := LsegCodec{}.PlanEncode(nil, 0, TextFormatCode, lseg).Encode(lseg, nil)
+ if err != nil {
+ return nil, err
+ }
+ return string(buf), err
+}
+
+type LsegCodec struct{}
+
+func (LsegCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (LsegCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (LsegCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ if _, ok := value.(LsegValuer); !ok {
+ return nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ return encodePlanLsegCodecBinary{}
+ case TextFormatCode:
+ return encodePlanLsegCodecText{}
+ }
+
+ return nil
+}
+
+type encodePlanLsegCodecBinary struct{}
+
+func (encodePlanLsegCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ lseg, err := value.(LsegValuer).LsegValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !lseg.Valid {
+ return nil, nil
+ }
+
+ buf = pgio.AppendUint64(buf, math.Float64bits(lseg.P[0].X))
+ buf = pgio.AppendUint64(buf, math.Float64bits(lseg.P[0].Y))
+ buf = pgio.AppendUint64(buf, math.Float64bits(lseg.P[1].X))
+ buf = pgio.AppendUint64(buf, math.Float64bits(lseg.P[1].Y))
+ return buf, nil
+}
+
+type encodePlanLsegCodecText struct{}
+
+func (encodePlanLsegCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ lseg, err := value.(LsegValuer).LsegValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !lseg.Valid {
+ return nil, nil
+ }
+
+ buf = append(buf, fmt.Sprintf(`[(%s,%s),(%s,%s)]`,
+ strconv.FormatFloat(lseg.P[0].X, 'f', -1, 64),
+ strconv.FormatFloat(lseg.P[0].Y, 'f', -1, 64),
+ strconv.FormatFloat(lseg.P[1].X, 'f', -1, 64),
+ strconv.FormatFloat(lseg.P[1].Y, 'f', -1, 64),
+ )...)
+ return buf, nil
+}
+
+func (LsegCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case LsegScanner:
+ return scanPlanBinaryLsegToLsegScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case LsegScanner:
+ return scanPlanTextAnyToLsegScanner{}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryLsegToLsegScanner struct{}
+
+func (scanPlanBinaryLsegToLsegScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(LsegScanner)
+
+ if src == nil {
+ return scanner.ScanLseg(Lseg{})
+ }
+
+ if len(src) != 32 {
+ return fmt.Errorf("invalid length for lseg: %v", len(src))
+ }
+
+ x1 := binary.BigEndian.Uint64(src)
+ y1 := binary.BigEndian.Uint64(src[8:])
+ x2 := binary.BigEndian.Uint64(src[16:])
+ y2 := binary.BigEndian.Uint64(src[24:])
+
+ return scanner.ScanLseg(Lseg{
+ P: [2]Vec2{
+ {math.Float64frombits(x1), math.Float64frombits(y1)},
+ {math.Float64frombits(x2), math.Float64frombits(y2)},
+ },
+ Valid: true,
+ })
+}
+
+type scanPlanTextAnyToLsegScanner struct{}
+
+func (scanPlanTextAnyToLsegScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(LsegScanner)
+
+ if src == nil {
+ return scanner.ScanLseg(Lseg{})
+ }
+
+ if len(src) < 11 {
+ return fmt.Errorf("invalid length for lseg: %v", len(src))
+ }
+
+ str := string(src[2:])
+
+ var end int
+ end = strings.IndexByte(str, ',')
+
+ x1, err := strconv.ParseFloat(str[:end], 64)
+ if err != nil {
+ return err
+ }
+
+ str = str[end+1:]
+ end = strings.IndexByte(str, ')')
+
+ y1, err := strconv.ParseFloat(str[:end], 64)
+ if err != nil {
+ return err
+ }
+
+ str = str[end+3:]
+ end = strings.IndexByte(str, ',')
+
+ x2, err := strconv.ParseFloat(str[:end], 64)
+ if err != nil {
+ return err
+ }
+
+ str = str[end+1 : len(str)-2]
+
+ y2, err := strconv.ParseFloat(str, 64)
+ if err != nil {
+ return err
+ }
+
+ return scanner.ScanLseg(Lseg{P: [2]Vec2{{x1, y1}, {x2, y2}}, Valid: true})
+}
+
+func (c LsegCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ return codecDecodeToTextFormat(c, m, oid, format, src)
+}
+
+func (c LsegCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var lseg Lseg
+ err := codecScan(c, m, oid, format, src, &lseg)
+ if err != nil {
+ return nil, err
+ }
+ return lseg, nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/ltree.go b/vendor/github.com/jackc/pgx/v5/pgtype/ltree.go
new file mode 100644
index 0000000..6af3177
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/ltree.go
@@ -0,0 +1,122 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "fmt"
+)
+
+type LtreeCodec struct{}
+
+func (l LtreeCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+// PreferredFormat returns the preferred format.
+func (l LtreeCodec) PreferredFormat() int16 {
+ return TextFormatCode
+}
+
+// PlanEncode returns an EncodePlan for encoding value into PostgreSQL format for oid and format. If no plan can be
+// found then nil is returned.
+func (l LtreeCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ switch format {
+ case TextFormatCode:
+ return (TextCodec)(l).PlanEncode(m, oid, format, value)
+ case BinaryFormatCode:
+ switch value.(type) {
+ case string:
+ return encodeLtreeCodecBinaryString{}
+ case []byte:
+ return encodeLtreeCodecBinaryByteSlice{}
+ case TextValuer:
+ return encodeLtreeCodecBinaryTextValuer{}
+ }
+ }
+
+ return nil
+}
+
+type encodeLtreeCodecBinaryString struct{}
+
+func (encodeLtreeCodecBinaryString) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ ltree := value.(string)
+ buf = append(buf, 1)
+ return append(buf, ltree...), nil
+}
+
+type encodeLtreeCodecBinaryByteSlice struct{}
+
+func (encodeLtreeCodecBinaryByteSlice) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ ltree := value.([]byte)
+ buf = append(buf, 1)
+ return append(buf, ltree...), nil
+}
+
+type encodeLtreeCodecBinaryTextValuer struct{}
+
+func (encodeLtreeCodecBinaryTextValuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ t, err := value.(TextValuer).TextValue()
+ if err != nil {
+ return nil, err
+ }
+ if !t.Valid {
+ return nil, nil
+ }
+
+ buf = append(buf, 1)
+ return append(buf, t.String...), nil
+}
+
+// PlanScan returns a ScanPlan for scanning a PostgreSQL value into a destination with the same type as target. If
+// no plan can be found then nil is returned.
+func (l LtreeCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+ switch format {
+ case TextFormatCode:
+ return (TextCodec)(l).PlanScan(m, oid, format, target)
+ case BinaryFormatCode:
+ switch target.(type) {
+ case *string:
+ return scanPlanBinaryLtreeToString{}
+ case TextScanner:
+ return scanPlanBinaryLtreeToTextScanner{}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryLtreeToString struct{}
+
+func (scanPlanBinaryLtreeToString) Scan(src []byte, target any) error {
+ version := src[0]
+ if version != 1 {
+ return fmt.Errorf("unsupported ltree version %d", version)
+ }
+
+ p := (target).(*string)
+ *p = string(src[1:])
+
+ return nil
+}
+
+type scanPlanBinaryLtreeToTextScanner struct{}
+
+func (scanPlanBinaryLtreeToTextScanner) Scan(src []byte, target any) error {
+ version := src[0]
+ if version != 1 {
+ return fmt.Errorf("unsupported ltree version %d", version)
+ }
+
+ scanner := (target).(TextScanner)
+ return scanner.ScanText(Text{String: string(src[1:]), Valid: true})
+}
+
+// DecodeDatabaseSQLValue returns src decoded into a value compatible with the sql.Scanner interface.
+func (l LtreeCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ return (TextCodec)(l).DecodeDatabaseSQLValue(m, oid, format, src)
+}
+
+// DecodeValue returns src decoded into its default format.
+func (l LtreeCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ return (TextCodec)(l).DecodeValue(m, oid, format, src)
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/macaddr.go b/vendor/github.com/jackc/pgx/v5/pgtype/macaddr.go
new file mode 100644
index 0000000..e913ec9
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/macaddr.go
@@ -0,0 +1,162 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "net"
+)
+
+type MacaddrCodec struct{}
+
+func (MacaddrCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (MacaddrCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (MacaddrCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ switch format {
+ case BinaryFormatCode:
+ switch value.(type) {
+ case net.HardwareAddr:
+ return encodePlanMacaddrCodecBinaryHardwareAddr{}
+ case TextValuer:
+ return encodePlanMacAddrCodecTextValuer{}
+
+ }
+ case TextFormatCode:
+ switch value.(type) {
+ case net.HardwareAddr:
+ return encodePlanMacaddrCodecTextHardwareAddr{}
+ case TextValuer:
+ return encodePlanTextCodecTextValuer{}
+ }
+ }
+
+ return nil
+}
+
+type encodePlanMacaddrCodecBinaryHardwareAddr struct{}
+
+func (encodePlanMacaddrCodecBinaryHardwareAddr) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ addr := value.(net.HardwareAddr)
+ if addr == nil {
+ return nil, nil
+ }
+
+ return append(buf, addr...), nil
+}
+
+type encodePlanMacAddrCodecTextValuer struct{}
+
+func (encodePlanMacAddrCodecTextValuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ t, err := value.(TextValuer).TextValue()
+ if err != nil {
+ return nil, err
+ }
+ if !t.Valid {
+ return nil, nil
+ }
+
+ addr, err := net.ParseMAC(t.String)
+ if err != nil {
+ return nil, err
+ }
+
+ return append(buf, addr...), nil
+}
+
+type encodePlanMacaddrCodecTextHardwareAddr struct{}
+
+func (encodePlanMacaddrCodecTextHardwareAddr) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ addr := value.(net.HardwareAddr)
+ if addr == nil {
+ return nil, nil
+ }
+
+ return append(buf, addr.String()...), nil
+}
+
+func (MacaddrCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case *net.HardwareAddr:
+ return scanPlanBinaryMacaddrToHardwareAddr{}
+ case TextScanner:
+ return scanPlanBinaryMacaddrToTextScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case *net.HardwareAddr:
+ return scanPlanTextMacaddrToHardwareAddr{}
+ case TextScanner:
+ return scanPlanTextAnyToTextScanner{}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryMacaddrToHardwareAddr struct{}
+
+func (scanPlanBinaryMacaddrToHardwareAddr) Scan(src []byte, dst any) error {
+ dstBuf := dst.(*net.HardwareAddr)
+ if src == nil {
+ *dstBuf = nil
+ return nil
+ }
+
+ *dstBuf = make([]byte, len(src))
+ copy(*dstBuf, src)
+ return nil
+}
+
+type scanPlanBinaryMacaddrToTextScanner struct{}
+
+func (scanPlanBinaryMacaddrToTextScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(TextScanner)
+ if src == nil {
+ return scanner.ScanText(Text{})
+ }
+
+ return scanner.ScanText(Text{String: net.HardwareAddr(src).String(), Valid: true})
+}
+
+type scanPlanTextMacaddrToHardwareAddr struct{}
+
+func (scanPlanTextMacaddrToHardwareAddr) Scan(src []byte, dst any) error {
+ p := dst.(*net.HardwareAddr)
+
+ if src == nil {
+ *p = nil
+ return nil
+ }
+
+ addr, err := net.ParseMAC(string(src))
+ if err != nil {
+ return err
+ }
+
+ *p = addr
+
+ return nil
+}
+
+func (c MacaddrCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ return codecDecodeToTextFormat(c, m, oid, format, src)
+}
+
+func (c MacaddrCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var addr net.HardwareAddr
+ err := codecScan(c, m, oid, format, src, &addr)
+ if err != nil {
+ return nil, err
+ }
+ return addr, nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/multirange.go b/vendor/github.com/jackc/pgx/v5/pgtype/multirange.go
new file mode 100644
index 0000000..e576378
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/multirange.go
@@ -0,0 +1,443 @@
+package pgtype
+
+import (
+ "bytes"
+ "database/sql/driver"
+ "encoding/binary"
+ "fmt"
+ "reflect"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+// MultirangeGetter is a type that can be converted into a PostgreSQL multirange.
+type MultirangeGetter interface {
+ // IsNull returns true if the value is SQL NULL.
+ IsNull() bool
+
+ // Len returns the number of elements in the multirange.
+ Len() int
+
+ // Index returns the element at i.
+ Index(i int) any
+
+ // IndexType returns a non-nil scan target of the type Index will return. This is used by MultirangeCodec.PlanEncode.
+ IndexType() any
+}
+
+// MultirangeSetter is a type can be set from a PostgreSQL multirange.
+type MultirangeSetter interface {
+ // ScanNull sets the value to SQL NULL.
+ ScanNull() error
+
+ // SetLen prepares the value such that ScanIndex can be called for each element. This will remove any existing
+ // elements.
+ SetLen(n int) error
+
+ // ScanIndex returns a value usable as a scan target for i. SetLen must be called before ScanIndex.
+ ScanIndex(i int) any
+
+ // ScanIndexType returns a non-nil scan target of the type ScanIndex will return. This is used by
+ // MultirangeCodec.PlanScan.
+ ScanIndexType() any
+}
+
+// MultirangeCodec is a codec for any multirange type.
+type MultirangeCodec struct {
+ ElementType *Type
+}
+
+func (c *MultirangeCodec) FormatSupported(format int16) bool {
+ return c.ElementType.Codec.FormatSupported(format)
+}
+
+func (c *MultirangeCodec) PreferredFormat() int16 {
+ return c.ElementType.Codec.PreferredFormat()
+}
+
+func (c *MultirangeCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ multirangeValuer, ok := value.(MultirangeGetter)
+ if !ok {
+ return nil
+ }
+
+ elementType := multirangeValuer.IndexType()
+
+ elementEncodePlan := m.PlanEncode(c.ElementType.OID, format, elementType)
+ if elementEncodePlan == nil {
+ return nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ return &encodePlanMultirangeCodecBinary{ac: c, m: m, oid: oid}
+ case TextFormatCode:
+ return &encodePlanMultirangeCodecText{ac: c, m: m, oid: oid}
+ }
+
+ return nil
+}
+
+type encodePlanMultirangeCodecText struct {
+ ac *MultirangeCodec
+ m *Map
+ oid uint32
+}
+
+func (p *encodePlanMultirangeCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ multirange := value.(MultirangeGetter)
+
+ if multirange.IsNull() {
+ return nil, nil
+ }
+
+ elementCount := multirange.Len()
+
+ buf = append(buf, '{')
+
+ var encodePlan EncodePlan
+ var lastElemType reflect.Type
+ inElemBuf := make([]byte, 0, 32)
+ for i := 0; i < elementCount; i++ {
+ if i > 0 {
+ buf = append(buf, ',')
+ }
+
+ elem := multirange.Index(i)
+ var elemBuf []byte
+ if elem != nil {
+ elemType := reflect.TypeOf(elem)
+ if lastElemType != elemType {
+ lastElemType = elemType
+ encodePlan = p.m.PlanEncode(p.ac.ElementType.OID, TextFormatCode, elem)
+ if encodePlan == nil {
+ return nil, fmt.Errorf("unable to encode %v", multirange.Index(i))
+ }
+ }
+ elemBuf, err = encodePlan.Encode(elem, inElemBuf)
+ if err != nil {
+ return nil, err
+ }
+ }
+
+ if elemBuf == nil {
+ return nil, fmt.Errorf("multirange cannot contain NULL element")
+ } else {
+ buf = append(buf, elemBuf...)
+ }
+ }
+
+ buf = append(buf, '}')
+
+ return buf, nil
+}
+
+type encodePlanMultirangeCodecBinary struct {
+ ac *MultirangeCodec
+ m *Map
+ oid uint32
+}
+
+func (p *encodePlanMultirangeCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ multirange := value.(MultirangeGetter)
+
+ if multirange.IsNull() {
+ return nil, nil
+ }
+
+ elementCount := multirange.Len()
+
+ buf = pgio.AppendInt32(buf, int32(elementCount))
+
+ var encodePlan EncodePlan
+ var lastElemType reflect.Type
+ for i := 0; i < elementCount; i++ {
+ sp := len(buf)
+ buf = pgio.AppendInt32(buf, -1)
+
+ elem := multirange.Index(i)
+ var elemBuf []byte
+ if elem != nil {
+ elemType := reflect.TypeOf(elem)
+ if lastElemType != elemType {
+ lastElemType = elemType
+ encodePlan = p.m.PlanEncode(p.ac.ElementType.OID, BinaryFormatCode, elem)
+ if encodePlan == nil {
+ return nil, fmt.Errorf("unable to encode %v", multirange.Index(i))
+ }
+ }
+ elemBuf, err = encodePlan.Encode(elem, buf)
+ if err != nil {
+ return nil, err
+ }
+ }
+
+ if elemBuf == nil {
+ return nil, fmt.Errorf("multirange cannot contain NULL element")
+ } else {
+ buf = elemBuf
+ pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
+ }
+ }
+
+ return buf, nil
+}
+
+func (c *MultirangeCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+ multirangeScanner, ok := target.(MultirangeSetter)
+ if !ok {
+ return nil
+ }
+
+ elementType := multirangeScanner.ScanIndexType()
+
+ elementScanPlan := m.PlanScan(c.ElementType.OID, format, elementType)
+ if _, ok := elementScanPlan.(*scanPlanFail); ok {
+ return nil
+ }
+
+ return &scanPlanMultirangeCodec{
+ multirangeCodec: c,
+ m: m,
+ oid: oid,
+ formatCode: format,
+ }
+}
+
+func (c *MultirangeCodec) decodeBinary(m *Map, multirangeOID uint32, src []byte, multirange MultirangeSetter) error {
+ rp := 0
+
+ elementCount := int(binary.BigEndian.Uint32(src[rp:]))
+ rp += 4
+
+ err := multirange.SetLen(elementCount)
+ if err != nil {
+ return err
+ }
+
+ if elementCount == 0 {
+ return nil
+ }
+
+ elementScanPlan := c.ElementType.Codec.PlanScan(m, c.ElementType.OID, BinaryFormatCode, multirange.ScanIndex(0))
+ if elementScanPlan == nil {
+ elementScanPlan = m.PlanScan(c.ElementType.OID, BinaryFormatCode, multirange.ScanIndex(0))
+ }
+
+ for i := 0; i < elementCount; i++ {
+ elem := multirange.ScanIndex(i)
+ elemLen := int(int32(binary.BigEndian.Uint32(src[rp:])))
+ rp += 4
+ var elemSrc []byte
+ if elemLen >= 0 {
+ elemSrc = src[rp : rp+elemLen]
+ rp += elemLen
+ }
+ err = elementScanPlan.Scan(elemSrc, elem)
+ if err != nil {
+ return fmt.Errorf("failed to scan multirange element %d: %w", i, err)
+ }
+ }
+
+ return nil
+}
+
+func (c *MultirangeCodec) decodeText(m *Map, multirangeOID uint32, src []byte, multirange MultirangeSetter) error {
+ elements, err := parseUntypedTextMultirange(src)
+ if err != nil {
+ return err
+ }
+
+ err = multirange.SetLen(len(elements))
+ if err != nil {
+ return err
+ }
+
+ if len(elements) == 0 {
+ return nil
+ }
+
+ elementScanPlan := c.ElementType.Codec.PlanScan(m, c.ElementType.OID, TextFormatCode, multirange.ScanIndex(0))
+ if elementScanPlan == nil {
+ elementScanPlan = m.PlanScan(c.ElementType.OID, TextFormatCode, multirange.ScanIndex(0))
+ }
+
+ for i, s := range elements {
+ elem := multirange.ScanIndex(i)
+ err = elementScanPlan.Scan([]byte(s), elem)
+ if err != nil {
+ return err
+ }
+ }
+
+ return nil
+}
+
+type scanPlanMultirangeCodec struct {
+ multirangeCodec *MultirangeCodec
+ m *Map
+ oid uint32
+ formatCode int16
+ elementScanPlan ScanPlan
+}
+
+func (spac *scanPlanMultirangeCodec) Scan(src []byte, dst any) error {
+ c := spac.multirangeCodec
+ m := spac.m
+ oid := spac.oid
+ formatCode := spac.formatCode
+
+ multirange := dst.(MultirangeSetter)
+
+ if src == nil {
+ return multirange.ScanNull()
+ }
+
+ switch formatCode {
+ case BinaryFormatCode:
+ return c.decodeBinary(m, oid, src, multirange)
+ case TextFormatCode:
+ return c.decodeText(m, oid, src, multirange)
+ default:
+ return fmt.Errorf("unknown format code %d", formatCode)
+ }
+}
+
+func (c *MultirangeCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ switch format {
+ case TextFormatCode:
+ return string(src), nil
+ case BinaryFormatCode:
+ buf := make([]byte, len(src))
+ copy(buf, src)
+ return buf, nil
+ default:
+ return nil, fmt.Errorf("unknown format code %d", format)
+ }
+}
+
+func (c *MultirangeCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var multirange Multirange[Range[any]]
+ err := m.PlanScan(oid, format, &multirange).Scan(src, &multirange)
+ return multirange, err
+}
+
+func parseUntypedTextMultirange(src []byte) ([]string, error) {
+ elements := make([]string, 0)
+
+ buf := bytes.NewBuffer(src)
+
+ skipWhitespace(buf)
+
+ r, _, err := buf.ReadRune()
+ if err != nil {
+ return nil, fmt.Errorf("invalid array: %w", err)
+ }
+
+ if r != '{' {
+ return nil, fmt.Errorf("invalid multirange, expected '{' got %v", r)
+ }
+
+parseValueLoop:
+ for {
+ r, _, err = buf.ReadRune()
+ if err != nil {
+ return nil, fmt.Errorf("invalid multirange: %w", err)
+ }
+
+ switch r {
+ case ',': // skip range separator
+ case '}':
+ break parseValueLoop
+ default:
+ buf.UnreadRune()
+ value, err := parseRange(buf)
+ if err != nil {
+ return nil, fmt.Errorf("invalid multirange value: %w", err)
+ }
+ elements = append(elements, value)
+ }
+ }
+
+ skipWhitespace(buf)
+
+ if buf.Len() > 0 {
+ return nil, fmt.Errorf("unexpected trailing data: %v", buf.String())
+ }
+
+ return elements, nil
+
+}
+
+func parseRange(buf *bytes.Buffer) (string, error) {
+ s := &bytes.Buffer{}
+
+ boundSepRead := false
+ for {
+ r, _, err := buf.ReadRune()
+ if err != nil {
+ return "", err
+ }
+
+ switch r {
+ case ',', '}':
+ if r == ',' && !boundSepRead {
+ boundSepRead = true
+ break
+ }
+ buf.UnreadRune()
+ return s.String(), nil
+ }
+
+ s.WriteRune(r)
+ }
+}
+
+// Multirange is a generic multirange type.
+//
+// T should implement RangeValuer and *T should implement RangeScanner. However, there does not appear to be a way to
+// enforce the RangeScanner constraint.
+type Multirange[T RangeValuer] []T
+
+func (r Multirange[T]) IsNull() bool {
+ return r == nil
+}
+
+func (r Multirange[T]) Len() int {
+ return len(r)
+}
+
+func (r Multirange[T]) Index(i int) any {
+ return r[i]
+}
+
+func (r Multirange[T]) IndexType() any {
+ var zero T
+ return zero
+}
+
+func (r *Multirange[T]) ScanNull() error {
+ *r = nil
+ return nil
+}
+
+func (r *Multirange[T]) SetLen(n int) error {
+ *r = make([]T, n)
+ return nil
+}
+
+func (r Multirange[T]) ScanIndex(i int) any {
+ return &r[i]
+}
+
+func (r Multirange[T]) ScanIndexType() any {
+ return new(T)
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/numeric.go b/vendor/github.com/jackc/pgx/v5/pgtype/numeric.go
new file mode 100644
index 0000000..4dbec78
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/numeric.go
@@ -0,0 +1,823 @@
+package pgtype
+
+import (
+ "bytes"
+ "database/sql/driver"
+ "encoding/binary"
+ "fmt"
+ "math"
+ "math/big"
+ "strconv"
+ "strings"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+// PostgreSQL internal numeric storage uses 16-bit "digits" with base of 10,000
+const nbase = 10000
+
+const (
+ pgNumericNaN = 0x00000000c0000000
+ pgNumericNaNSign = 0xc000
+
+ pgNumericPosInf = 0x00000000d0000000
+ pgNumericPosInfSign = 0xd000
+
+ pgNumericNegInf = 0x00000000f0000000
+ pgNumericNegInfSign = 0xf000
+)
+
+var big0 *big.Int = big.NewInt(0)
+var big1 *big.Int = big.NewInt(1)
+var big10 *big.Int = big.NewInt(10)
+var big100 *big.Int = big.NewInt(100)
+var big1000 *big.Int = big.NewInt(1000)
+
+var bigNBase *big.Int = big.NewInt(nbase)
+var bigNBaseX2 *big.Int = big.NewInt(nbase * nbase)
+var bigNBaseX3 *big.Int = big.NewInt(nbase * nbase * nbase)
+var bigNBaseX4 *big.Int = big.NewInt(nbase * nbase * nbase * nbase)
+
+type NumericScanner interface {
+ ScanNumeric(v Numeric) error
+}
+
+type NumericValuer interface {
+ NumericValue() (Numeric, error)
+}
+
+type Numeric struct {
+ Int *big.Int
+ Exp int32
+ NaN bool
+ InfinityModifier InfinityModifier
+ Valid bool
+}
+
+func (n *Numeric) ScanNumeric(v Numeric) error {
+ *n = v
+ return nil
+}
+
+func (n Numeric) NumericValue() (Numeric, error) {
+ return n, nil
+}
+
+func (n Numeric) Float64Value() (Float8, error) {
+ if !n.Valid {
+ return Float8{}, nil
+ } else if n.NaN {
+ return Float8{Float64: math.NaN(), Valid: true}, nil
+ } else if n.InfinityModifier == Infinity {
+ return Float8{Float64: math.Inf(1), Valid: true}, nil
+ } else if n.InfinityModifier == NegativeInfinity {
+ return Float8{Float64: math.Inf(-1), Valid: true}, nil
+ }
+
+ buf := make([]byte, 0, 32)
+
+ if n.Int == nil {
+ buf = append(buf, '0')
+ } else {
+ buf = append(buf, n.Int.String()...)
+ }
+ buf = append(buf, 'e')
+ buf = append(buf, strconv.FormatInt(int64(n.Exp), 10)...)
+
+ f, err := strconv.ParseFloat(string(buf), 64)
+ if err != nil {
+ return Float8{}, err
+ }
+
+ return Float8{Float64: f, Valid: true}, nil
+}
+
+func (n *Numeric) ScanInt64(v Int8) error {
+ if !v.Valid {
+ *n = Numeric{}
+ return nil
+ }
+
+ *n = Numeric{Int: big.NewInt(v.Int64), Valid: true}
+ return nil
+}
+
+func (n Numeric) Int64Value() (Int8, error) {
+ if !n.Valid {
+ return Int8{}, nil
+ }
+
+ bi, err := n.toBigInt()
+ if err != nil {
+ return Int8{}, err
+ }
+
+ if !bi.IsInt64() {
+ return Int8{}, fmt.Errorf("cannot convert %v to int64", n)
+ }
+
+ return Int8{Int64: bi.Int64(), Valid: true}, nil
+}
+
+func (n *Numeric) ScanScientific(src string) error {
+ if !strings.ContainsAny("eE", src) {
+ return scanPlanTextAnyToNumericScanner{}.Scan([]byte(src), n)
+ }
+
+ if bigF, ok := new(big.Float).SetString(string(src)); ok {
+ smallF, _ := bigF.Float64()
+ src = strconv.FormatFloat(smallF, 'f', -1, 64)
+ }
+
+ num, exp, err := parseNumericString(src)
+ if err != nil {
+ return err
+ }
+
+ *n = Numeric{Int: num, Exp: exp, Valid: true}
+
+ return nil
+}
+
+func (n *Numeric) toBigInt() (*big.Int, error) {
+ if n.Exp == 0 {
+ return n.Int, nil
+ }
+
+ num := &big.Int{}
+ num.Set(n.Int)
+ if n.Exp > 0 {
+ mul := &big.Int{}
+ mul.Exp(big10, big.NewInt(int64(n.Exp)), nil)
+ num.Mul(num, mul)
+ return num, nil
+ }
+
+ div := &big.Int{}
+ div.Exp(big10, big.NewInt(int64(-n.Exp)), nil)
+ remainder := &big.Int{}
+ num.DivMod(num, div, remainder)
+ if remainder.Cmp(big0) != 0 {
+ return nil, fmt.Errorf("cannot convert %v to integer", n)
+ }
+ return num, nil
+}
+
+func parseNumericString(str string) (n *big.Int, exp int32, err error) {
+ idx := strings.IndexByte(str, '.')
+
+ if idx == -1 {
+ for len(str) > 1 && str[len(str)-1] == '0' && str[len(str)-2] != '-' {
+ str = str[:len(str)-1]
+ exp++
+ }
+ } else {
+ exp = int32(-(len(str) - idx - 1))
+ str = str[:idx] + str[idx+1:]
+ }
+
+ accum := &big.Int{}
+ if _, ok := accum.SetString(str, 10); !ok {
+ return nil, 0, fmt.Errorf("%s is not a number", str)
+ }
+
+ return accum, exp, nil
+}
+
+func nbaseDigitsToInt64(src []byte) (accum int64, bytesRead, digitsRead int) {
+ digits := len(src) / 2
+ if digits > 4 {
+ digits = 4
+ }
+
+ rp := 0
+
+ for i := 0; i < digits; i++ {
+ if i > 0 {
+ accum *= nbase
+ }
+ accum += int64(binary.BigEndian.Uint16(src[rp:]))
+ rp += 2
+ }
+
+ return accum, rp, digits
+}
+
+// Scan implements the database/sql Scanner interface.
+func (n *Numeric) Scan(src any) error {
+ if src == nil {
+ *n = Numeric{}
+ return nil
+ }
+
+ switch src := src.(type) {
+ case string:
+ return scanPlanTextAnyToNumericScanner{}.Scan([]byte(src), n)
+ }
+
+ return fmt.Errorf("cannot scan %T", src)
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (n Numeric) Value() (driver.Value, error) {
+ if !n.Valid {
+ return nil, nil
+ }
+
+ buf, err := NumericCodec{}.PlanEncode(nil, 0, TextFormatCode, n).Encode(n, nil)
+ if err != nil {
+ return nil, err
+ }
+ return string(buf), err
+}
+
+func (n Numeric) MarshalJSON() ([]byte, error) {
+ if !n.Valid {
+ return []byte("null"), nil
+ }
+
+ if n.NaN {
+ return []byte(`"NaN"`), nil
+ }
+
+ return n.numberTextBytes(), nil
+}
+
+func (n *Numeric) UnmarshalJSON(src []byte) error {
+ if bytes.Equal(src, []byte(`null`)) {
+ *n = Numeric{}
+ return nil
+ }
+ if bytes.Equal(src, []byte(`"NaN"`)) {
+ *n = Numeric{NaN: true, Valid: true}
+ return nil
+ }
+ return scanPlanTextAnyToNumericScanner{}.Scan(src, n)
+}
+
+// numberString returns a string of the number. undefined if NaN, infinite, or NULL
+func (n Numeric) numberTextBytes() []byte {
+ intStr := n.Int.String()
+
+ buf := &bytes.Buffer{}
+
+ if len(intStr) > 0 && intStr[:1] == "-" {
+ intStr = intStr[1:]
+ buf.WriteByte('-')
+ }
+
+ exp := int(n.Exp)
+ if exp > 0 {
+ buf.WriteString(intStr)
+ for i := 0; i < exp; i++ {
+ buf.WriteByte('0')
+ }
+ } else if exp < 0 {
+ if len(intStr) <= -exp {
+ buf.WriteString("0.")
+ leadingZeros := -exp - len(intStr)
+ for i := 0; i < leadingZeros; i++ {
+ buf.WriteByte('0')
+ }
+ buf.WriteString(intStr)
+ } else if len(intStr) > -exp {
+ dpPos := len(intStr) + exp
+ buf.WriteString(intStr[:dpPos])
+ buf.WriteByte('.')
+ buf.WriteString(intStr[dpPos:])
+ }
+ } else {
+ buf.WriteString(intStr)
+ }
+
+ return buf.Bytes()
+}
+
+type NumericCodec struct{}
+
+func (NumericCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (NumericCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (NumericCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ switch format {
+ case BinaryFormatCode:
+ switch value.(type) {
+ case NumericValuer:
+ return encodePlanNumericCodecBinaryNumericValuer{}
+ case Float64Valuer:
+ return encodePlanNumericCodecBinaryFloat64Valuer{}
+ case Int64Valuer:
+ return encodePlanNumericCodecBinaryInt64Valuer{}
+ }
+ case TextFormatCode:
+ switch value.(type) {
+ case NumericValuer:
+ return encodePlanNumericCodecTextNumericValuer{}
+ case Float64Valuer:
+ return encodePlanNumericCodecTextFloat64Valuer{}
+ case Int64Valuer:
+ return encodePlanNumericCodecTextInt64Valuer{}
+ }
+ }
+
+ return nil
+}
+
+type encodePlanNumericCodecBinaryNumericValuer struct{}
+
+func (encodePlanNumericCodecBinaryNumericValuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n, err := value.(NumericValuer).NumericValue()
+ if err != nil {
+ return nil, err
+ }
+
+ return encodeNumericBinary(n, buf)
+}
+
+type encodePlanNumericCodecBinaryFloat64Valuer struct{}
+
+func (encodePlanNumericCodecBinaryFloat64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n, err := value.(Float64Valuer).Float64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !n.Valid {
+ return nil, nil
+ }
+
+ if math.IsNaN(n.Float64) {
+ return encodeNumericBinary(Numeric{NaN: true, Valid: true}, buf)
+ } else if math.IsInf(n.Float64, 1) {
+ return encodeNumericBinary(Numeric{InfinityModifier: Infinity, Valid: true}, buf)
+ } else if math.IsInf(n.Float64, -1) {
+ return encodeNumericBinary(Numeric{InfinityModifier: NegativeInfinity, Valid: true}, buf)
+ }
+ num, exp, err := parseNumericString(strconv.FormatFloat(n.Float64, 'f', -1, 64))
+ if err != nil {
+ return nil, err
+ }
+
+ return encodeNumericBinary(Numeric{Int: num, Exp: exp, Valid: true}, buf)
+}
+
+type encodePlanNumericCodecBinaryInt64Valuer struct{}
+
+func (encodePlanNumericCodecBinaryInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n, err := value.(Int64Valuer).Int64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !n.Valid {
+ return nil, nil
+ }
+
+ return encodeNumericBinary(Numeric{Int: big.NewInt(n.Int64), Valid: true}, buf)
+}
+
+func encodeNumericBinary(n Numeric, buf []byte) (newBuf []byte, err error) {
+ if !n.Valid {
+ return nil, nil
+ }
+
+ if n.NaN {
+ buf = pgio.AppendUint64(buf, pgNumericNaN)
+ return buf, nil
+ } else if n.InfinityModifier == Infinity {
+ buf = pgio.AppendUint64(buf, pgNumericPosInf)
+ return buf, nil
+ } else if n.InfinityModifier == NegativeInfinity {
+ buf = pgio.AppendUint64(buf, pgNumericNegInf)
+ return buf, nil
+ }
+
+ var sign int16
+ if n.Int.Cmp(big0) < 0 {
+ sign = 16384
+ }
+
+ absInt := &big.Int{}
+ wholePart := &big.Int{}
+ fracPart := &big.Int{}
+ remainder := &big.Int{}
+ absInt.Abs(n.Int)
+
+ // Normalize absInt and exp to where exp is always a multiple of 4. This makes
+ // converting to 16-bit base 10,000 digits easier.
+ var exp int32
+ switch n.Exp % 4 {
+ case 1, -3:
+ exp = n.Exp - 1
+ absInt.Mul(absInt, big10)
+ case 2, -2:
+ exp = n.Exp - 2
+ absInt.Mul(absInt, big100)
+ case 3, -1:
+ exp = n.Exp - 3
+ absInt.Mul(absInt, big1000)
+ default:
+ exp = n.Exp
+ }
+
+ if exp < 0 {
+ divisor := &big.Int{}
+ divisor.Exp(big10, big.NewInt(int64(-exp)), nil)
+ wholePart.DivMod(absInt, divisor, fracPart)
+ fracPart.Add(fracPart, divisor)
+ } else {
+ wholePart = absInt
+ }
+
+ var wholeDigits, fracDigits []int16
+
+ for wholePart.Cmp(big0) != 0 {
+ wholePart.DivMod(wholePart, bigNBase, remainder)
+ wholeDigits = append(wholeDigits, int16(remainder.Int64()))
+ }
+
+ if fracPart.Cmp(big0) != 0 {
+ for fracPart.Cmp(big1) != 0 {
+ fracPart.DivMod(fracPart, bigNBase, remainder)
+ fracDigits = append(fracDigits, int16(remainder.Int64()))
+ }
+ }
+
+ buf = pgio.AppendInt16(buf, int16(len(wholeDigits)+len(fracDigits)))
+
+ var weight int16
+ if len(wholeDigits) > 0 {
+ weight = int16(len(wholeDigits) - 1)
+ if exp > 0 {
+ weight += int16(exp / 4)
+ }
+ } else {
+ weight = int16(exp/4) - 1 + int16(len(fracDigits))
+ }
+ buf = pgio.AppendInt16(buf, weight)
+
+ buf = pgio.AppendInt16(buf, sign)
+
+ var dscale int16
+ if n.Exp < 0 {
+ dscale = int16(-n.Exp)
+ }
+ buf = pgio.AppendInt16(buf, dscale)
+
+ for i := len(wholeDigits) - 1; i >= 0; i-- {
+ buf = pgio.AppendInt16(buf, wholeDigits[i])
+ }
+
+ for i := len(fracDigits) - 1; i >= 0; i-- {
+ buf = pgio.AppendInt16(buf, fracDigits[i])
+ }
+
+ return buf, nil
+}
+
+type encodePlanNumericCodecTextNumericValuer struct{}
+
+func (encodePlanNumericCodecTextNumericValuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n, err := value.(NumericValuer).NumericValue()
+ if err != nil {
+ return nil, err
+ }
+
+ return encodeNumericText(n, buf)
+}
+
+type encodePlanNumericCodecTextFloat64Valuer struct{}
+
+func (encodePlanNumericCodecTextFloat64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n, err := value.(Float64Valuer).Float64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !n.Valid {
+ return nil, nil
+ }
+
+ if math.IsNaN(n.Float64) {
+ buf = append(buf, "NaN"...)
+ } else if math.IsInf(n.Float64, 1) {
+ buf = append(buf, "Infinity"...)
+ } else if math.IsInf(n.Float64, -1) {
+ buf = append(buf, "-Infinity"...)
+ } else {
+ buf = append(buf, strconv.FormatFloat(n.Float64, 'f', -1, 64)...)
+ }
+ return buf, nil
+}
+
+type encodePlanNumericCodecTextInt64Valuer struct{}
+
+func (encodePlanNumericCodecTextInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ n, err := value.(Int64Valuer).Int64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !n.Valid {
+ return nil, nil
+ }
+
+ buf = append(buf, strconv.FormatInt(n.Int64, 10)...)
+ return buf, nil
+}
+
+func encodeNumericText(n Numeric, buf []byte) (newBuf []byte, err error) {
+ if !n.Valid {
+ return nil, nil
+ }
+
+ if n.NaN {
+ buf = append(buf, "NaN"...)
+ return buf, nil
+ } else if n.InfinityModifier == Infinity {
+ buf = append(buf, "Infinity"...)
+ return buf, nil
+ } else if n.InfinityModifier == NegativeInfinity {
+ buf = append(buf, "-Infinity"...)
+ return buf, nil
+ }
+
+ buf = append(buf, n.numberTextBytes()...)
+
+ return buf, nil
+}
+
+func (NumericCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case NumericScanner:
+ return scanPlanBinaryNumericToNumericScanner{}
+ case Float64Scanner:
+ return scanPlanBinaryNumericToFloat64Scanner{}
+ case Int64Scanner:
+ return scanPlanBinaryNumericToInt64Scanner{}
+ case TextScanner:
+ return scanPlanBinaryNumericToTextScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case NumericScanner:
+ return scanPlanTextAnyToNumericScanner{}
+ case Float64Scanner:
+ return scanPlanTextAnyToFloat64Scanner{}
+ case Int64Scanner:
+ return scanPlanTextAnyToInt64Scanner{}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryNumericToNumericScanner struct{}
+
+func (scanPlanBinaryNumericToNumericScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(NumericScanner)
+
+ if src == nil {
+ return scanner.ScanNumeric(Numeric{})
+ }
+
+ if len(src) < 8 {
+ return fmt.Errorf("numeric incomplete %v", src)
+ }
+
+ rp := 0
+ ndigits := binary.BigEndian.Uint16(src[rp:])
+ rp += 2
+ weight := int16(binary.BigEndian.Uint16(src[rp:]))
+ rp += 2
+ sign := binary.BigEndian.Uint16(src[rp:])
+ rp += 2
+ dscale := int16(binary.BigEndian.Uint16(src[rp:]))
+ rp += 2
+
+ if sign == pgNumericNaNSign {
+ return scanner.ScanNumeric(Numeric{NaN: true, Valid: true})
+ } else if sign == pgNumericPosInfSign {
+ return scanner.ScanNumeric(Numeric{InfinityModifier: Infinity, Valid: true})
+ } else if sign == pgNumericNegInfSign {
+ return scanner.ScanNumeric(Numeric{InfinityModifier: NegativeInfinity, Valid: true})
+ }
+
+ if ndigits == 0 {
+ return scanner.ScanNumeric(Numeric{Int: big.NewInt(0), Valid: true})
+ }
+
+ if len(src[rp:]) < int(ndigits)*2 {
+ return fmt.Errorf("numeric incomplete %v", src)
+ }
+
+ accum := &big.Int{}
+
+ for i := 0; i < int(ndigits+3)/4; i++ {
+ int64accum, bytesRead, digitsRead := nbaseDigitsToInt64(src[rp:])
+ rp += bytesRead
+
+ if i > 0 {
+ var mul *big.Int
+ switch digitsRead {
+ case 1:
+ mul = bigNBase
+ case 2:
+ mul = bigNBaseX2
+ case 3:
+ mul = bigNBaseX3
+ case 4:
+ mul = bigNBaseX4
+ default:
+ return fmt.Errorf("invalid digitsRead: %d (this can't happen)", digitsRead)
+ }
+ accum.Mul(accum, mul)
+ }
+
+ accum.Add(accum, big.NewInt(int64accum))
+ }
+
+ exp := (int32(weight) - int32(ndigits) + 1) * 4
+
+ if dscale > 0 {
+ fracNBaseDigits := int16(int32(ndigits) - int32(weight) - 1)
+ fracDecimalDigits := fracNBaseDigits * 4
+
+ if dscale > fracDecimalDigits {
+ multCount := int(dscale - fracDecimalDigits)
+ for i := 0; i < multCount; i++ {
+ accum.Mul(accum, big10)
+ exp--
+ }
+ } else if dscale < fracDecimalDigits {
+ divCount := int(fracDecimalDigits - dscale)
+ for i := 0; i < divCount; i++ {
+ accum.Div(accum, big10)
+ exp++
+ }
+ }
+ }
+
+ reduced := &big.Int{}
+ remainder := &big.Int{}
+ if exp >= 0 {
+ for {
+ reduced.DivMod(accum, big10, remainder)
+ if remainder.Cmp(big0) != 0 {
+ break
+ }
+ accum.Set(reduced)
+ exp++
+ }
+ }
+
+ if sign != 0 {
+ accum.Neg(accum)
+ }
+
+ return scanner.ScanNumeric(Numeric{Int: accum, Exp: exp, Valid: true})
+}
+
+type scanPlanBinaryNumericToFloat64Scanner struct{}
+
+func (scanPlanBinaryNumericToFloat64Scanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(Float64Scanner)
+
+ if src == nil {
+ return scanner.ScanFloat64(Float8{})
+ }
+
+ var n Numeric
+
+ err := scanPlanBinaryNumericToNumericScanner{}.Scan(src, &n)
+ if err != nil {
+ return err
+ }
+
+ f8, err := n.Float64Value()
+ if err != nil {
+ return err
+ }
+
+ return scanner.ScanFloat64(f8)
+}
+
+type scanPlanBinaryNumericToInt64Scanner struct{}
+
+func (scanPlanBinaryNumericToInt64Scanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(Int64Scanner)
+
+ if src == nil {
+ return scanner.ScanInt64(Int8{})
+ }
+
+ var n Numeric
+
+ err := scanPlanBinaryNumericToNumericScanner{}.Scan(src, &n)
+ if err != nil {
+ return err
+ }
+
+ bigInt, err := n.toBigInt()
+ if err != nil {
+ return err
+ }
+
+ if !bigInt.IsInt64() {
+ return fmt.Errorf("%v is out of range for int64", bigInt)
+ }
+
+ return scanner.ScanInt64(Int8{Int64: bigInt.Int64(), Valid: true})
+}
+
+type scanPlanBinaryNumericToTextScanner struct{}
+
+func (scanPlanBinaryNumericToTextScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(TextScanner)
+
+ if src == nil {
+ return scanner.ScanText(Text{})
+ }
+
+ var n Numeric
+
+ err := scanPlanBinaryNumericToNumericScanner{}.Scan(src, &n)
+ if err != nil {
+ return err
+ }
+
+ sbuf, err := encodeNumericText(n, nil)
+ if err != nil {
+ return err
+ }
+
+ return scanner.ScanText(Text{String: string(sbuf), Valid: true})
+}
+
+type scanPlanTextAnyToNumericScanner struct{}
+
+func (scanPlanTextAnyToNumericScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(NumericScanner)
+
+ if src == nil {
+ return scanner.ScanNumeric(Numeric{})
+ }
+
+ if string(src) == "NaN" {
+ return scanner.ScanNumeric(Numeric{NaN: true, Valid: true})
+ } else if string(src) == "Infinity" {
+ return scanner.ScanNumeric(Numeric{InfinityModifier: Infinity, Valid: true})
+ } else if string(src) == "-Infinity" {
+ return scanner.ScanNumeric(Numeric{InfinityModifier: NegativeInfinity, Valid: true})
+ }
+
+ num, exp, err := parseNumericString(string(src))
+ if err != nil {
+ return err
+ }
+
+ return scanner.ScanNumeric(Numeric{Int: num, Exp: exp, Valid: true})
+}
+
+func (c NumericCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ if format == TextFormatCode {
+ return string(src), nil
+ }
+
+ var n Numeric
+ err := codecScan(c, m, oid, format, src, &n)
+ if err != nil {
+ return nil, err
+ }
+
+ buf, err := m.Encode(oid, TextFormatCode, n, nil)
+ if err != nil {
+ return nil, err
+ }
+ return string(buf), nil
+}
+
+func (c NumericCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var n Numeric
+ err := codecScan(c, m, oid, format, src, &n)
+ if err != nil {
+ return nil, err
+ }
+ return n, nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/path.go b/vendor/github.com/jackc/pgx/v5/pgtype/path.go
new file mode 100644
index 0000000..73e0ec5
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/path.go
@@ -0,0 +1,272 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "fmt"
+ "math"
+ "strconv"
+ "strings"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+type PathScanner interface {
+ ScanPath(v Path) error
+}
+
+type PathValuer interface {
+ PathValue() (Path, error)
+}
+
+type Path struct {
+ P []Vec2
+ Closed bool
+ Valid bool
+}
+
+func (path *Path) ScanPath(v Path) error {
+ *path = v
+ return nil
+}
+
+func (path Path) PathValue() (Path, error) {
+ return path, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (path *Path) Scan(src any) error {
+ if src == nil {
+ *path = Path{}
+ return nil
+ }
+
+ switch src := src.(type) {
+ case string:
+ return scanPlanTextAnyToPathScanner{}.Scan([]byte(src), path)
+ }
+
+ return fmt.Errorf("cannot scan %T", src)
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (path Path) Value() (driver.Value, error) {
+ if !path.Valid {
+ return nil, nil
+ }
+
+ buf, err := PathCodec{}.PlanEncode(nil, 0, TextFormatCode, path).Encode(path, nil)
+ if err != nil {
+ return nil, err
+ }
+
+ return string(buf), err
+}
+
+type PathCodec struct{}
+
+func (PathCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (PathCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (PathCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ if _, ok := value.(PathValuer); !ok {
+ return nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ return encodePlanPathCodecBinary{}
+ case TextFormatCode:
+ return encodePlanPathCodecText{}
+ }
+
+ return nil
+}
+
+type encodePlanPathCodecBinary struct{}
+
+func (encodePlanPathCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ path, err := value.(PathValuer).PathValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !path.Valid {
+ return nil, nil
+ }
+
+ var closeByte byte
+ if path.Closed {
+ closeByte = 1
+ }
+ buf = append(buf, closeByte)
+
+ buf = pgio.AppendInt32(buf, int32(len(path.P)))
+
+ for _, p := range path.P {
+ buf = pgio.AppendUint64(buf, math.Float64bits(p.X))
+ buf = pgio.AppendUint64(buf, math.Float64bits(p.Y))
+ }
+
+ return buf, nil
+}
+
+type encodePlanPathCodecText struct{}
+
+func (encodePlanPathCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ path, err := value.(PathValuer).PathValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !path.Valid {
+ return nil, nil
+ }
+
+ var startByte, endByte byte
+ if path.Closed {
+ startByte = '('
+ endByte = ')'
+ } else {
+ startByte = '['
+ endByte = ']'
+ }
+ buf = append(buf, startByte)
+
+ for i, p := range path.P {
+ if i > 0 {
+ buf = append(buf, ',')
+ }
+ buf = append(buf, fmt.Sprintf(`(%s,%s)`,
+ strconv.FormatFloat(p.X, 'f', -1, 64),
+ strconv.FormatFloat(p.Y, 'f', -1, 64),
+ )...)
+ }
+
+ buf = append(buf, endByte)
+
+ return buf, nil
+}
+
+func (PathCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case PathScanner:
+ return scanPlanBinaryPathToPathScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case PathScanner:
+ return scanPlanTextAnyToPathScanner{}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryPathToPathScanner struct{}
+
+func (scanPlanBinaryPathToPathScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(PathScanner)
+
+ if src == nil {
+ return scanner.ScanPath(Path{})
+ }
+
+ if len(src) < 5 {
+ return fmt.Errorf("invalid length for Path: %v", len(src))
+ }
+
+ closed := src[0] == 1
+ pointCount := int(binary.BigEndian.Uint32(src[1:]))
+
+ rp := 5
+
+ if 5+pointCount*16 != len(src) {
+ return fmt.Errorf("invalid length for Path with %d points: %v", pointCount, len(src))
+ }
+
+ points := make([]Vec2, pointCount)
+ for i := 0; i < len(points); i++ {
+ x := binary.BigEndian.Uint64(src[rp:])
+ rp += 8
+ y := binary.BigEndian.Uint64(src[rp:])
+ rp += 8
+ points[i] = Vec2{math.Float64frombits(x), math.Float64frombits(y)}
+ }
+
+ return scanner.ScanPath(Path{
+ P: points,
+ Closed: closed,
+ Valid: true,
+ })
+}
+
+type scanPlanTextAnyToPathScanner struct{}
+
+func (scanPlanTextAnyToPathScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(PathScanner)
+
+ if src == nil {
+ return scanner.ScanPath(Path{})
+ }
+
+ if len(src) < 7 {
+ return fmt.Errorf("invalid length for Path: %v", len(src))
+ }
+
+ closed := src[0] == '('
+ points := make([]Vec2, 0)
+
+ str := string(src[2:])
+
+ for {
+ end := strings.IndexByte(str, ',')
+ x, err := strconv.ParseFloat(str[:end], 64)
+ if err != nil {
+ return err
+ }
+
+ str = str[end+1:]
+ end = strings.IndexByte(str, ')')
+
+ y, err := strconv.ParseFloat(str[:end], 64)
+ if err != nil {
+ return err
+ }
+
+ points = append(points, Vec2{x, y})
+
+ if end+3 < len(str) {
+ str = str[end+3:]
+ } else {
+ break
+ }
+ }
+
+ return scanner.ScanPath(Path{P: points, Closed: closed, Valid: true})
+}
+
+func (c PathCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ return codecDecodeToTextFormat(c, m, oid, format, src)
+}
+
+func (c PathCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var path Path
+ err := codecScan(c, m, oid, format, src, &path)
+ if err != nil {
+ return nil, err
+ }
+ return path, nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/pgtype.go b/vendor/github.com/jackc/pgx/v5/pgtype/pgtype.go
new file mode 100644
index 0000000..f9d43ed
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/pgtype.go
@@ -0,0 +1,2104 @@
+package pgtype
+
+import (
+ "database/sql"
+ "database/sql/driver"
+ "errors"
+ "fmt"
+ "net"
+ "net/netip"
+ "reflect"
+ "time"
+)
+
+// PostgreSQL oids for common types
+const (
+ BoolOID = 16
+ ByteaOID = 17
+ QCharOID = 18
+ NameOID = 19
+ Int8OID = 20
+ Int2OID = 21
+ Int4OID = 23
+ TextOID = 25
+ OIDOID = 26
+ TIDOID = 27
+ XIDOID = 28
+ CIDOID = 29
+ JSONOID = 114
+ XMLOID = 142
+ XMLArrayOID = 143
+ JSONArrayOID = 199
+ XID8ArrayOID = 271
+ PointOID = 600
+ LsegOID = 601
+ PathOID = 602
+ BoxOID = 603
+ PolygonOID = 604
+ LineOID = 628
+ LineArrayOID = 629
+ CIDROID = 650
+ CIDRArrayOID = 651
+ Float4OID = 700
+ Float8OID = 701
+ CircleOID = 718
+ CircleArrayOID = 719
+ UnknownOID = 705
+ Macaddr8OID = 774
+ MacaddrOID = 829
+ InetOID = 869
+ BoolArrayOID = 1000
+ QCharArrayOID = 1002
+ NameArrayOID = 1003
+ Int2ArrayOID = 1005
+ Int4ArrayOID = 1007
+ TextArrayOID = 1009
+ TIDArrayOID = 1010
+ ByteaArrayOID = 1001
+ XIDArrayOID = 1011
+ CIDArrayOID = 1012
+ BPCharArrayOID = 1014
+ VarcharArrayOID = 1015
+ Int8ArrayOID = 1016
+ PointArrayOID = 1017
+ LsegArrayOID = 1018
+ PathArrayOID = 1019
+ BoxArrayOID = 1020
+ Float4ArrayOID = 1021
+ Float8ArrayOID = 1022
+ PolygonArrayOID = 1027
+ OIDArrayOID = 1028
+ ACLItemOID = 1033
+ ACLItemArrayOID = 1034
+ MacaddrArrayOID = 1040
+ InetArrayOID = 1041
+ BPCharOID = 1042
+ VarcharOID = 1043
+ DateOID = 1082
+ TimeOID = 1083
+ TimestampOID = 1114
+ TimestampArrayOID = 1115
+ DateArrayOID = 1182
+ TimeArrayOID = 1183
+ TimestamptzOID = 1184
+ TimestamptzArrayOID = 1185
+ IntervalOID = 1186
+ IntervalArrayOID = 1187
+ NumericArrayOID = 1231
+ TimetzOID = 1266
+ TimetzArrayOID = 1270
+ BitOID = 1560
+ BitArrayOID = 1561
+ VarbitOID = 1562
+ VarbitArrayOID = 1563
+ NumericOID = 1700
+ RecordOID = 2249
+ RecordArrayOID = 2287
+ UUIDOID = 2950
+ UUIDArrayOID = 2951
+ JSONBOID = 3802
+ JSONBArrayOID = 3807
+ DaterangeOID = 3912
+ DaterangeArrayOID = 3913
+ Int4rangeOID = 3904
+ Int4rangeArrayOID = 3905
+ NumrangeOID = 3906
+ NumrangeArrayOID = 3907
+ TsrangeOID = 3908
+ TsrangeArrayOID = 3909
+ TstzrangeOID = 3910
+ TstzrangeArrayOID = 3911
+ Int8rangeOID = 3926
+ Int8rangeArrayOID = 3927
+ JSONPathOID = 4072
+ JSONPathArrayOID = 4073
+ Int4multirangeOID = 4451
+ NummultirangeOID = 4532
+ TsmultirangeOID = 4533
+ TstzmultirangeOID = 4534
+ DatemultirangeOID = 4535
+ Int8multirangeOID = 4536
+ XID8OID = 5069
+ Int4multirangeArrayOID = 6150
+ NummultirangeArrayOID = 6151
+ TsmultirangeArrayOID = 6152
+ TstzmultirangeArrayOID = 6153
+ DatemultirangeArrayOID = 6155
+ Int8multirangeArrayOID = 6157
+)
+
+type InfinityModifier int8
+
+const (
+ Infinity InfinityModifier = 1
+ Finite InfinityModifier = 0
+ NegativeInfinity InfinityModifier = -Infinity
+)
+
+func (im InfinityModifier) String() string {
+ switch im {
+ case Finite:
+ return "finite"
+ case Infinity:
+ return "infinity"
+ case NegativeInfinity:
+ return "-infinity"
+ default:
+ return "invalid"
+ }
+}
+
+// PostgreSQL format codes
+const (
+ TextFormatCode = 0
+ BinaryFormatCode = 1
+)
+
+// A Codec converts between Go and PostgreSQL values. A Codec must not be mutated after it is registered with a Map.
+type Codec interface {
+ // FormatSupported returns true if the format is supported.
+ FormatSupported(int16) bool
+
+ // PreferredFormat returns the preferred format.
+ PreferredFormat() int16
+
+ // PlanEncode returns an EncodePlan for encoding value into PostgreSQL format for oid and format. If no plan can be
+ // found then nil is returned.
+ PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan
+
+ // PlanScan returns a ScanPlan for scanning a PostgreSQL value into a destination with the same type as target. If
+ // no plan can be found then nil is returned.
+ PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan
+
+ // DecodeDatabaseSQLValue returns src decoded into a value compatible with the sql.Scanner interface.
+ DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error)
+
+ // DecodeValue returns src decoded into its default format.
+ DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error)
+}
+
+type nullAssignmentError struct {
+ dst any
+}
+
+func (e *nullAssignmentError) Error() string {
+ return fmt.Sprintf("cannot assign NULL to %T", e.dst)
+}
+
+// Type represents a PostgreSQL data type. It must not be mutated after it is registered with a Map.
+type Type struct {
+ Codec Codec
+ Name string
+ OID uint32
+}
+
+// Map is the mapping between PostgreSQL server types and Go type handling logic. It can encode values for
+// transmission to a PostgreSQL server and scan received values.
+type Map struct {
+ oidToType map[uint32]*Type
+ nameToType map[string]*Type
+ reflectTypeToName map[reflect.Type]string
+ oidToFormatCode map[uint32]int16
+
+ reflectTypeToType map[reflect.Type]*Type
+
+ memoizedScanPlans map[uint32]map[reflect.Type][2]ScanPlan
+ memoizedEncodePlans map[uint32]map[reflect.Type][2]EncodePlan
+
+ // TryWrapEncodePlanFuncs is a slice of functions that will wrap a value that cannot be encoded by the Codec. Every
+ // time a wrapper is found the PlanEncode method will be recursively called with the new value. This allows several layers of wrappers
+ // to be built up. There are default functions placed in this slice by NewMap(). In most cases these functions
+ // should run last. i.e. Additional functions should typically be prepended not appended.
+ TryWrapEncodePlanFuncs []TryWrapEncodePlanFunc
+
+ // TryWrapScanPlanFuncs is a slice of functions that will wrap a target that cannot be scanned into by the Codec. Every
+ // time a wrapper is found the PlanScan method will be recursively called with the new target. This allows several layers of wrappers
+ // to be built up. There are default functions placed in this slice by NewMap(). In most cases these functions
+ // should run last. i.e. Additional functions should typically be prepended not appended.
+ TryWrapScanPlanFuncs []TryWrapScanPlanFunc
+}
+
+// Copy returns a new Map containing the same registered types.
+func (m *Map) Copy() *Map {
+ newMap := NewMap()
+ for _, type_ := range m.oidToType {
+ newMap.RegisterType(type_)
+ }
+ return newMap
+}
+
+func NewMap() *Map {
+ defaultMapInitOnce.Do(initDefaultMap)
+
+ return &Map{
+ oidToType: make(map[uint32]*Type),
+ nameToType: make(map[string]*Type),
+ reflectTypeToName: make(map[reflect.Type]string),
+ oidToFormatCode: make(map[uint32]int16),
+
+ memoizedScanPlans: make(map[uint32]map[reflect.Type][2]ScanPlan),
+ memoizedEncodePlans: make(map[uint32]map[reflect.Type][2]EncodePlan),
+
+ TryWrapEncodePlanFuncs: []TryWrapEncodePlanFunc{
+ TryWrapDerefPointerEncodePlan,
+ TryWrapBuiltinTypeEncodePlan,
+ TryWrapFindUnderlyingTypeEncodePlan,
+ TryWrapStructEncodePlan,
+ TryWrapSliceEncodePlan,
+ TryWrapMultiDimSliceEncodePlan,
+ TryWrapArrayEncodePlan,
+ },
+
+ TryWrapScanPlanFuncs: []TryWrapScanPlanFunc{
+ TryPointerPointerScanPlan,
+ TryWrapBuiltinTypeScanPlan,
+ TryFindUnderlyingTypeScanPlan,
+ TryWrapStructScanPlan,
+ TryWrapPtrSliceScanPlan,
+ TryWrapPtrMultiDimSliceScanPlan,
+ TryWrapPtrArrayScanPlan,
+ },
+ }
+}
+
+// RegisterTypes registers multiple data types in the sequence they are provided.
+func (m *Map) RegisterTypes(types []*Type) {
+ for _, t := range types {
+ m.RegisterType(t)
+ }
+}
+
+// RegisterType registers a data type with the Map. t must not be mutated after it is registered.
+func (m *Map) RegisterType(t *Type) {
+ m.oidToType[t.OID] = t
+ m.nameToType[t.Name] = t
+ m.oidToFormatCode[t.OID] = t.Codec.PreferredFormat()
+
+ // Invalidated by type registration
+ m.reflectTypeToType = nil
+ for k := range m.memoizedScanPlans {
+ delete(m.memoizedScanPlans, k)
+ }
+ for k := range m.memoizedEncodePlans {
+ delete(m.memoizedEncodePlans, k)
+ }
+}
+
+// RegisterDefaultPgType registers a mapping of a Go type to a PostgreSQL type name. Typically the data type to be
+// encoded or decoded is determined by the PostgreSQL OID. But if the OID of a value to be encoded or decoded is
+// unknown, this additional mapping will be used by TypeForValue to determine a suitable data type.
+func (m *Map) RegisterDefaultPgType(value any, name string) {
+ m.reflectTypeToName[reflect.TypeOf(value)] = name
+
+ // Invalidated by type registration
+ m.reflectTypeToType = nil
+ for k := range m.memoizedScanPlans {
+ delete(m.memoizedScanPlans, k)
+ }
+ for k := range m.memoizedEncodePlans {
+ delete(m.memoizedEncodePlans, k)
+ }
+}
+
+// TypeForOID returns the Type registered for the given OID. The returned Type must not be mutated.
+func (m *Map) TypeForOID(oid uint32) (*Type, bool) {
+ if dt, ok := m.oidToType[oid]; ok {
+ return dt, true
+ }
+
+ dt, ok := defaultMap.oidToType[oid]
+ return dt, ok
+}
+
+// TypeForName returns the Type registered for the given name. The returned Type must not be mutated.
+func (m *Map) TypeForName(name string) (*Type, bool) {
+ if dt, ok := m.nameToType[name]; ok {
+ return dt, true
+ }
+ dt, ok := defaultMap.nameToType[name]
+ return dt, ok
+}
+
+func (m *Map) buildReflectTypeToType() {
+ m.reflectTypeToType = make(map[reflect.Type]*Type)
+
+ for reflectType, name := range m.reflectTypeToName {
+ if dt, ok := m.TypeForName(name); ok {
+ m.reflectTypeToType[reflectType] = dt
+ }
+ }
+}
+
+// TypeForValue finds a data type suitable for v. Use RegisterType to register types that can encode and decode
+// themselves. Use RegisterDefaultPgType to register that can be handled by a registered data type. The returned Type
+// must not be mutated.
+func (m *Map) TypeForValue(v any) (*Type, bool) {
+ if m.reflectTypeToType == nil {
+ m.buildReflectTypeToType()
+ }
+
+ if dt, ok := m.reflectTypeToType[reflect.TypeOf(v)]; ok {
+ return dt, true
+ }
+
+ dt, ok := defaultMap.reflectTypeToType[reflect.TypeOf(v)]
+ return dt, ok
+}
+
+// FormatCodeForOID returns the preferred format code for type oid. If the type is not registered it returns the text
+// format code.
+func (m *Map) FormatCodeForOID(oid uint32) int16 {
+ if fc, ok := m.oidToFormatCode[oid]; ok {
+ return fc
+ }
+
+ if fc, ok := defaultMap.oidToFormatCode[oid]; ok {
+ return fc
+ }
+
+ return TextFormatCode
+}
+
+// EncodePlan is a precompiled plan to encode a particular type into a particular OID and format.
+type EncodePlan interface {
+ // Encode appends the encoded bytes of value to buf. If value is the SQL value NULL then append nothing and return
+ // (nil, nil). The caller of Encode is responsible for writing the correct NULL value or the length of the data
+ // written.
+ Encode(value any, buf []byte) (newBuf []byte, err error)
+}
+
+// ScanPlan is a precompiled plan to scan into a type of destination.
+type ScanPlan interface {
+ // Scan scans src into target. src is only valid during the call to Scan. The ScanPlan must not retain a reference to
+ // src.
+ Scan(src []byte, target any) error
+}
+
+type scanPlanCodecSQLScanner struct {
+ c Codec
+ m *Map
+ oid uint32
+ formatCode int16
+}
+
+func (plan *scanPlanCodecSQLScanner) Scan(src []byte, dst any) error {
+ value, err := plan.c.DecodeDatabaseSQLValue(plan.m, plan.oid, plan.formatCode, src)
+ if err != nil {
+ return err
+ }
+
+ scanner := dst.(sql.Scanner)
+ return scanner.Scan(value)
+}
+
+type scanPlanSQLScanner struct {
+ formatCode int16
+}
+
+func (plan *scanPlanSQLScanner) Scan(src []byte, dst any) error {
+ scanner := getSQLScanner(dst)
+
+ if scanner == nil {
+ return fmt.Errorf("cannot scan into %T", dst)
+ }
+
+ if src == nil {
+ // This is necessary because interface value []byte:nil does not equal nil:nil for the binary format path and the
+ // text format path would be converted to empty string.
+ return scanner.Scan(nil)
+ } else if plan.formatCode == BinaryFormatCode {
+ return scanner.Scan(src)
+ } else {
+ return scanner.Scan(string(src))
+ }
+}
+
+// we don't know if the target is a sql.Scanner or a pointer on a sql.Scanner, so we need to check recursively
+func getSQLScanner(target any) sql.Scanner {
+ val := reflect.ValueOf(target)
+ for val.Kind() == reflect.Ptr {
+ if _, ok := val.Interface().(sql.Scanner); ok {
+ if val.IsNil() {
+ val.Set(reflect.New(val.Type().Elem()))
+ }
+ return val.Interface().(sql.Scanner)
+ }
+ val = val.Elem()
+ }
+ return nil
+}
+
+type scanPlanString struct{}
+
+func (scanPlanString) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ p := (dst).(*string)
+ *p = string(src)
+ return nil
+}
+
+type scanPlanAnyTextToBytes struct{}
+
+func (scanPlanAnyTextToBytes) Scan(src []byte, dst any) error {
+ dstBuf := dst.(*[]byte)
+ if src == nil {
+ *dstBuf = nil
+ return nil
+ }
+
+ *dstBuf = make([]byte, len(src))
+ copy(*dstBuf, src)
+ return nil
+}
+
+type scanPlanFail struct {
+ m *Map
+ oid uint32
+ formatCode int16
+}
+
+func (plan *scanPlanFail) Scan(src []byte, dst any) error {
+ // If src is NULL it might be possible to scan into dst even though it is the types are not compatible. While this
+ // may seem to be a contrived case it can occur when selecting NULL directly. PostgreSQL assigns it the type of text.
+ // It would be surprising to the caller to have to cast the NULL (e.g. `select null::int`). So try to figure out a
+ // compatible data type for dst and scan with that.
+ //
+ // See https://github.com/jackc/pgx/issues/1326
+ if src == nil {
+ // As a horrible hack try all types to find anything that can scan into dst.
+ for oid := range plan.m.oidToType {
+ // using planScan instead of Scan or PlanScan to avoid polluting the planned scan cache.
+ plan := plan.m.planScan(oid, plan.formatCode, dst, 0)
+ if _, ok := plan.(*scanPlanFail); !ok {
+ return plan.Scan(src, dst)
+ }
+ }
+ for oid := range defaultMap.oidToType {
+ if _, ok := plan.m.oidToType[oid]; !ok {
+ plan := plan.m.planScan(oid, plan.formatCode, dst, 0)
+ if _, ok := plan.(*scanPlanFail); !ok {
+ return plan.Scan(src, dst)
+ }
+ }
+ }
+ }
+
+ var format string
+ switch plan.formatCode {
+ case TextFormatCode:
+ format = "text"
+ case BinaryFormatCode:
+ format = "binary"
+ default:
+ format = fmt.Sprintf("unknown %d", plan.formatCode)
+ }
+
+ var dataTypeName string
+ if t, ok := plan.m.TypeForOID(plan.oid); ok {
+ dataTypeName = t.Name
+ } else {
+ dataTypeName = "unknown type"
+ }
+
+ return fmt.Errorf("cannot scan %s (OID %d) in %v format into %T", dataTypeName, plan.oid, format, dst)
+}
+
+// TryWrapScanPlanFunc is a function that tries to create a wrapper plan for target. If successful it returns a plan
+// that will convert the target passed to Scan and then call the next plan. nextTarget is target as it will be converted
+// by plan. It must be used to find another suitable ScanPlan. When it is found SetNext must be called on plan for it
+// to be usabled. ok indicates if a suitable wrapper was found.
+type TryWrapScanPlanFunc func(target any) (plan WrappedScanPlanNextSetter, nextTarget any, ok bool)
+
+type pointerPointerScanPlan struct {
+ dstType reflect.Type
+ next ScanPlan
+}
+
+func (plan *pointerPointerScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *pointerPointerScanPlan) Scan(src []byte, dst any) error {
+ el := reflect.ValueOf(dst).Elem()
+ if src == nil {
+ el.Set(reflect.Zero(el.Type()))
+ return nil
+ }
+
+ el.Set(reflect.New(el.Type().Elem()))
+ return plan.next.Scan(src, el.Interface())
+}
+
+// TryPointerPointerScanPlan handles a pointer to a pointer by setting the target to nil for SQL NULL and allocating and
+// scanning for non-NULL.
+func TryPointerPointerScanPlan(target any) (plan WrappedScanPlanNextSetter, nextTarget any, ok bool) {
+ if dstValue := reflect.ValueOf(target); dstValue.Kind() == reflect.Ptr {
+ elemValue := dstValue.Elem()
+ if elemValue.Kind() == reflect.Ptr {
+ plan = &pointerPointerScanPlan{dstType: dstValue.Type()}
+ return plan, reflect.Zero(elemValue.Type()).Interface(), true
+ }
+ }
+
+ return nil, nil, false
+}
+
+// SkipUnderlyingTypePlanner prevents PlanScan and PlanDecode from trying to use the underlying type.
+type SkipUnderlyingTypePlanner interface {
+ SkipUnderlyingTypePlan()
+}
+
+var elemKindToPointerTypes map[reflect.Kind]reflect.Type = map[reflect.Kind]reflect.Type{
+ reflect.Int: reflect.TypeOf(new(int)),
+ reflect.Int8: reflect.TypeOf(new(int8)),
+ reflect.Int16: reflect.TypeOf(new(int16)),
+ reflect.Int32: reflect.TypeOf(new(int32)),
+ reflect.Int64: reflect.TypeOf(new(int64)),
+ reflect.Uint: reflect.TypeOf(new(uint)),
+ reflect.Uint8: reflect.TypeOf(new(uint8)),
+ reflect.Uint16: reflect.TypeOf(new(uint16)),
+ reflect.Uint32: reflect.TypeOf(new(uint32)),
+ reflect.Uint64: reflect.TypeOf(new(uint64)),
+ reflect.Float32: reflect.TypeOf(new(float32)),
+ reflect.Float64: reflect.TypeOf(new(float64)),
+ reflect.String: reflect.TypeOf(new(string)),
+ reflect.Bool: reflect.TypeOf(new(bool)),
+}
+
+type underlyingTypeScanPlan struct {
+ dstType reflect.Type
+ nextDstType reflect.Type
+ next ScanPlan
+}
+
+func (plan *underlyingTypeScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *underlyingTypeScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, reflect.ValueOf(dst).Convert(plan.nextDstType).Interface())
+}
+
+// TryFindUnderlyingTypeScanPlan tries to convert to a Go builtin type. e.g. If value was of type MyString and
+// MyString was defined as a string then a wrapper plan would be returned that converts MyString to string.
+func TryFindUnderlyingTypeScanPlan(dst any) (plan WrappedScanPlanNextSetter, nextDst any, ok bool) {
+ if _, ok := dst.(SkipUnderlyingTypePlanner); ok {
+ return nil, nil, false
+ }
+
+ dstValue := reflect.ValueOf(dst)
+
+ if dstValue.Kind() == reflect.Ptr {
+ var elemValue reflect.Value
+ if dstValue.IsNil() {
+ elemValue = reflect.New(dstValue.Type().Elem()).Elem()
+ } else {
+ elemValue = dstValue.Elem()
+ }
+ nextDstType := elemKindToPointerTypes[elemValue.Kind()]
+ if nextDstType == nil {
+ if elemValue.Kind() == reflect.Slice {
+ if elemValue.Type().Elem().Kind() == reflect.Uint8 {
+ var v *[]byte
+ nextDstType = reflect.TypeOf(v)
+ }
+ }
+
+ // Get underlying type of any array.
+ // https://github.com/jackc/pgx/issues/2107
+ if elemValue.Kind() == reflect.Array {
+ nextDstType = reflect.PointerTo(reflect.ArrayOf(elemValue.Len(), elemValue.Type().Elem()))
+ }
+ }
+
+ if nextDstType != nil && dstValue.Type() != nextDstType && dstValue.CanConvert(nextDstType) {
+ return &underlyingTypeScanPlan{dstType: dstValue.Type(), nextDstType: nextDstType}, dstValue.Convert(nextDstType).Interface(), true
+ }
+ }
+
+ return nil, nil, false
+}
+
+type WrappedScanPlanNextSetter interface {
+ SetNext(ScanPlan)
+ ScanPlan
+}
+
+// TryWrapBuiltinTypeScanPlan tries to wrap a builtin type with a wrapper that provides additional methods. e.g. If
+// value was of type int32 then a wrapper plan would be returned that converts target to a value that implements
+// Int64Scanner.
+func TryWrapBuiltinTypeScanPlan(target any) (plan WrappedScanPlanNextSetter, nextDst any, ok bool) {
+ switch target := target.(type) {
+ case *int8:
+ return &wrapInt8ScanPlan{}, (*int8Wrapper)(target), true
+ case *int16:
+ return &wrapInt16ScanPlan{}, (*int16Wrapper)(target), true
+ case *int32:
+ return &wrapInt32ScanPlan{}, (*int32Wrapper)(target), true
+ case *int64:
+ return &wrapInt64ScanPlan{}, (*int64Wrapper)(target), true
+ case *int:
+ return &wrapIntScanPlan{}, (*intWrapper)(target), true
+ case *uint8:
+ return &wrapUint8ScanPlan{}, (*uint8Wrapper)(target), true
+ case *uint16:
+ return &wrapUint16ScanPlan{}, (*uint16Wrapper)(target), true
+ case *uint32:
+ return &wrapUint32ScanPlan{}, (*uint32Wrapper)(target), true
+ case *uint64:
+ return &wrapUint64ScanPlan{}, (*uint64Wrapper)(target), true
+ case *uint:
+ return &wrapUintScanPlan{}, (*uintWrapper)(target), true
+ case *float32:
+ return &wrapFloat32ScanPlan{}, (*float32Wrapper)(target), true
+ case *float64:
+ return &wrapFloat64ScanPlan{}, (*float64Wrapper)(target), true
+ case *string:
+ return &wrapStringScanPlan{}, (*stringWrapper)(target), true
+ case *time.Time:
+ return &wrapTimeScanPlan{}, (*timeWrapper)(target), true
+ case *time.Duration:
+ return &wrapDurationScanPlan{}, (*durationWrapper)(target), true
+ case *net.IPNet:
+ return &wrapNetIPNetScanPlan{}, (*netIPNetWrapper)(target), true
+ case *net.IP:
+ return &wrapNetIPScanPlan{}, (*netIPWrapper)(target), true
+ case *netip.Prefix:
+ return &wrapNetipPrefixScanPlan{}, (*netipPrefixWrapper)(target), true
+ case *netip.Addr:
+ return &wrapNetipAddrScanPlan{}, (*netipAddrWrapper)(target), true
+ case *map[string]*string:
+ return &wrapMapStringToPointerStringScanPlan{}, (*mapStringToPointerStringWrapper)(target), true
+ case *map[string]string:
+ return &wrapMapStringToStringScanPlan{}, (*mapStringToStringWrapper)(target), true
+ case *[16]byte:
+ return &wrapByte16ScanPlan{}, (*byte16Wrapper)(target), true
+ case *[]byte:
+ return &wrapByteSliceScanPlan{}, (*byteSliceWrapper)(target), true
+ }
+
+ return nil, nil, false
+}
+
+type wrapInt8ScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapInt8ScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapInt8ScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*int8Wrapper)(dst.(*int8)))
+}
+
+type wrapInt16ScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapInt16ScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapInt16ScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*int16Wrapper)(dst.(*int16)))
+}
+
+type wrapInt32ScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapInt32ScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapInt32ScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*int32Wrapper)(dst.(*int32)))
+}
+
+type wrapInt64ScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapInt64ScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapInt64ScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*int64Wrapper)(dst.(*int64)))
+}
+
+type wrapIntScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapIntScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapIntScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*intWrapper)(dst.(*int)))
+}
+
+type wrapUint8ScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapUint8ScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapUint8ScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*uint8Wrapper)(dst.(*uint8)))
+}
+
+type wrapUint16ScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapUint16ScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapUint16ScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*uint16Wrapper)(dst.(*uint16)))
+}
+
+type wrapUint32ScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapUint32ScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapUint32ScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*uint32Wrapper)(dst.(*uint32)))
+}
+
+type wrapUint64ScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapUint64ScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapUint64ScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*uint64Wrapper)(dst.(*uint64)))
+}
+
+type wrapUintScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapUintScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapUintScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*uintWrapper)(dst.(*uint)))
+}
+
+type wrapFloat32ScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapFloat32ScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapFloat32ScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*float32Wrapper)(dst.(*float32)))
+}
+
+type wrapFloat64ScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapFloat64ScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapFloat64ScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*float64Wrapper)(dst.(*float64)))
+}
+
+type wrapStringScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapStringScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapStringScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*stringWrapper)(dst.(*string)))
+}
+
+type wrapTimeScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapTimeScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapTimeScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*timeWrapper)(dst.(*time.Time)))
+}
+
+type wrapDurationScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapDurationScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapDurationScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*durationWrapper)(dst.(*time.Duration)))
+}
+
+type wrapNetIPNetScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapNetIPNetScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapNetIPNetScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*netIPNetWrapper)(dst.(*net.IPNet)))
+}
+
+type wrapNetIPScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapNetIPScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapNetIPScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*netIPWrapper)(dst.(*net.IP)))
+}
+
+type wrapNetipPrefixScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapNetipPrefixScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapNetipPrefixScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*netipPrefixWrapper)(dst.(*netip.Prefix)))
+}
+
+type wrapNetipAddrScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapNetipAddrScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapNetipAddrScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*netipAddrWrapper)(dst.(*netip.Addr)))
+}
+
+type wrapMapStringToPointerStringScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapMapStringToPointerStringScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapMapStringToPointerStringScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*mapStringToPointerStringWrapper)(dst.(*map[string]*string)))
+}
+
+type wrapMapStringToStringScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapMapStringToStringScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapMapStringToStringScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*mapStringToStringWrapper)(dst.(*map[string]string)))
+}
+
+type wrapByte16ScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapByte16ScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapByte16ScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*byte16Wrapper)(dst.(*[16]byte)))
+}
+
+type wrapByteSliceScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapByteSliceScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapByteSliceScanPlan) Scan(src []byte, dst any) error {
+ return plan.next.Scan(src, (*byteSliceWrapper)(dst.(*[]byte)))
+}
+
+type pointerEmptyInterfaceScanPlan struct {
+ codec Codec
+ m *Map
+ oid uint32
+ formatCode int16
+}
+
+func (plan *pointerEmptyInterfaceScanPlan) Scan(src []byte, dst any) error {
+ value, err := plan.codec.DecodeValue(plan.m, plan.oid, plan.formatCode, src)
+ if err != nil {
+ return err
+ }
+
+ ptrAny := dst.(*any)
+ *ptrAny = value
+
+ return nil
+}
+
+// TryWrapStructPlan tries to wrap a struct with a wrapper that implements CompositeIndexGetter.
+func TryWrapStructScanPlan(target any) (plan WrappedScanPlanNextSetter, nextValue any, ok bool) {
+ targetValue := reflect.ValueOf(target)
+ if targetValue.Kind() != reflect.Ptr {
+ return nil, nil, false
+ }
+
+ var targetElemValue reflect.Value
+ if targetValue.IsNil() {
+ targetElemValue = reflect.Zero(targetValue.Type().Elem())
+ } else {
+ targetElemValue = targetValue.Elem()
+ }
+ targetElemType := targetElemValue.Type()
+
+ if targetElemType.Kind() == reflect.Struct {
+ exportedFields := getExportedFieldValues(targetElemValue)
+ if len(exportedFields) == 0 {
+ return nil, nil, false
+ }
+
+ w := ptrStructWrapper{
+ s: target,
+ exportedFields: exportedFields,
+ }
+ return &wrapAnyPtrStructScanPlan{}, &w, true
+ }
+
+ return nil, nil, false
+}
+
+type wrapAnyPtrStructScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapAnyPtrStructScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapAnyPtrStructScanPlan) Scan(src []byte, target any) error {
+ w := ptrStructWrapper{
+ s: target,
+ exportedFields: getExportedFieldValues(reflect.ValueOf(target).Elem()),
+ }
+
+ return plan.next.Scan(src, &w)
+}
+
+// TryWrapPtrSliceScanPlan tries to wrap a pointer to a single dimension slice.
+func TryWrapPtrSliceScanPlan(target any) (plan WrappedScanPlanNextSetter, nextValue any, ok bool) {
+ // Avoid using reflect path for common types.
+ switch target := target.(type) {
+ case *[]int16:
+ return &wrapPtrSliceScanPlan[int16]{}, (*FlatArray[int16])(target), true
+ case *[]int32:
+ return &wrapPtrSliceScanPlan[int32]{}, (*FlatArray[int32])(target), true
+ case *[]int64:
+ return &wrapPtrSliceScanPlan[int64]{}, (*FlatArray[int64])(target), true
+ case *[]float32:
+ return &wrapPtrSliceScanPlan[float32]{}, (*FlatArray[float32])(target), true
+ case *[]float64:
+ return &wrapPtrSliceScanPlan[float64]{}, (*FlatArray[float64])(target), true
+ case *[]string:
+ return &wrapPtrSliceScanPlan[string]{}, (*FlatArray[string])(target), true
+ case *[]time.Time:
+ return &wrapPtrSliceScanPlan[time.Time]{}, (*FlatArray[time.Time])(target), true
+ }
+
+ targetType := reflect.TypeOf(target)
+ if targetType.Kind() != reflect.Ptr {
+ return nil, nil, false
+ }
+
+ targetElemType := targetType.Elem()
+
+ if targetElemType.Kind() == reflect.Slice {
+ slice := reflect.New(targetElemType).Elem()
+ return &wrapPtrSliceReflectScanPlan{}, &anySliceArrayReflect{slice: slice}, true
+ }
+ return nil, nil, false
+}
+
+type wrapPtrSliceScanPlan[T any] struct {
+ next ScanPlan
+}
+
+func (plan *wrapPtrSliceScanPlan[T]) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapPtrSliceScanPlan[T]) Scan(src []byte, target any) error {
+ return plan.next.Scan(src, (*FlatArray[T])(target.(*[]T)))
+}
+
+type wrapPtrSliceReflectScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapPtrSliceReflectScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapPtrSliceReflectScanPlan) Scan(src []byte, target any) error {
+ return plan.next.Scan(src, &anySliceArrayReflect{slice: reflect.ValueOf(target).Elem()})
+}
+
+// TryWrapPtrMultiDimSliceScanPlan tries to wrap a pointer to a multi-dimension slice.
+func TryWrapPtrMultiDimSliceScanPlan(target any) (plan WrappedScanPlanNextSetter, nextValue any, ok bool) {
+ targetValue := reflect.ValueOf(target)
+ if targetValue.Kind() != reflect.Ptr {
+ return nil, nil, false
+ }
+
+ targetElemValue := targetValue.Elem()
+
+ if targetElemValue.Kind() == reflect.Slice {
+ elemElemKind := targetElemValue.Type().Elem().Kind()
+ if elemElemKind == reflect.Slice {
+ if !isRagged(targetElemValue) {
+ return &wrapPtrMultiDimSliceScanPlan{}, &anyMultiDimSliceArray{slice: targetValue.Elem()}, true
+ }
+ }
+ }
+
+ return nil, nil, false
+}
+
+type wrapPtrMultiDimSliceScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapPtrMultiDimSliceScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapPtrMultiDimSliceScanPlan) Scan(src []byte, target any) error {
+ return plan.next.Scan(src, &anyMultiDimSliceArray{slice: reflect.ValueOf(target).Elem()})
+}
+
+// TryWrapPtrArrayScanPlan tries to wrap a pointer to a single dimension array.
+func TryWrapPtrArrayScanPlan(target any) (plan WrappedScanPlanNextSetter, nextValue any, ok bool) {
+ targetValue := reflect.ValueOf(target)
+ if targetValue.Kind() != reflect.Ptr {
+ return nil, nil, false
+ }
+
+ targetElemValue := targetValue.Elem()
+
+ if targetElemValue.Kind() == reflect.Array {
+ return &wrapPtrArrayReflectScanPlan{}, &anyArrayArrayReflect{array: targetElemValue}, true
+ }
+ return nil, nil, false
+}
+
+type wrapPtrArrayReflectScanPlan struct {
+ next ScanPlan
+}
+
+func (plan *wrapPtrArrayReflectScanPlan) SetNext(next ScanPlan) { plan.next = next }
+
+func (plan *wrapPtrArrayReflectScanPlan) Scan(src []byte, target any) error {
+ return plan.next.Scan(src, &anyArrayArrayReflect{array: reflect.ValueOf(target).Elem()})
+}
+
+// PlanScan prepares a plan to scan a value into target.
+func (m *Map) PlanScan(oid uint32, formatCode int16, target any) ScanPlan {
+ return m.planScanDepth(oid, formatCode, target, 0)
+}
+
+func (m *Map) planScanDepth(oid uint32, formatCode int16, target any, depth int) ScanPlan {
+ if depth > 8 {
+ return &scanPlanFail{m: m, oid: oid, formatCode: formatCode}
+ }
+
+ oidMemo := m.memoizedScanPlans[oid]
+ if oidMemo == nil {
+ oidMemo = make(map[reflect.Type][2]ScanPlan)
+ m.memoizedScanPlans[oid] = oidMemo
+ }
+ targetReflectType := reflect.TypeOf(target)
+ typeMemo := oidMemo[targetReflectType]
+ plan := typeMemo[formatCode]
+ if plan == nil {
+ plan = m.planScan(oid, formatCode, target, depth)
+ typeMemo[formatCode] = plan
+ oidMemo[targetReflectType] = typeMemo
+ }
+
+ return plan
+}
+
+func (m *Map) planScan(oid uint32, formatCode int16, target any, depth int) ScanPlan {
+ if target == nil {
+ return &scanPlanFail{m: m, oid: oid, formatCode: formatCode}
+ }
+
+ if _, ok := target.(*UndecodedBytes); ok {
+ return scanPlanAnyToUndecodedBytes{}
+ }
+
+ switch formatCode {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case *string:
+ switch oid {
+ case TextOID, VarcharOID:
+ return scanPlanString{}
+ }
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case *string:
+ return scanPlanString{}
+ case *[]byte:
+ if oid != ByteaOID {
+ return scanPlanAnyTextToBytes{}
+ }
+ case TextScanner:
+ return scanPlanTextAnyToTextScanner{}
+ }
+ }
+
+ var dt *Type
+
+ if dataType, ok := m.TypeForOID(oid); ok {
+ dt = dataType
+ } else if dataType, ok := m.TypeForValue(target); ok {
+ dt = dataType
+ oid = dt.OID // Preserve assumed OID in case we are recursively called below.
+ }
+
+ if dt != nil {
+ if plan := dt.Codec.PlanScan(m, oid, formatCode, target); plan != nil {
+ return plan
+ }
+ }
+
+ // This needs to happen before trying m.TryWrapScanPlanFuncs. Otherwise, a sql.Scanner would not get called if it was
+ // defined on a type that could be unwrapped such as `type myString string`.
+ //
+ // https://github.com/jackc/pgtype/issues/197
+ if _, ok := target.(sql.Scanner); ok {
+ if dt == nil {
+ return &scanPlanSQLScanner{formatCode: formatCode}
+ } else {
+ return &scanPlanCodecSQLScanner{c: dt.Codec, m: m, oid: oid, formatCode: formatCode}
+ }
+ }
+
+ for _, f := range m.TryWrapScanPlanFuncs {
+ if wrapperPlan, nextDst, ok := f(target); ok {
+ if nextPlan := m.planScanDepth(oid, formatCode, nextDst, depth+1); nextPlan != nil {
+ if _, failed := nextPlan.(*scanPlanFail); !failed {
+ wrapperPlan.SetNext(nextPlan)
+ return wrapperPlan
+ }
+ }
+ }
+ }
+
+ if dt != nil {
+ if _, ok := target.(*any); ok {
+ return &pointerEmptyInterfaceScanPlan{codec: dt.Codec, m: m, oid: oid, formatCode: formatCode}
+ }
+ }
+
+ return &scanPlanFail{m: m, oid: oid, formatCode: formatCode}
+}
+
+func (m *Map) Scan(oid uint32, formatCode int16, src []byte, dst any) error {
+ if dst == nil {
+ return nil
+ }
+
+ plan := m.PlanScan(oid, formatCode, dst)
+ return plan.Scan(src, dst)
+}
+
+var ErrScanTargetTypeChanged = errors.New("scan target type changed")
+
+func codecScan(codec Codec, m *Map, oid uint32, format int16, src []byte, dst any) error {
+ scanPlan := codec.PlanScan(m, oid, format, dst)
+ if scanPlan == nil {
+ return fmt.Errorf("PlanScan did not find a plan")
+ }
+ return scanPlan.Scan(src, dst)
+}
+
+func codecDecodeToTextFormat(codec Codec, m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ if format == TextFormatCode {
+ return string(src), nil
+ } else {
+ value, err := codec.DecodeValue(m, oid, format, src)
+ if err != nil {
+ return nil, err
+ }
+ buf, err := m.Encode(oid, TextFormatCode, value, nil)
+ if err != nil {
+ return nil, err
+ }
+ return string(buf), nil
+ }
+}
+
+// PlanEncode returns an Encode plan for encoding value into PostgreSQL format for oid and format. If no plan can be
+// found then nil is returned.
+func (m *Map) PlanEncode(oid uint32, format int16, value any) EncodePlan {
+ return m.planEncodeDepth(oid, format, value, 0)
+}
+
+func (m *Map) planEncodeDepth(oid uint32, format int16, value any, depth int) EncodePlan {
+ // Guard against infinite recursion.
+ if depth > 8 {
+ return nil
+ }
+
+ oidMemo := m.memoizedEncodePlans[oid]
+ if oidMemo == nil {
+ oidMemo = make(map[reflect.Type][2]EncodePlan)
+ m.memoizedEncodePlans[oid] = oidMemo
+ }
+ targetReflectType := reflect.TypeOf(value)
+ typeMemo := oidMemo[targetReflectType]
+ plan := typeMemo[format]
+ if plan == nil {
+ plan = m.planEncode(oid, format, value, depth)
+ typeMemo[format] = plan
+ oidMemo[targetReflectType] = typeMemo
+ }
+
+ return plan
+}
+
+func (m *Map) planEncode(oid uint32, format int16, value any, depth int) EncodePlan {
+ if format == TextFormatCode {
+ switch value.(type) {
+ case string:
+ return encodePlanStringToAnyTextFormat{}
+ case TextValuer:
+ return encodePlanTextValuerToAnyTextFormat{}
+ }
+ }
+
+ var dt *Type
+ if dataType, ok := m.TypeForOID(oid); ok {
+ dt = dataType
+ } else {
+ // If no type for the OID was found, then either it is unknowable (e.g. the simple protocol) or it is an
+ // unregistered type. In either case try to find the type and OID that matches the value (e.g. a []byte would be
+ // registered to PostgreSQL bytea).
+ if dataType, ok := m.TypeForValue(value); ok {
+ dt = dataType
+ oid = dt.OID // Preserve assumed OID in case we are recursively called below.
+ }
+ }
+
+ if dt != nil {
+ if plan := dt.Codec.PlanEncode(m, oid, format, value); plan != nil {
+ return plan
+ }
+ }
+
+ for _, f := range m.TryWrapEncodePlanFuncs {
+ if wrapperPlan, nextValue, ok := f(value); ok {
+ if nextPlan := m.planEncodeDepth(oid, format, nextValue, depth+1); nextPlan != nil {
+ wrapperPlan.SetNext(nextPlan)
+ return wrapperPlan
+ }
+ }
+ }
+
+ if _, ok := value.(driver.Valuer); ok {
+ return &encodePlanDriverValuer{m: m, oid: oid, formatCode: format}
+ }
+
+ return nil
+}
+
+type encodePlanStringToAnyTextFormat struct{}
+
+func (encodePlanStringToAnyTextFormat) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ s := value.(string)
+ return append(buf, s...), nil
+}
+
+type encodePlanTextValuerToAnyTextFormat struct{}
+
+func (encodePlanTextValuerToAnyTextFormat) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ t, err := value.(TextValuer).TextValue()
+ if err != nil {
+ return nil, err
+ }
+ if !t.Valid {
+ return nil, nil
+ }
+
+ return append(buf, t.String...), nil
+}
+
+type encodePlanDriverValuer struct {
+ m *Map
+ oid uint32
+ formatCode int16
+}
+
+func (plan *encodePlanDriverValuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ dv := value.(driver.Valuer)
+ if dv == nil {
+ return nil, nil
+ }
+ v, err := dv.Value()
+ if err != nil {
+ return nil, err
+ }
+ if v == nil {
+ return nil, nil
+ }
+
+ newBuf, err = plan.m.Encode(plan.oid, plan.formatCode, v, buf)
+ if err == nil {
+ return newBuf, nil
+ }
+
+ s, ok := v.(string)
+ if !ok {
+ return nil, err
+ }
+
+ var scannedValue any
+ scanErr := plan.m.Scan(plan.oid, TextFormatCode, []byte(s), &scannedValue)
+ if scanErr != nil {
+ return nil, err
+ }
+
+ // Prevent infinite loop. We can't encode this. See https://github.com/jackc/pgx/issues/1331.
+ if reflect.TypeOf(value) == reflect.TypeOf(scannedValue) {
+ return nil, fmt.Errorf("tried to encode %v via encoding to text and scanning but failed due to receiving same type back", value)
+ }
+
+ var err2 error
+ newBuf, err2 = plan.m.Encode(plan.oid, BinaryFormatCode, scannedValue, buf)
+ if err2 != nil {
+ return nil, err
+ }
+
+ return newBuf, nil
+}
+
+// TryWrapEncodePlanFunc is a function that tries to create a wrapper plan for value. If successful it returns a plan
+// that will convert the value passed to Encode and then call the next plan. nextValue is value as it will be converted
+// by plan. It must be used to find another suitable EncodePlan. When it is found SetNext must be called on plan for it
+// to be usabled. ok indicates if a suitable wrapper was found.
+type TryWrapEncodePlanFunc func(value any) (plan WrappedEncodePlanNextSetter, nextValue any, ok bool)
+
+type derefPointerEncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *derefPointerEncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *derefPointerEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ ptr := reflect.ValueOf(value)
+
+ if ptr.IsNil() {
+ return nil, nil
+ }
+
+ return plan.next.Encode(ptr.Elem().Interface(), buf)
+}
+
+// TryWrapDerefPointerEncodePlan tries to dereference a pointer. e.g. If value was of type *string then a wrapper plan
+// would be returned that dereferences the value.
+func TryWrapDerefPointerEncodePlan(value any) (plan WrappedEncodePlanNextSetter, nextValue any, ok bool) {
+ if _, ok := value.(driver.Valuer); ok {
+ return nil, nil, false
+ }
+
+ if valueType := reflect.TypeOf(value); valueType != nil && valueType.Kind() == reflect.Ptr {
+ return &derefPointerEncodePlan{}, reflect.New(valueType.Elem()).Elem().Interface(), true
+ }
+
+ return nil, nil, false
+}
+
+var kindToTypes map[reflect.Kind]reflect.Type = map[reflect.Kind]reflect.Type{
+ reflect.Int: reflect.TypeOf(int(0)),
+ reflect.Int8: reflect.TypeOf(int8(0)),
+ reflect.Int16: reflect.TypeOf(int16(0)),
+ reflect.Int32: reflect.TypeOf(int32(0)),
+ reflect.Int64: reflect.TypeOf(int64(0)),
+ reflect.Uint: reflect.TypeOf(uint(0)),
+ reflect.Uint8: reflect.TypeOf(uint8(0)),
+ reflect.Uint16: reflect.TypeOf(uint16(0)),
+ reflect.Uint32: reflect.TypeOf(uint32(0)),
+ reflect.Uint64: reflect.TypeOf(uint64(0)),
+ reflect.Float32: reflect.TypeOf(float32(0)),
+ reflect.Float64: reflect.TypeOf(float64(0)),
+ reflect.String: reflect.TypeOf(""),
+ reflect.Bool: reflect.TypeOf(false),
+}
+
+var byteSliceType = reflect.TypeOf([]byte{})
+
+type underlyingTypeEncodePlan struct {
+ nextValueType reflect.Type
+ next EncodePlan
+}
+
+func (plan *underlyingTypeEncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *underlyingTypeEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(reflect.ValueOf(value).Convert(plan.nextValueType).Interface(), buf)
+}
+
+// TryWrapFindUnderlyingTypeEncodePlan tries to convert to a Go builtin type. e.g. If value was of type MyString and
+// MyString was defined as a string then a wrapper plan would be returned that converts MyString to string.
+func TryWrapFindUnderlyingTypeEncodePlan(value any) (plan WrappedEncodePlanNextSetter, nextValue any, ok bool) {
+ if value == nil {
+ return nil, nil, false
+ }
+
+ if _, ok := value.(driver.Valuer); ok {
+ return nil, nil, false
+ }
+
+ if _, ok := value.(SkipUnderlyingTypePlanner); ok {
+ return nil, nil, false
+ }
+
+ refValue := reflect.ValueOf(value)
+
+ nextValueType := kindToTypes[refValue.Kind()]
+ if nextValueType != nil && refValue.Type() != nextValueType {
+ return &underlyingTypeEncodePlan{nextValueType: nextValueType}, refValue.Convert(nextValueType).Interface(), true
+ }
+
+ // []byte is a special case. It is a slice but we treat it as a scalar type. In the case of a named type like
+ // json.RawMessage which is defined as []byte the underlying type should be considered as []byte. But any other slice
+ // does not have a special underlying type.
+ //
+ // https://github.com/jackc/pgx/issues/1763
+ if refValue.Type() != byteSliceType && refValue.Type().AssignableTo(byteSliceType) {
+ return &underlyingTypeEncodePlan{nextValueType: byteSliceType}, refValue.Convert(byteSliceType).Interface(), true
+ }
+
+ // Get underlying type of any array.
+ // https://github.com/jackc/pgx/issues/2107
+ if refValue.Kind() == reflect.Array {
+ underlyingArrayType := reflect.ArrayOf(refValue.Len(), refValue.Type().Elem())
+ if refValue.Type() != underlyingArrayType {
+ return &underlyingTypeEncodePlan{nextValueType: underlyingArrayType}, refValue.Convert(underlyingArrayType).Interface(), true
+ }
+ }
+
+ return nil, nil, false
+}
+
+type WrappedEncodePlanNextSetter interface {
+ SetNext(EncodePlan)
+ EncodePlan
+}
+
+// TryWrapBuiltinTypeEncodePlan tries to wrap a builtin type with a wrapper that provides additional methods. e.g. If
+// value was of type int32 then a wrapper plan would be returned that converts value to a type that implements
+// Int64Valuer.
+func TryWrapBuiltinTypeEncodePlan(value any) (plan WrappedEncodePlanNextSetter, nextValue any, ok bool) {
+ if _, ok := value.(driver.Valuer); ok {
+ return nil, nil, false
+ }
+
+ switch value := value.(type) {
+ case int8:
+ return &wrapInt8EncodePlan{}, int8Wrapper(value), true
+ case int16:
+ return &wrapInt16EncodePlan{}, int16Wrapper(value), true
+ case int32:
+ return &wrapInt32EncodePlan{}, int32Wrapper(value), true
+ case int64:
+ return &wrapInt64EncodePlan{}, int64Wrapper(value), true
+ case int:
+ return &wrapIntEncodePlan{}, intWrapper(value), true
+ case uint8:
+ return &wrapUint8EncodePlan{}, uint8Wrapper(value), true
+ case uint16:
+ return &wrapUint16EncodePlan{}, uint16Wrapper(value), true
+ case uint32:
+ return &wrapUint32EncodePlan{}, uint32Wrapper(value), true
+ case uint64:
+ return &wrapUint64EncodePlan{}, uint64Wrapper(value), true
+ case uint:
+ return &wrapUintEncodePlan{}, uintWrapper(value), true
+ case float32:
+ return &wrapFloat32EncodePlan{}, float32Wrapper(value), true
+ case float64:
+ return &wrapFloat64EncodePlan{}, float64Wrapper(value), true
+ case string:
+ return &wrapStringEncodePlan{}, stringWrapper(value), true
+ case time.Time:
+ return &wrapTimeEncodePlan{}, timeWrapper(value), true
+ case time.Duration:
+ return &wrapDurationEncodePlan{}, durationWrapper(value), true
+ case net.IPNet:
+ return &wrapNetIPNetEncodePlan{}, netIPNetWrapper(value), true
+ case net.IP:
+ return &wrapNetIPEncodePlan{}, netIPWrapper(value), true
+ case netip.Prefix:
+ return &wrapNetipPrefixEncodePlan{}, netipPrefixWrapper(value), true
+ case netip.Addr:
+ return &wrapNetipAddrEncodePlan{}, netipAddrWrapper(value), true
+ case map[string]*string:
+ return &wrapMapStringToPointerStringEncodePlan{}, mapStringToPointerStringWrapper(value), true
+ case map[string]string:
+ return &wrapMapStringToStringEncodePlan{}, mapStringToStringWrapper(value), true
+ case [16]byte:
+ return &wrapByte16EncodePlan{}, byte16Wrapper(value), true
+ case []byte:
+ return &wrapByteSliceEncodePlan{}, byteSliceWrapper(value), true
+ case fmt.Stringer:
+ return &wrapFmtStringerEncodePlan{}, fmtStringerWrapper{value}, true
+ }
+
+ return nil, nil, false
+}
+
+type wrapInt8EncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapInt8EncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapInt8EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(int8Wrapper(value.(int8)), buf)
+}
+
+type wrapInt16EncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapInt16EncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapInt16EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(int16Wrapper(value.(int16)), buf)
+}
+
+type wrapInt32EncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapInt32EncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapInt32EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(int32Wrapper(value.(int32)), buf)
+}
+
+type wrapInt64EncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapInt64EncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapInt64EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(int64Wrapper(value.(int64)), buf)
+}
+
+type wrapIntEncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapIntEncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapIntEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(intWrapper(value.(int)), buf)
+}
+
+type wrapUint8EncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapUint8EncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapUint8EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(uint8Wrapper(value.(uint8)), buf)
+}
+
+type wrapUint16EncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapUint16EncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapUint16EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(uint16Wrapper(value.(uint16)), buf)
+}
+
+type wrapUint32EncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapUint32EncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapUint32EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(uint32Wrapper(value.(uint32)), buf)
+}
+
+type wrapUint64EncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapUint64EncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapUint64EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(uint64Wrapper(value.(uint64)), buf)
+}
+
+type wrapUintEncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapUintEncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapUintEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(uintWrapper(value.(uint)), buf)
+}
+
+type wrapFloat32EncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapFloat32EncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapFloat32EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(float32Wrapper(value.(float32)), buf)
+}
+
+type wrapFloat64EncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapFloat64EncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapFloat64EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(float64Wrapper(value.(float64)), buf)
+}
+
+type wrapStringEncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapStringEncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapStringEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(stringWrapper(value.(string)), buf)
+}
+
+type wrapTimeEncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapTimeEncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapTimeEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(timeWrapper(value.(time.Time)), buf)
+}
+
+type wrapDurationEncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapDurationEncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapDurationEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(durationWrapper(value.(time.Duration)), buf)
+}
+
+type wrapNetIPNetEncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapNetIPNetEncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapNetIPNetEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(netIPNetWrapper(value.(net.IPNet)), buf)
+}
+
+type wrapNetIPEncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapNetIPEncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapNetIPEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(netIPWrapper(value.(net.IP)), buf)
+}
+
+type wrapNetipPrefixEncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapNetipPrefixEncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapNetipPrefixEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(netipPrefixWrapper(value.(netip.Prefix)), buf)
+}
+
+type wrapNetipAddrEncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapNetipAddrEncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapNetipAddrEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(netipAddrWrapper(value.(netip.Addr)), buf)
+}
+
+type wrapMapStringToPointerStringEncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapMapStringToPointerStringEncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapMapStringToPointerStringEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(mapStringToPointerStringWrapper(value.(map[string]*string)), buf)
+}
+
+type wrapMapStringToStringEncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapMapStringToStringEncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapMapStringToStringEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(mapStringToStringWrapper(value.(map[string]string)), buf)
+}
+
+type wrapByte16EncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapByte16EncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapByte16EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(byte16Wrapper(value.([16]byte)), buf)
+}
+
+type wrapByteSliceEncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapByteSliceEncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapByteSliceEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(byteSliceWrapper(value.([]byte)), buf)
+}
+
+type wrapFmtStringerEncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapFmtStringerEncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapFmtStringerEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode(fmtStringerWrapper{value.(fmt.Stringer)}, buf)
+}
+
+// TryWrapStructPlan tries to wrap a struct with a wrapper that implements CompositeIndexGetter.
+func TryWrapStructEncodePlan(value any) (plan WrappedEncodePlanNextSetter, nextValue any, ok bool) {
+ if _, ok := value.(driver.Valuer); ok {
+ return nil, nil, false
+ }
+
+ if valueType := reflect.TypeOf(value); valueType != nil && valueType.Kind() == reflect.Struct {
+ exportedFields := getExportedFieldValues(reflect.ValueOf(value))
+ if len(exportedFields) == 0 {
+ return nil, nil, false
+ }
+
+ w := structWrapper{
+ s: value,
+ exportedFields: exportedFields,
+ }
+ return &wrapAnyStructEncodePlan{}, w, true
+ }
+
+ return nil, nil, false
+}
+
+type wrapAnyStructEncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapAnyStructEncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapAnyStructEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ w := structWrapper{
+ s: value,
+ exportedFields: getExportedFieldValues(reflect.ValueOf(value)),
+ }
+
+ return plan.next.Encode(w, buf)
+}
+
+func getExportedFieldValues(structValue reflect.Value) []reflect.Value {
+ structType := structValue.Type()
+ exportedFields := make([]reflect.Value, 0, structValue.NumField())
+ for i := 0; i < structType.NumField(); i++ {
+ sf := structType.Field(i)
+ if sf.IsExported() {
+ exportedFields = append(exportedFields, structValue.Field(i))
+ }
+ }
+
+ return exportedFields
+}
+
+func TryWrapSliceEncodePlan(value any) (plan WrappedEncodePlanNextSetter, nextValue any, ok bool) {
+ if _, ok := value.(driver.Valuer); ok {
+ return nil, nil, false
+ }
+
+ // Avoid using reflect path for common types.
+ switch value := value.(type) {
+ case []int16:
+ return &wrapSliceEncodePlan[int16]{}, (FlatArray[int16])(value), true
+ case []int32:
+ return &wrapSliceEncodePlan[int32]{}, (FlatArray[int32])(value), true
+ case []int64:
+ return &wrapSliceEncodePlan[int64]{}, (FlatArray[int64])(value), true
+ case []float32:
+ return &wrapSliceEncodePlan[float32]{}, (FlatArray[float32])(value), true
+ case []float64:
+ return &wrapSliceEncodePlan[float64]{}, (FlatArray[float64])(value), true
+ case []string:
+ return &wrapSliceEncodePlan[string]{}, (FlatArray[string])(value), true
+ case []time.Time:
+ return &wrapSliceEncodePlan[time.Time]{}, (FlatArray[time.Time])(value), true
+ }
+
+ if valueType := reflect.TypeOf(value); valueType != nil && valueType.Kind() == reflect.Slice {
+ w := anySliceArrayReflect{
+ slice: reflect.ValueOf(value),
+ }
+ return &wrapSliceEncodeReflectPlan{}, w, true
+ }
+
+ return nil, nil, false
+}
+
+type wrapSliceEncodePlan[T any] struct {
+ next EncodePlan
+}
+
+func (plan *wrapSliceEncodePlan[T]) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapSliceEncodePlan[T]) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ return plan.next.Encode((FlatArray[T])(value.([]T)), buf)
+}
+
+type wrapSliceEncodeReflectPlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapSliceEncodeReflectPlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapSliceEncodeReflectPlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ w := anySliceArrayReflect{
+ slice: reflect.ValueOf(value),
+ }
+
+ return plan.next.Encode(w, buf)
+}
+
+func TryWrapMultiDimSliceEncodePlan(value any) (plan WrappedEncodePlanNextSetter, nextValue any, ok bool) {
+ if _, ok := value.(driver.Valuer); ok {
+ return nil, nil, false
+ }
+
+ sliceValue := reflect.ValueOf(value)
+ if sliceValue.Kind() == reflect.Slice {
+ valueElemType := sliceValue.Type().Elem()
+
+ if valueElemType.Kind() == reflect.Slice {
+ if !isRagged(sliceValue) {
+ w := anyMultiDimSliceArray{
+ slice: reflect.ValueOf(value),
+ }
+ return &wrapMultiDimSliceEncodePlan{}, &w, true
+ }
+ }
+ }
+
+ return nil, nil, false
+}
+
+type wrapMultiDimSliceEncodePlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapMultiDimSliceEncodePlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapMultiDimSliceEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ w := anyMultiDimSliceArray{
+ slice: reflect.ValueOf(value),
+ }
+
+ return plan.next.Encode(&w, buf)
+}
+
+func TryWrapArrayEncodePlan(value any) (plan WrappedEncodePlanNextSetter, nextValue any, ok bool) {
+ if _, ok := value.(driver.Valuer); ok {
+ return nil, nil, false
+ }
+
+ if valueType := reflect.TypeOf(value); valueType != nil && valueType.Kind() == reflect.Array {
+ w := anyArrayArrayReflect{
+ array: reflect.ValueOf(value),
+ }
+ return &wrapArrayEncodeReflectPlan{}, w, true
+ }
+
+ return nil, nil, false
+}
+
+type wrapArrayEncodeReflectPlan struct {
+ next EncodePlan
+}
+
+func (plan *wrapArrayEncodeReflectPlan) SetNext(next EncodePlan) { plan.next = next }
+
+func (plan *wrapArrayEncodeReflectPlan) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ w := anyArrayArrayReflect{
+ array: reflect.ValueOf(value),
+ }
+
+ return plan.next.Encode(w, buf)
+}
+
+func newEncodeError(value any, m *Map, oid uint32, formatCode int16, err error) error {
+ var format string
+ switch formatCode {
+ case TextFormatCode:
+ format = "text"
+ case BinaryFormatCode:
+ format = "binary"
+ default:
+ format = fmt.Sprintf("unknown (%d)", formatCode)
+ }
+
+ var dataTypeName string
+ if t, ok := m.TypeForOID(oid); ok {
+ dataTypeName = t.Name
+ } else {
+ dataTypeName = "unknown type"
+ }
+
+ return fmt.Errorf("unable to encode %#v into %s format for %s (OID %d): %w", value, format, dataTypeName, oid, err)
+}
+
+// Encode appends the encoded bytes of value to buf. If value is the SQL value NULL then append nothing and return
+// (nil, nil). The caller of Encode is responsible for writing the correct NULL value or the length of the data
+// written.
+func (m *Map) Encode(oid uint32, formatCode int16, value any, buf []byte) (newBuf []byte, err error) {
+ if isNil, callNilDriverValuer := isNilDriverValuer(value); isNil {
+ if callNilDriverValuer {
+ newBuf, err = (&encodePlanDriverValuer{m: m, oid: oid, formatCode: formatCode}).Encode(value, buf)
+ if err != nil {
+ return nil, newEncodeError(value, m, oid, formatCode, err)
+ }
+
+ return newBuf, nil
+ } else {
+ return nil, nil
+ }
+ }
+
+ plan := m.PlanEncode(oid, formatCode, value)
+ if plan == nil {
+ return nil, newEncodeError(value, m, oid, formatCode, errors.New("cannot find encode plan"))
+ }
+
+ newBuf, err = plan.Encode(value, buf)
+ if err != nil {
+ return nil, newEncodeError(value, m, oid, formatCode, err)
+ }
+
+ return newBuf, nil
+}
+
+// SQLScanner returns a database/sql.Scanner for v. This is necessary for types like Array[T] and Range[T] where the
+// type needs assistance from Map to implement the sql.Scanner interface. It is not necessary for types like Box that
+// implement sql.Scanner directly.
+//
+// This uses the type of v to look up the PostgreSQL OID that v presumably came from. This means v must be registered
+// with m by calling RegisterDefaultPgType.
+func (m *Map) SQLScanner(v any) sql.Scanner {
+ if s, ok := v.(sql.Scanner); ok {
+ return s
+ }
+
+ return &sqlScannerWrapper{m: m, v: v}
+}
+
+type sqlScannerWrapper struct {
+ m *Map
+ v any
+}
+
+func (w *sqlScannerWrapper) Scan(src any) error {
+ t, ok := w.m.TypeForValue(w.v)
+ if !ok {
+ return fmt.Errorf("cannot convert to sql.Scanner: cannot find registered type for %T", w.v)
+ }
+
+ var bufSrc []byte
+ if src != nil {
+ switch src := src.(type) {
+ case string:
+ bufSrc = []byte(src)
+ case []byte:
+ bufSrc = src
+ default:
+ bufSrc = []byte(fmt.Sprint(bufSrc))
+ }
+ }
+
+ return w.m.Scan(t.OID, TextFormatCode, bufSrc, w.v)
+}
+
+// canBeNil returns true if value can be nil.
+func canBeNil(value any) bool {
+ refVal := reflect.ValueOf(value)
+ kind := refVal.Kind()
+ switch kind {
+ case reflect.Chan, reflect.Func, reflect.Map, reflect.Ptr, reflect.UnsafePointer, reflect.Interface, reflect.Slice:
+ return true
+ default:
+ return false
+ }
+}
+
+// valuerReflectType is a reflect.Type for driver.Valuer. It has confusing syntax because reflect.TypeOf returns nil
+// when it's argument is a nil interface value. So we use a pointer to the interface and call Elem to get the actual
+// type. Yuck.
+//
+// This can be simplified in Go 1.22 with reflect.TypeFor.
+//
+// var valuerReflectType = reflect.TypeFor[driver.Valuer]()
+var valuerReflectType = reflect.TypeOf((*driver.Valuer)(nil)).Elem()
+
+// isNilDriverValuer returns true if value is any type of nil unless it implements driver.Valuer. *T is not considered to implement
+// driver.Valuer if it is only implemented by T.
+func isNilDriverValuer(value any) (isNil bool, callNilDriverValuer bool) {
+ if value == nil {
+ return true, false
+ }
+
+ refVal := reflect.ValueOf(value)
+ kind := refVal.Kind()
+ switch kind {
+ case reflect.Chan, reflect.Func, reflect.Map, reflect.Ptr, reflect.UnsafePointer, reflect.Interface, reflect.Slice:
+ if !refVal.IsNil() {
+ return false, false
+ }
+
+ if _, ok := value.(driver.Valuer); ok {
+ if kind == reflect.Ptr {
+ // The type assertion will succeed if driver.Valuer is implemented on T or *T. Check if it is implemented on *T
+ // by checking if it is not implemented on *T.
+ return true, !refVal.Type().Elem().Implements(valuerReflectType)
+ } else {
+ return true, true
+ }
+ }
+
+ return true, false
+ default:
+ return false, false
+ }
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/pgtype_default.go b/vendor/github.com/jackc/pgx/v5/pgtype/pgtype_default.go
new file mode 100644
index 0000000..9496cb9
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/pgtype_default.go
@@ -0,0 +1,231 @@
+package pgtype
+
+import (
+ "encoding/json"
+ "encoding/xml"
+ "net"
+ "net/netip"
+ "reflect"
+ "sync"
+ "time"
+)
+
+var (
+ // defaultMap contains default mappings between PostgreSQL server types and Go type handling logic.
+ defaultMap *Map
+ defaultMapInitOnce = sync.Once{}
+)
+
+func initDefaultMap() {
+ defaultMap = &Map{
+ oidToType: make(map[uint32]*Type),
+ nameToType: make(map[string]*Type),
+ reflectTypeToName: make(map[reflect.Type]string),
+ oidToFormatCode: make(map[uint32]int16),
+
+ memoizedScanPlans: make(map[uint32]map[reflect.Type][2]ScanPlan),
+ memoizedEncodePlans: make(map[uint32]map[reflect.Type][2]EncodePlan),
+
+ TryWrapEncodePlanFuncs: []TryWrapEncodePlanFunc{
+ TryWrapDerefPointerEncodePlan,
+ TryWrapBuiltinTypeEncodePlan,
+ TryWrapFindUnderlyingTypeEncodePlan,
+ TryWrapStructEncodePlan,
+ TryWrapSliceEncodePlan,
+ TryWrapMultiDimSliceEncodePlan,
+ TryWrapArrayEncodePlan,
+ },
+
+ TryWrapScanPlanFuncs: []TryWrapScanPlanFunc{
+ TryPointerPointerScanPlan,
+ TryWrapBuiltinTypeScanPlan,
+ TryFindUnderlyingTypeScanPlan,
+ TryWrapStructScanPlan,
+ TryWrapPtrSliceScanPlan,
+ TryWrapPtrMultiDimSliceScanPlan,
+ TryWrapPtrArrayScanPlan,
+ },
+ }
+
+ // Base types
+ defaultMap.RegisterType(&Type{Name: "aclitem", OID: ACLItemOID, Codec: &TextFormatOnlyCodec{TextCodec{}}})
+ defaultMap.RegisterType(&Type{Name: "bit", OID: BitOID, Codec: BitsCodec{}})
+ defaultMap.RegisterType(&Type{Name: "bool", OID: BoolOID, Codec: BoolCodec{}})
+ defaultMap.RegisterType(&Type{Name: "box", OID: BoxOID, Codec: BoxCodec{}})
+ defaultMap.RegisterType(&Type{Name: "bpchar", OID: BPCharOID, Codec: TextCodec{}})
+ defaultMap.RegisterType(&Type{Name: "bytea", OID: ByteaOID, Codec: ByteaCodec{}})
+ defaultMap.RegisterType(&Type{Name: "char", OID: QCharOID, Codec: QCharCodec{}})
+ defaultMap.RegisterType(&Type{Name: "cid", OID: CIDOID, Codec: Uint32Codec{}})
+ defaultMap.RegisterType(&Type{Name: "cidr", OID: CIDROID, Codec: InetCodec{}})
+ defaultMap.RegisterType(&Type{Name: "circle", OID: CircleOID, Codec: CircleCodec{}})
+ defaultMap.RegisterType(&Type{Name: "date", OID: DateOID, Codec: DateCodec{}})
+ defaultMap.RegisterType(&Type{Name: "float4", OID: Float4OID, Codec: Float4Codec{}})
+ defaultMap.RegisterType(&Type{Name: "float8", OID: Float8OID, Codec: Float8Codec{}})
+ defaultMap.RegisterType(&Type{Name: "inet", OID: InetOID, Codec: InetCodec{}})
+ defaultMap.RegisterType(&Type{Name: "int2", OID: Int2OID, Codec: Int2Codec{}})
+ defaultMap.RegisterType(&Type{Name: "int4", OID: Int4OID, Codec: Int4Codec{}})
+ defaultMap.RegisterType(&Type{Name: "int8", OID: Int8OID, Codec: Int8Codec{}})
+ defaultMap.RegisterType(&Type{Name: "interval", OID: IntervalOID, Codec: IntervalCodec{}})
+ defaultMap.RegisterType(&Type{Name: "json", OID: JSONOID, Codec: &JSONCodec{Marshal: json.Marshal, Unmarshal: json.Unmarshal}})
+ defaultMap.RegisterType(&Type{Name: "jsonb", OID: JSONBOID, Codec: &JSONBCodec{Marshal: json.Marshal, Unmarshal: json.Unmarshal}})
+ defaultMap.RegisterType(&Type{Name: "jsonpath", OID: JSONPathOID, Codec: &TextFormatOnlyCodec{TextCodec{}}})
+ defaultMap.RegisterType(&Type{Name: "line", OID: LineOID, Codec: LineCodec{}})
+ defaultMap.RegisterType(&Type{Name: "lseg", OID: LsegOID, Codec: LsegCodec{}})
+ defaultMap.RegisterType(&Type{Name: "macaddr8", OID: Macaddr8OID, Codec: MacaddrCodec{}})
+ defaultMap.RegisterType(&Type{Name: "macaddr", OID: MacaddrOID, Codec: MacaddrCodec{}})
+ defaultMap.RegisterType(&Type{Name: "name", OID: NameOID, Codec: TextCodec{}})
+ defaultMap.RegisterType(&Type{Name: "numeric", OID: NumericOID, Codec: NumericCodec{}})
+ defaultMap.RegisterType(&Type{Name: "oid", OID: OIDOID, Codec: Uint32Codec{}})
+ defaultMap.RegisterType(&Type{Name: "path", OID: PathOID, Codec: PathCodec{}})
+ defaultMap.RegisterType(&Type{Name: "point", OID: PointOID, Codec: PointCodec{}})
+ defaultMap.RegisterType(&Type{Name: "polygon", OID: PolygonOID, Codec: PolygonCodec{}})
+ defaultMap.RegisterType(&Type{Name: "record", OID: RecordOID, Codec: RecordCodec{}})
+ defaultMap.RegisterType(&Type{Name: "text", OID: TextOID, Codec: TextCodec{}})
+ defaultMap.RegisterType(&Type{Name: "tid", OID: TIDOID, Codec: TIDCodec{}})
+ defaultMap.RegisterType(&Type{Name: "time", OID: TimeOID, Codec: TimeCodec{}})
+ defaultMap.RegisterType(&Type{Name: "timestamp", OID: TimestampOID, Codec: &TimestampCodec{}})
+ defaultMap.RegisterType(&Type{Name: "timestamptz", OID: TimestamptzOID, Codec: &TimestamptzCodec{}})
+ defaultMap.RegisterType(&Type{Name: "unknown", OID: UnknownOID, Codec: TextCodec{}})
+ defaultMap.RegisterType(&Type{Name: "uuid", OID: UUIDOID, Codec: UUIDCodec{}})
+ defaultMap.RegisterType(&Type{Name: "varbit", OID: VarbitOID, Codec: BitsCodec{}})
+ defaultMap.RegisterType(&Type{Name: "varchar", OID: VarcharOID, Codec: TextCodec{}})
+ defaultMap.RegisterType(&Type{Name: "xid", OID: XIDOID, Codec: Uint32Codec{}})
+ defaultMap.RegisterType(&Type{Name: "xid8", OID: XID8OID, Codec: Uint64Codec{}})
+ defaultMap.RegisterType(&Type{Name: "xml", OID: XMLOID, Codec: &XMLCodec{Marshal: xml.Marshal, Unmarshal: xml.Unmarshal}})
+
+ // Range types
+ defaultMap.RegisterType(&Type{Name: "daterange", OID: DaterangeOID, Codec: &RangeCodec{ElementType: defaultMap.oidToType[DateOID]}})
+ defaultMap.RegisterType(&Type{Name: "int4range", OID: Int4rangeOID, Codec: &RangeCodec{ElementType: defaultMap.oidToType[Int4OID]}})
+ defaultMap.RegisterType(&Type{Name: "int8range", OID: Int8rangeOID, Codec: &RangeCodec{ElementType: defaultMap.oidToType[Int8OID]}})
+ defaultMap.RegisterType(&Type{Name: "numrange", OID: NumrangeOID, Codec: &RangeCodec{ElementType: defaultMap.oidToType[NumericOID]}})
+ defaultMap.RegisterType(&Type{Name: "tsrange", OID: TsrangeOID, Codec: &RangeCodec{ElementType: defaultMap.oidToType[TimestampOID]}})
+ defaultMap.RegisterType(&Type{Name: "tstzrange", OID: TstzrangeOID, Codec: &RangeCodec{ElementType: defaultMap.oidToType[TimestamptzOID]}})
+
+ // Multirange types
+ defaultMap.RegisterType(&Type{Name: "datemultirange", OID: DatemultirangeOID, Codec: &MultirangeCodec{ElementType: defaultMap.oidToType[DaterangeOID]}})
+ defaultMap.RegisterType(&Type{Name: "int4multirange", OID: Int4multirangeOID, Codec: &MultirangeCodec{ElementType: defaultMap.oidToType[Int4rangeOID]}})
+ defaultMap.RegisterType(&Type{Name: "int8multirange", OID: Int8multirangeOID, Codec: &MultirangeCodec{ElementType: defaultMap.oidToType[Int8rangeOID]}})
+ defaultMap.RegisterType(&Type{Name: "nummultirange", OID: NummultirangeOID, Codec: &MultirangeCodec{ElementType: defaultMap.oidToType[NumrangeOID]}})
+ defaultMap.RegisterType(&Type{Name: "tsmultirange", OID: TsmultirangeOID, Codec: &MultirangeCodec{ElementType: defaultMap.oidToType[TsrangeOID]}})
+ defaultMap.RegisterType(&Type{Name: "tstzmultirange", OID: TstzmultirangeOID, Codec: &MultirangeCodec{ElementType: defaultMap.oidToType[TstzrangeOID]}})
+
+ // Array types
+ defaultMap.RegisterType(&Type{Name: "_aclitem", OID: ACLItemArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[ACLItemOID]}})
+ defaultMap.RegisterType(&Type{Name: "_bit", OID: BitArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[BitOID]}})
+ defaultMap.RegisterType(&Type{Name: "_bool", OID: BoolArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[BoolOID]}})
+ defaultMap.RegisterType(&Type{Name: "_box", OID: BoxArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[BoxOID]}})
+ defaultMap.RegisterType(&Type{Name: "_bpchar", OID: BPCharArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[BPCharOID]}})
+ defaultMap.RegisterType(&Type{Name: "_bytea", OID: ByteaArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[ByteaOID]}})
+ defaultMap.RegisterType(&Type{Name: "_char", OID: QCharArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[QCharOID]}})
+ defaultMap.RegisterType(&Type{Name: "_cid", OID: CIDArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[CIDOID]}})
+ defaultMap.RegisterType(&Type{Name: "_cidr", OID: CIDRArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[CIDROID]}})
+ defaultMap.RegisterType(&Type{Name: "_circle", OID: CircleArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[CircleOID]}})
+ defaultMap.RegisterType(&Type{Name: "_date", OID: DateArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[DateOID]}})
+ defaultMap.RegisterType(&Type{Name: "_daterange", OID: DaterangeArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[DaterangeOID]}})
+ defaultMap.RegisterType(&Type{Name: "_float4", OID: Float4ArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[Float4OID]}})
+ defaultMap.RegisterType(&Type{Name: "_float8", OID: Float8ArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[Float8OID]}})
+ defaultMap.RegisterType(&Type{Name: "_inet", OID: InetArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[InetOID]}})
+ defaultMap.RegisterType(&Type{Name: "_int2", OID: Int2ArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[Int2OID]}})
+ defaultMap.RegisterType(&Type{Name: "_int4", OID: Int4ArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[Int4OID]}})
+ defaultMap.RegisterType(&Type{Name: "_int4range", OID: Int4rangeArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[Int4rangeOID]}})
+ defaultMap.RegisterType(&Type{Name: "_int8", OID: Int8ArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[Int8OID]}})
+ defaultMap.RegisterType(&Type{Name: "_int8range", OID: Int8rangeArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[Int8rangeOID]}})
+ defaultMap.RegisterType(&Type{Name: "_interval", OID: IntervalArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[IntervalOID]}})
+ defaultMap.RegisterType(&Type{Name: "_json", OID: JSONArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[JSONOID]}})
+ defaultMap.RegisterType(&Type{Name: "_jsonb", OID: JSONBArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[JSONBOID]}})
+ defaultMap.RegisterType(&Type{Name: "_jsonpath", OID: JSONPathArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[JSONPathOID]}})
+ defaultMap.RegisterType(&Type{Name: "_line", OID: LineArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[LineOID]}})
+ defaultMap.RegisterType(&Type{Name: "_lseg", OID: LsegArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[LsegOID]}})
+ defaultMap.RegisterType(&Type{Name: "_macaddr", OID: MacaddrArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[MacaddrOID]}})
+ defaultMap.RegisterType(&Type{Name: "_name", OID: NameArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[NameOID]}})
+ defaultMap.RegisterType(&Type{Name: "_numeric", OID: NumericArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[NumericOID]}})
+ defaultMap.RegisterType(&Type{Name: "_numrange", OID: NumrangeArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[NumrangeOID]}})
+ defaultMap.RegisterType(&Type{Name: "_oid", OID: OIDArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[OIDOID]}})
+ defaultMap.RegisterType(&Type{Name: "_path", OID: PathArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[PathOID]}})
+ defaultMap.RegisterType(&Type{Name: "_point", OID: PointArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[PointOID]}})
+ defaultMap.RegisterType(&Type{Name: "_polygon", OID: PolygonArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[PolygonOID]}})
+ defaultMap.RegisterType(&Type{Name: "_record", OID: RecordArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[RecordOID]}})
+ defaultMap.RegisterType(&Type{Name: "_text", OID: TextArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[TextOID]}})
+ defaultMap.RegisterType(&Type{Name: "_tid", OID: TIDArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[TIDOID]}})
+ defaultMap.RegisterType(&Type{Name: "_time", OID: TimeArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[TimeOID]}})
+ defaultMap.RegisterType(&Type{Name: "_timestamp", OID: TimestampArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[TimestampOID]}})
+ defaultMap.RegisterType(&Type{Name: "_timestamptz", OID: TimestamptzArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[TimestamptzOID]}})
+ defaultMap.RegisterType(&Type{Name: "_tsrange", OID: TsrangeArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[TsrangeOID]}})
+ defaultMap.RegisterType(&Type{Name: "_tstzrange", OID: TstzrangeArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[TstzrangeOID]}})
+ defaultMap.RegisterType(&Type{Name: "_uuid", OID: UUIDArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[UUIDOID]}})
+ defaultMap.RegisterType(&Type{Name: "_varbit", OID: VarbitArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[VarbitOID]}})
+ defaultMap.RegisterType(&Type{Name: "_varchar", OID: VarcharArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[VarcharOID]}})
+ defaultMap.RegisterType(&Type{Name: "_xid", OID: XIDArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[XIDOID]}})
+ defaultMap.RegisterType(&Type{Name: "_xid8", OID: XID8ArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[XID8OID]}})
+ defaultMap.RegisterType(&Type{Name: "_xml", OID: XMLArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[XMLOID]}})
+
+ // Integer types that directly map to a PostgreSQL type
+ registerDefaultPgTypeVariants[int16](defaultMap, "int2")
+ registerDefaultPgTypeVariants[int32](defaultMap, "int4")
+ registerDefaultPgTypeVariants[int64](defaultMap, "int8")
+
+ // Integer types that do not have a direct match to a PostgreSQL type
+ registerDefaultPgTypeVariants[int8](defaultMap, "int8")
+ registerDefaultPgTypeVariants[int](defaultMap, "int8")
+ registerDefaultPgTypeVariants[uint8](defaultMap, "int8")
+ registerDefaultPgTypeVariants[uint16](defaultMap, "int8")
+ registerDefaultPgTypeVariants[uint32](defaultMap, "int8")
+ registerDefaultPgTypeVariants[uint64](defaultMap, "numeric")
+ registerDefaultPgTypeVariants[uint](defaultMap, "numeric")
+
+ registerDefaultPgTypeVariants[float32](defaultMap, "float4")
+ registerDefaultPgTypeVariants[float64](defaultMap, "float8")
+
+ registerDefaultPgTypeVariants[bool](defaultMap, "bool")
+ registerDefaultPgTypeVariants[time.Time](defaultMap, "timestamptz")
+ registerDefaultPgTypeVariants[time.Duration](defaultMap, "interval")
+ registerDefaultPgTypeVariants[string](defaultMap, "text")
+ registerDefaultPgTypeVariants[json.RawMessage](defaultMap, "json")
+ registerDefaultPgTypeVariants[[]byte](defaultMap, "bytea")
+
+ registerDefaultPgTypeVariants[net.IP](defaultMap, "inet")
+ registerDefaultPgTypeVariants[net.IPNet](defaultMap, "cidr")
+ registerDefaultPgTypeVariants[netip.Addr](defaultMap, "inet")
+ registerDefaultPgTypeVariants[netip.Prefix](defaultMap, "cidr")
+
+ // pgtype provided structs
+ registerDefaultPgTypeVariants[Bits](defaultMap, "varbit")
+ registerDefaultPgTypeVariants[Bool](defaultMap, "bool")
+ registerDefaultPgTypeVariants[Box](defaultMap, "box")
+ registerDefaultPgTypeVariants[Circle](defaultMap, "circle")
+ registerDefaultPgTypeVariants[Date](defaultMap, "date")
+ registerDefaultPgTypeVariants[Range[Date]](defaultMap, "daterange")
+ registerDefaultPgTypeVariants[Multirange[Range[Date]]](defaultMap, "datemultirange")
+ registerDefaultPgTypeVariants[Float4](defaultMap, "float4")
+ registerDefaultPgTypeVariants[Float8](defaultMap, "float8")
+ registerDefaultPgTypeVariants[Range[Float8]](defaultMap, "numrange") // There is no PostgreSQL builtin float8range so map it to numrange.
+ registerDefaultPgTypeVariants[Multirange[Range[Float8]]](defaultMap, "nummultirange") // There is no PostgreSQL builtin float8multirange so map it to nummultirange.
+ registerDefaultPgTypeVariants[Int2](defaultMap, "int2")
+ registerDefaultPgTypeVariants[Int4](defaultMap, "int4")
+ registerDefaultPgTypeVariants[Range[Int4]](defaultMap, "int4range")
+ registerDefaultPgTypeVariants[Multirange[Range[Int4]]](defaultMap, "int4multirange")
+ registerDefaultPgTypeVariants[Int8](defaultMap, "int8")
+ registerDefaultPgTypeVariants[Range[Int8]](defaultMap, "int8range")
+ registerDefaultPgTypeVariants[Multirange[Range[Int8]]](defaultMap, "int8multirange")
+ registerDefaultPgTypeVariants[Interval](defaultMap, "interval")
+ registerDefaultPgTypeVariants[Line](defaultMap, "line")
+ registerDefaultPgTypeVariants[Lseg](defaultMap, "lseg")
+ registerDefaultPgTypeVariants[Numeric](defaultMap, "numeric")
+ registerDefaultPgTypeVariants[Range[Numeric]](defaultMap, "numrange")
+ registerDefaultPgTypeVariants[Multirange[Range[Numeric]]](defaultMap, "nummultirange")
+ registerDefaultPgTypeVariants[Path](defaultMap, "path")
+ registerDefaultPgTypeVariants[Point](defaultMap, "point")
+ registerDefaultPgTypeVariants[Polygon](defaultMap, "polygon")
+ registerDefaultPgTypeVariants[TID](defaultMap, "tid")
+ registerDefaultPgTypeVariants[Text](defaultMap, "text")
+ registerDefaultPgTypeVariants[Time](defaultMap, "time")
+ registerDefaultPgTypeVariants[Timestamp](defaultMap, "timestamp")
+ registerDefaultPgTypeVariants[Timestamptz](defaultMap, "timestamptz")
+ registerDefaultPgTypeVariants[Range[Timestamp]](defaultMap, "tsrange")
+ registerDefaultPgTypeVariants[Multirange[Range[Timestamp]]](defaultMap, "tsmultirange")
+ registerDefaultPgTypeVariants[Range[Timestamptz]](defaultMap, "tstzrange")
+ registerDefaultPgTypeVariants[Multirange[Range[Timestamptz]]](defaultMap, "tstzmultirange")
+ registerDefaultPgTypeVariants[UUID](defaultMap, "uuid")
+
+ defaultMap.buildReflectTypeToType()
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/point.go b/vendor/github.com/jackc/pgx/v5/pgtype/point.go
new file mode 100644
index 0000000..09b19bb
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/point.go
@@ -0,0 +1,266 @@
+package pgtype
+
+import (
+ "bytes"
+ "database/sql/driver"
+ "encoding/binary"
+ "fmt"
+ "math"
+ "strconv"
+ "strings"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+type Vec2 struct {
+ X float64
+ Y float64
+}
+
+type PointScanner interface {
+ ScanPoint(v Point) error
+}
+
+type PointValuer interface {
+ PointValue() (Point, error)
+}
+
+type Point struct {
+ P Vec2
+ Valid bool
+}
+
+func (p *Point) ScanPoint(v Point) error {
+ *p = v
+ return nil
+}
+
+func (p Point) PointValue() (Point, error) {
+ return p, nil
+}
+
+func parsePoint(src []byte) (*Point, error) {
+ if src == nil || bytes.Equal(src, []byte("null")) {
+ return &Point{}, nil
+ }
+
+ if len(src) < 5 {
+ return nil, fmt.Errorf("invalid length for point: %v", len(src))
+ }
+ if src[0] == '"' && src[len(src)-1] == '"' {
+ src = src[1 : len(src)-1]
+ }
+ sx, sy, found := strings.Cut(string(src[1:len(src)-1]), ",")
+ if !found {
+ return nil, fmt.Errorf("invalid format for point")
+ }
+
+ x, err := strconv.ParseFloat(sx, 64)
+ if err != nil {
+ return nil, err
+ }
+
+ y, err := strconv.ParseFloat(sy, 64)
+ if err != nil {
+ return nil, err
+ }
+
+ return &Point{P: Vec2{x, y}, Valid: true}, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (dst *Point) Scan(src any) error {
+ if src == nil {
+ *dst = Point{}
+ return nil
+ }
+
+ switch src := src.(type) {
+ case string:
+ return scanPlanTextAnyToPointScanner{}.Scan([]byte(src), dst)
+ }
+
+ return fmt.Errorf("cannot scan %T", src)
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (src Point) Value() (driver.Value, error) {
+ if !src.Valid {
+ return nil, nil
+ }
+
+ buf, err := PointCodec{}.PlanEncode(nil, 0, TextFormatCode, src).Encode(src, nil)
+ if err != nil {
+ return nil, err
+ }
+ return string(buf), err
+}
+
+func (src Point) MarshalJSON() ([]byte, error) {
+ if !src.Valid {
+ return []byte("null"), nil
+ }
+
+ var buff bytes.Buffer
+ buff.WriteByte('"')
+ buff.WriteString(fmt.Sprintf("(%g,%g)", src.P.X, src.P.Y))
+ buff.WriteByte('"')
+ return buff.Bytes(), nil
+}
+
+func (dst *Point) UnmarshalJSON(point []byte) error {
+ p, err := parsePoint(point)
+ if err != nil {
+ return err
+ }
+ *dst = *p
+ return nil
+}
+
+type PointCodec struct{}
+
+func (PointCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (PointCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (PointCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ if _, ok := value.(PointValuer); !ok {
+ return nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ return encodePlanPointCodecBinary{}
+ case TextFormatCode:
+ return encodePlanPointCodecText{}
+ }
+
+ return nil
+}
+
+type encodePlanPointCodecBinary struct{}
+
+func (encodePlanPointCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ point, err := value.(PointValuer).PointValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !point.Valid {
+ return nil, nil
+ }
+
+ buf = pgio.AppendUint64(buf, math.Float64bits(point.P.X))
+ buf = pgio.AppendUint64(buf, math.Float64bits(point.P.Y))
+ return buf, nil
+}
+
+type encodePlanPointCodecText struct{}
+
+func (encodePlanPointCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ point, err := value.(PointValuer).PointValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !point.Valid {
+ return nil, nil
+ }
+
+ return append(buf, fmt.Sprintf(`(%s,%s)`,
+ strconv.FormatFloat(point.P.X, 'f', -1, 64),
+ strconv.FormatFloat(point.P.Y, 'f', -1, 64),
+ )...), nil
+}
+
+func (PointCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case PointScanner:
+ return scanPlanBinaryPointToPointScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case PointScanner:
+ return scanPlanTextAnyToPointScanner{}
+ }
+ }
+
+ return nil
+}
+
+func (c PointCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ return codecDecodeToTextFormat(c, m, oid, format, src)
+}
+
+func (c PointCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var point Point
+ err := codecScan(c, m, oid, format, src, &point)
+ if err != nil {
+ return nil, err
+ }
+ return point, nil
+}
+
+type scanPlanBinaryPointToPointScanner struct{}
+
+func (scanPlanBinaryPointToPointScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(PointScanner)
+
+ if src == nil {
+ return scanner.ScanPoint(Point{})
+ }
+
+ if len(src) != 16 {
+ return fmt.Errorf("invalid length for point: %v", len(src))
+ }
+
+ x := binary.BigEndian.Uint64(src)
+ y := binary.BigEndian.Uint64(src[8:])
+
+ return scanner.ScanPoint(Point{
+ P: Vec2{math.Float64frombits(x), math.Float64frombits(y)},
+ Valid: true,
+ })
+}
+
+type scanPlanTextAnyToPointScanner struct{}
+
+func (scanPlanTextAnyToPointScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(PointScanner)
+
+ if src == nil {
+ return scanner.ScanPoint(Point{})
+ }
+
+ if len(src) < 5 {
+ return fmt.Errorf("invalid length for point: %v", len(src))
+ }
+
+ sx, sy, found := strings.Cut(string(src[1:len(src)-1]), ",")
+ if !found {
+ return fmt.Errorf("invalid format for point")
+ }
+
+ x, err := strconv.ParseFloat(sx, 64)
+ if err != nil {
+ return err
+ }
+
+ y, err := strconv.ParseFloat(sy, 64)
+ if err != nil {
+ return err
+ }
+
+ return scanner.ScanPoint(Point{P: Vec2{x, y}, Valid: true})
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/polygon.go b/vendor/github.com/jackc/pgx/v5/pgtype/polygon.go
new file mode 100644
index 0000000..04b0ba6
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/polygon.go
@@ -0,0 +1,253 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "fmt"
+ "math"
+ "strconv"
+ "strings"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+type PolygonScanner interface {
+ ScanPolygon(v Polygon) error
+}
+
+type PolygonValuer interface {
+ PolygonValue() (Polygon, error)
+}
+
+type Polygon struct {
+ P []Vec2
+ Valid bool
+}
+
+func (p *Polygon) ScanPolygon(v Polygon) error {
+ *p = v
+ return nil
+}
+
+func (p Polygon) PolygonValue() (Polygon, error) {
+ return p, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (p *Polygon) Scan(src any) error {
+ if src == nil {
+ *p = Polygon{}
+ return nil
+ }
+
+ switch src := src.(type) {
+ case string:
+ return scanPlanTextAnyToPolygonScanner{}.Scan([]byte(src), p)
+ }
+
+ return fmt.Errorf("cannot scan %T", src)
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (p Polygon) Value() (driver.Value, error) {
+ if !p.Valid {
+ return nil, nil
+ }
+
+ buf, err := PolygonCodec{}.PlanEncode(nil, 0, TextFormatCode, p).Encode(p, nil)
+ if err != nil {
+ return nil, err
+ }
+
+ return string(buf), err
+}
+
+type PolygonCodec struct{}
+
+func (PolygonCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (PolygonCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (PolygonCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ if _, ok := value.(PolygonValuer); !ok {
+ return nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ return encodePlanPolygonCodecBinary{}
+ case TextFormatCode:
+ return encodePlanPolygonCodecText{}
+ }
+
+ return nil
+}
+
+type encodePlanPolygonCodecBinary struct{}
+
+func (encodePlanPolygonCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ polygon, err := value.(PolygonValuer).PolygonValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !polygon.Valid {
+ return nil, nil
+ }
+
+ buf = pgio.AppendInt32(buf, int32(len(polygon.P)))
+
+ for _, p := range polygon.P {
+ buf = pgio.AppendUint64(buf, math.Float64bits(p.X))
+ buf = pgio.AppendUint64(buf, math.Float64bits(p.Y))
+ }
+
+ return buf, nil
+}
+
+type encodePlanPolygonCodecText struct{}
+
+func (encodePlanPolygonCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ polygon, err := value.(PolygonValuer).PolygonValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !polygon.Valid {
+ return nil, nil
+ }
+
+ buf = append(buf, '(')
+
+ for i, p := range polygon.P {
+ if i > 0 {
+ buf = append(buf, ',')
+ }
+ buf = append(buf, fmt.Sprintf(`(%s,%s)`,
+ strconv.FormatFloat(p.X, 'f', -1, 64),
+ strconv.FormatFloat(p.Y, 'f', -1, 64),
+ )...)
+ }
+
+ buf = append(buf, ')')
+
+ return buf, nil
+}
+
+func (PolygonCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case PolygonScanner:
+ return scanPlanBinaryPolygonToPolygonScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case PolygonScanner:
+ return scanPlanTextAnyToPolygonScanner{}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryPolygonToPolygonScanner struct{}
+
+func (scanPlanBinaryPolygonToPolygonScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(PolygonScanner)
+
+ if src == nil {
+ return scanner.ScanPolygon(Polygon{})
+ }
+
+ if len(src) < 5 {
+ return fmt.Errorf("invalid length for polygon: %v", len(src))
+ }
+
+ pointCount := int(binary.BigEndian.Uint32(src))
+ rp := 4
+
+ if 4+pointCount*16 != len(src) {
+ return fmt.Errorf("invalid length for Polygon with %d points: %v", pointCount, len(src))
+ }
+
+ points := make([]Vec2, pointCount)
+ for i := 0; i < len(points); i++ {
+ x := binary.BigEndian.Uint64(src[rp:])
+ rp += 8
+ y := binary.BigEndian.Uint64(src[rp:])
+ rp += 8
+ points[i] = Vec2{math.Float64frombits(x), math.Float64frombits(y)}
+ }
+
+ return scanner.ScanPolygon(Polygon{
+ P: points,
+ Valid: true,
+ })
+}
+
+type scanPlanTextAnyToPolygonScanner struct{}
+
+func (scanPlanTextAnyToPolygonScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(PolygonScanner)
+
+ if src == nil {
+ return scanner.ScanPolygon(Polygon{})
+ }
+
+ if len(src) < 7 {
+ return fmt.Errorf("invalid length for Polygon: %v", len(src))
+ }
+
+ points := make([]Vec2, 0)
+
+ str := string(src[2:])
+
+ for {
+ end := strings.IndexByte(str, ',')
+ x, err := strconv.ParseFloat(str[:end], 64)
+ if err != nil {
+ return err
+ }
+
+ str = str[end+1:]
+ end = strings.IndexByte(str, ')')
+
+ y, err := strconv.ParseFloat(str[:end], 64)
+ if err != nil {
+ return err
+ }
+
+ points = append(points, Vec2{x, y})
+
+ if end+3 < len(str) {
+ str = str[end+3:]
+ } else {
+ break
+ }
+ }
+
+ return scanner.ScanPolygon(Polygon{P: points, Valid: true})
+}
+
+func (c PolygonCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ return codecDecodeToTextFormat(c, m, oid, format, src)
+}
+
+func (c PolygonCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var polygon Polygon
+ err := codecScan(c, m, oid, format, src, &polygon)
+ if err != nil {
+ return nil, err
+ }
+ return polygon, nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/qchar.go b/vendor/github.com/jackc/pgx/v5/pgtype/qchar.go
new file mode 100644
index 0000000..fc40a5b
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/qchar.go
@@ -0,0 +1,141 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "fmt"
+ "math"
+)
+
+// QCharCodec is for PostgreSQL's special 8-bit-only "char" type more akin to the C
+// language's char type, or Go's byte type. (Note that the name in PostgreSQL
+// itself is "char", in double-quotes, and not char.) It gets used a lot in
+// PostgreSQL's system tables to hold a single ASCII character value (eg
+// pg_class.relkind). It is named Qchar for quoted char to disambiguate from SQL
+// standard type char.
+type QCharCodec struct{}
+
+func (QCharCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (QCharCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (QCharCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ switch format {
+ case TextFormatCode, BinaryFormatCode:
+ switch value.(type) {
+ case byte:
+ return encodePlanQcharCodecByte{}
+ case rune:
+ return encodePlanQcharCodecRune{}
+ }
+ }
+
+ return nil
+}
+
+type encodePlanQcharCodecByte struct{}
+
+func (encodePlanQcharCodecByte) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ b := value.(byte)
+ buf = append(buf, b)
+ return buf, nil
+}
+
+type encodePlanQcharCodecRune struct{}
+
+func (encodePlanQcharCodecRune) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ r := value.(rune)
+ if r > math.MaxUint8 {
+ return nil, fmt.Errorf(`%v cannot be encoded to "char"`, r)
+ }
+ b := byte(r)
+ buf = append(buf, b)
+ return buf, nil
+}
+
+func (QCharCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+ switch format {
+ case TextFormatCode, BinaryFormatCode:
+ switch target.(type) {
+ case *byte:
+ return scanPlanQcharCodecByte{}
+ case *rune:
+ return scanPlanQcharCodecRune{}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanQcharCodecByte struct{}
+
+func (scanPlanQcharCodecByte) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) > 1 {
+ return fmt.Errorf(`invalid length for "char": %v`, len(src))
+ }
+
+ b := dst.(*byte)
+ // In the text format the zero value is returned as a zero byte value instead of 0
+ if len(src) == 0 {
+ *b = 0
+ } else {
+ *b = src[0]
+ }
+
+ return nil
+}
+
+type scanPlanQcharCodecRune struct{}
+
+func (scanPlanQcharCodecRune) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) > 1 {
+ return fmt.Errorf(`invalid length for "char": %v`, len(src))
+ }
+
+ r := dst.(*rune)
+ // In the text format the zero value is returned as a zero byte value instead of 0
+ if len(src) == 0 {
+ *r = 0
+ } else {
+ *r = rune(src[0])
+ }
+
+ return nil
+}
+
+func (c QCharCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var r rune
+ err := codecScan(c, m, oid, format, src, &r)
+ if err != nil {
+ return nil, err
+ }
+ return string(r), nil
+}
+
+func (c QCharCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var r rune
+ err := codecScan(c, m, oid, format, src, &r)
+ if err != nil {
+ return nil, err
+ }
+ return r, nil
+}
diff --git a/vendor/github.com/jackc/pgtype/range.go b/vendor/github.com/jackc/pgx/v5/pgtype/range.go
index e999f6a..16427cc 100644
--- a/vendor/github.com/jackc/pgtype/range.go
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/range.go
@@ -19,15 +19,15 @@ func (bt BoundType) String() string {
return string(bt)
}
-type UntypedTextRange struct {
+type untypedTextRange struct {
Lower string
Upper string
LowerType BoundType
UpperType BoundType
}
-func ParseUntypedTextRange(src string) (*UntypedTextRange, error) {
- utr := &UntypedTextRange{}
+func parseUntypedTextRange(src string) (*untypedTextRange, error) {
+ utr := &untypedTextRange{}
if src == "empty" {
utr.LowerType = Empty
utr.UpperType = Empty
@@ -40,7 +40,7 @@ func ParseUntypedTextRange(src string) (*UntypedTextRange, error) {
r, _, err := buf.ReadRune()
if err != nil {
- return nil, fmt.Errorf("invalid lower bound: %v", err)
+ return nil, fmt.Errorf("invalid lower bound: %w", err)
}
switch r {
case '(':
@@ -53,7 +53,7 @@ func ParseUntypedTextRange(src string) (*UntypedTextRange, error) {
r, _, err = buf.ReadRune()
if err != nil {
- return nil, fmt.Errorf("invalid lower value: %v", err)
+ return nil, fmt.Errorf("invalid lower value: %w", err)
}
buf.UnreadRune()
@@ -62,13 +62,13 @@ func ParseUntypedTextRange(src string) (*UntypedTextRange, error) {
} else {
utr.Lower, err = rangeParseValue(buf)
if err != nil {
- return nil, fmt.Errorf("invalid lower value: %v", err)
+ return nil, fmt.Errorf("invalid lower value: %w", err)
}
}
r, _, err = buf.ReadRune()
if err != nil {
- return nil, fmt.Errorf("missing range separator: %v", err)
+ return nil, fmt.Errorf("missing range separator: %w", err)
}
if r != ',' {
return nil, fmt.Errorf("missing range separator: %v", r)
@@ -76,7 +76,7 @@ func ParseUntypedTextRange(src string) (*UntypedTextRange, error) {
r, _, err = buf.ReadRune()
if err != nil {
- return nil, fmt.Errorf("invalid upper value: %v", err)
+ return nil, fmt.Errorf("invalid upper value: %w", err)
}
if r == ')' || r == ']' {
@@ -85,12 +85,12 @@ func ParseUntypedTextRange(src string) (*UntypedTextRange, error) {
buf.UnreadRune()
utr.Upper, err = rangeParseValue(buf)
if err != nil {
- return nil, fmt.Errorf("invalid upper value: %v", err)
+ return nil, fmt.Errorf("invalid upper value: %w", err)
}
r, _, err = buf.ReadRune()
if err != nil {
- return nil, fmt.Errorf("missing upper bound: %v", err)
+ return nil, fmt.Errorf("missing upper bound: %w", err)
}
switch r {
case ')':
@@ -173,7 +173,7 @@ func rangeParseQuotedValue(buf *bytes.Buffer) (string, error) {
}
}
-type UntypedBinaryRange struct {
+type untypedBinaryRange struct {
Lower []byte
Upper []byte
LowerType BoundType
@@ -197,8 +197,8 @@ const upperInclusiveMask = 4
const lowerUnboundedMask = 8
const upperUnboundedMask = 16
-func ParseUntypedBinaryRange(src []byte) (*UntypedBinaryRange, error) {
- ubr := &UntypedBinaryRange{}
+func parseUntypedBinaryRange(src []byte) (*untypedBinaryRange, error) {
+ ubr := &untypedBinaryRange{}
if len(src) == 0 {
return nil, fmt.Errorf("range too short: %v", len(src))
@@ -275,3 +275,48 @@ func ParseUntypedBinaryRange(src []byte) (*UntypedBinaryRange, error) {
return ubr, nil
}
+
+// Range is a generic range type.
+type Range[T any] struct {
+ Lower T
+ Upper T
+ LowerType BoundType
+ UpperType BoundType
+ Valid bool
+}
+
+func (r Range[T]) IsNull() bool {
+ return !r.Valid
+}
+
+func (r Range[T]) BoundTypes() (lower, upper BoundType) {
+ return r.LowerType, r.UpperType
+}
+
+func (r Range[T]) Bounds() (lower, upper any) {
+ return &r.Lower, &r.Upper
+}
+
+func (r *Range[T]) ScanNull() error {
+ *r = Range[T]{}
+ return nil
+}
+
+func (r *Range[T]) ScanBounds() (lowerTarget, upperTarget any) {
+ return &r.Lower, &r.Upper
+}
+
+func (r *Range[T]) SetBoundTypes(lower, upper BoundType) error {
+ if lower == Unbounded || lower == Empty {
+ var zero T
+ r.Lower = zero
+ }
+ if upper == Unbounded || upper == Empty {
+ var zero T
+ r.Upper = zero
+ }
+ r.LowerType = lower
+ r.UpperType = upper
+ r.Valid = true
+ return nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/range_codec.go b/vendor/github.com/jackc/pgx/v5/pgtype/range_codec.go
new file mode 100644
index 0000000..684f1bf
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/range_codec.go
@@ -0,0 +1,379 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "fmt"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+// RangeValuer is a type that can be converted into a PostgreSQL range.
+type RangeValuer interface {
+ // IsNull returns true if the value is SQL NULL.
+ IsNull() bool
+
+ // BoundTypes returns the lower and upper bound types.
+ BoundTypes() (lower, upper BoundType)
+
+ // Bounds returns the lower and upper range values.
+ Bounds() (lower, upper any)
+}
+
+// RangeScanner is a type can be scanned from a PostgreSQL range.
+type RangeScanner interface {
+ // ScanNull sets the value to SQL NULL.
+ ScanNull() error
+
+ // ScanBounds returns values usable as a scan target. The returned values may not be scanned if the range is empty or
+ // the bound type is unbounded.
+ ScanBounds() (lowerTarget, upperTarget any)
+
+ // SetBoundTypes sets the lower and upper bound types. ScanBounds will be called and the returned values scanned
+ // (if appropriate) before SetBoundTypes is called. If the bound types are unbounded or empty this method must
+ // also set the bound values.
+ SetBoundTypes(lower, upper BoundType) error
+}
+
+// RangeCodec is a codec for any range type.
+type RangeCodec struct {
+ ElementType *Type
+}
+
+func (c *RangeCodec) FormatSupported(format int16) bool {
+ return c.ElementType.Codec.FormatSupported(format)
+}
+
+func (c *RangeCodec) PreferredFormat() int16 {
+ if c.FormatSupported(BinaryFormatCode) {
+ return BinaryFormatCode
+ }
+ return TextFormatCode
+}
+
+func (c *RangeCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ if _, ok := value.(RangeValuer); !ok {
+ return nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ return &encodePlanRangeCodecRangeValuerToBinary{rc: c, m: m}
+ case TextFormatCode:
+ return &encodePlanRangeCodecRangeValuerToText{rc: c, m: m}
+ }
+
+ return nil
+}
+
+type encodePlanRangeCodecRangeValuerToBinary struct {
+ rc *RangeCodec
+ m *Map
+}
+
+func (plan *encodePlanRangeCodecRangeValuerToBinary) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ getter := value.(RangeValuer)
+
+ if getter.IsNull() {
+ return nil, nil
+ }
+
+ lowerType, upperType := getter.BoundTypes()
+ lower, upper := getter.Bounds()
+
+ var rangeType byte
+ switch lowerType {
+ case Inclusive:
+ rangeType |= lowerInclusiveMask
+ case Unbounded:
+ rangeType |= lowerUnboundedMask
+ case Exclusive:
+ case Empty:
+ return append(buf, emptyMask), nil
+ default:
+ return nil, fmt.Errorf("unknown LowerType: %v", lowerType)
+ }
+
+ switch upperType {
+ case Inclusive:
+ rangeType |= upperInclusiveMask
+ case Unbounded:
+ rangeType |= upperUnboundedMask
+ case Exclusive:
+ default:
+ return nil, fmt.Errorf("unknown UpperType: %v", upperType)
+ }
+
+ buf = append(buf, rangeType)
+
+ if lowerType != Unbounded {
+ if lower == nil {
+ return nil, fmt.Errorf("Lower cannot be NULL unless LowerType is Unbounded")
+ }
+
+ sp := len(buf)
+ buf = pgio.AppendInt32(buf, -1)
+
+ lowerPlan := plan.m.PlanEncode(plan.rc.ElementType.OID, BinaryFormatCode, lower)
+ if lowerPlan == nil {
+ return nil, fmt.Errorf("cannot encode %v as element of range", lower)
+ }
+
+ buf, err = lowerPlan.Encode(lower, buf)
+ if err != nil {
+ return nil, fmt.Errorf("failed to encode %v as element of range: %w", lower, err)
+ }
+ if buf == nil {
+ return nil, fmt.Errorf("Lower cannot be NULL unless LowerType is Unbounded")
+ }
+
+ pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
+ }
+
+ if upperType != Unbounded {
+ if upper == nil {
+ return nil, fmt.Errorf("Upper cannot be NULL unless UpperType is Unbounded")
+ }
+
+ sp := len(buf)
+ buf = pgio.AppendInt32(buf, -1)
+
+ upperPlan := plan.m.PlanEncode(plan.rc.ElementType.OID, BinaryFormatCode, upper)
+ if upperPlan == nil {
+ return nil, fmt.Errorf("cannot encode %v as element of range", upper)
+ }
+
+ buf, err = upperPlan.Encode(upper, buf)
+ if err != nil {
+ return nil, fmt.Errorf("failed to encode %v as element of range: %w", upper, err)
+ }
+ if buf == nil {
+ return nil, fmt.Errorf("Upper cannot be NULL unless UpperType is Unbounded")
+ }
+
+ pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
+ }
+
+ return buf, nil
+}
+
+type encodePlanRangeCodecRangeValuerToText struct {
+ rc *RangeCodec
+ m *Map
+}
+
+func (plan *encodePlanRangeCodecRangeValuerToText) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ getter := value.(RangeValuer)
+
+ if getter.IsNull() {
+ return nil, nil
+ }
+
+ lowerType, upperType := getter.BoundTypes()
+ lower, upper := getter.Bounds()
+
+ switch lowerType {
+ case Exclusive, Unbounded:
+ buf = append(buf, '(')
+ case Inclusive:
+ buf = append(buf, '[')
+ case Empty:
+ return append(buf, "empty"...), nil
+ default:
+ return nil, fmt.Errorf("unknown lower bound type %v", lowerType)
+ }
+
+ if lowerType != Unbounded {
+ if lower == nil {
+ return nil, fmt.Errorf("Lower cannot be NULL unless LowerType is Unbounded")
+ }
+
+ lowerPlan := plan.m.PlanEncode(plan.rc.ElementType.OID, TextFormatCode, lower)
+ if lowerPlan == nil {
+ return nil, fmt.Errorf("cannot encode %v as element of range", lower)
+ }
+
+ buf, err = lowerPlan.Encode(lower, buf)
+ if err != nil {
+ return nil, fmt.Errorf("failed to encode %v as element of range: %w", lower, err)
+ }
+ if buf == nil {
+ return nil, fmt.Errorf("Lower cannot be NULL unless LowerType is Unbounded")
+ }
+ }
+
+ buf = append(buf, ',')
+
+ if upperType != Unbounded {
+ if upper == nil {
+ return nil, fmt.Errorf("Upper cannot be NULL unless UpperType is Unbounded")
+ }
+
+ upperPlan := plan.m.PlanEncode(plan.rc.ElementType.OID, TextFormatCode, upper)
+ if upperPlan == nil {
+ return nil, fmt.Errorf("cannot encode %v as element of range", upper)
+ }
+
+ buf, err = upperPlan.Encode(upper, buf)
+ if err != nil {
+ return nil, fmt.Errorf("failed to encode %v as element of range: %w", upper, err)
+ }
+ if buf == nil {
+ return nil, fmt.Errorf("Upper cannot be NULL unless UpperType is Unbounded")
+ }
+ }
+
+ switch upperType {
+ case Exclusive, Unbounded:
+ buf = append(buf, ')')
+ case Inclusive:
+ buf = append(buf, ']')
+ default:
+ return nil, fmt.Errorf("unknown upper bound type %v", upperType)
+ }
+
+ return buf, nil
+}
+
+func (c *RangeCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case RangeScanner:
+ return &scanPlanBinaryRangeToRangeScanner{rc: c, m: m}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case RangeScanner:
+ return &scanPlanTextRangeToRangeScanner{rc: c, m: m}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryRangeToRangeScanner struct {
+ rc *RangeCodec
+ m *Map
+}
+
+func (plan *scanPlanBinaryRangeToRangeScanner) Scan(src []byte, target any) error {
+ rangeScanner := (target).(RangeScanner)
+
+ if src == nil {
+ return rangeScanner.ScanNull()
+ }
+
+ ubr, err := parseUntypedBinaryRange(src)
+ if err != nil {
+ return err
+ }
+
+ if ubr.LowerType == Empty {
+ return rangeScanner.SetBoundTypes(ubr.LowerType, ubr.UpperType)
+ }
+
+ lowerTarget, upperTarget := rangeScanner.ScanBounds()
+
+ if ubr.LowerType == Inclusive || ubr.LowerType == Exclusive {
+ lowerPlan := plan.m.PlanScan(plan.rc.ElementType.OID, BinaryFormatCode, lowerTarget)
+ if lowerPlan == nil {
+ return fmt.Errorf("cannot scan into %v from range element", lowerTarget)
+ }
+
+ err = lowerPlan.Scan(ubr.Lower, lowerTarget)
+ if err != nil {
+ return fmt.Errorf("cannot scan into %v from range element: %w", lowerTarget, err)
+ }
+ }
+
+ if ubr.UpperType == Inclusive || ubr.UpperType == Exclusive {
+ upperPlan := plan.m.PlanScan(plan.rc.ElementType.OID, BinaryFormatCode, upperTarget)
+ if upperPlan == nil {
+ return fmt.Errorf("cannot scan into %v from range element", upperTarget)
+ }
+
+ err = upperPlan.Scan(ubr.Upper, upperTarget)
+ if err != nil {
+ return fmt.Errorf("cannot scan into %v from range element: %w", upperTarget, err)
+ }
+ }
+
+ return rangeScanner.SetBoundTypes(ubr.LowerType, ubr.UpperType)
+}
+
+type scanPlanTextRangeToRangeScanner struct {
+ rc *RangeCodec
+ m *Map
+}
+
+func (plan *scanPlanTextRangeToRangeScanner) Scan(src []byte, target any) error {
+ rangeScanner := (target).(RangeScanner)
+
+ if src == nil {
+ return rangeScanner.ScanNull()
+ }
+
+ utr, err := parseUntypedTextRange(string(src))
+ if err != nil {
+ return err
+ }
+
+ if utr.LowerType == Empty {
+ return rangeScanner.SetBoundTypes(utr.LowerType, utr.UpperType)
+ }
+
+ lowerTarget, upperTarget := rangeScanner.ScanBounds()
+
+ if utr.LowerType == Inclusive || utr.LowerType == Exclusive {
+ lowerPlan := plan.m.PlanScan(plan.rc.ElementType.OID, TextFormatCode, lowerTarget)
+ if lowerPlan == nil {
+ return fmt.Errorf("cannot scan into %v from range element", lowerTarget)
+ }
+
+ err = lowerPlan.Scan([]byte(utr.Lower), lowerTarget)
+ if err != nil {
+ return fmt.Errorf("cannot scan into %v from range element: %w", lowerTarget, err)
+ }
+ }
+
+ if utr.UpperType == Inclusive || utr.UpperType == Exclusive {
+ upperPlan := plan.m.PlanScan(plan.rc.ElementType.OID, TextFormatCode, upperTarget)
+ if upperPlan == nil {
+ return fmt.Errorf("cannot scan into %v from range element", upperTarget)
+ }
+
+ err = upperPlan.Scan([]byte(utr.Upper), upperTarget)
+ if err != nil {
+ return fmt.Errorf("cannot scan into %v from range element: %w", upperTarget, err)
+ }
+ }
+
+ return rangeScanner.SetBoundTypes(utr.LowerType, utr.UpperType)
+}
+
+func (c *RangeCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ switch format {
+ case TextFormatCode:
+ return string(src), nil
+ case BinaryFormatCode:
+ buf := make([]byte, len(src))
+ copy(buf, src)
+ return buf, nil
+ default:
+ return nil, fmt.Errorf("unknown format code %d", format)
+ }
+}
+
+func (c *RangeCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var r Range[any]
+ err := c.PlanScan(m, oid, format, &r).Scan(src, &r)
+ return r, err
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/record_codec.go b/vendor/github.com/jackc/pgx/v5/pgtype/record_codec.go
new file mode 100644
index 0000000..b3b1660
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/record_codec.go
@@ -0,0 +1,125 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "fmt"
+)
+
+// ArrayGetter is a type that can be converted into a PostgreSQL array.
+
+// RecordCodec is a codec for the generic PostgreSQL record type such as is created with the "row" function. Record can
+// only decode the binary format. The text format output format from PostgreSQL does not include type information and
+// is therefore impossible to decode. Encoding is impossible because PostgreSQL does not support input of generic
+// records.
+type RecordCodec struct{}
+
+func (RecordCodec) FormatSupported(format int16) bool {
+ return format == BinaryFormatCode
+}
+
+func (RecordCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (RecordCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ return nil
+}
+
+func (RecordCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+ if format == BinaryFormatCode {
+ switch target.(type) {
+ case CompositeIndexScanner:
+ return &scanPlanBinaryRecordToCompositeIndexScanner{m: m}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryRecordToCompositeIndexScanner struct {
+ m *Map
+}
+
+func (plan *scanPlanBinaryRecordToCompositeIndexScanner) Scan(src []byte, target any) error {
+ targetScanner := (target).(CompositeIndexScanner)
+
+ if src == nil {
+ return targetScanner.ScanNull()
+ }
+
+ scanner := NewCompositeBinaryScanner(plan.m, src)
+ for i := 0; scanner.Next(); i++ {
+ fieldTarget := targetScanner.ScanIndex(i)
+ if fieldTarget != nil {
+ fieldPlan := plan.m.PlanScan(scanner.OID(), BinaryFormatCode, fieldTarget)
+ if fieldPlan == nil {
+ return fmt.Errorf("unable to scan OID %d in binary format into %v", scanner.OID(), fieldTarget)
+ }
+
+ err := fieldPlan.Scan(scanner.Bytes(), fieldTarget)
+ if err != nil {
+ return err
+ }
+ }
+ }
+
+ if err := scanner.Err(); err != nil {
+ return err
+ }
+
+ return nil
+}
+
+func (RecordCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ switch format {
+ case TextFormatCode:
+ return string(src), nil
+ case BinaryFormatCode:
+ buf := make([]byte, len(src))
+ copy(buf, src)
+ return buf, nil
+ default:
+ return nil, fmt.Errorf("unknown format code %d", format)
+ }
+}
+
+func (RecordCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ switch format {
+ case TextFormatCode:
+ return string(src), nil
+ case BinaryFormatCode:
+ scanner := NewCompositeBinaryScanner(m, src)
+ values := make([]any, scanner.FieldCount())
+ for i := 0; scanner.Next(); i++ {
+ var v any
+ fieldPlan := m.PlanScan(scanner.OID(), BinaryFormatCode, &v)
+ if fieldPlan == nil {
+ return nil, fmt.Errorf("unable to scan OID %d in binary format into %v", scanner.OID(), v)
+ }
+
+ err := fieldPlan.Scan(scanner.Bytes(), &v)
+ if err != nil {
+ return nil, err
+ }
+
+ values[i] = v
+ }
+
+ if err := scanner.Err(); err != nil {
+ return nil, err
+ }
+
+ return values, nil
+ default:
+ return nil, fmt.Errorf("unknown format code %d", format)
+ }
+
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/register_default_pg_types.go b/vendor/github.com/jackc/pgx/v5/pgtype/register_default_pg_types.go
new file mode 100644
index 0000000..be1ca4a
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/register_default_pg_types.go
@@ -0,0 +1,35 @@
+//go:build !nopgxregisterdefaulttypes
+
+package pgtype
+
+func registerDefaultPgTypeVariants[T any](m *Map, name string) {
+ arrayName := "_" + name
+
+ var value T
+ m.RegisterDefaultPgType(value, name) // T
+ m.RegisterDefaultPgType(&value, name) // *T
+
+ var sliceT []T
+ m.RegisterDefaultPgType(sliceT, arrayName) // []T
+ m.RegisterDefaultPgType(&sliceT, arrayName) // *[]T
+
+ var slicePtrT []*T
+ m.RegisterDefaultPgType(slicePtrT, arrayName) // []*T
+ m.RegisterDefaultPgType(&slicePtrT, arrayName) // *[]*T
+
+ var arrayOfT Array[T]
+ m.RegisterDefaultPgType(arrayOfT, arrayName) // Array[T]
+ m.RegisterDefaultPgType(&arrayOfT, arrayName) // *Array[T]
+
+ var arrayOfPtrT Array[*T]
+ m.RegisterDefaultPgType(arrayOfPtrT, arrayName) // Array[*T]
+ m.RegisterDefaultPgType(&arrayOfPtrT, arrayName) // *Array[*T]
+
+ var flatArrayOfT FlatArray[T]
+ m.RegisterDefaultPgType(flatArrayOfT, arrayName) // FlatArray[T]
+ m.RegisterDefaultPgType(&flatArrayOfT, arrayName) // *FlatArray[T]
+
+ var flatArrayOfPtrT FlatArray[*T]
+ m.RegisterDefaultPgType(flatArrayOfPtrT, arrayName) // FlatArray[*T]
+ m.RegisterDefaultPgType(&flatArrayOfPtrT, arrayName) // *FlatArray[*T]
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/register_default_pg_types_disabled.go b/vendor/github.com/jackc/pgx/v5/pgtype/register_default_pg_types_disabled.go
new file mode 100644
index 0000000..56fe7c2
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/register_default_pg_types_disabled.go
@@ -0,0 +1,6 @@
+//go:build nopgxregisterdefaulttypes
+
+package pgtype
+
+func registerDefaultPgTypeVariants[T any](m *Map, name string) {
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/text.go b/vendor/github.com/jackc/pgx/v5/pgtype/text.go
new file mode 100644
index 0000000..021ee33
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/text.go
@@ -0,0 +1,223 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/json"
+ "fmt"
+)
+
+type TextScanner interface {
+ ScanText(v Text) error
+}
+
+type TextValuer interface {
+ TextValue() (Text, error)
+}
+
+type Text struct {
+ String string
+ Valid bool
+}
+
+func (t *Text) ScanText(v Text) error {
+ *t = v
+ return nil
+}
+
+func (t Text) TextValue() (Text, error) {
+ return t, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (dst *Text) Scan(src any) error {
+ if src == nil {
+ *dst = Text{}
+ return nil
+ }
+
+ switch src := src.(type) {
+ case string:
+ *dst = Text{String: src, Valid: true}
+ return nil
+ case []byte:
+ *dst = Text{String: string(src), Valid: true}
+ return nil
+ }
+
+ return fmt.Errorf("cannot scan %T", src)
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (src Text) Value() (driver.Value, error) {
+ if !src.Valid {
+ return nil, nil
+ }
+ return src.String, nil
+}
+
+func (src Text) MarshalJSON() ([]byte, error) {
+ if !src.Valid {
+ return []byte("null"), nil
+ }
+
+ return json.Marshal(src.String)
+}
+
+func (dst *Text) UnmarshalJSON(b []byte) error {
+ var s *string
+ err := json.Unmarshal(b, &s)
+ if err != nil {
+ return err
+ }
+
+ if s == nil {
+ *dst = Text{}
+ } else {
+ *dst = Text{String: *s, Valid: true}
+ }
+
+ return nil
+}
+
+type TextCodec struct{}
+
+func (TextCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (TextCodec) PreferredFormat() int16 {
+ return TextFormatCode
+}
+
+func (TextCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ switch format {
+ case TextFormatCode, BinaryFormatCode:
+ switch value.(type) {
+ case string:
+ return encodePlanTextCodecString{}
+ case []byte:
+ return encodePlanTextCodecByteSlice{}
+ case TextValuer:
+ return encodePlanTextCodecTextValuer{}
+ }
+ }
+
+ return nil
+}
+
+type encodePlanTextCodecString struct{}
+
+func (encodePlanTextCodecString) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ s := value.(string)
+ buf = append(buf, s...)
+ return buf, nil
+}
+
+type encodePlanTextCodecByteSlice struct{}
+
+func (encodePlanTextCodecByteSlice) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ s := value.([]byte)
+ buf = append(buf, s...)
+ return buf, nil
+}
+
+type encodePlanTextCodecStringer struct{}
+
+func (encodePlanTextCodecStringer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ s := value.(fmt.Stringer)
+ buf = append(buf, s.String()...)
+ return buf, nil
+}
+
+type encodePlanTextCodecTextValuer struct{}
+
+func (encodePlanTextCodecTextValuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ text, err := value.(TextValuer).TextValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !text.Valid {
+ return nil, nil
+ }
+
+ buf = append(buf, text.String...)
+ return buf, nil
+}
+
+func (TextCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case TextFormatCode, BinaryFormatCode:
+ switch target.(type) {
+ case *string:
+ return scanPlanTextAnyToString{}
+ case *[]byte:
+ return scanPlanAnyToNewByteSlice{}
+ case BytesScanner:
+ return scanPlanAnyToByteScanner{}
+ case TextScanner:
+ return scanPlanTextAnyToTextScanner{}
+ }
+ }
+
+ return nil
+}
+
+func (c TextCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ return c.DecodeValue(m, oid, format, src)
+}
+
+func (c TextCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ return string(src), nil
+}
+
+type scanPlanTextAnyToString struct{}
+
+func (scanPlanTextAnyToString) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ p := (dst).(*string)
+ *p = string(src)
+
+ return nil
+}
+
+type scanPlanAnyToNewByteSlice struct{}
+
+func (scanPlanAnyToNewByteSlice) Scan(src []byte, dst any) error {
+ p := (dst).(*[]byte)
+ if src == nil {
+ *p = nil
+ } else {
+ *p = make([]byte, len(src))
+ copy(*p, src)
+ }
+
+ return nil
+}
+
+type scanPlanAnyToByteScanner struct{}
+
+func (scanPlanAnyToByteScanner) Scan(src []byte, dst any) error {
+ p := (dst).(BytesScanner)
+ return p.ScanBytes(src)
+}
+
+type scanPlanTextAnyToTextScanner struct{}
+
+func (scanPlanTextAnyToTextScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(TextScanner)
+
+ if src == nil {
+ return scanner.ScanText(Text{})
+ }
+
+ return scanner.ScanText(Text{String: string(src), Valid: true})
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/text_format_only_codec.go b/vendor/github.com/jackc/pgx/v5/pgtype/text_format_only_codec.go
new file mode 100644
index 0000000..d5e4cdb
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/text_format_only_codec.go
@@ -0,0 +1,13 @@
+package pgtype
+
+type TextFormatOnlyCodec struct {
+ Codec
+}
+
+func (c *TextFormatOnlyCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode && c.Codec.FormatSupported(format)
+}
+
+func (TextFormatOnlyCodec) PreferredFormat() int16 {
+ return TextFormatCode
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/tid.go b/vendor/github.com/jackc/pgx/v5/pgtype/tid.go
new file mode 100644
index 0000000..9bc2c2a
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/tid.go
@@ -0,0 +1,241 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "fmt"
+ "strconv"
+ "strings"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+type TIDScanner interface {
+ ScanTID(v TID) error
+}
+
+type TIDValuer interface {
+ TIDValue() (TID, error)
+}
+
+// TID is PostgreSQL's Tuple Identifier type.
+//
+// When one does
+//
+// select ctid, * from some_table;
+//
+// it is the data type of the ctid hidden system column.
+//
+// It is currently implemented as a pair unsigned two byte integers.
+// Its conversion functions can be found in src/backend/utils/adt/tid.c
+// in the PostgreSQL sources.
+type TID struct {
+ BlockNumber uint32
+ OffsetNumber uint16
+ Valid bool
+}
+
+func (b *TID) ScanTID(v TID) error {
+ *b = v
+ return nil
+}
+
+func (b TID) TIDValue() (TID, error) {
+ return b, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (dst *TID) Scan(src any) error {
+ if src == nil {
+ *dst = TID{}
+ return nil
+ }
+
+ switch src := src.(type) {
+ case string:
+ return scanPlanTextAnyToTIDScanner{}.Scan([]byte(src), dst)
+ }
+
+ return fmt.Errorf("cannot scan %T", src)
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (src TID) Value() (driver.Value, error) {
+ if !src.Valid {
+ return nil, nil
+ }
+
+ buf, err := TIDCodec{}.PlanEncode(nil, 0, TextFormatCode, src).Encode(src, nil)
+ if err != nil {
+ return nil, err
+ }
+ return string(buf), err
+}
+
+type TIDCodec struct{}
+
+func (TIDCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (TIDCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (TIDCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ if _, ok := value.(TIDValuer); !ok {
+ return nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ return encodePlanTIDCodecBinary{}
+ case TextFormatCode:
+ return encodePlanTIDCodecText{}
+ }
+
+ return nil
+}
+
+type encodePlanTIDCodecBinary struct{}
+
+func (encodePlanTIDCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ tid, err := value.(TIDValuer).TIDValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !tid.Valid {
+ return nil, nil
+ }
+
+ buf = pgio.AppendUint32(buf, tid.BlockNumber)
+ buf = pgio.AppendUint16(buf, tid.OffsetNumber)
+ return buf, nil
+}
+
+type encodePlanTIDCodecText struct{}
+
+func (encodePlanTIDCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ tid, err := value.(TIDValuer).TIDValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !tid.Valid {
+ return nil, nil
+ }
+
+ buf = append(buf, fmt.Sprintf(`(%d,%d)`, tid.BlockNumber, tid.OffsetNumber)...)
+ return buf, nil
+}
+
+func (TIDCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case TIDScanner:
+ return scanPlanBinaryTIDToTIDScanner{}
+ case TextScanner:
+ return scanPlanBinaryTIDToTextScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case TIDScanner:
+ return scanPlanTextAnyToTIDScanner{}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryTIDToTIDScanner struct{}
+
+func (scanPlanBinaryTIDToTIDScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(TIDScanner)
+
+ if src == nil {
+ return scanner.ScanTID(TID{})
+ }
+
+ if len(src) != 6 {
+ return fmt.Errorf("invalid length for tid: %v", len(src))
+ }
+
+ return scanner.ScanTID(TID{
+ BlockNumber: binary.BigEndian.Uint32(src),
+ OffsetNumber: binary.BigEndian.Uint16(src[4:]),
+ Valid: true,
+ })
+}
+
+type scanPlanBinaryTIDToTextScanner struct{}
+
+func (scanPlanBinaryTIDToTextScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(TextScanner)
+
+ if src == nil {
+ return scanner.ScanText(Text{})
+ }
+
+ if len(src) != 6 {
+ return fmt.Errorf("invalid length for tid: %v", len(src))
+ }
+
+ blockNumber := binary.BigEndian.Uint32(src)
+ offsetNumber := binary.BigEndian.Uint16(src[4:])
+
+ return scanner.ScanText(Text{
+ String: fmt.Sprintf(`(%d,%d)`, blockNumber, offsetNumber),
+ Valid: true,
+ })
+}
+
+type scanPlanTextAnyToTIDScanner struct{}
+
+func (scanPlanTextAnyToTIDScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(TIDScanner)
+
+ if src == nil {
+ return scanner.ScanTID(TID{})
+ }
+
+ if len(src) < 5 {
+ return fmt.Errorf("invalid length for tid: %v", len(src))
+ }
+
+ block, offset, found := strings.Cut(string(src[1:len(src)-1]), ",")
+ if !found {
+ return fmt.Errorf("invalid format for tid")
+ }
+
+ blockNumber, err := strconv.ParseUint(block, 10, 32)
+ if err != nil {
+ return err
+ }
+
+ offsetNumber, err := strconv.ParseUint(offset, 10, 16)
+ if err != nil {
+ return err
+ }
+
+ return scanner.ScanTID(TID{BlockNumber: uint32(blockNumber), OffsetNumber: uint16(offsetNumber), Valid: true})
+}
+
+func (c TIDCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ return codecDecodeToTextFormat(c, m, oid, format, src)
+}
+
+func (c TIDCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var tid TID
+ err := codecScan(c, m, oid, format, src, &tid)
+ if err != nil {
+ return nil, err
+ }
+ return tid, nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/time.go b/vendor/github.com/jackc/pgx/v5/pgtype/time.go
new file mode 100644
index 0000000..f8fd948
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/time.go
@@ -0,0 +1,274 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "fmt"
+ "strconv"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+type TimeScanner interface {
+ ScanTime(v Time) error
+}
+
+type TimeValuer interface {
+ TimeValue() (Time, error)
+}
+
+// Time represents the PostgreSQL time type. The PostgreSQL time is a time of day without time zone.
+//
+// Time is represented as the number of microseconds since midnight in the same way that PostgreSQL does. Other time and
+// date types in pgtype can use time.Time as the underlying representation. However, pgtype.Time type cannot due to
+// needing to handle 24:00:00. time.Time converts that to 00:00:00 on the following day.
+//
+// The time with time zone type is not supported. Use of time with time zone is discouraged by the PostgreSQL documentation.
+type Time struct {
+ Microseconds int64 // Number of microseconds since midnight
+ Valid bool
+}
+
+func (t *Time) ScanTime(v Time) error {
+ *t = v
+ return nil
+}
+
+func (t Time) TimeValue() (Time, error) {
+ return t, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (t *Time) Scan(src any) error {
+ if src == nil {
+ *t = Time{}
+ return nil
+ }
+
+ switch src := src.(type) {
+ case string:
+ err := scanPlanTextAnyToTimeScanner{}.Scan([]byte(src), t)
+ if err != nil {
+ t.Microseconds = 0
+ t.Valid = false
+ }
+ return err
+ }
+
+ return fmt.Errorf("cannot scan %T", src)
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (t Time) Value() (driver.Value, error) {
+ if !t.Valid {
+ return nil, nil
+ }
+
+ buf, err := TimeCodec{}.PlanEncode(nil, 0, TextFormatCode, t).Encode(t, nil)
+ if err != nil {
+ return nil, err
+ }
+ return string(buf), err
+}
+
+type TimeCodec struct{}
+
+func (TimeCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (TimeCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (TimeCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ if _, ok := value.(TimeValuer); !ok {
+ return nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ return encodePlanTimeCodecBinary{}
+ case TextFormatCode:
+ return encodePlanTimeCodecText{}
+ }
+
+ return nil
+}
+
+type encodePlanTimeCodecBinary struct{}
+
+func (encodePlanTimeCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ t, err := value.(TimeValuer).TimeValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !t.Valid {
+ return nil, nil
+ }
+
+ return pgio.AppendInt64(buf, t.Microseconds), nil
+}
+
+type encodePlanTimeCodecText struct{}
+
+func (encodePlanTimeCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ t, err := value.(TimeValuer).TimeValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !t.Valid {
+ return nil, nil
+ }
+
+ usec := t.Microseconds
+ hours := usec / microsecondsPerHour
+ usec -= hours * microsecondsPerHour
+ minutes := usec / microsecondsPerMinute
+ usec -= minutes * microsecondsPerMinute
+ seconds := usec / microsecondsPerSecond
+ usec -= seconds * microsecondsPerSecond
+
+ s := fmt.Sprintf("%02d:%02d:%02d.%06d", hours, minutes, seconds, usec)
+
+ return append(buf, s...), nil
+}
+
+func (TimeCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case TimeScanner:
+ return scanPlanBinaryTimeToTimeScanner{}
+ case TextScanner:
+ return scanPlanBinaryTimeToTextScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case TimeScanner:
+ return scanPlanTextAnyToTimeScanner{}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryTimeToTimeScanner struct{}
+
+func (scanPlanBinaryTimeToTimeScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(TimeScanner)
+
+ if src == nil {
+ return scanner.ScanTime(Time{})
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for time: %v", len(src))
+ }
+
+ usec := int64(binary.BigEndian.Uint64(src))
+
+ return scanner.ScanTime(Time{Microseconds: usec, Valid: true})
+}
+
+type scanPlanBinaryTimeToTextScanner struct{}
+
+func (scanPlanBinaryTimeToTextScanner) Scan(src []byte, dst any) error {
+ ts, ok := (dst).(TextScanner)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ if src == nil {
+ return ts.ScanText(Text{})
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for time: %v", len(src))
+ }
+
+ usec := int64(binary.BigEndian.Uint64(src))
+
+ tim := Time{Microseconds: usec, Valid: true}
+
+ buf, err := TimeCodec{}.PlanEncode(nil, 0, TextFormatCode, tim).Encode(tim, nil)
+ if err != nil {
+ return err
+ }
+
+ return ts.ScanText(Text{String: string(buf), Valid: true})
+}
+
+type scanPlanTextAnyToTimeScanner struct{}
+
+func (scanPlanTextAnyToTimeScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(TimeScanner)
+
+ if src == nil {
+ return scanner.ScanTime(Time{})
+ }
+
+ s := string(src)
+
+ if len(s) < 8 || s[2] != ':' || s[5] != ':' {
+ return fmt.Errorf("cannot decode %v into Time", s)
+ }
+
+ hours, err := strconv.ParseInt(s[0:2], 10, 64)
+ if err != nil {
+ return fmt.Errorf("cannot decode %v into Time", s)
+ }
+ usec := hours * microsecondsPerHour
+
+ minutes, err := strconv.ParseInt(s[3:5], 10, 64)
+ if err != nil {
+ return fmt.Errorf("cannot decode %v into Time", s)
+ }
+ usec += minutes * microsecondsPerMinute
+
+ seconds, err := strconv.ParseInt(s[6:8], 10, 64)
+ if err != nil {
+ return fmt.Errorf("cannot decode %v into Time", s)
+ }
+ usec += seconds * microsecondsPerSecond
+
+ if len(s) > 9 {
+ if s[8] != '.' || len(s) > 15 {
+ return fmt.Errorf("cannot decode %v into Time", s)
+ }
+
+ fraction := s[9:]
+ n, err := strconv.ParseInt(fraction, 10, 64)
+ if err != nil {
+ return fmt.Errorf("cannot decode %v into Time", s)
+ }
+
+ for i := len(fraction); i < 6; i++ {
+ n *= 10
+ }
+
+ usec += n
+ }
+
+ return scanner.ScanTime(Time{Microseconds: usec, Valid: true})
+}
+
+func (c TimeCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ return codecDecodeToTextFormat(c, m, oid, format, src)
+}
+
+func (c TimeCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var t Time
+ err := codecScan(c, m, oid, format, src, &t)
+ if err != nil {
+ return nil, err
+ }
+ return t, nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/timestamp.go b/vendor/github.com/jackc/pgx/v5/pgtype/timestamp.go
new file mode 100644
index 0000000..ff2739d
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/timestamp.go
@@ -0,0 +1,355 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "encoding/json"
+ "fmt"
+ "strings"
+ "time"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+const pgTimestampFormat = "2006-01-02 15:04:05.999999999"
+
+type TimestampScanner interface {
+ ScanTimestamp(v Timestamp) error
+}
+
+type TimestampValuer interface {
+ TimestampValue() (Timestamp, error)
+}
+
+// Timestamp represents the PostgreSQL timestamp type.
+type Timestamp struct {
+ Time time.Time // Time zone will be ignored when encoding to PostgreSQL.
+ InfinityModifier InfinityModifier
+ Valid bool
+}
+
+func (ts *Timestamp) ScanTimestamp(v Timestamp) error {
+ *ts = v
+ return nil
+}
+
+func (ts Timestamp) TimestampValue() (Timestamp, error) {
+ return ts, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (ts *Timestamp) Scan(src any) error {
+ if src == nil {
+ *ts = Timestamp{}
+ return nil
+ }
+
+ switch src := src.(type) {
+ case string:
+ return (&scanPlanTextTimestampToTimestampScanner{}).Scan([]byte(src), ts)
+ case time.Time:
+ *ts = Timestamp{Time: src, Valid: true}
+ return nil
+ }
+
+ return fmt.Errorf("cannot scan %T", src)
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (ts Timestamp) Value() (driver.Value, error) {
+ if !ts.Valid {
+ return nil, nil
+ }
+
+ if ts.InfinityModifier != Finite {
+ return ts.InfinityModifier.String(), nil
+ }
+ return ts.Time, nil
+}
+
+func (ts Timestamp) MarshalJSON() ([]byte, error) {
+ if !ts.Valid {
+ return []byte("null"), nil
+ }
+
+ var s string
+
+ switch ts.InfinityModifier {
+ case Finite:
+ s = ts.Time.Format(time.RFC3339Nano)
+ case Infinity:
+ s = "infinity"
+ case NegativeInfinity:
+ s = "-infinity"
+ }
+
+ return json.Marshal(s)
+}
+
+func (ts *Timestamp) UnmarshalJSON(b []byte) error {
+ var s *string
+ err := json.Unmarshal(b, &s)
+ if err != nil {
+ return err
+ }
+
+ if s == nil {
+ *ts = Timestamp{}
+ return nil
+ }
+
+ switch *s {
+ case "infinity":
+ *ts = Timestamp{Valid: true, InfinityModifier: Infinity}
+ case "-infinity":
+ *ts = Timestamp{Valid: true, InfinityModifier: -Infinity}
+ default:
+ // PostgreSQL uses ISO 8601 wihout timezone for to_json function and casting from a string to timestampt
+ tim, err := time.Parse(time.RFC3339Nano, *s+"Z")
+ if err != nil {
+ return err
+ }
+
+ *ts = Timestamp{Time: tim, Valid: true}
+ }
+
+ return nil
+}
+
+type TimestampCodec struct {
+ // ScanLocation is the location that the time is assumed to be in for scanning. This is different from
+ // TimestamptzCodec.ScanLocation in that this setting does change the instant in time that the timestamp represents.
+ ScanLocation *time.Location
+}
+
+func (*TimestampCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (*TimestampCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (*TimestampCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ if _, ok := value.(TimestampValuer); !ok {
+ return nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ return encodePlanTimestampCodecBinary{}
+ case TextFormatCode:
+ return encodePlanTimestampCodecText{}
+ }
+
+ return nil
+}
+
+type encodePlanTimestampCodecBinary struct{}
+
+func (encodePlanTimestampCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ ts, err := value.(TimestampValuer).TimestampValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !ts.Valid {
+ return nil, nil
+ }
+
+ var microsecSinceY2K int64
+ switch ts.InfinityModifier {
+ case Finite:
+ t := discardTimeZone(ts.Time)
+ microsecSinceUnixEpoch := t.Unix()*1000000 + int64(t.Nanosecond())/1000
+ microsecSinceY2K = microsecSinceUnixEpoch - microsecFromUnixEpochToY2K
+ case Infinity:
+ microsecSinceY2K = infinityMicrosecondOffset
+ case NegativeInfinity:
+ microsecSinceY2K = negativeInfinityMicrosecondOffset
+ }
+
+ buf = pgio.AppendInt64(buf, microsecSinceY2K)
+
+ return buf, nil
+}
+
+type encodePlanTimestampCodecText struct{}
+
+func (encodePlanTimestampCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ ts, err := value.(TimestampValuer).TimestampValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !ts.Valid {
+ return nil, nil
+ }
+
+ var s string
+
+ switch ts.InfinityModifier {
+ case Finite:
+ t := discardTimeZone(ts.Time)
+
+ // Year 0000 is 1 BC
+ bc := false
+ if year := t.Year(); year <= 0 {
+ year = -year + 1
+ t = time.Date(year, t.Month(), t.Day(), t.Hour(), t.Minute(), t.Second(), t.Nanosecond(), time.UTC)
+ bc = true
+ }
+
+ s = t.Truncate(time.Microsecond).Format(pgTimestampFormat)
+
+ if bc {
+ s = s + " BC"
+ }
+ case Infinity:
+ s = "infinity"
+ case NegativeInfinity:
+ s = "-infinity"
+ }
+
+ buf = append(buf, s...)
+
+ return buf, nil
+}
+
+func discardTimeZone(t time.Time) time.Time {
+ if t.Location() != time.UTC {
+ return time.Date(t.Year(), t.Month(), t.Day(), t.Hour(), t.Minute(), t.Second(), t.Nanosecond(), time.UTC)
+ }
+
+ return t
+}
+
+func (c *TimestampCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case TimestampScanner:
+ return &scanPlanBinaryTimestampToTimestampScanner{location: c.ScanLocation}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case TimestampScanner:
+ return &scanPlanTextTimestampToTimestampScanner{location: c.ScanLocation}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryTimestampToTimestampScanner struct{ location *time.Location }
+
+func (plan *scanPlanBinaryTimestampToTimestampScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(TimestampScanner)
+
+ if src == nil {
+ return scanner.ScanTimestamp(Timestamp{})
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for timestamp: %v", len(src))
+ }
+
+ var ts Timestamp
+ microsecSinceY2K := int64(binary.BigEndian.Uint64(src))
+
+ switch microsecSinceY2K {
+ case infinityMicrosecondOffset:
+ ts = Timestamp{Valid: true, InfinityModifier: Infinity}
+ case negativeInfinityMicrosecondOffset:
+ ts = Timestamp{Valid: true, InfinityModifier: -Infinity}
+ default:
+ tim := time.Unix(
+ microsecFromUnixEpochToY2K/1000000+microsecSinceY2K/1000000,
+ (microsecFromUnixEpochToY2K%1000000*1000)+(microsecSinceY2K%1000000*1000),
+ ).UTC()
+ if plan.location != nil {
+ tim = time.Date(tim.Year(), tim.Month(), tim.Day(), tim.Hour(), tim.Minute(), tim.Second(), tim.Nanosecond(), plan.location)
+ }
+ ts = Timestamp{Time: tim, Valid: true}
+ }
+
+ return scanner.ScanTimestamp(ts)
+}
+
+type scanPlanTextTimestampToTimestampScanner struct{ location *time.Location }
+
+func (plan *scanPlanTextTimestampToTimestampScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(TimestampScanner)
+
+ if src == nil {
+ return scanner.ScanTimestamp(Timestamp{})
+ }
+
+ var ts Timestamp
+ sbuf := string(src)
+ switch sbuf {
+ case "infinity":
+ ts = Timestamp{Valid: true, InfinityModifier: Infinity}
+ case "-infinity":
+ ts = Timestamp{Valid: true, InfinityModifier: -Infinity}
+ default:
+ bc := false
+ if strings.HasSuffix(sbuf, " BC") {
+ sbuf = sbuf[:len(sbuf)-3]
+ bc = true
+ }
+ tim, err := time.Parse(pgTimestampFormat, sbuf)
+ if err != nil {
+ return err
+ }
+
+ if bc {
+ year := -tim.Year() + 1
+ tim = time.Date(year, tim.Month(), tim.Day(), tim.Hour(), tim.Minute(), tim.Second(), tim.Nanosecond(), tim.Location())
+ }
+
+ if plan.location != nil {
+ tim = time.Date(tim.Year(), tim.Month(), tim.Day(), tim.Hour(), tim.Minute(), tim.Second(), tim.Nanosecond(), plan.location)
+ }
+
+ ts = Timestamp{Time: tim, Valid: true}
+ }
+
+ return scanner.ScanTimestamp(ts)
+}
+
+func (c *TimestampCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var ts Timestamp
+ err := codecScan(c, m, oid, format, src, &ts)
+ if err != nil {
+ return nil, err
+ }
+
+ if ts.InfinityModifier != Finite {
+ return ts.InfinityModifier.String(), nil
+ }
+
+ return ts.Time, nil
+}
+
+func (c *TimestampCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var ts Timestamp
+ err := codecScan(c, m, oid, format, src, &ts)
+ if err != nil {
+ return nil, err
+ }
+
+ if ts.InfinityModifier != Finite {
+ return ts.InfinityModifier, nil
+ }
+
+ return ts.Time, nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/timestamptz.go b/vendor/github.com/jackc/pgx/v5/pgtype/timestamptz.go
new file mode 100644
index 0000000..7efbcff
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/timestamptz.go
@@ -0,0 +1,366 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "encoding/json"
+ "fmt"
+ "strings"
+ "time"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+const pgTimestamptzHourFormat = "2006-01-02 15:04:05.999999999Z07"
+const pgTimestamptzMinuteFormat = "2006-01-02 15:04:05.999999999Z07:00"
+const pgTimestamptzSecondFormat = "2006-01-02 15:04:05.999999999Z07:00:00"
+const microsecFromUnixEpochToY2K = 946684800 * 1000000
+
+const (
+ negativeInfinityMicrosecondOffset = -9223372036854775808
+ infinityMicrosecondOffset = 9223372036854775807
+)
+
+type TimestamptzScanner interface {
+ ScanTimestamptz(v Timestamptz) error
+}
+
+type TimestamptzValuer interface {
+ TimestamptzValue() (Timestamptz, error)
+}
+
+// Timestamptz represents the PostgreSQL timestamptz type.
+type Timestamptz struct {
+ Time time.Time
+ InfinityModifier InfinityModifier
+ Valid bool
+}
+
+func (tstz *Timestamptz) ScanTimestamptz(v Timestamptz) error {
+ *tstz = v
+ return nil
+}
+
+func (tstz Timestamptz) TimestamptzValue() (Timestamptz, error) {
+ return tstz, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (tstz *Timestamptz) Scan(src any) error {
+ if src == nil {
+ *tstz = Timestamptz{}
+ return nil
+ }
+
+ switch src := src.(type) {
+ case string:
+ return (&scanPlanTextTimestamptzToTimestamptzScanner{}).Scan([]byte(src), tstz)
+ case time.Time:
+ *tstz = Timestamptz{Time: src, Valid: true}
+ return nil
+ }
+
+ return fmt.Errorf("cannot scan %T", src)
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (tstz Timestamptz) Value() (driver.Value, error) {
+ if !tstz.Valid {
+ return nil, nil
+ }
+
+ if tstz.InfinityModifier != Finite {
+ return tstz.InfinityModifier.String(), nil
+ }
+ return tstz.Time, nil
+}
+
+func (tstz Timestamptz) MarshalJSON() ([]byte, error) {
+ if !tstz.Valid {
+ return []byte("null"), nil
+ }
+
+ var s string
+
+ switch tstz.InfinityModifier {
+ case Finite:
+ s = tstz.Time.Format(time.RFC3339Nano)
+ case Infinity:
+ s = "infinity"
+ case NegativeInfinity:
+ s = "-infinity"
+ }
+
+ return json.Marshal(s)
+}
+
+func (tstz *Timestamptz) UnmarshalJSON(b []byte) error {
+ var s *string
+ err := json.Unmarshal(b, &s)
+ if err != nil {
+ return err
+ }
+
+ if s == nil {
+ *tstz = Timestamptz{}
+ return nil
+ }
+
+ switch *s {
+ case "infinity":
+ *tstz = Timestamptz{Valid: true, InfinityModifier: Infinity}
+ case "-infinity":
+ *tstz = Timestamptz{Valid: true, InfinityModifier: -Infinity}
+ default:
+ // PostgreSQL uses ISO 8601 for to_json function and casting from a string to timestamptz
+ tim, err := time.Parse(time.RFC3339Nano, *s)
+ if err != nil {
+ return err
+ }
+
+ *tstz = Timestamptz{Time: tim, Valid: true}
+ }
+
+ return nil
+}
+
+type TimestamptzCodec struct {
+ // ScanLocation is the location to return scanned timestamptz values in. This does not change the instant in time that
+ // the timestamptz represents.
+ ScanLocation *time.Location
+}
+
+func (*TimestamptzCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (*TimestamptzCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (*TimestamptzCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ if _, ok := value.(TimestamptzValuer); !ok {
+ return nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ return encodePlanTimestamptzCodecBinary{}
+ case TextFormatCode:
+ return encodePlanTimestamptzCodecText{}
+ }
+
+ return nil
+}
+
+type encodePlanTimestamptzCodecBinary struct{}
+
+func (encodePlanTimestamptzCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ ts, err := value.(TimestamptzValuer).TimestamptzValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !ts.Valid {
+ return nil, nil
+ }
+
+ var microsecSinceY2K int64
+ switch ts.InfinityModifier {
+ case Finite:
+ microsecSinceUnixEpoch := ts.Time.Unix()*1000000 + int64(ts.Time.Nanosecond())/1000
+ microsecSinceY2K = microsecSinceUnixEpoch - microsecFromUnixEpochToY2K
+ case Infinity:
+ microsecSinceY2K = infinityMicrosecondOffset
+ case NegativeInfinity:
+ microsecSinceY2K = negativeInfinityMicrosecondOffset
+ }
+
+ buf = pgio.AppendInt64(buf, microsecSinceY2K)
+
+ return buf, nil
+}
+
+type encodePlanTimestamptzCodecText struct{}
+
+func (encodePlanTimestamptzCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ ts, err := value.(TimestamptzValuer).TimestamptzValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !ts.Valid {
+ return nil, nil
+ }
+
+ var s string
+
+ switch ts.InfinityModifier {
+ case Finite:
+
+ t := ts.Time.UTC().Truncate(time.Microsecond)
+
+ // Year 0000 is 1 BC
+ bc := false
+ if year := t.Year(); year <= 0 {
+ year = -year + 1
+ t = time.Date(year, t.Month(), t.Day(), t.Hour(), t.Minute(), t.Second(), t.Nanosecond(), time.UTC)
+ bc = true
+ }
+
+ s = t.Format(pgTimestamptzSecondFormat)
+
+ if bc {
+ s = s + " BC"
+ }
+ case Infinity:
+ s = "infinity"
+ case NegativeInfinity:
+ s = "-infinity"
+ }
+
+ buf = append(buf, s...)
+
+ return buf, nil
+}
+
+func (c *TimestamptzCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case TimestamptzScanner:
+ return &scanPlanBinaryTimestamptzToTimestamptzScanner{location: c.ScanLocation}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case TimestamptzScanner:
+ return &scanPlanTextTimestamptzToTimestamptzScanner{location: c.ScanLocation}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryTimestamptzToTimestamptzScanner struct{ location *time.Location }
+
+func (plan *scanPlanBinaryTimestamptzToTimestamptzScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(TimestamptzScanner)
+
+ if src == nil {
+ return scanner.ScanTimestamptz(Timestamptz{})
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for timestamptz: %v", len(src))
+ }
+
+ var tstz Timestamptz
+ microsecSinceY2K := int64(binary.BigEndian.Uint64(src))
+
+ switch microsecSinceY2K {
+ case infinityMicrosecondOffset:
+ tstz = Timestamptz{Valid: true, InfinityModifier: Infinity}
+ case negativeInfinityMicrosecondOffset:
+ tstz = Timestamptz{Valid: true, InfinityModifier: -Infinity}
+ default:
+ tim := time.Unix(
+ microsecFromUnixEpochToY2K/1000000+microsecSinceY2K/1000000,
+ (microsecFromUnixEpochToY2K%1000000*1000)+(microsecSinceY2K%1000000*1000),
+ )
+ if plan.location != nil {
+ tim = tim.In(plan.location)
+ }
+ tstz = Timestamptz{Time: tim, Valid: true}
+ }
+
+ return scanner.ScanTimestamptz(tstz)
+}
+
+type scanPlanTextTimestamptzToTimestamptzScanner struct{ location *time.Location }
+
+func (plan *scanPlanTextTimestamptzToTimestamptzScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(TimestamptzScanner)
+
+ if src == nil {
+ return scanner.ScanTimestamptz(Timestamptz{})
+ }
+
+ var tstz Timestamptz
+ sbuf := string(src)
+ switch sbuf {
+ case "infinity":
+ tstz = Timestamptz{Valid: true, InfinityModifier: Infinity}
+ case "-infinity":
+ tstz = Timestamptz{Valid: true, InfinityModifier: -Infinity}
+ default:
+ bc := false
+ if strings.HasSuffix(sbuf, " BC") {
+ sbuf = sbuf[:len(sbuf)-3]
+ bc = true
+ }
+
+ var format string
+ if len(sbuf) >= 9 && (sbuf[len(sbuf)-9] == '-' || sbuf[len(sbuf)-9] == '+') {
+ format = pgTimestamptzSecondFormat
+ } else if len(sbuf) >= 6 && (sbuf[len(sbuf)-6] == '-' || sbuf[len(sbuf)-6] == '+') {
+ format = pgTimestamptzMinuteFormat
+ } else {
+ format = pgTimestamptzHourFormat
+ }
+
+ tim, err := time.Parse(format, sbuf)
+ if err != nil {
+ return err
+ }
+
+ if bc {
+ year := -tim.Year() + 1
+ tim = time.Date(year, tim.Month(), tim.Day(), tim.Hour(), tim.Minute(), tim.Second(), tim.Nanosecond(), tim.Location())
+ }
+
+ if plan.location != nil {
+ tim = tim.In(plan.location)
+ }
+
+ tstz = Timestamptz{Time: tim, Valid: true}
+ }
+
+ return scanner.ScanTimestamptz(tstz)
+}
+
+func (c *TimestamptzCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var tstz Timestamptz
+ err := codecScan(c, m, oid, format, src, &tstz)
+ if err != nil {
+ return nil, err
+ }
+
+ if tstz.InfinityModifier != Finite {
+ return tstz.InfinityModifier.String(), nil
+ }
+
+ return tstz.Time, nil
+}
+
+func (c *TimestamptzCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var tstz Timestamptz
+ err := codecScan(c, m, oid, format, src, &tstz)
+ if err != nil {
+ return nil, err
+ }
+
+ if tstz.InfinityModifier != Finite {
+ return tstz.InfinityModifier, nil
+ }
+
+ return tstz.Time, nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/uint32.go b/vendor/github.com/jackc/pgx/v5/pgtype/uint32.go
new file mode 100644
index 0000000..f2b2fa6
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/uint32.go
@@ -0,0 +1,325 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "fmt"
+ "math"
+ "strconv"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+type Uint32Scanner interface {
+ ScanUint32(v Uint32) error
+}
+
+type Uint32Valuer interface {
+ Uint32Value() (Uint32, error)
+}
+
+// Uint32 is the core type that is used to represent PostgreSQL types such as OID, CID, and XID.
+type Uint32 struct {
+ Uint32 uint32
+ Valid bool
+}
+
+func (n *Uint32) ScanUint32(v Uint32) error {
+ *n = v
+ return nil
+}
+
+func (n Uint32) Uint32Value() (Uint32, error) {
+ return n, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (dst *Uint32) Scan(src any) error {
+ if src == nil {
+ *dst = Uint32{}
+ return nil
+ }
+
+ var n int64
+
+ switch src := src.(type) {
+ case int64:
+ n = src
+ case string:
+ un, err := strconv.ParseUint(src, 10, 32)
+ if err != nil {
+ return err
+ }
+ n = int64(un)
+ default:
+ return fmt.Errorf("cannot scan %T", src)
+ }
+
+ if n < 0 {
+ return fmt.Errorf("%d is less than the minimum value for Uint32", n)
+ }
+ if n > math.MaxUint32 {
+ return fmt.Errorf("%d is greater than maximum value for Uint32", n)
+ }
+
+ *dst = Uint32{Uint32: uint32(n), Valid: true}
+
+ return nil
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (src Uint32) Value() (driver.Value, error) {
+ if !src.Valid {
+ return nil, nil
+ }
+ return int64(src.Uint32), nil
+}
+
+type Uint32Codec struct{}
+
+func (Uint32Codec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (Uint32Codec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (Uint32Codec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ switch format {
+ case BinaryFormatCode:
+ switch value.(type) {
+ case uint32:
+ return encodePlanUint32CodecBinaryUint32{}
+ case Uint32Valuer:
+ return encodePlanUint32CodecBinaryUint32Valuer{}
+ case Int64Valuer:
+ return encodePlanUint32CodecBinaryInt64Valuer{}
+ }
+ case TextFormatCode:
+ switch value.(type) {
+ case uint32:
+ return encodePlanUint32CodecTextUint32{}
+ case Int64Valuer:
+ return encodePlanUint32CodecTextInt64Valuer{}
+ }
+ }
+
+ return nil
+}
+
+type encodePlanUint32CodecBinaryUint32 struct{}
+
+func (encodePlanUint32CodecBinaryUint32) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ v := value.(uint32)
+ return pgio.AppendUint32(buf, v), nil
+}
+
+type encodePlanUint32CodecBinaryUint32Valuer struct{}
+
+func (encodePlanUint32CodecBinaryUint32Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ v, err := value.(Uint32Valuer).Uint32Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !v.Valid {
+ return nil, nil
+ }
+
+ return pgio.AppendUint32(buf, v.Uint32), nil
+}
+
+type encodePlanUint32CodecBinaryInt64Valuer struct{}
+
+func (encodePlanUint32CodecBinaryInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ v, err := value.(Int64Valuer).Int64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !v.Valid {
+ return nil, nil
+ }
+
+ if v.Int64 < 0 {
+ return nil, fmt.Errorf("%d is less than minimum value for uint32", v.Int64)
+ }
+ if v.Int64 > math.MaxUint32 {
+ return nil, fmt.Errorf("%d is greater than maximum value for uint32", v.Int64)
+ }
+
+ return pgio.AppendUint32(buf, uint32(v.Int64)), nil
+}
+
+type encodePlanUint32CodecTextUint32 struct{}
+
+func (encodePlanUint32CodecTextUint32) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ v := value.(uint32)
+ return append(buf, strconv.FormatUint(uint64(v), 10)...), nil
+}
+
+type encodePlanUint32CodecTextUint32Valuer struct{}
+
+func (encodePlanUint32CodecTextUint32Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ v, err := value.(Uint32Valuer).Uint32Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !v.Valid {
+ return nil, nil
+ }
+
+ return append(buf, strconv.FormatUint(uint64(v.Uint32), 10)...), nil
+}
+
+type encodePlanUint32CodecTextInt64Valuer struct{}
+
+func (encodePlanUint32CodecTextInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ v, err := value.(Int64Valuer).Int64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !v.Valid {
+ return nil, nil
+ }
+
+ if v.Int64 < 0 {
+ return nil, fmt.Errorf("%d is less than minimum value for uint32", v.Int64)
+ }
+ if v.Int64 > math.MaxUint32 {
+ return nil, fmt.Errorf("%d is greater than maximum value for uint32", v.Int64)
+ }
+
+ return append(buf, strconv.FormatInt(v.Int64, 10)...), nil
+}
+
+func (Uint32Codec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case *uint32:
+ return scanPlanBinaryUint32ToUint32{}
+ case Uint32Scanner:
+ return scanPlanBinaryUint32ToUint32Scanner{}
+ case TextScanner:
+ return scanPlanBinaryUint32ToTextScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case *uint32:
+ return scanPlanTextAnyToUint32{}
+ case Uint32Scanner:
+ return scanPlanTextAnyToUint32Scanner{}
+ }
+ }
+
+ return nil
+}
+
+func (c Uint32Codec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var n uint32
+ err := codecScan(c, m, oid, format, src, &n)
+ if err != nil {
+ return nil, err
+ }
+ return int64(n), nil
+}
+
+func (c Uint32Codec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var n uint32
+ err := codecScan(c, m, oid, format, src, &n)
+ if err != nil {
+ return nil, err
+ }
+ return n, nil
+}
+
+type scanPlanBinaryUint32ToUint32 struct{}
+
+func (scanPlanBinaryUint32ToUint32) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 4 {
+ return fmt.Errorf("invalid length for uint32: %v", len(src))
+ }
+
+ p := (dst).(*uint32)
+ *p = binary.BigEndian.Uint32(src)
+
+ return nil
+}
+
+type scanPlanBinaryUint32ToUint32Scanner struct{}
+
+func (scanPlanBinaryUint32ToUint32Scanner) Scan(src []byte, dst any) error {
+ s, ok := (dst).(Uint32Scanner)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ if src == nil {
+ return s.ScanUint32(Uint32{})
+ }
+
+ if len(src) != 4 {
+ return fmt.Errorf("invalid length for uint32: %v", len(src))
+ }
+
+ n := binary.BigEndian.Uint32(src)
+
+ return s.ScanUint32(Uint32{Uint32: n, Valid: true})
+}
+
+type scanPlanBinaryUint32ToTextScanner struct{}
+
+func (scanPlanBinaryUint32ToTextScanner) Scan(src []byte, dst any) error {
+ s, ok := (dst).(TextScanner)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ if src == nil {
+ return s.ScanText(Text{})
+ }
+
+ if len(src) != 4 {
+ return fmt.Errorf("invalid length for uint32: %v", len(src))
+ }
+
+ n := uint64(binary.BigEndian.Uint32(src))
+ return s.ScanText(Text{String: strconv.FormatUint(n, 10), Valid: true})
+}
+
+type scanPlanTextAnyToUint32Scanner struct{}
+
+func (scanPlanTextAnyToUint32Scanner) Scan(src []byte, dst any) error {
+ s, ok := (dst).(Uint32Scanner)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ if src == nil {
+ return s.ScanUint32(Uint32{})
+ }
+
+ n, err := strconv.ParseUint(string(src), 10, 32)
+ if err != nil {
+ return err
+ }
+
+ return s.ScanUint32(Uint32{Uint32: uint32(n), Valid: true})
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/uint64.go b/vendor/github.com/jackc/pgx/v5/pgtype/uint64.go
new file mode 100644
index 0000000..dd2130e
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/uint64.go
@@ -0,0 +1,322 @@
+package pgtype
+
+import (
+ "database/sql/driver"
+ "encoding/binary"
+ "fmt"
+ "math"
+ "strconv"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+)
+
+type Uint64Scanner interface {
+ ScanUint64(v Uint64) error
+}
+
+type Uint64Valuer interface {
+ Uint64Value() (Uint64, error)
+}
+
+// Uint64 is the core type that is used to represent PostgreSQL types such as XID8.
+type Uint64 struct {
+ Uint64 uint64
+ Valid bool
+}
+
+func (n *Uint64) ScanUint64(v Uint64) error {
+ *n = v
+ return nil
+}
+
+func (n Uint64) Uint64Value() (Uint64, error) {
+ return n, nil
+}
+
+// Scan implements the database/sql Scanner interface.
+func (dst *Uint64) Scan(src any) error {
+ if src == nil {
+ *dst = Uint64{}
+ return nil
+ }
+
+ var n uint64
+
+ switch src := src.(type) {
+ case int64:
+ if src < 0 {
+ return fmt.Errorf("%d is less than the minimum value for Uint64", src)
+ }
+ n = uint64(src)
+ case string:
+ un, err := strconv.ParseUint(src, 10, 64)
+ if err != nil {
+ return err
+ }
+ n = un
+ default:
+ return fmt.Errorf("cannot scan %T", src)
+ }
+
+ *dst = Uint64{Uint64: n, Valid: true}
+
+ return nil
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (src Uint64) Value() (driver.Value, error) {
+ if !src.Valid {
+ return nil, nil
+ }
+
+ // If the value is greater than the maximum value for int64, return it as a string instead of losing data or returning
+ // an error.
+ if src.Uint64 > math.MaxInt64 {
+ return strconv.FormatUint(src.Uint64, 10), nil
+ }
+
+ return int64(src.Uint64), nil
+}
+
+type Uint64Codec struct{}
+
+func (Uint64Codec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (Uint64Codec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (Uint64Codec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ switch format {
+ case BinaryFormatCode:
+ switch value.(type) {
+ case uint64:
+ return encodePlanUint64CodecBinaryUint64{}
+ case Uint64Valuer:
+ return encodePlanUint64CodecBinaryUint64Valuer{}
+ case Int64Valuer:
+ return encodePlanUint64CodecBinaryInt64Valuer{}
+ }
+ case TextFormatCode:
+ switch value.(type) {
+ case uint64:
+ return encodePlanUint64CodecTextUint64{}
+ case Int64Valuer:
+ return encodePlanUint64CodecTextInt64Valuer{}
+ }
+ }
+
+ return nil
+}
+
+type encodePlanUint64CodecBinaryUint64 struct{}
+
+func (encodePlanUint64CodecBinaryUint64) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ v := value.(uint64)
+ return pgio.AppendUint64(buf, v), nil
+}
+
+type encodePlanUint64CodecBinaryUint64Valuer struct{}
+
+func (encodePlanUint64CodecBinaryUint64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ v, err := value.(Uint64Valuer).Uint64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !v.Valid {
+ return nil, nil
+ }
+
+ return pgio.AppendUint64(buf, v.Uint64), nil
+}
+
+type encodePlanUint64CodecBinaryInt64Valuer struct{}
+
+func (encodePlanUint64CodecBinaryInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ v, err := value.(Int64Valuer).Int64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !v.Valid {
+ return nil, nil
+ }
+
+ if v.Int64 < 0 {
+ return nil, fmt.Errorf("%d is less than minimum value for uint64", v.Int64)
+ }
+
+ return pgio.AppendUint64(buf, uint64(v.Int64)), nil
+}
+
+type encodePlanUint64CodecTextUint64 struct{}
+
+func (encodePlanUint64CodecTextUint64) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ v := value.(uint64)
+ return append(buf, strconv.FormatUint(uint64(v), 10)...), nil
+}
+
+type encodePlanUint64CodecTextUint64Valuer struct{}
+
+func (encodePlanUint64CodecTextUint64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ v, err := value.(Uint64Valuer).Uint64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !v.Valid {
+ return nil, nil
+ }
+
+ return append(buf, strconv.FormatUint(v.Uint64, 10)...), nil
+}
+
+type encodePlanUint64CodecTextInt64Valuer struct{}
+
+func (encodePlanUint64CodecTextInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ v, err := value.(Int64Valuer).Int64Value()
+ if err != nil {
+ return nil, err
+ }
+
+ if !v.Valid {
+ return nil, nil
+ }
+
+ if v.Int64 < 0 {
+ return nil, fmt.Errorf("%d is less than minimum value for uint64", v.Int64)
+ }
+
+ return append(buf, strconv.FormatInt(v.Int64, 10)...), nil
+}
+
+func (Uint64Codec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case *uint64:
+ return scanPlanBinaryUint64ToUint64{}
+ case Uint64Scanner:
+ return scanPlanBinaryUint64ToUint64Scanner{}
+ case TextScanner:
+ return scanPlanBinaryUint64ToTextScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case *uint64:
+ return scanPlanTextAnyToUint64{}
+ case Uint64Scanner:
+ return scanPlanTextAnyToUint64Scanner{}
+ }
+ }
+
+ return nil
+}
+
+func (c Uint64Codec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var n uint64
+ err := codecScan(c, m, oid, format, src, &n)
+ if err != nil {
+ return nil, err
+ }
+ return int64(n), nil
+}
+
+func (c Uint64Codec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var n uint64
+ err := codecScan(c, m, oid, format, src, &n)
+ if err != nil {
+ return nil, err
+ }
+ return n, nil
+}
+
+type scanPlanBinaryUint64ToUint64 struct{}
+
+func (scanPlanBinaryUint64ToUint64) Scan(src []byte, dst any) error {
+ if src == nil {
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for uint64: %v", len(src))
+ }
+
+ p := (dst).(*uint64)
+ *p = binary.BigEndian.Uint64(src)
+
+ return nil
+}
+
+type scanPlanBinaryUint64ToUint64Scanner struct{}
+
+func (scanPlanBinaryUint64ToUint64Scanner) Scan(src []byte, dst any) error {
+ s, ok := (dst).(Uint64Scanner)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ if src == nil {
+ return s.ScanUint64(Uint64{})
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for uint64: %v", len(src))
+ }
+
+ n := binary.BigEndian.Uint64(src)
+
+ return s.ScanUint64(Uint64{Uint64: n, Valid: true})
+}
+
+type scanPlanBinaryUint64ToTextScanner struct{}
+
+func (scanPlanBinaryUint64ToTextScanner) Scan(src []byte, dst any) error {
+ s, ok := (dst).(TextScanner)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ if src == nil {
+ return s.ScanText(Text{})
+ }
+
+ if len(src) != 8 {
+ return fmt.Errorf("invalid length for uint64: %v", len(src))
+ }
+
+ n := uint64(binary.BigEndian.Uint64(src))
+ return s.ScanText(Text{String: strconv.FormatUint(n, 10), Valid: true})
+}
+
+type scanPlanTextAnyToUint64Scanner struct{}
+
+func (scanPlanTextAnyToUint64Scanner) Scan(src []byte, dst any) error {
+ s, ok := (dst).(Uint64Scanner)
+ if !ok {
+ return ErrScanTargetTypeChanged
+ }
+
+ if src == nil {
+ return s.ScanUint64(Uint64{})
+ }
+
+ n, err := strconv.ParseUint(string(src), 10, 64)
+ if err != nil {
+ return err
+ }
+
+ return s.ScanUint64(Uint64{Uint64: n, Valid: true})
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/uuid.go b/vendor/github.com/jackc/pgx/v5/pgtype/uuid.go
new file mode 100644
index 0000000..0628f19
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/uuid.go
@@ -0,0 +1,289 @@
+package pgtype
+
+import (
+ "bytes"
+ "database/sql/driver"
+ "encoding/hex"
+ "fmt"
+)
+
+type UUIDScanner interface {
+ ScanUUID(v UUID) error
+}
+
+type UUIDValuer interface {
+ UUIDValue() (UUID, error)
+}
+
+type UUID struct {
+ Bytes [16]byte
+ Valid bool
+}
+
+func (b *UUID) ScanUUID(v UUID) error {
+ *b = v
+ return nil
+}
+
+func (b UUID) UUIDValue() (UUID, error) {
+ return b, nil
+}
+
+// parseUUID converts a string UUID in standard form to a byte array.
+func parseUUID(src string) (dst [16]byte, err error) {
+ switch len(src) {
+ case 36:
+ src = src[0:8] + src[9:13] + src[14:18] + src[19:23] + src[24:]
+ case 32:
+ // dashes already stripped, assume valid
+ default:
+ // assume invalid.
+ return dst, fmt.Errorf("cannot parse UUID %v", src)
+ }
+
+ buf, err := hex.DecodeString(src)
+ if err != nil {
+ return dst, err
+ }
+
+ copy(dst[:], buf)
+ return dst, err
+}
+
+// encodeUUID converts a uuid byte array to UUID standard string form.
+func encodeUUID(src [16]byte) string {
+ var buf [36]byte
+
+ hex.Encode(buf[0:8], src[:4])
+ buf[8] = '-'
+ hex.Encode(buf[9:13], src[4:6])
+ buf[13] = '-'
+ hex.Encode(buf[14:18], src[6:8])
+ buf[18] = '-'
+ hex.Encode(buf[19:23], src[8:10])
+ buf[23] = '-'
+ hex.Encode(buf[24:], src[10:])
+
+ return string(buf[:])
+}
+
+// Scan implements the database/sql Scanner interface.
+func (dst *UUID) Scan(src any) error {
+ if src == nil {
+ *dst = UUID{}
+ return nil
+ }
+
+ switch src := src.(type) {
+ case string:
+ buf, err := parseUUID(src)
+ if err != nil {
+ return err
+ }
+ *dst = UUID{Bytes: buf, Valid: true}
+ return nil
+ }
+
+ return fmt.Errorf("cannot scan %T", src)
+}
+
+// Value implements the database/sql/driver Valuer interface.
+func (src UUID) Value() (driver.Value, error) {
+ if !src.Valid {
+ return nil, nil
+ }
+
+ return encodeUUID(src.Bytes), nil
+}
+
+func (src UUID) String() string {
+ if !src.Valid {
+ return ""
+ }
+
+ return encodeUUID(src.Bytes)
+}
+
+func (src UUID) MarshalJSON() ([]byte, error) {
+ if !src.Valid {
+ return []byte("null"), nil
+ }
+
+ var buff bytes.Buffer
+ buff.WriteByte('"')
+ buff.WriteString(encodeUUID(src.Bytes))
+ buff.WriteByte('"')
+ return buff.Bytes(), nil
+}
+
+func (dst *UUID) UnmarshalJSON(src []byte) error {
+ if bytes.Equal(src, []byte("null")) {
+ *dst = UUID{}
+ return nil
+ }
+ if len(src) != 38 {
+ return fmt.Errorf("invalid length for UUID: %v", len(src))
+ }
+ buf, err := parseUUID(string(src[1 : len(src)-1]))
+ if err != nil {
+ return err
+ }
+ *dst = UUID{Bytes: buf, Valid: true}
+ return nil
+}
+
+type UUIDCodec struct{}
+
+func (UUIDCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (UUIDCodec) PreferredFormat() int16 {
+ return BinaryFormatCode
+}
+
+func (UUIDCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ if _, ok := value.(UUIDValuer); !ok {
+ return nil
+ }
+
+ switch format {
+ case BinaryFormatCode:
+ return encodePlanUUIDCodecBinaryUUIDValuer{}
+ case TextFormatCode:
+ return encodePlanUUIDCodecTextUUIDValuer{}
+ }
+
+ return nil
+}
+
+type encodePlanUUIDCodecBinaryUUIDValuer struct{}
+
+func (encodePlanUUIDCodecBinaryUUIDValuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ uuid, err := value.(UUIDValuer).UUIDValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !uuid.Valid {
+ return nil, nil
+ }
+
+ return append(buf, uuid.Bytes[:]...), nil
+}
+
+type encodePlanUUIDCodecTextUUIDValuer struct{}
+
+func (encodePlanUUIDCodecTextUUIDValuer) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ uuid, err := value.(UUIDValuer).UUIDValue()
+ if err != nil {
+ return nil, err
+ }
+
+ if !uuid.Valid {
+ return nil, nil
+ }
+
+ return append(buf, encodeUUID(uuid.Bytes)...), nil
+}
+
+func (UUIDCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+ switch format {
+ case BinaryFormatCode:
+ switch target.(type) {
+ case UUIDScanner:
+ return scanPlanBinaryUUIDToUUIDScanner{}
+ case TextScanner:
+ return scanPlanBinaryUUIDToTextScanner{}
+ }
+ case TextFormatCode:
+ switch target.(type) {
+ case UUIDScanner:
+ return scanPlanTextAnyToUUIDScanner{}
+ }
+ }
+
+ return nil
+}
+
+type scanPlanBinaryUUIDToUUIDScanner struct{}
+
+func (scanPlanBinaryUUIDToUUIDScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(UUIDScanner)
+
+ if src == nil {
+ return scanner.ScanUUID(UUID{})
+ }
+
+ if len(src) != 16 {
+ return fmt.Errorf("invalid length for UUID: %v", len(src))
+ }
+
+ uuid := UUID{Valid: true}
+ copy(uuid.Bytes[:], src)
+
+ return scanner.ScanUUID(uuid)
+}
+
+type scanPlanBinaryUUIDToTextScanner struct{}
+
+func (scanPlanBinaryUUIDToTextScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(TextScanner)
+
+ if src == nil {
+ return scanner.ScanText(Text{})
+ }
+
+ if len(src) != 16 {
+ return fmt.Errorf("invalid length for UUID: %v", len(src))
+ }
+
+ var buf [16]byte
+ copy(buf[:], src)
+
+ return scanner.ScanText(Text{String: encodeUUID(buf), Valid: true})
+}
+
+type scanPlanTextAnyToUUIDScanner struct{}
+
+func (scanPlanTextAnyToUUIDScanner) Scan(src []byte, dst any) error {
+ scanner := (dst).(UUIDScanner)
+
+ if src == nil {
+ return scanner.ScanUUID(UUID{})
+ }
+
+ buf, err := parseUUID(string(src))
+ if err != nil {
+ return err
+ }
+
+ return scanner.ScanUUID(UUID{Bytes: buf, Valid: true})
+}
+
+func (c UUIDCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var uuid UUID
+ err := codecScan(c, m, oid, format, src, &uuid)
+ if err != nil {
+ return nil, err
+ }
+
+ return encodeUUID(uuid.Bytes), nil
+}
+
+func (c UUIDCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var uuid UUID
+ err := codecScan(c, m, oid, format, src, &uuid)
+ if err != nil {
+ return nil, err
+ }
+ return uuid.Bytes, nil
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgtype/xml.go b/vendor/github.com/jackc/pgx/v5/pgtype/xml.go
new file mode 100644
index 0000000..79e3698
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgtype/xml.go
@@ -0,0 +1,198 @@
+package pgtype
+
+import (
+ "database/sql"
+ "database/sql/driver"
+ "encoding/xml"
+ "fmt"
+ "reflect"
+)
+
+type XMLCodec struct {
+ Marshal func(v any) ([]byte, error)
+ Unmarshal func(data []byte, v any) error
+}
+
+func (*XMLCodec) FormatSupported(format int16) bool {
+ return format == TextFormatCode || format == BinaryFormatCode
+}
+
+func (*XMLCodec) PreferredFormat() int16 {
+ return TextFormatCode
+}
+
+func (c *XMLCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan {
+ switch value.(type) {
+ case string:
+ return encodePlanXMLCodecEitherFormatString{}
+ case []byte:
+ return encodePlanXMLCodecEitherFormatByteSlice{}
+
+ // Cannot rely on driver.Valuer being handled later because anything can be marshalled.
+ //
+ // https://github.com/jackc/pgx/issues/1430
+ //
+ // Check for driver.Valuer must come before xml.Marshaler so that it is guaranteed to be used
+ // when both are implemented https://github.com/jackc/pgx/issues/1805
+ case driver.Valuer:
+ return &encodePlanDriverValuer{m: m, oid: oid, formatCode: format}
+
+ // Must come before trying wrap encode plans because a pointer to a struct may be unwrapped to a struct that can be
+ // marshalled.
+ //
+ // https://github.com/jackc/pgx/issues/1681
+ case xml.Marshaler:
+ return &encodePlanXMLCodecEitherFormatMarshal{
+ marshal: c.Marshal,
+ }
+ }
+
+ // Because anything can be marshalled the normal wrapping in Map.PlanScan doesn't get a chance to run. So try the
+ // appropriate wrappers here.
+ for _, f := range []TryWrapEncodePlanFunc{
+ TryWrapDerefPointerEncodePlan,
+ TryWrapFindUnderlyingTypeEncodePlan,
+ } {
+ if wrapperPlan, nextValue, ok := f(value); ok {
+ if nextPlan := c.PlanEncode(m, oid, format, nextValue); nextPlan != nil {
+ wrapperPlan.SetNext(nextPlan)
+ return wrapperPlan
+ }
+ }
+ }
+
+ return &encodePlanXMLCodecEitherFormatMarshal{
+ marshal: c.Marshal,
+ }
+}
+
+type encodePlanXMLCodecEitherFormatString struct{}
+
+func (encodePlanXMLCodecEitherFormatString) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ xmlString := value.(string)
+ buf = append(buf, xmlString...)
+ return buf, nil
+}
+
+type encodePlanXMLCodecEitherFormatByteSlice struct{}
+
+func (encodePlanXMLCodecEitherFormatByteSlice) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ xmlBytes := value.([]byte)
+ if xmlBytes == nil {
+ return nil, nil
+ }
+
+ buf = append(buf, xmlBytes...)
+ return buf, nil
+}
+
+type encodePlanXMLCodecEitherFormatMarshal struct {
+ marshal func(v any) ([]byte, error)
+}
+
+func (e *encodePlanXMLCodecEitherFormatMarshal) Encode(value any, buf []byte) (newBuf []byte, err error) {
+ xmlBytes, err := e.marshal(value)
+ if err != nil {
+ return nil, err
+ }
+
+ buf = append(buf, xmlBytes...)
+ return buf, nil
+}
+
+func (c *XMLCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan {
+ switch target.(type) {
+ case *string:
+ return scanPlanAnyToString{}
+
+ case **string:
+ // This is to fix **string scanning. It seems wrong to special case **string, but it's not clear what a better
+ // solution would be.
+ //
+ // https://github.com/jackc/pgx/issues/1470 -- **string
+ // https://github.com/jackc/pgx/issues/1691 -- ** anything else
+
+ if wrapperPlan, nextDst, ok := TryPointerPointerScanPlan(target); ok {
+ if nextPlan := m.planScan(oid, format, nextDst, 0); nextPlan != nil {
+ if _, failed := nextPlan.(*scanPlanFail); !failed {
+ wrapperPlan.SetNext(nextPlan)
+ return wrapperPlan
+ }
+ }
+ }
+
+ case *[]byte:
+ return scanPlanXMLToByteSlice{}
+ case BytesScanner:
+ return scanPlanBinaryBytesToBytesScanner{}
+
+ // Cannot rely on sql.Scanner being handled later because scanPlanXMLToXMLUnmarshal will take precedence.
+ //
+ // https://github.com/jackc/pgx/issues/1418
+ case sql.Scanner:
+ return &scanPlanSQLScanner{formatCode: format}
+ }
+
+ return &scanPlanXMLToXMLUnmarshal{
+ unmarshal: c.Unmarshal,
+ }
+}
+
+type scanPlanXMLToByteSlice struct{}
+
+func (scanPlanXMLToByteSlice) Scan(src []byte, dst any) error {
+ dstBuf := dst.(*[]byte)
+ if src == nil {
+ *dstBuf = nil
+ return nil
+ }
+
+ *dstBuf = make([]byte, len(src))
+ copy(*dstBuf, src)
+ return nil
+}
+
+type scanPlanXMLToXMLUnmarshal struct {
+ unmarshal func(data []byte, v any) error
+}
+
+func (s *scanPlanXMLToXMLUnmarshal) Scan(src []byte, dst any) error {
+ if src == nil {
+ dstValue := reflect.ValueOf(dst)
+ if dstValue.Kind() == reflect.Ptr {
+ el := dstValue.Elem()
+ switch el.Kind() {
+ case reflect.Ptr, reflect.Slice, reflect.Map, reflect.Interface, reflect.Struct:
+ el.Set(reflect.Zero(el.Type()))
+ return nil
+ }
+ }
+
+ return fmt.Errorf("cannot scan NULL into %T", dst)
+ }
+
+ elem := reflect.ValueOf(dst).Elem()
+ elem.Set(reflect.Zero(elem.Type()))
+
+ return s.unmarshal(src, dst)
+}
+
+func (c *XMLCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ dstBuf := make([]byte, len(src))
+ copy(dstBuf, src)
+ return dstBuf, nil
+}
+
+func (c *XMLCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) {
+ if src == nil {
+ return nil, nil
+ }
+
+ var dst any
+ err := c.Unmarshal(src, &dst)
+ return dst, err
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgxpool/batch_results.go b/vendor/github.com/jackc/pgx/v5/pgxpool/batch_results.go
new file mode 100644
index 0000000..5d5c681
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgxpool/batch_results.go
@@ -0,0 +1,52 @@
+package pgxpool
+
+import (
+ "github.com/jackc/pgx/v5"
+ "github.com/jackc/pgx/v5/pgconn"
+)
+
+type errBatchResults struct {
+ err error
+}
+
+func (br errBatchResults) Exec() (pgconn.CommandTag, error) {
+ return pgconn.CommandTag{}, br.err
+}
+
+func (br errBatchResults) Query() (pgx.Rows, error) {
+ return errRows{err: br.err}, br.err
+}
+
+func (br errBatchResults) QueryRow() pgx.Row {
+ return errRow{err: br.err}
+}
+
+func (br errBatchResults) Close() error {
+ return br.err
+}
+
+type poolBatchResults struct {
+ br pgx.BatchResults
+ c *Conn
+}
+
+func (br *poolBatchResults) Exec() (pgconn.CommandTag, error) {
+ return br.br.Exec()
+}
+
+func (br *poolBatchResults) Query() (pgx.Rows, error) {
+ return br.br.Query()
+}
+
+func (br *poolBatchResults) QueryRow() pgx.Row {
+ return br.br.QueryRow()
+}
+
+func (br *poolBatchResults) Close() error {
+ err := br.br.Close()
+ if br.c != nil {
+ br.c.Release()
+ br.c = nil
+ }
+ return err
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgxpool/conn.go b/vendor/github.com/jackc/pgx/v5/pgxpool/conn.go
new file mode 100644
index 0000000..38c90f3
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgxpool/conn.go
@@ -0,0 +1,134 @@
+package pgxpool
+
+import (
+ "context"
+ "sync/atomic"
+
+ "github.com/jackc/pgx/v5"
+ "github.com/jackc/pgx/v5/pgconn"
+ "github.com/jackc/puddle/v2"
+)
+
+// Conn is an acquired *pgx.Conn from a Pool.
+type Conn struct {
+ res *puddle.Resource[*connResource]
+ p *Pool
+}
+
+// Release returns c to the pool it was acquired from. Once Release has been called, other methods must not be called.
+// However, it is safe to call Release multiple times. Subsequent calls after the first will be ignored.
+func (c *Conn) Release() {
+ if c.res == nil {
+ return
+ }
+
+ conn := c.Conn()
+ res := c.res
+ c.res = nil
+
+ if c.p.releaseTracer != nil {
+ c.p.releaseTracer.TraceRelease(c.p, TraceReleaseData{Conn: conn})
+ }
+
+ if conn.IsClosed() || conn.PgConn().IsBusy() || conn.PgConn().TxStatus() != 'I' {
+ res.Destroy()
+ // Signal to the health check to run since we just destroyed a connections
+ // and we might be below minConns now
+ c.p.triggerHealthCheck()
+ return
+ }
+
+ // If the pool is consistently being used, we might never get to check the
+ // lifetime of a connection since we only check idle connections in checkConnsHealth
+ // so we also check the lifetime here and force a health check
+ if c.p.isExpired(res) {
+ atomic.AddInt64(&c.p.lifetimeDestroyCount, 1)
+ res.Destroy()
+ // Signal to the health check to run since we just destroyed a connections
+ // and we might be below minConns now
+ c.p.triggerHealthCheck()
+ return
+ }
+
+ if c.p.afterRelease == nil {
+ res.Release()
+ return
+ }
+
+ go func() {
+ if c.p.afterRelease(conn) {
+ res.Release()
+ } else {
+ res.Destroy()
+ // Signal to the health check to run since we just destroyed a connections
+ // and we might be below minConns now
+ c.p.triggerHealthCheck()
+ }
+ }()
+}
+
+// Hijack assumes ownership of the connection from the pool. Caller is responsible for closing the connection. Hijack
+// will panic if called on an already released or hijacked connection.
+func (c *Conn) Hijack() *pgx.Conn {
+ if c.res == nil {
+ panic("cannot hijack already released or hijacked connection")
+ }
+
+ conn := c.Conn()
+ res := c.res
+ c.res = nil
+
+ res.Hijack()
+
+ return conn
+}
+
+func (c *Conn) Exec(ctx context.Context, sql string, arguments ...any) (pgconn.CommandTag, error) {
+ return c.Conn().Exec(ctx, sql, arguments...)
+}
+
+func (c *Conn) Query(ctx context.Context, sql string, args ...any) (pgx.Rows, error) {
+ return c.Conn().Query(ctx, sql, args...)
+}
+
+func (c *Conn) QueryRow(ctx context.Context, sql string, args ...any) pgx.Row {
+ return c.Conn().QueryRow(ctx, sql, args...)
+}
+
+func (c *Conn) SendBatch(ctx context.Context, b *pgx.Batch) pgx.BatchResults {
+ return c.Conn().SendBatch(ctx, b)
+}
+
+func (c *Conn) CopyFrom(ctx context.Context, tableName pgx.Identifier, columnNames []string, rowSrc pgx.CopyFromSource) (int64, error) {
+ return c.Conn().CopyFrom(ctx, tableName, columnNames, rowSrc)
+}
+
+// Begin starts a transaction block from the *Conn without explicitly setting a transaction mode (see BeginTx with TxOptions if transaction mode is required).
+func (c *Conn) Begin(ctx context.Context) (pgx.Tx, error) {
+ return c.Conn().Begin(ctx)
+}
+
+// BeginTx starts a transaction block from the *Conn with txOptions determining the transaction mode.
+func (c *Conn) BeginTx(ctx context.Context, txOptions pgx.TxOptions) (pgx.Tx, error) {
+ return c.Conn().BeginTx(ctx, txOptions)
+}
+
+func (c *Conn) Ping(ctx context.Context) error {
+ return c.Conn().Ping(ctx)
+}
+
+func (c *Conn) Conn() *pgx.Conn {
+ return c.connResource().conn
+}
+
+func (c *Conn) connResource() *connResource {
+ return c.res.Value()
+}
+
+func (c *Conn) getPoolRow(r pgx.Row) *poolRow {
+ return c.connResource().getPoolRow(c, r)
+}
+
+func (c *Conn) getPoolRows(r pgx.Rows) *poolRows {
+ return c.connResource().getPoolRows(c, r)
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgxpool/doc.go b/vendor/github.com/jackc/pgx/v5/pgxpool/doc.go
new file mode 100644
index 0000000..099443b
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgxpool/doc.go
@@ -0,0 +1,27 @@
+// Package pgxpool is a concurrency-safe connection pool for pgx.
+/*
+pgxpool implements a nearly identical interface to pgx connections.
+
+Creating a Pool
+
+The primary way of creating a pool is with [pgxpool.New]:
+
+ pool, err := pgxpool.New(context.Background(), os.Getenv("DATABASE_URL"))
+
+The database connection string can be in URL or keyword/value format. PostgreSQL settings, pgx settings, and pool settings can be
+specified here. In addition, a config struct can be created by [ParseConfig].
+
+ config, err := pgxpool.ParseConfig(os.Getenv("DATABASE_URL"))
+ if err != nil {
+ // ...
+ }
+ config.AfterConnect = func(ctx context.Context, conn *pgx.Conn) error {
+ // do something with every new connection
+ }
+
+ pool, err := pgxpool.NewWithConfig(context.Background(), config)
+
+A pool returns without waiting for any connections to be established. Acquire a connection immediately after creating
+the pool to check if a connection can successfully be established.
+*/
+package pgxpool
diff --git a/vendor/github.com/jackc/pgx/v5/pgxpool/pool.go b/vendor/github.com/jackc/pgx/v5/pgxpool/pool.go
new file mode 100644
index 0000000..270b761
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgxpool/pool.go
@@ -0,0 +1,717 @@
+package pgxpool
+
+import (
+ "context"
+ "fmt"
+ "math/rand"
+ "runtime"
+ "strconv"
+ "sync"
+ "sync/atomic"
+ "time"
+
+ "github.com/jackc/pgx/v5"
+ "github.com/jackc/pgx/v5/pgconn"
+ "github.com/jackc/puddle/v2"
+)
+
+var defaultMaxConns = int32(4)
+var defaultMinConns = int32(0)
+var defaultMaxConnLifetime = time.Hour
+var defaultMaxConnIdleTime = time.Minute * 30
+var defaultHealthCheckPeriod = time.Minute
+
+type connResource struct {
+ conn *pgx.Conn
+ conns []Conn
+ poolRows []poolRow
+ poolRowss []poolRows
+ maxAgeTime time.Time
+}
+
+func (cr *connResource) getConn(p *Pool, res *puddle.Resource[*connResource]) *Conn {
+ if len(cr.conns) == 0 {
+ cr.conns = make([]Conn, 128)
+ }
+
+ c := &cr.conns[len(cr.conns)-1]
+ cr.conns = cr.conns[0 : len(cr.conns)-1]
+
+ c.res = res
+ c.p = p
+
+ return c
+}
+
+func (cr *connResource) getPoolRow(c *Conn, r pgx.Row) *poolRow {
+ if len(cr.poolRows) == 0 {
+ cr.poolRows = make([]poolRow, 128)
+ }
+
+ pr := &cr.poolRows[len(cr.poolRows)-1]
+ cr.poolRows = cr.poolRows[0 : len(cr.poolRows)-1]
+
+ pr.c = c
+ pr.r = r
+
+ return pr
+}
+
+func (cr *connResource) getPoolRows(c *Conn, r pgx.Rows) *poolRows {
+ if len(cr.poolRowss) == 0 {
+ cr.poolRowss = make([]poolRows, 128)
+ }
+
+ pr := &cr.poolRowss[len(cr.poolRowss)-1]
+ cr.poolRowss = cr.poolRowss[0 : len(cr.poolRowss)-1]
+
+ pr.c = c
+ pr.r = r
+
+ return pr
+}
+
+// Pool allows for connection reuse.
+type Pool struct {
+ // 64 bit fields accessed with atomics must be at beginning of struct to guarantee alignment for certain 32-bit
+ // architectures. See BUGS section of https://pkg.go.dev/sync/atomic and https://github.com/jackc/pgx/issues/1288.
+ newConnsCount int64
+ lifetimeDestroyCount int64
+ idleDestroyCount int64
+
+ p *puddle.Pool[*connResource]
+ config *Config
+ beforeConnect func(context.Context, *pgx.ConnConfig) error
+ afterConnect func(context.Context, *pgx.Conn) error
+ beforeAcquire func(context.Context, *pgx.Conn) bool
+ afterRelease func(*pgx.Conn) bool
+ beforeClose func(*pgx.Conn)
+ minConns int32
+ maxConns int32
+ maxConnLifetime time.Duration
+ maxConnLifetimeJitter time.Duration
+ maxConnIdleTime time.Duration
+ healthCheckPeriod time.Duration
+
+ healthCheckChan chan struct{}
+
+ acquireTracer AcquireTracer
+ releaseTracer ReleaseTracer
+
+ closeOnce sync.Once
+ closeChan chan struct{}
+}
+
+// Config is the configuration struct for creating a pool. It must be created by [ParseConfig] and then it can be
+// modified.
+type Config struct {
+ ConnConfig *pgx.ConnConfig
+
+ // BeforeConnect is called before a new connection is made. It is passed a copy of the underlying pgx.ConnConfig and
+ // will not impact any existing open connections.
+ BeforeConnect func(context.Context, *pgx.ConnConfig) error
+
+ // AfterConnect is called after a connection is established, but before it is added to the pool.
+ AfterConnect func(context.Context, *pgx.Conn) error
+
+ // BeforeAcquire is called before a connection is acquired from the pool. It must return true to allow the
+ // acquisition or false to indicate that the connection should be destroyed and a different connection should be
+ // acquired.
+ BeforeAcquire func(context.Context, *pgx.Conn) bool
+
+ // AfterRelease is called after a connection is released, but before it is returned to the pool. It must return true to
+ // return the connection to the pool or false to destroy the connection.
+ AfterRelease func(*pgx.Conn) bool
+
+ // BeforeClose is called right before a connection is closed and removed from the pool.
+ BeforeClose func(*pgx.Conn)
+
+ // MaxConnLifetime is the duration since creation after which a connection will be automatically closed.
+ MaxConnLifetime time.Duration
+
+ // MaxConnLifetimeJitter is the duration after MaxConnLifetime to randomly decide to close a connection.
+ // This helps prevent all connections from being closed at the exact same time, starving the pool.
+ MaxConnLifetimeJitter time.Duration
+
+ // MaxConnIdleTime is the duration after which an idle connection will be automatically closed by the health check.
+ MaxConnIdleTime time.Duration
+
+ // MaxConns is the maximum size of the pool. The default is the greater of 4 or runtime.NumCPU().
+ MaxConns int32
+
+ // MinConns is the minimum size of the pool. After connection closes, the pool might dip below MinConns. A low
+ // number of MinConns might mean the pool is empty after MaxConnLifetime until the health check has a chance
+ // to create new connections.
+ MinConns int32
+
+ // HealthCheckPeriod is the duration between checks of the health of idle connections.
+ HealthCheckPeriod time.Duration
+
+ createdByParseConfig bool // Used to enforce created by ParseConfig rule.
+}
+
+// Copy returns a deep copy of the config that is safe to use and modify.
+// The only exception is the tls.Config:
+// according to the tls.Config docs it must not be modified after creation.
+func (c *Config) Copy() *Config {
+ newConfig := new(Config)
+ *newConfig = *c
+ newConfig.ConnConfig = c.ConnConfig.Copy()
+ return newConfig
+}
+
+// ConnString returns the connection string as parsed by pgxpool.ParseConfig into pgxpool.Config.
+func (c *Config) ConnString() string { return c.ConnConfig.ConnString() }
+
+// New creates a new Pool. See [ParseConfig] for information on connString format.
+func New(ctx context.Context, connString string) (*Pool, error) {
+ config, err := ParseConfig(connString)
+ if err != nil {
+ return nil, err
+ }
+
+ return NewWithConfig(ctx, config)
+}
+
+// NewWithConfig creates a new Pool. config must have been created by [ParseConfig].
+func NewWithConfig(ctx context.Context, config *Config) (*Pool, error) {
+ // Default values are set in ParseConfig. Enforce initial creation by ParseConfig rather than setting defaults from
+ // zero values.
+ if !config.createdByParseConfig {
+ panic("config must be created by ParseConfig")
+ }
+
+ p := &Pool{
+ config: config,
+ beforeConnect: config.BeforeConnect,
+ afterConnect: config.AfterConnect,
+ beforeAcquire: config.BeforeAcquire,
+ afterRelease: config.AfterRelease,
+ beforeClose: config.BeforeClose,
+ minConns: config.MinConns,
+ maxConns: config.MaxConns,
+ maxConnLifetime: config.MaxConnLifetime,
+ maxConnLifetimeJitter: config.MaxConnLifetimeJitter,
+ maxConnIdleTime: config.MaxConnIdleTime,
+ healthCheckPeriod: config.HealthCheckPeriod,
+ healthCheckChan: make(chan struct{}, 1),
+ closeChan: make(chan struct{}),
+ }
+
+ if t, ok := config.ConnConfig.Tracer.(AcquireTracer); ok {
+ p.acquireTracer = t
+ }
+
+ if t, ok := config.ConnConfig.Tracer.(ReleaseTracer); ok {
+ p.releaseTracer = t
+ }
+
+ var err error
+ p.p, err = puddle.NewPool(
+ &puddle.Config[*connResource]{
+ Constructor: func(ctx context.Context) (*connResource, error) {
+ atomic.AddInt64(&p.newConnsCount, 1)
+ connConfig := p.config.ConnConfig.Copy()
+
+ // Connection will continue in background even if Acquire is canceled. Ensure that a connect won't hang forever.
+ if connConfig.ConnectTimeout <= 0 {
+ connConfig.ConnectTimeout = 2 * time.Minute
+ }
+
+ if p.beforeConnect != nil {
+ if err := p.beforeConnect(ctx, connConfig); err != nil {
+ return nil, err
+ }
+ }
+
+ conn, err := pgx.ConnectConfig(ctx, connConfig)
+ if err != nil {
+ return nil, err
+ }
+
+ if p.afterConnect != nil {
+ err = p.afterConnect(ctx, conn)
+ if err != nil {
+ conn.Close(ctx)
+ return nil, err
+ }
+ }
+
+ jitterSecs := rand.Float64() * config.MaxConnLifetimeJitter.Seconds()
+ maxAgeTime := time.Now().Add(config.MaxConnLifetime).Add(time.Duration(jitterSecs) * time.Second)
+
+ cr := &connResource{
+ conn: conn,
+ conns: make([]Conn, 64),
+ poolRows: make([]poolRow, 64),
+ poolRowss: make([]poolRows, 64),
+ maxAgeTime: maxAgeTime,
+ }
+
+ return cr, nil
+ },
+ Destructor: func(value *connResource) {
+ ctx, cancel := context.WithTimeout(context.Background(), 15*time.Second)
+ conn := value.conn
+ if p.beforeClose != nil {
+ p.beforeClose(conn)
+ }
+ conn.Close(ctx)
+ select {
+ case <-conn.PgConn().CleanupDone():
+ case <-ctx.Done():
+ }
+ cancel()
+ },
+ MaxSize: config.MaxConns,
+ },
+ )
+ if err != nil {
+ return nil, err
+ }
+
+ go func() {
+ p.createIdleResources(ctx, int(p.minConns))
+ p.backgroundHealthCheck()
+ }()
+
+ return p, nil
+}
+
+// ParseConfig builds a Config from connString. It parses connString with the same behavior as [pgx.ParseConfig] with the
+// addition of the following variables:
+//
+// - pool_max_conns: integer greater than 0 (default 4)
+// - pool_min_conns: integer 0 or greater (default 0)
+// - pool_max_conn_lifetime: duration string (default 1 hour)
+// - pool_max_conn_idle_time: duration string (default 30 minutes)
+// - pool_health_check_period: duration string (default 1 minute)
+// - pool_max_conn_lifetime_jitter: duration string (default 0)
+//
+// See Config for definitions of these arguments.
+//
+// # Example Keyword/Value
+// user=jack password=secret host=pg.example.com port=5432 dbname=mydb sslmode=verify-ca pool_max_conns=10 pool_max_conn_lifetime=1h30m
+//
+// # Example URL
+// postgres://jack:secret@pg.example.com:5432/mydb?sslmode=verify-ca&pool_max_conns=10&pool_max_conn_lifetime=1h30m
+func ParseConfig(connString string) (*Config, error) {
+ connConfig, err := pgx.ParseConfig(connString)
+ if err != nil {
+ return nil, err
+ }
+
+ config := &Config{
+ ConnConfig: connConfig,
+ createdByParseConfig: true,
+ }
+
+ if s, ok := config.ConnConfig.Config.RuntimeParams["pool_max_conns"]; ok {
+ delete(connConfig.Config.RuntimeParams, "pool_max_conns")
+ n, err := strconv.ParseInt(s, 10, 32)
+ if err != nil {
+ return nil, fmt.Errorf("cannot parse pool_max_conns: %w", err)
+ }
+ if n < 1 {
+ return nil, fmt.Errorf("pool_max_conns too small: %d", n)
+ }
+ config.MaxConns = int32(n)
+ } else {
+ config.MaxConns = defaultMaxConns
+ if numCPU := int32(runtime.NumCPU()); numCPU > config.MaxConns {
+ config.MaxConns = numCPU
+ }
+ }
+
+ if s, ok := config.ConnConfig.Config.RuntimeParams["pool_min_conns"]; ok {
+ delete(connConfig.Config.RuntimeParams, "pool_min_conns")
+ n, err := strconv.ParseInt(s, 10, 32)
+ if err != nil {
+ return nil, fmt.Errorf("cannot parse pool_min_conns: %w", err)
+ }
+ config.MinConns = int32(n)
+ } else {
+ config.MinConns = defaultMinConns
+ }
+
+ if s, ok := config.ConnConfig.Config.RuntimeParams["pool_max_conn_lifetime"]; ok {
+ delete(connConfig.Config.RuntimeParams, "pool_max_conn_lifetime")
+ d, err := time.ParseDuration(s)
+ if err != nil {
+ return nil, fmt.Errorf("invalid pool_max_conn_lifetime: %w", err)
+ }
+ config.MaxConnLifetime = d
+ } else {
+ config.MaxConnLifetime = defaultMaxConnLifetime
+ }
+
+ if s, ok := config.ConnConfig.Config.RuntimeParams["pool_max_conn_idle_time"]; ok {
+ delete(connConfig.Config.RuntimeParams, "pool_max_conn_idle_time")
+ d, err := time.ParseDuration(s)
+ if err != nil {
+ return nil, fmt.Errorf("invalid pool_max_conn_idle_time: %w", err)
+ }
+ config.MaxConnIdleTime = d
+ } else {
+ config.MaxConnIdleTime = defaultMaxConnIdleTime
+ }
+
+ if s, ok := config.ConnConfig.Config.RuntimeParams["pool_health_check_period"]; ok {
+ delete(connConfig.Config.RuntimeParams, "pool_health_check_period")
+ d, err := time.ParseDuration(s)
+ if err != nil {
+ return nil, fmt.Errorf("invalid pool_health_check_period: %w", err)
+ }
+ config.HealthCheckPeriod = d
+ } else {
+ config.HealthCheckPeriod = defaultHealthCheckPeriod
+ }
+
+ if s, ok := config.ConnConfig.Config.RuntimeParams["pool_max_conn_lifetime_jitter"]; ok {
+ delete(connConfig.Config.RuntimeParams, "pool_max_conn_lifetime_jitter")
+ d, err := time.ParseDuration(s)
+ if err != nil {
+ return nil, fmt.Errorf("invalid pool_max_conn_lifetime_jitter: %w", err)
+ }
+ config.MaxConnLifetimeJitter = d
+ }
+
+ return config, nil
+}
+
+// Close closes all connections in the pool and rejects future Acquire calls. Blocks until all connections are returned
+// to pool and closed.
+func (p *Pool) Close() {
+ p.closeOnce.Do(func() {
+ close(p.closeChan)
+ p.p.Close()
+ })
+}
+
+func (p *Pool) isExpired(res *puddle.Resource[*connResource]) bool {
+ return time.Now().After(res.Value().maxAgeTime)
+}
+
+func (p *Pool) triggerHealthCheck() {
+ go func() {
+ // Destroy is asynchronous so we give it time to actually remove itself from
+ // the pool otherwise we might try to check the pool size too soon
+ time.Sleep(500 * time.Millisecond)
+ select {
+ case p.healthCheckChan <- struct{}{}:
+ default:
+ }
+ }()
+}
+
+func (p *Pool) backgroundHealthCheck() {
+ ticker := time.NewTicker(p.healthCheckPeriod)
+ defer ticker.Stop()
+ for {
+ select {
+ case <-p.closeChan:
+ return
+ case <-p.healthCheckChan:
+ p.checkHealth()
+ case <-ticker.C:
+ p.checkHealth()
+ }
+ }
+}
+
+func (p *Pool) checkHealth() {
+ for {
+ // If checkMinConns failed we don't destroy any connections since we couldn't
+ // even get to minConns
+ if err := p.checkMinConns(); err != nil {
+ // Should we log this error somewhere?
+ break
+ }
+ if !p.checkConnsHealth() {
+ // Since we didn't destroy any connections we can stop looping
+ break
+ }
+ // Technically Destroy is asynchronous but 500ms should be enough for it to
+ // remove it from the underlying pool
+ select {
+ case <-p.closeChan:
+ return
+ case <-time.After(500 * time.Millisecond):
+ }
+ }
+}
+
+// checkConnsHealth will check all idle connections, destroy a connection if
+// it's idle or too old, and returns true if any were destroyed
+func (p *Pool) checkConnsHealth() bool {
+ var destroyed bool
+ totalConns := p.Stat().TotalConns()
+ resources := p.p.AcquireAllIdle()
+ for _, res := range resources {
+ // We're okay going under minConns if the lifetime is up
+ if p.isExpired(res) && totalConns >= p.minConns {
+ atomic.AddInt64(&p.lifetimeDestroyCount, 1)
+ res.Destroy()
+ destroyed = true
+ // Since Destroy is async we manually decrement totalConns.
+ totalConns--
+ } else if res.IdleDuration() > p.maxConnIdleTime && totalConns > p.minConns {
+ atomic.AddInt64(&p.idleDestroyCount, 1)
+ res.Destroy()
+ destroyed = true
+ // Since Destroy is async we manually decrement totalConns.
+ totalConns--
+ } else {
+ res.ReleaseUnused()
+ }
+ }
+ return destroyed
+}
+
+func (p *Pool) checkMinConns() error {
+ // TotalConns can include ones that are being destroyed but we should have
+ // sleep(500ms) around all of the destroys to help prevent that from throwing
+ // off this check
+ toCreate := p.minConns - p.Stat().TotalConns()
+ if toCreate > 0 {
+ return p.createIdleResources(context.Background(), int(toCreate))
+ }
+ return nil
+}
+
+func (p *Pool) createIdleResources(parentCtx context.Context, targetResources int) error {
+ ctx, cancel := context.WithCancel(parentCtx)
+ defer cancel()
+
+ errs := make(chan error, targetResources)
+
+ for i := 0; i < targetResources; i++ {
+ go func() {
+ err := p.p.CreateResource(ctx)
+ // Ignore ErrNotAvailable since it means that the pool has become full since we started creating resource.
+ if err == puddle.ErrNotAvailable {
+ err = nil
+ }
+ errs <- err
+ }()
+ }
+
+ var firstError error
+ for i := 0; i < targetResources; i++ {
+ err := <-errs
+ if err != nil && firstError == nil {
+ cancel()
+ firstError = err
+ }
+ }
+
+ return firstError
+}
+
+// Acquire returns a connection (*Conn) from the Pool
+func (p *Pool) Acquire(ctx context.Context) (c *Conn, err error) {
+ if p.acquireTracer != nil {
+ ctx = p.acquireTracer.TraceAcquireStart(ctx, p, TraceAcquireStartData{})
+ defer func() {
+ var conn *pgx.Conn
+ if c != nil {
+ conn = c.Conn()
+ }
+ p.acquireTracer.TraceAcquireEnd(ctx, p, TraceAcquireEndData{Conn: conn, Err: err})
+ }()
+ }
+
+ for {
+ res, err := p.p.Acquire(ctx)
+ if err != nil {
+ return nil, err
+ }
+
+ cr := res.Value()
+
+ if res.IdleDuration() > time.Second {
+ err := cr.conn.Ping(ctx)
+ if err != nil {
+ res.Destroy()
+ continue
+ }
+ }
+
+ if p.beforeAcquire == nil || p.beforeAcquire(ctx, cr.conn) {
+ return cr.getConn(p, res), nil
+ }
+
+ res.Destroy()
+ }
+}
+
+// AcquireFunc acquires a *Conn and calls f with that *Conn. ctx will only affect the Acquire. It has no effect on the
+// call of f. The return value is either an error acquiring the *Conn or the return value of f. The *Conn is
+// automatically released after the call of f.
+func (p *Pool) AcquireFunc(ctx context.Context, f func(*Conn) error) error {
+ conn, err := p.Acquire(ctx)
+ if err != nil {
+ return err
+ }
+ defer conn.Release()
+
+ return f(conn)
+}
+
+// AcquireAllIdle atomically acquires all currently idle connections. Its intended use is for health check and
+// keep-alive functionality. It does not update pool statistics.
+func (p *Pool) AcquireAllIdle(ctx context.Context) []*Conn {
+ resources := p.p.AcquireAllIdle()
+ conns := make([]*Conn, 0, len(resources))
+ for _, res := range resources {
+ cr := res.Value()
+ if p.beforeAcquire == nil || p.beforeAcquire(ctx, cr.conn) {
+ conns = append(conns, cr.getConn(p, res))
+ } else {
+ res.Destroy()
+ }
+ }
+
+ return conns
+}
+
+// Reset closes all connections, but leaves the pool open. It is intended for use when an error is detected that would
+// disrupt all connections (such as a network interruption or a server state change).
+//
+// It is safe to reset a pool while connections are checked out. Those connections will be closed when they are returned
+// to the pool.
+func (p *Pool) Reset() {
+ p.p.Reset()
+}
+
+// Config returns a copy of config that was used to initialize this pool.
+func (p *Pool) Config() *Config { return p.config.Copy() }
+
+// Stat returns a pgxpool.Stat struct with a snapshot of Pool statistics.
+func (p *Pool) Stat() *Stat {
+ return &Stat{
+ s: p.p.Stat(),
+ newConnsCount: atomic.LoadInt64(&p.newConnsCount),
+ lifetimeDestroyCount: atomic.LoadInt64(&p.lifetimeDestroyCount),
+ idleDestroyCount: atomic.LoadInt64(&p.idleDestroyCount),
+ }
+}
+
+// Exec acquires a connection from the Pool and executes the given SQL.
+// SQL can be either a prepared statement name or an SQL string.
+// Arguments should be referenced positionally from the SQL string as $1, $2, etc.
+// The acquired connection is returned to the pool when the Exec function returns.
+func (p *Pool) Exec(ctx context.Context, sql string, arguments ...any) (pgconn.CommandTag, error) {
+ c, err := p.Acquire(ctx)
+ if err != nil {
+ return pgconn.CommandTag{}, err
+ }
+ defer c.Release()
+
+ return c.Exec(ctx, sql, arguments...)
+}
+
+// Query acquires a connection and executes a query that returns pgx.Rows.
+// Arguments should be referenced positionally from the SQL string as $1, $2, etc.
+// See pgx.Rows documentation to close the returned Rows and return the acquired connection to the Pool.
+//
+// If there is an error, the returned pgx.Rows will be returned in an error state.
+// If preferred, ignore the error returned from Query and handle errors using the returned pgx.Rows.
+//
+// For extra control over how the query is executed, the types QuerySimpleProtocol, QueryResultFormats, and
+// QueryResultFormatsByOID may be used as the first args to control exactly how the query is executed. This is rarely
+// needed. See the documentation for those types for details.
+func (p *Pool) Query(ctx context.Context, sql string, args ...any) (pgx.Rows, error) {
+ c, err := p.Acquire(ctx)
+ if err != nil {
+ return errRows{err: err}, err
+ }
+
+ rows, err := c.Query(ctx, sql, args...)
+ if err != nil {
+ c.Release()
+ return errRows{err: err}, err
+ }
+
+ return c.getPoolRows(rows), nil
+}
+
+// QueryRow acquires a connection and executes a query that is expected
+// to return at most one row (pgx.Row). Errors are deferred until pgx.Row's
+// Scan method is called. If the query selects no rows, pgx.Row's Scan will
+// return ErrNoRows. Otherwise, pgx.Row's Scan scans the first selected row
+// and discards the rest. The acquired connection is returned to the Pool when
+// pgx.Row's Scan method is called.
+//
+// Arguments should be referenced positionally from the SQL string as $1, $2, etc.
+//
+// For extra control over how the query is executed, the types QuerySimpleProtocol, QueryResultFormats, and
+// QueryResultFormatsByOID may be used as the first args to control exactly how the query is executed. This is rarely
+// needed. See the documentation for those types for details.
+func (p *Pool) QueryRow(ctx context.Context, sql string, args ...any) pgx.Row {
+ c, err := p.Acquire(ctx)
+ if err != nil {
+ return errRow{err: err}
+ }
+
+ row := c.QueryRow(ctx, sql, args...)
+ return c.getPoolRow(row)
+}
+
+func (p *Pool) SendBatch(ctx context.Context, b *pgx.Batch) pgx.BatchResults {
+ c, err := p.Acquire(ctx)
+ if err != nil {
+ return errBatchResults{err: err}
+ }
+
+ br := c.SendBatch(ctx, b)
+ return &poolBatchResults{br: br, c: c}
+}
+
+// Begin acquires a connection from the Pool and starts a transaction. Unlike database/sql, the context only affects the begin command. i.e. there is no
+// auto-rollback on context cancellation. Begin initiates a transaction block without explicitly setting a transaction mode for the block (see BeginTx with TxOptions if transaction mode is required).
+// *pgxpool.Tx is returned, which implements the pgx.Tx interface.
+// Commit or Rollback must be called on the returned transaction to finalize the transaction block.
+func (p *Pool) Begin(ctx context.Context) (pgx.Tx, error) {
+ return p.BeginTx(ctx, pgx.TxOptions{})
+}
+
+// BeginTx acquires a connection from the Pool and starts a transaction with pgx.TxOptions determining the transaction mode.
+// Unlike database/sql, the context only affects the begin command. i.e. there is no auto-rollback on context cancellation.
+// *pgxpool.Tx is returned, which implements the pgx.Tx interface.
+// Commit or Rollback must be called on the returned transaction to finalize the transaction block.
+func (p *Pool) BeginTx(ctx context.Context, txOptions pgx.TxOptions) (pgx.Tx, error) {
+ c, err := p.Acquire(ctx)
+ if err != nil {
+ return nil, err
+ }
+
+ t, err := c.BeginTx(ctx, txOptions)
+ if err != nil {
+ c.Release()
+ return nil, err
+ }
+
+ return &Tx{t: t, c: c}, nil
+}
+
+func (p *Pool) CopyFrom(ctx context.Context, tableName pgx.Identifier, columnNames []string, rowSrc pgx.CopyFromSource) (int64, error) {
+ c, err := p.Acquire(ctx)
+ if err != nil {
+ return 0, err
+ }
+ defer c.Release()
+
+ return c.Conn().CopyFrom(ctx, tableName, columnNames, rowSrc)
+}
+
+// Ping acquires a connection from the Pool and executes an empty sql statement against it.
+// If the sql returns without error, the database Ping is considered successful, otherwise, the error is returned.
+func (p *Pool) Ping(ctx context.Context) error {
+ c, err := p.Acquire(ctx)
+ if err != nil {
+ return err
+ }
+ defer c.Release()
+ return c.Ping(ctx)
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgxpool/rows.go b/vendor/github.com/jackc/pgx/v5/pgxpool/rows.go
new file mode 100644
index 0000000..f834b7e
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgxpool/rows.go
@@ -0,0 +1,116 @@
+package pgxpool
+
+import (
+ "github.com/jackc/pgx/v5"
+ "github.com/jackc/pgx/v5/pgconn"
+)
+
+type errRows struct {
+ err error
+}
+
+func (errRows) Close() {}
+func (e errRows) Err() error { return e.err }
+func (errRows) CommandTag() pgconn.CommandTag { return pgconn.CommandTag{} }
+func (errRows) FieldDescriptions() []pgconn.FieldDescription { return nil }
+func (errRows) Next() bool { return false }
+func (e errRows) Scan(dest ...any) error { return e.err }
+func (e errRows) Values() ([]any, error) { return nil, e.err }
+func (e errRows) RawValues() [][]byte { return nil }
+func (e errRows) Conn() *pgx.Conn { return nil }
+
+type errRow struct {
+ err error
+}
+
+func (e errRow) Scan(dest ...any) error { return e.err }
+
+type poolRows struct {
+ r pgx.Rows
+ c *Conn
+ err error
+}
+
+func (rows *poolRows) Close() {
+ rows.r.Close()
+ if rows.c != nil {
+ rows.c.Release()
+ rows.c = nil
+ }
+}
+
+func (rows *poolRows) Err() error {
+ if rows.err != nil {
+ return rows.err
+ }
+ return rows.r.Err()
+}
+
+func (rows *poolRows) CommandTag() pgconn.CommandTag {
+ return rows.r.CommandTag()
+}
+
+func (rows *poolRows) FieldDescriptions() []pgconn.FieldDescription {
+ return rows.r.FieldDescriptions()
+}
+
+func (rows *poolRows) Next() bool {
+ if rows.err != nil {
+ return false
+ }
+
+ n := rows.r.Next()
+ if !n {
+ rows.Close()
+ }
+ return n
+}
+
+func (rows *poolRows) Scan(dest ...any) error {
+ err := rows.r.Scan(dest...)
+ if err != nil {
+ rows.Close()
+ }
+ return err
+}
+
+func (rows *poolRows) Values() ([]any, error) {
+ values, err := rows.r.Values()
+ if err != nil {
+ rows.Close()
+ }
+ return values, err
+}
+
+func (rows *poolRows) RawValues() [][]byte {
+ return rows.r.RawValues()
+}
+
+func (rows *poolRows) Conn() *pgx.Conn {
+ return rows.r.Conn()
+}
+
+type poolRow struct {
+ r pgx.Row
+ c *Conn
+ err error
+}
+
+func (row *poolRow) Scan(dest ...any) error {
+ if row.err != nil {
+ return row.err
+ }
+
+ panicked := true
+ defer func() {
+ if panicked && row.c != nil {
+ row.c.Release()
+ }
+ }()
+ err := row.r.Scan(dest...)
+ panicked = false
+ if row.c != nil {
+ row.c.Release()
+ }
+ return err
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgxpool/stat.go b/vendor/github.com/jackc/pgx/v5/pgxpool/stat.go
new file mode 100644
index 0000000..cfa0c4c
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgxpool/stat.go
@@ -0,0 +1,84 @@
+package pgxpool
+
+import (
+ "time"
+
+ "github.com/jackc/puddle/v2"
+)
+
+// Stat is a snapshot of Pool statistics.
+type Stat struct {
+ s *puddle.Stat
+ newConnsCount int64
+ lifetimeDestroyCount int64
+ idleDestroyCount int64
+}
+
+// AcquireCount returns the cumulative count of successful acquires from the pool.
+func (s *Stat) AcquireCount() int64 {
+ return s.s.AcquireCount()
+}
+
+// AcquireDuration returns the total duration of all successful acquires from
+// the pool.
+func (s *Stat) AcquireDuration() time.Duration {
+ return s.s.AcquireDuration()
+}
+
+// AcquiredConns returns the number of currently acquired connections in the pool.
+func (s *Stat) AcquiredConns() int32 {
+ return s.s.AcquiredResources()
+}
+
+// CanceledAcquireCount returns the cumulative count of acquires from the pool
+// that were canceled by a context.
+func (s *Stat) CanceledAcquireCount() int64 {
+ return s.s.CanceledAcquireCount()
+}
+
+// ConstructingConns returns the number of conns with construction in progress in
+// the pool.
+func (s *Stat) ConstructingConns() int32 {
+ return s.s.ConstructingResources()
+}
+
+// EmptyAcquireCount returns the cumulative count of successful acquires from the pool
+// that waited for a resource to be released or constructed because the pool was
+// empty.
+func (s *Stat) EmptyAcquireCount() int64 {
+ return s.s.EmptyAcquireCount()
+}
+
+// IdleConns returns the number of currently idle conns in the pool.
+func (s *Stat) IdleConns() int32 {
+ return s.s.IdleResources()
+}
+
+// MaxConns returns the maximum size of the pool.
+func (s *Stat) MaxConns() int32 {
+ return s.s.MaxResources()
+}
+
+// TotalConns returns the total number of resources currently in the pool.
+// The value is the sum of ConstructingConns, AcquiredConns, and
+// IdleConns.
+func (s *Stat) TotalConns() int32 {
+ return s.s.TotalResources()
+}
+
+// NewConnsCount returns the cumulative count of new connections opened.
+func (s *Stat) NewConnsCount() int64 {
+ return s.newConnsCount
+}
+
+// MaxLifetimeDestroyCount returns the cumulative count of connections destroyed
+// because they exceeded MaxConnLifetime.
+func (s *Stat) MaxLifetimeDestroyCount() int64 {
+ return s.lifetimeDestroyCount
+}
+
+// MaxIdleDestroyCount returns the cumulative count of connections destroyed because
+// they exceeded MaxConnIdleTime.
+func (s *Stat) MaxIdleDestroyCount() int64 {
+ return s.idleDestroyCount
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgxpool/tracer.go b/vendor/github.com/jackc/pgx/v5/pgxpool/tracer.go
new file mode 100644
index 0000000..78b9d15
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgxpool/tracer.go
@@ -0,0 +1,33 @@
+package pgxpool
+
+import (
+ "context"
+
+ "github.com/jackc/pgx/v5"
+)
+
+// AcquireTracer traces Acquire.
+type AcquireTracer interface {
+ // TraceAcquireStart is called at the beginning of Acquire.
+ // The returned context is used for the rest of the call and will be passed to the TraceAcquireEnd.
+ TraceAcquireStart(ctx context.Context, pool *Pool, data TraceAcquireStartData) context.Context
+ // TraceAcquireEnd is called when a connection has been acquired.
+ TraceAcquireEnd(ctx context.Context, pool *Pool, data TraceAcquireEndData)
+}
+
+type TraceAcquireStartData struct{}
+
+type TraceAcquireEndData struct {
+ Conn *pgx.Conn
+ Err error
+}
+
+// ReleaseTracer traces Release.
+type ReleaseTracer interface {
+ // TraceRelease is called at the beginning of Release.
+ TraceRelease(pool *Pool, data TraceReleaseData)
+}
+
+type TraceReleaseData struct {
+ Conn *pgx.Conn
+}
diff --git a/vendor/github.com/jackc/pgx/v5/pgxpool/tx.go b/vendor/github.com/jackc/pgx/v5/pgxpool/tx.go
new file mode 100644
index 0000000..b49e7f4
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/pgxpool/tx.go
@@ -0,0 +1,83 @@
+package pgxpool
+
+import (
+ "context"
+
+ "github.com/jackc/pgx/v5"
+ "github.com/jackc/pgx/v5/pgconn"
+)
+
+// Tx represents a database transaction acquired from a Pool.
+type Tx struct {
+ t pgx.Tx
+ c *Conn
+}
+
+// Begin starts a pseudo nested transaction implemented with a savepoint.
+func (tx *Tx) Begin(ctx context.Context) (pgx.Tx, error) {
+ return tx.t.Begin(ctx)
+}
+
+// Commit commits the transaction and returns the associated connection back to the Pool. Commit will return an error
+// where errors.Is(ErrTxClosed) is true if the Tx is already closed, but is otherwise safe to call multiple times. If
+// the commit fails with a rollback status (e.g. the transaction was already in a broken state) then ErrTxCommitRollback
+// will be returned.
+func (tx *Tx) Commit(ctx context.Context) error {
+ err := tx.t.Commit(ctx)
+ if tx.c != nil {
+ tx.c.Release()
+ tx.c = nil
+ }
+ return err
+}
+
+// Rollback rolls back the transaction and returns the associated connection back to the Pool. Rollback will return
+// where an error where errors.Is(ErrTxClosed) is true if the Tx is already closed, but is otherwise safe to call
+// multiple times. Hence, defer tx.Rollback() is safe even if tx.Commit() will be called first in a non-error condition.
+func (tx *Tx) Rollback(ctx context.Context) error {
+ err := tx.t.Rollback(ctx)
+ if tx.c != nil {
+ tx.c.Release()
+ tx.c = nil
+ }
+ return err
+}
+
+func (tx *Tx) CopyFrom(ctx context.Context, tableName pgx.Identifier, columnNames []string, rowSrc pgx.CopyFromSource) (int64, error) {
+ return tx.t.CopyFrom(ctx, tableName, columnNames, rowSrc)
+}
+
+func (tx *Tx) SendBatch(ctx context.Context, b *pgx.Batch) pgx.BatchResults {
+ return tx.t.SendBatch(ctx, b)
+}
+
+func (tx *Tx) LargeObjects() pgx.LargeObjects {
+ return tx.t.LargeObjects()
+}
+
+// Prepare creates a prepared statement with name and sql. If the name is empty,
+// an anonymous prepared statement will be used. sql can contain placeholders
+// for bound parameters. These placeholders are referenced positionally as $1, $2, etc.
+//
+// Prepare is idempotent; i.e. it is safe to call Prepare multiple times with the same
+// name and sql arguments. This allows a code path to Prepare and Query/Exec without
+// needing to first check whether the statement has already been prepared.
+func (tx *Tx) Prepare(ctx context.Context, name, sql string) (*pgconn.StatementDescription, error) {
+ return tx.t.Prepare(ctx, name, sql)
+}
+
+func (tx *Tx) Exec(ctx context.Context, sql string, arguments ...any) (pgconn.CommandTag, error) {
+ return tx.t.Exec(ctx, sql, arguments...)
+}
+
+func (tx *Tx) Query(ctx context.Context, sql string, args ...any) (pgx.Rows, error) {
+ return tx.t.Query(ctx, sql, args...)
+}
+
+func (tx *Tx) QueryRow(ctx context.Context, sql string, args ...any) pgx.Row {
+ return tx.t.QueryRow(ctx, sql, args...)
+}
+
+func (tx *Tx) Conn() *pgx.Conn {
+ return tx.t.Conn()
+}
diff --git a/vendor/github.com/jackc/pgx/v5/rows.go b/vendor/github.com/jackc/pgx/v5/rows.go
new file mode 100644
index 0000000..f23625d
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/rows.go
@@ -0,0 +1,856 @@
+package pgx
+
+import (
+ "context"
+ "errors"
+ "fmt"
+ "reflect"
+ "strings"
+ "sync"
+ "time"
+
+ "github.com/jackc/pgx/v5/pgconn"
+ "github.com/jackc/pgx/v5/pgtype"
+)
+
+// Rows is the result set returned from *Conn.Query. Rows must be closed before
+// the *Conn can be used again. Rows are closed by explicitly calling Close(),
+// calling Next() until it returns false, or when a fatal error occurs.
+//
+// Once a Rows is closed the only methods that may be called are Close(), Err(),
+// and CommandTag().
+//
+// Rows is an interface instead of a struct to allow tests to mock Query. However,
+// adding a method to an interface is technically a breaking change. Because of this
+// the Rows interface is partially excluded from semantic version requirements.
+// Methods will not be removed or changed, but new methods may be added.
+type Rows interface {
+ // Close closes the rows, making the connection ready for use again. It is safe
+ // to call Close after rows is already closed.
+ Close()
+
+ // Err returns any error that occurred while reading. Err must only be called after the Rows is closed (either by
+ // calling Close or by Next returning false). If it is called early it may return nil even if there was an error
+ // executing the query.
+ Err() error
+
+ // CommandTag returns the command tag from this query. It is only available after Rows is closed.
+ CommandTag() pgconn.CommandTag
+
+ // FieldDescriptions returns the field descriptions of the columns. It may return nil. In particular this can occur
+ // when there was an error executing the query.
+ FieldDescriptions() []pgconn.FieldDescription
+
+ // Next prepares the next row for reading. It returns true if there is another
+ // row and false if no more rows are available or a fatal error has occurred.
+ // It automatically closes rows when all rows are read.
+ //
+ // Callers should check rows.Err() after rows.Next() returns false to detect
+ // whether result-set reading ended prematurely due to an error. See
+ // Conn.Query for details.
+ //
+ // For simpler error handling, consider using the higher-level pgx v5
+ // CollectRows() and ForEachRow() helpers instead.
+ Next() bool
+
+ // Scan reads the values from the current row into dest values positionally.
+ // dest can include pointers to core types, values implementing the Scanner
+ // interface, and nil. nil will skip the value entirely. It is an error to
+ // call Scan without first calling Next() and checking that it returned true.
+ Scan(dest ...any) error
+
+ // Values returns the decoded row values. As with Scan(), it is an error to
+ // call Values without first calling Next() and checking that it returned
+ // true.
+ Values() ([]any, error)
+
+ // RawValues returns the unparsed bytes of the row values. The returned data is only valid until the next Next
+ // call or the Rows is closed.
+ RawValues() [][]byte
+
+ // Conn returns the underlying *Conn on which the query was executed. This may return nil if Rows did not come from a
+ // *Conn (e.g. if it was created by RowsFromResultReader)
+ Conn() *Conn
+}
+
+// Row is a convenience wrapper over Rows that is returned by QueryRow.
+//
+// Row is an interface instead of a struct to allow tests to mock QueryRow. However,
+// adding a method to an interface is technically a breaking change. Because of this
+// the Row interface is partially excluded from semantic version requirements.
+// Methods will not be removed or changed, but new methods may be added.
+type Row interface {
+ // Scan works the same as Rows. with the following exceptions. If no
+ // rows were found it returns ErrNoRows. If multiple rows are returned it
+ // ignores all but the first.
+ Scan(dest ...any) error
+}
+
+// RowScanner scans an entire row at a time into the RowScanner.
+type RowScanner interface {
+ // ScanRows scans the row.
+ ScanRow(rows Rows) error
+}
+
+// connRow implements the Row interface for Conn.QueryRow.
+type connRow baseRows
+
+func (r *connRow) Scan(dest ...any) (err error) {
+ rows := (*baseRows)(r)
+
+ if rows.Err() != nil {
+ return rows.Err()
+ }
+
+ for _, d := range dest {
+ if _, ok := d.(*pgtype.DriverBytes); ok {
+ rows.Close()
+ return fmt.Errorf("cannot scan into *pgtype.DriverBytes from QueryRow")
+ }
+ }
+
+ if !rows.Next() {
+ if rows.Err() == nil {
+ return ErrNoRows
+ }
+ return rows.Err()
+ }
+
+ rows.Scan(dest...)
+ rows.Close()
+ return rows.Err()
+}
+
+// baseRows implements the Rows interface for Conn.Query.
+type baseRows struct {
+ typeMap *pgtype.Map
+ resultReader *pgconn.ResultReader
+
+ values [][]byte
+
+ commandTag pgconn.CommandTag
+ err error
+ closed bool
+
+ scanPlans []pgtype.ScanPlan
+ scanTypes []reflect.Type
+
+ conn *Conn
+ multiResultReader *pgconn.MultiResultReader
+
+ queryTracer QueryTracer
+ batchTracer BatchTracer
+ ctx context.Context
+ startTime time.Time
+ sql string
+ args []any
+ rowCount int
+}
+
+func (rows *baseRows) FieldDescriptions() []pgconn.FieldDescription {
+ return rows.resultReader.FieldDescriptions()
+}
+
+func (rows *baseRows) Close() {
+ if rows.closed {
+ return
+ }
+
+ rows.closed = true
+
+ if rows.resultReader != nil {
+ var closeErr error
+ rows.commandTag, closeErr = rows.resultReader.Close()
+ if rows.err == nil {
+ rows.err = closeErr
+ }
+ }
+
+ if rows.multiResultReader != nil {
+ closeErr := rows.multiResultReader.Close()
+ if rows.err == nil {
+ rows.err = closeErr
+ }
+ }
+
+ if rows.err != nil && rows.conn != nil && rows.sql != "" {
+ if sc := rows.conn.statementCache; sc != nil {
+ sc.Invalidate(rows.sql)
+ }
+
+ if sc := rows.conn.descriptionCache; sc != nil {
+ sc.Invalidate(rows.sql)
+ }
+ }
+
+ if rows.batchTracer != nil {
+ rows.batchTracer.TraceBatchQuery(rows.ctx, rows.conn, TraceBatchQueryData{SQL: rows.sql, Args: rows.args, CommandTag: rows.commandTag, Err: rows.err})
+ } else if rows.queryTracer != nil {
+ rows.queryTracer.TraceQueryEnd(rows.ctx, rows.conn, TraceQueryEndData{rows.commandTag, rows.err})
+ }
+}
+
+func (rows *baseRows) CommandTag() pgconn.CommandTag {
+ return rows.commandTag
+}
+
+func (rows *baseRows) Err() error {
+ return rows.err
+}
+
+// fatal signals an error occurred after the query was sent to the server. It
+// closes the rows automatically.
+func (rows *baseRows) fatal(err error) {
+ if rows.err != nil {
+ return
+ }
+
+ rows.err = err
+ rows.Close()
+}
+
+func (rows *baseRows) Next() bool {
+ if rows.closed {
+ return false
+ }
+
+ if rows.resultReader.NextRow() {
+ rows.rowCount++
+ rows.values = rows.resultReader.Values()
+ return true
+ } else {
+ rows.Close()
+ return false
+ }
+}
+
+func (rows *baseRows) Scan(dest ...any) error {
+ m := rows.typeMap
+ fieldDescriptions := rows.FieldDescriptions()
+ values := rows.values
+
+ if len(fieldDescriptions) != len(values) {
+ err := fmt.Errorf("number of field descriptions must equal number of values, got %d and %d", len(fieldDescriptions), len(values))
+ rows.fatal(err)
+ return err
+ }
+
+ if len(dest) == 1 {
+ if rc, ok := dest[0].(RowScanner); ok {
+ err := rc.ScanRow(rows)
+ if err != nil {
+ rows.fatal(err)
+ }
+ return err
+ }
+ }
+
+ if len(fieldDescriptions) != len(dest) {
+ err := fmt.Errorf("number of field descriptions must equal number of destinations, got %d and %d", len(fieldDescriptions), len(dest))
+ rows.fatal(err)
+ return err
+ }
+
+ if rows.scanPlans == nil {
+ rows.scanPlans = make([]pgtype.ScanPlan, len(values))
+ rows.scanTypes = make([]reflect.Type, len(values))
+ for i := range dest {
+ rows.scanPlans[i] = m.PlanScan(fieldDescriptions[i].DataTypeOID, fieldDescriptions[i].Format, dest[i])
+ rows.scanTypes[i] = reflect.TypeOf(dest[i])
+ }
+ }
+
+ for i, dst := range dest {
+ if dst == nil {
+ continue
+ }
+
+ if rows.scanTypes[i] != reflect.TypeOf(dst) {
+ rows.scanPlans[i] = m.PlanScan(fieldDescriptions[i].DataTypeOID, fieldDescriptions[i].Format, dest[i])
+ rows.scanTypes[i] = reflect.TypeOf(dest[i])
+ }
+
+ err := rows.scanPlans[i].Scan(values[i], dst)
+ if err != nil {
+ err = ScanArgError{ColumnIndex: i, Err: err}
+ rows.fatal(err)
+ return err
+ }
+ }
+
+ return nil
+}
+
+func (rows *baseRows) Values() ([]any, error) {
+ if rows.closed {
+ return nil, errors.New("rows is closed")
+ }
+
+ values := make([]any, 0, len(rows.FieldDescriptions()))
+
+ for i := range rows.FieldDescriptions() {
+ buf := rows.values[i]
+ fd := &rows.FieldDescriptions()[i]
+
+ if buf == nil {
+ values = append(values, nil)
+ continue
+ }
+
+ if dt, ok := rows.typeMap.TypeForOID(fd.DataTypeOID); ok {
+ value, err := dt.Codec.DecodeValue(rows.typeMap, fd.DataTypeOID, fd.Format, buf)
+ if err != nil {
+ rows.fatal(err)
+ }
+ values = append(values, value)
+ } else {
+ switch fd.Format {
+ case TextFormatCode:
+ values = append(values, string(buf))
+ case BinaryFormatCode:
+ newBuf := make([]byte, len(buf))
+ copy(newBuf, buf)
+ values = append(values, newBuf)
+ default:
+ rows.fatal(errors.New("unknown format code"))
+ }
+ }
+
+ if rows.Err() != nil {
+ return nil, rows.Err()
+ }
+ }
+
+ return values, rows.Err()
+}
+
+func (rows *baseRows) RawValues() [][]byte {
+ return rows.values
+}
+
+func (rows *baseRows) Conn() *Conn {
+ return rows.conn
+}
+
+type ScanArgError struct {
+ ColumnIndex int
+ Err error
+}
+
+func (e ScanArgError) Error() string {
+ return fmt.Sprintf("can't scan into dest[%d]: %v", e.ColumnIndex, e.Err)
+}
+
+func (e ScanArgError) Unwrap() error {
+ return e.Err
+}
+
+// ScanRow decodes raw row data into dest. It can be used to scan rows read from the lower level pgconn interface.
+//
+// typeMap - OID to Go type mapping.
+// fieldDescriptions - OID and format of values
+// values - the raw data as returned from the PostgreSQL server
+// dest - the destination that values will be decoded into
+func ScanRow(typeMap *pgtype.Map, fieldDescriptions []pgconn.FieldDescription, values [][]byte, dest ...any) error {
+ if len(fieldDescriptions) != len(values) {
+ return fmt.Errorf("number of field descriptions must equal number of values, got %d and %d", len(fieldDescriptions), len(values))
+ }
+ if len(fieldDescriptions) != len(dest) {
+ return fmt.Errorf("number of field descriptions must equal number of destinations, got %d and %d", len(fieldDescriptions), len(dest))
+ }
+
+ for i, d := range dest {
+ if d == nil {
+ continue
+ }
+
+ err := typeMap.Scan(fieldDescriptions[i].DataTypeOID, fieldDescriptions[i].Format, values[i], d)
+ if err != nil {
+ return ScanArgError{ColumnIndex: i, Err: err}
+ }
+ }
+
+ return nil
+}
+
+// RowsFromResultReader returns a Rows that will read from values resultReader and decode with typeMap. It can be used
+// to read from the lower level pgconn interface.
+func RowsFromResultReader(typeMap *pgtype.Map, resultReader *pgconn.ResultReader) Rows {
+ return &baseRows{
+ typeMap: typeMap,
+ resultReader: resultReader,
+ }
+}
+
+// ForEachRow iterates through rows. For each row it scans into the elements of scans and calls fn. If any row
+// fails to scan or fn returns an error the query will be aborted and the error will be returned. Rows will be closed
+// when ForEachRow returns.
+func ForEachRow(rows Rows, scans []any, fn func() error) (pgconn.CommandTag, error) {
+ defer rows.Close()
+
+ for rows.Next() {
+ err := rows.Scan(scans...)
+ if err != nil {
+ return pgconn.CommandTag{}, err
+ }
+
+ err = fn()
+ if err != nil {
+ return pgconn.CommandTag{}, err
+ }
+ }
+
+ if err := rows.Err(); err != nil {
+ return pgconn.CommandTag{}, err
+ }
+
+ return rows.CommandTag(), nil
+}
+
+// CollectableRow is the subset of Rows methods that a RowToFunc is allowed to call.
+type CollectableRow interface {
+ FieldDescriptions() []pgconn.FieldDescription
+ Scan(dest ...any) error
+ Values() ([]any, error)
+ RawValues() [][]byte
+}
+
+// RowToFunc is a function that scans or otherwise converts row to a T.
+type RowToFunc[T any] func(row CollectableRow) (T, error)
+
+// AppendRows iterates through rows, calling fn for each row, and appending the results into a slice of T.
+//
+// This function closes the rows automatically on return.
+func AppendRows[T any, S ~[]T](slice S, rows Rows, fn RowToFunc[T]) (S, error) {
+ defer rows.Close()
+
+ for rows.Next() {
+ value, err := fn(rows)
+ if err != nil {
+ return nil, err
+ }
+ slice = append(slice, value)
+ }
+
+ if err := rows.Err(); err != nil {
+ return nil, err
+ }
+
+ return slice, nil
+}
+
+// CollectRows iterates through rows, calling fn for each row, and collecting the results into a slice of T.
+//
+// This function closes the rows automatically on return.
+func CollectRows[T any](rows Rows, fn RowToFunc[T]) ([]T, error) {
+ return AppendRows([]T{}, rows, fn)
+}
+
+// CollectOneRow calls fn for the first row in rows and returns the result. If no rows are found returns an error where errors.Is(ErrNoRows) is true.
+// CollectOneRow is to CollectRows as QueryRow is to Query.
+//
+// This function closes the rows automatically on return.
+func CollectOneRow[T any](rows Rows, fn RowToFunc[T]) (T, error) {
+ defer rows.Close()
+
+ var value T
+ var err error
+
+ if !rows.Next() {
+ if err = rows.Err(); err != nil {
+ return value, err
+ }
+ return value, ErrNoRows
+ }
+
+ value, err = fn(rows)
+ if err != nil {
+ return value, err
+ }
+
+ rows.Close()
+ return value, rows.Err()
+}
+
+// CollectExactlyOneRow calls fn for the first row in rows and returns the result.
+// - If no rows are found returns an error where errors.Is(ErrNoRows) is true.
+// - If more than 1 row is found returns an error where errors.Is(ErrTooManyRows) is true.
+//
+// This function closes the rows automatically on return.
+func CollectExactlyOneRow[T any](rows Rows, fn RowToFunc[T]) (T, error) {
+ defer rows.Close()
+
+ var (
+ err error
+ value T
+ )
+
+ if !rows.Next() {
+ if err = rows.Err(); err != nil {
+ return value, err
+ }
+
+ return value, ErrNoRows
+ }
+
+ value, err = fn(rows)
+ if err != nil {
+ return value, err
+ }
+
+ if rows.Next() {
+ var zero T
+
+ return zero, ErrTooManyRows
+ }
+
+ return value, rows.Err()
+}
+
+// RowTo returns a T scanned from row.
+func RowTo[T any](row CollectableRow) (T, error) {
+ var value T
+ err := row.Scan(&value)
+ return value, err
+}
+
+// RowTo returns a the address of a T scanned from row.
+func RowToAddrOf[T any](row CollectableRow) (*T, error) {
+ var value T
+ err := row.Scan(&value)
+ return &value, err
+}
+
+// RowToMap returns a map scanned from row.
+func RowToMap(row CollectableRow) (map[string]any, error) {
+ var value map[string]any
+ err := row.Scan((*mapRowScanner)(&value))
+ return value, err
+}
+
+type mapRowScanner map[string]any
+
+func (rs *mapRowScanner) ScanRow(rows Rows) error {
+ values, err := rows.Values()
+ if err != nil {
+ return err
+ }
+
+ *rs = make(mapRowScanner, len(values))
+
+ for i := range values {
+ (*rs)[string(rows.FieldDescriptions()[i].Name)] = values[i]
+ }
+
+ return nil
+}
+
+// RowToStructByPos returns a T scanned from row. T must be a struct. T must have the same number a public fields as row
+// has fields. The row and T fields will be matched by position. If the "db" struct tag is "-" then the field will be
+// ignored.
+func RowToStructByPos[T any](row CollectableRow) (T, error) {
+ var value T
+ err := (&positionalStructRowScanner{ptrToStruct: &value}).ScanRow(row)
+ return value, err
+}
+
+// RowToAddrOfStructByPos returns the address of a T scanned from row. T must be a struct. T must have the same number a
+// public fields as row has fields. The row and T fields will be matched by position. If the "db" struct tag is "-" then
+// the field will be ignored.
+func RowToAddrOfStructByPos[T any](row CollectableRow) (*T, error) {
+ var value T
+ err := (&positionalStructRowScanner{ptrToStruct: &value}).ScanRow(row)
+ return &value, err
+}
+
+type positionalStructRowScanner struct {
+ ptrToStruct any
+}
+
+func (rs *positionalStructRowScanner) ScanRow(rows CollectableRow) error {
+ typ := reflect.TypeOf(rs.ptrToStruct).Elem()
+ fields := lookupStructFields(typ)
+ if len(rows.RawValues()) > len(fields) {
+ return fmt.Errorf(
+ "got %d values, but dst struct has only %d fields",
+ len(rows.RawValues()),
+ len(fields),
+ )
+ }
+ scanTargets := setupStructScanTargets(rs.ptrToStruct, fields)
+ return rows.Scan(scanTargets...)
+}
+
+// Map from reflect.Type -> []structRowField
+var positionalStructFieldMap sync.Map
+
+func lookupStructFields(t reflect.Type) []structRowField {
+ if cached, ok := positionalStructFieldMap.Load(t); ok {
+ return cached.([]structRowField)
+ }
+
+ fieldStack := make([]int, 0, 1)
+ fields := computeStructFields(t, make([]structRowField, 0, t.NumField()), &fieldStack)
+ fieldsIface, _ := positionalStructFieldMap.LoadOrStore(t, fields)
+ return fieldsIface.([]structRowField)
+}
+
+func computeStructFields(
+ t reflect.Type,
+ fields []structRowField,
+ fieldStack *[]int,
+) []structRowField {
+ tail := len(*fieldStack)
+ *fieldStack = append(*fieldStack, 0)
+ for i := 0; i < t.NumField(); i++ {
+ sf := t.Field(i)
+ (*fieldStack)[tail] = i
+ // Handle anonymous struct embedding, but do not try to handle embedded pointers.
+ if sf.Anonymous && sf.Type.Kind() == reflect.Struct {
+ fields = computeStructFields(sf.Type, fields, fieldStack)
+ } else if sf.PkgPath == "" {
+ dbTag, _ := sf.Tag.Lookup(structTagKey)
+ if dbTag == "-" {
+ // Field is ignored, skip it.
+ continue
+ }
+ fields = append(fields, structRowField{
+ path: append([]int(nil), *fieldStack...),
+ })
+ }
+ }
+ *fieldStack = (*fieldStack)[:tail]
+ return fields
+}
+
+// RowToStructByName returns a T scanned from row. T must be a struct. T must have the same number of named public
+// fields as row has fields. The row and T fields will be matched by name. The match is case-insensitive. The database
+// column name can be overridden with a "db" struct tag. If the "db" struct tag is "-" then the field will be ignored.
+func RowToStructByName[T any](row CollectableRow) (T, error) {
+ var value T
+ err := (&namedStructRowScanner{ptrToStruct: &value}).ScanRow(row)
+ return value, err
+}
+
+// RowToAddrOfStructByName returns the address of a T scanned from row. T must be a struct. T must have the same number
+// of named public fields as row has fields. The row and T fields will be matched by name. The match is
+// case-insensitive. The database column name can be overridden with a "db" struct tag. If the "db" struct tag is "-"
+// then the field will be ignored.
+func RowToAddrOfStructByName[T any](row CollectableRow) (*T, error) {
+ var value T
+ err := (&namedStructRowScanner{ptrToStruct: &value}).ScanRow(row)
+ return &value, err
+}
+
+// RowToStructByNameLax returns a T scanned from row. T must be a struct. T must have greater than or equal number of named public
+// fields as row has fields. The row and T fields will be matched by name. The match is case-insensitive. The database
+// column name can be overridden with a "db" struct tag. If the "db" struct tag is "-" then the field will be ignored.
+func RowToStructByNameLax[T any](row CollectableRow) (T, error) {
+ var value T
+ err := (&namedStructRowScanner{ptrToStruct: &value, lax: true}).ScanRow(row)
+ return value, err
+}
+
+// RowToAddrOfStructByNameLax returns the address of a T scanned from row. T must be a struct. T must have greater than or
+// equal number of named public fields as row has fields. The row and T fields will be matched by name. The match is
+// case-insensitive. The database column name can be overridden with a "db" struct tag. If the "db" struct tag is "-"
+// then the field will be ignored.
+func RowToAddrOfStructByNameLax[T any](row CollectableRow) (*T, error) {
+ var value T
+ err := (&namedStructRowScanner{ptrToStruct: &value, lax: true}).ScanRow(row)
+ return &value, err
+}
+
+type namedStructRowScanner struct {
+ ptrToStruct any
+ lax bool
+}
+
+func (rs *namedStructRowScanner) ScanRow(rows CollectableRow) error {
+ typ := reflect.TypeOf(rs.ptrToStruct).Elem()
+ fldDescs := rows.FieldDescriptions()
+ namedStructFields, err := lookupNamedStructFields(typ, fldDescs)
+ if err != nil {
+ return err
+ }
+ if !rs.lax && namedStructFields.missingField != "" {
+ return fmt.Errorf("cannot find field %s in returned row", namedStructFields.missingField)
+ }
+ fields := namedStructFields.fields
+ scanTargets := setupStructScanTargets(rs.ptrToStruct, fields)
+ return rows.Scan(scanTargets...)
+}
+
+// Map from namedStructFieldMap -> *namedStructFields
+var namedStructFieldMap sync.Map
+
+type namedStructFieldsKey struct {
+ t reflect.Type
+ colNames string
+}
+
+type namedStructFields struct {
+ fields []structRowField
+ // missingField is the first field from the struct without a corresponding row field.
+ // This is used to construct the correct error message for non-lax queries.
+ missingField string
+}
+
+func lookupNamedStructFields(
+ t reflect.Type,
+ fldDescs []pgconn.FieldDescription,
+) (*namedStructFields, error) {
+ key := namedStructFieldsKey{
+ t: t,
+ colNames: joinFieldNames(fldDescs),
+ }
+ if cached, ok := namedStructFieldMap.Load(key); ok {
+ return cached.(*namedStructFields), nil
+ }
+
+ // We could probably do two-levels of caching, where we compute the key -> fields mapping
+ // for a type only once, cache it by type, then use that to compute the column -> fields
+ // mapping for a given set of columns.
+ fieldStack := make([]int, 0, 1)
+ fields, missingField := computeNamedStructFields(
+ fldDescs,
+ t,
+ make([]structRowField, len(fldDescs)),
+ &fieldStack,
+ )
+ for i, f := range fields {
+ if f.path == nil {
+ return nil, fmt.Errorf(
+ "struct doesn't have corresponding row field %s",
+ fldDescs[i].Name,
+ )
+ }
+ }
+
+ fieldsIface, _ := namedStructFieldMap.LoadOrStore(
+ key,
+ &namedStructFields{fields: fields, missingField: missingField},
+ )
+ return fieldsIface.(*namedStructFields), nil
+}
+
+func joinFieldNames(fldDescs []pgconn.FieldDescription) string {
+ switch len(fldDescs) {
+ case 0:
+ return ""
+ case 1:
+ return fldDescs[0].Name
+ }
+
+ totalSize := len(fldDescs) - 1 // Space for separator bytes.
+ for _, d := range fldDescs {
+ totalSize += len(d.Name)
+ }
+ var b strings.Builder
+ b.Grow(totalSize)
+ b.WriteString(fldDescs[0].Name)
+ for _, d := range fldDescs[1:] {
+ b.WriteByte(0) // Join with NUL byte as it's (presumably) not a valid column character.
+ b.WriteString(d.Name)
+ }
+ return b.String()
+}
+
+func computeNamedStructFields(
+ fldDescs []pgconn.FieldDescription,
+ t reflect.Type,
+ fields []structRowField,
+ fieldStack *[]int,
+) ([]structRowField, string) {
+ var missingField string
+ tail := len(*fieldStack)
+ *fieldStack = append(*fieldStack, 0)
+ for i := 0; i < t.NumField(); i++ {
+ sf := t.Field(i)
+ (*fieldStack)[tail] = i
+ if sf.PkgPath != "" && !sf.Anonymous {
+ // Field is unexported, skip it.
+ continue
+ }
+ // Handle anonymous struct embedding, but do not try to handle embedded pointers.
+ if sf.Anonymous && sf.Type.Kind() == reflect.Struct {
+ var missingSubField string
+ fields, missingSubField = computeNamedStructFields(
+ fldDescs,
+ sf.Type,
+ fields,
+ fieldStack,
+ )
+ if missingField == "" {
+ missingField = missingSubField
+ }
+ } else {
+ dbTag, dbTagPresent := sf.Tag.Lookup(structTagKey)
+ if dbTagPresent {
+ dbTag, _, _ = strings.Cut(dbTag, ",")
+ }
+ if dbTag == "-" {
+ // Field is ignored, skip it.
+ continue
+ }
+ colName := dbTag
+ if !dbTagPresent {
+ colName = sf.Name
+ }
+ fpos := fieldPosByName(fldDescs, colName, !dbTagPresent)
+ if fpos == -1 {
+ if missingField == "" {
+ missingField = colName
+ }
+ continue
+ }
+ fields[fpos] = structRowField{
+ path: append([]int(nil), *fieldStack...),
+ }
+ }
+ }
+ *fieldStack = (*fieldStack)[:tail]
+
+ return fields, missingField
+}
+
+const structTagKey = "db"
+
+func fieldPosByName(fldDescs []pgconn.FieldDescription, field string, normalize bool) (i int) {
+ i = -1
+
+ if normalize {
+ field = strings.ReplaceAll(field, "_", "")
+ }
+ for i, desc := range fldDescs {
+ if normalize {
+ if strings.EqualFold(strings.ReplaceAll(desc.Name, "_", ""), field) {
+ return i
+ }
+ } else {
+ if desc.Name == field {
+ return i
+ }
+ }
+ }
+ return
+}
+
+// structRowField describes a field of a struct.
+//
+// TODO: It would be a bit more efficient to track the path using the pointer
+// offset within the (outermost) struct and use unsafe.Pointer arithmetic to
+// construct references when scanning rows. However, it's not clear it's worth
+// using unsafe for this.
+type structRowField struct {
+ path []int
+}
+
+func setupStructScanTargets(receiver any, fields []structRowField) []any {
+ scanTargets := make([]any, len(fields))
+ v := reflect.ValueOf(receiver).Elem()
+ for i, f := range fields {
+ scanTargets[i] = v.FieldByIndex(f.path).Addr().Interface()
+ }
+ return scanTargets
+}
diff --git a/vendor/github.com/jackc/pgx/v4/stdlib/sql.go b/vendor/github.com/jackc/pgx/v5/stdlib/sql.go
index 1c46e27..c1d00ab 100644
--- a/vendor/github.com/jackc/pgx/v4/stdlib/sql.go
+++ b/vendor/github.com/jackc/pgx/v5/stdlib/sql.go
@@ -4,48 +4,65 @@
//
// db, err := sql.Open("pgx", "postgres://pgx_md5:secret@localhost:5432/pgx_test?sslmode=disable")
// if err != nil {
-// return err
+// return err
// }
//
-// Or from a DSN string.
+// Or from a keyword/value string.
//
// db, err := sql.Open("pgx", "user=postgres password=secret host=localhost port=5432 database=pgx_test sslmode=disable")
// if err != nil {
-// return err
+// return err
// }
//
+// Or from a *pgxpool.Pool.
+//
+// pool, err := pgxpool.New(context.Background(), os.Getenv("DATABASE_URL"))
+// if err != nil {
+// return err
+// }
+//
+// db := stdlib.OpenDBFromPool(pool)
+//
// Or a pgx.ConnConfig can be used to set configuration not accessible via connection string. In this case the
// pgx.ConnConfig must first be registered with the driver. This registration returns a connection string which is used
// with sql.Open.
//
// connConfig, _ := pgx.ParseConfig(os.Getenv("DATABASE_URL"))
-// connConfig.Logger = myLogger
+// connConfig.Tracer = &tracelog.TraceLog{Logger: myLogger, LogLevel: tracelog.LogLevelInfo}
// connStr := stdlib.RegisterConnConfig(connConfig)
// db, _ := sql.Open("pgx", connStr)
//
-// pgx uses standard PostgreSQL positional parameters in queries. e.g. $1, $2.
-// It does not support named parameters.
+// pgx uses standard PostgreSQL positional parameters in queries. e.g. $1, $2. It does not support named parameters.
//
// db.QueryRow("select * from users where id=$1", userID)
//
-// In Go 1.13 and above (*sql.Conn) Raw() can be used to get a *pgx.Conn from the standard
-// database/sql.DB connection pool. This allows operations that use pgx specific functionality.
+// (*sql.Conn) Raw() can be used to get a *pgx.Conn from the standard database/sql.DB connection pool. This allows
+// operations that use pgx specific functionality.
//
// // Given db is a *sql.DB
// conn, err := db.Conn(context.Background())
// if err != nil {
-// // handle error from acquiring connection from DB pool
+// // handle error from acquiring connection from DB pool
// }
//
-// err = conn.Raw(func(driverConn interface{}) error {
-// conn := driverConn.(*stdlib.Conn).Conn() // conn is a *pgx.Conn
-// // Do pgx specific stuff with conn
-// conn.CopyFrom(...)
-// return nil
+// err = conn.Raw(func(driverConn any) error {
+// conn := driverConn.(*stdlib.Conn).Conn() // conn is a *pgx.Conn
+// // Do pgx specific stuff with conn
+// conn.CopyFrom(...)
+// return nil
// })
// if err != nil {
-// // handle error that occurred while using *pgx.Conn
+// // handle error that occurred while using *pgx.Conn
// }
+//
+// # PostgreSQL Specific Data Types
+//
+// The pgtype package provides support for PostgreSQL specific types. *pgtype.Map.SQLScanner is an adapter that makes
+// these types usable as a sql.Scanner.
+//
+// m := pgtype.NewMap()
+// var a []int64
+// err := db.QueryRow("select '{1,2,3}'::bigint[]").Scan(m.SQLScanner(&a))
package stdlib
import (
@@ -58,15 +75,16 @@ import (
"math"
"math/rand"
"reflect"
- "sort"
+ "slices"
"strconv"
"strings"
"sync"
"time"
- "github.com/jackc/pgconn"
- "github.com/jackc/pgtype"
- "github.com/jackc/pgx/v4"
+ "github.com/jackc/pgx/v5"
+ "github.com/jackc/pgx/v5/pgconn"
+ "github.com/jackc/pgx/v5/pgtype"
+ "github.com/jackc/pgx/v5/pgxpool"
)
// Only intrinsic types should be binary format with database/sql.
@@ -74,24 +92,17 @@ var databaseSQLResultFormats pgx.QueryResultFormatsByOID
var pgxDriver *Driver
-type ctxKey int
-
-var ctxKeyFakeTx ctxKey = 0
-
-var ErrNotPgx = errors.New("not pgx *sql.DB")
-
func init() {
pgxDriver = &Driver{
configs: make(map[string]*pgx.ConnConfig),
}
- fakeTxConns = make(map[*pgx.Conn]*sql.Tx)
- drivers := sql.Drivers()
- // if pgx driver was already registered by different pgx major version then we skip registration under the default name.
- if i := sort.SearchStrings(sql.Drivers(), "pgx"); len(drivers) >= i || drivers[i] != "pgx" {
+ // if pgx driver was already registered by different pgx major version then we
+ // skip registration under the default name.
+ if !slices.Contains(sql.Drivers(), "pgx") {
sql.Register("pgx", pgxDriver)
}
- sql.Register("pgx/v4", pgxDriver)
+ sql.Register("pgx/v5", pgxDriver)
databaseSQLResultFormats = pgx.QueryResultFormatsByOID{
pgtype.BoolOID: 1,
@@ -110,23 +121,18 @@ func init() {
}
}
-var (
- fakeTxMutex sync.Mutex
- fakeTxConns map[*pgx.Conn]*sql.Tx
-)
-
// OptionOpenDB options for configuring the driver when opening a new db pool.
type OptionOpenDB func(*connector)
// OptionBeforeConnect provides a callback for before connect. It is passed a shallow copy of the ConnConfig that will
-// be used to connect, so only its immediate members should be modified.
+// be used to connect, so only its immediate members should be modified. Used only if db is opened with *pgx.ConnConfig.
func OptionBeforeConnect(bc func(context.Context, *pgx.ConnConfig) error) OptionOpenDB {
return func(dc *connector) {
dc.BeforeConnect = bc
}
}
-// OptionAfterConnect provides a callback for after connect.
+// OptionAfterConnect provides a callback for after connect. Used only if db is opened with *pgx.ConnConfig.
func OptionAfterConnect(ac func(context.Context, *pgx.Conn) error) OptionOpenDB {
return func(dc *connector) {
dc.AfterConnect = ac
@@ -151,7 +157,7 @@ func RandomizeHostOrderFunc(ctx context.Context, connConfig *pgx.ConnConfig) err
return nil
}
- newFallbacks := append([]*pgconn.FallbackConfig{&pgconn.FallbackConfig{
+ newFallbacks := append([]*pgconn.FallbackConfig{{
Host: connConfig.Host,
Port: connConfig.Port,
TLSConfig: connConfig.TLSConfig,
@@ -185,13 +191,42 @@ func GetConnector(config pgx.ConnConfig, opts ...OptionOpenDB) driver.Connector
return c
}
+// GetPoolConnector creates a new driver.Connector from the given *pgxpool.Pool. By using this be sure to set the
+// maximum idle connections of the *sql.DB created with this connector to zero since they must be managed from the
+// *pgxpool.Pool. This is required to avoid acquiring all the connections from the pgxpool and starving any direct
+// users of the pgxpool.
+func GetPoolConnector(pool *pgxpool.Pool, opts ...OptionOpenDB) driver.Connector {
+ c := connector{
+ pool: pool,
+ ResetSession: func(context.Context, *pgx.Conn) error { return nil }, // noop reset session by default
+ driver: pgxDriver,
+ }
+
+ for _, opt := range opts {
+ opt(&c)
+ }
+
+ return c
+}
+
func OpenDB(config pgx.ConnConfig, opts ...OptionOpenDB) *sql.DB {
c := GetConnector(config, opts...)
return sql.OpenDB(c)
}
+// OpenDBFromPool creates a new *sql.DB from the given *pgxpool.Pool. Note that this method automatically sets the
+// maximum number of idle connections in *sql.DB to zero, since they must be managed from the *pgxpool.Pool. This is
+// required to avoid acquiring all the connections from the pgxpool and starving any direct users of the pgxpool.
+func OpenDBFromPool(pool *pgxpool.Pool, opts ...OptionOpenDB) *sql.DB {
+ c := GetPoolConnector(pool, opts...)
+ db := sql.OpenDB(c)
+ db.SetMaxIdleConns(0)
+ return db
+}
+
type connector struct {
pgx.ConnConfig
+ pool *pgxpool.Pool
BeforeConnect func(context.Context, *pgx.ConnConfig) error // function to call before creation of every new connection
AfterConnect func(context.Context, *pgx.Conn) error // function to call after creation of every new connection
ResetSession func(context.Context, *pgx.Conn) error // function is called before a connection is reused
@@ -201,25 +236,53 @@ type connector struct {
// Connect implement driver.Connector interface
func (c connector) Connect(ctx context.Context) (driver.Conn, error) {
var (
- err error
- conn *pgx.Conn
+ connConfig pgx.ConnConfig
+ conn *pgx.Conn
+ close func(context.Context) error
+ err error
)
- // Create a shallow copy of the config, so that BeforeConnect can safely modify it
- connConfig := c.ConnConfig
- if err = c.BeforeConnect(ctx, &connConfig); err != nil {
- return nil, err
- }
+ if c.pool == nil {
+ // Create a shallow copy of the config, so that BeforeConnect can safely modify it
+ connConfig = c.ConnConfig
- if conn, err = pgx.ConnectConfig(ctx, &connConfig); err != nil {
- return nil, err
- }
+ if err = c.BeforeConnect(ctx, &connConfig); err != nil {
+ return nil, err
+ }
- if err = c.AfterConnect(ctx, conn); err != nil {
- return nil, err
+ if conn, err = pgx.ConnectConfig(ctx, &connConfig); err != nil {
+ return nil, err
+ }
+
+ if err = c.AfterConnect(ctx, conn); err != nil {
+ return nil, err
+ }
+
+ close = conn.Close
+ } else {
+ var pconn *pgxpool.Conn
+
+ pconn, err = c.pool.Acquire(ctx)
+ if err != nil {
+ return nil, err
+ }
+
+ conn = pconn.Conn()
+
+ close = func(_ context.Context) error {
+ pconn.Release()
+ return nil
+ }
}
- return &Conn{conn: conn, driver: c.driver, connConfig: connConfig, resetSessionFunc: c.ResetSession}, nil
+ return &Conn{
+ conn: conn,
+ close: close,
+ driver: c.driver,
+ connConfig: connConfig,
+ resetSessionFunc: c.ResetSession,
+ psRefCounts: make(map[*pgconn.StatementDescription]int),
+ }, nil
}
// Driver implement driver.Connector interface
@@ -296,9 +359,11 @@ func (dc *driverConnector) Connect(ctx context.Context) (driver.Conn, error) {
c := &Conn{
conn: conn,
+ close: conn.Close,
driver: dc.driver,
connConfig: *connConfig,
resetSessionFunc: func(context.Context, *pgx.Conn) error { return nil },
+ psRefCounts: make(map[*pgconn.StatementDescription]int),
}
return c, nil
@@ -319,11 +384,20 @@ func UnregisterConnConfig(connStr string) {
}
type Conn struct {
- conn *pgx.Conn
- psCount int64 // Counter used for creating unique prepared statement names
- driver *Driver
- connConfig pgx.ConnConfig
- resetSessionFunc func(context.Context, *pgx.Conn) error // Function is called before a connection is reused
+ conn *pgx.Conn
+ close func(context.Context) error
+ driver *Driver
+ connConfig pgx.ConnConfig
+ resetSessionFunc func(context.Context, *pgx.Conn) error // Function is called before a connection is reused
+ lastResetSessionTime time.Time
+
+ // psRefCounts contains reference counts for prepared statements. Prepare uses the underlying pgx logic to generate
+ // deterministic statement names from the statement text. If this query has already been prepared then the existing
+ // *pgconn.StatementDescription will be returned. However, this means that if Close is called on the returned Stmt
+ // then the underlying prepared statement will be closed even when the underlying prepared statement is still in use
+ // by another database/sql Stmt. To prevent this psRefCounts keeps track of how many database/sql statements are using
+ // the same underlying statement and only closes the underlying statement when the reference count reaches 0.
+ psRefCounts map[*pgconn.StatementDescription]int
}
// Conn returns the underlying *pgx.Conn
@@ -340,13 +414,11 @@ func (c *Conn) PrepareContext(ctx context.Context, query string) (driver.Stmt, e
return nil, driver.ErrBadConn
}
- name := fmt.Sprintf("pgx_%d", c.psCount)
- c.psCount++
-
- sd, err := c.conn.Prepare(ctx, name, query)
+ sd, err := c.conn.Prepare(ctx, query, query)
if err != nil {
return nil, err
}
+ c.psRefCounts[sd]++
return &Stmt{sd: sd, conn: c}, nil
}
@@ -354,7 +426,7 @@ func (c *Conn) PrepareContext(ctx context.Context, query string) (driver.Stmt, e
func (c *Conn) Close() error {
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
defer cancel()
- return c.conn.Close(ctx)
+ return c.close(ctx)
}
func (c *Conn) Begin() (driver.Tx, error) {
@@ -366,11 +438,6 @@ func (c *Conn) BeginTx(ctx context.Context, opts driver.TxOptions) (driver.Tx, e
return nil, driver.ErrBadConn
}
- if pconn, ok := ctx.Value(ctxKeyFakeTx).(**pgx.Conn); ok {
- *pconn = c.conn
- return fakeTx{}, nil
- }
-
var pgxOpts pgx.TxOptions
switch sql.IsolationLevel(opts.Isolation) {
case sql.LevelDefault:
@@ -420,7 +487,7 @@ func (c *Conn) QueryContext(ctx context.Context, query string, argsV []driver.Na
return nil, driver.ErrBadConn
}
- args := []interface{}{databaseSQLResultFormats}
+ args := []any{databaseSQLResultFormats}
args = append(args, namedValueToInterface(argsV)...)
rows, err := c.conn.Query(ctx, query, args...)
@@ -466,6 +533,14 @@ func (c *Conn) ResetSession(ctx context.Context) error {
return driver.ErrBadConn
}
+ now := time.Now()
+ if now.Sub(c.lastResetSessionTime) > time.Second {
+ if err := c.conn.PgConn().Ping(ctx); err != nil {
+ return driver.ErrBadConn
+ }
+ }
+ c.lastResetSessionTime = now
+
return c.resetSessionFunc(ctx, c.conn)
}
@@ -477,7 +552,16 @@ type Stmt struct {
func (s *Stmt) Close() error {
ctx, cancel := context.WithTimeout(context.Background(), time.Second*5)
defer cancel()
- return s.conn.conn.Deallocate(ctx, s.sd.Name)
+
+ refCount := s.conn.psRefCounts[s.sd]
+ if refCount == 1 {
+ delete(s.conn.psRefCounts, s.sd)
+ } else {
+ s.conn.psRefCounts[s.sd]--
+ return nil
+ }
+
+ return s.conn.conn.Deallocate(ctx, s.sd.SQL)
}
func (s *Stmt) NumInput() int {
@@ -489,7 +573,7 @@ func (s *Stmt) Exec(argsV []driver.Value) (driver.Result, error) {
}
func (s *Stmt) ExecContext(ctx context.Context, argsV []driver.NamedValue) (driver.Result, error) {
- return s.conn.ExecContext(ctx, s.sd.Name, argsV)
+ return s.conn.ExecContext(ctx, s.sd.SQL, argsV)
}
func (s *Stmt) Query(argsV []driver.Value) (driver.Rows, error) {
@@ -497,7 +581,7 @@ func (s *Stmt) Query(argsV []driver.Value) (driver.Rows, error) {
}
func (s *Stmt) QueryContext(ctx context.Context, argsV []driver.NamedValue) (driver.Rows, error) {
- return s.conn.QueryContext(ctx, s.sd.Name, argsV)
+ return s.conn.QueryContext(ctx, s.sd.SQL, argsV)
}
type rowValueFunc func(src []byte) (driver.Value, error)
@@ -526,7 +610,7 @@ func (r *Rows) Columns() []string {
// ColumnTypeDatabaseTypeName returns the database system type name. If the name is unknown the OID is returned.
func (r *Rows) ColumnTypeDatabaseTypeName(index int) string {
- if dt, ok := r.conn.conn.ConnInfo().DataTypeForOID(r.rows.FieldDescriptions()[index].DataTypeOID); ok {
+ if dt, ok := r.conn.conn.TypeMap().TypeForOID(r.rows.FieldDescriptions()[index].DataTypeOID); ok {
return strings.ToUpper(dt.Name)
}
@@ -601,7 +685,7 @@ func (r *Rows) Close() error {
}
func (r *Rows) Next(dest []driver.Value) error {
- ci := r.conn.conn.ConnInfo()
+ m := r.conn.conn.TypeMap()
fieldDescriptions := r.rows.FieldDescriptions()
if r.valueFuncs == nil {
@@ -614,23 +698,23 @@ func (r *Rows) Next(dest []driver.Value) error {
switch fd.DataTypeOID {
case pgtype.BoolOID:
var d bool
- scanPlan := ci.PlanScan(dataTypeOID, format, &d)
+ scanPlan := m.PlanScan(dataTypeOID, format, &d)
r.valueFuncs[i] = func(src []byte) (driver.Value, error) {
- err := scanPlan.Scan(ci, dataTypeOID, format, src, &d)
+ err := scanPlan.Scan(src, &d)
return d, err
}
case pgtype.ByteaOID:
var d []byte
- scanPlan := ci.PlanScan(dataTypeOID, format, &d)
+ scanPlan := m.PlanScan(dataTypeOID, format, &d)
r.valueFuncs[i] = func(src []byte) (driver.Value, error) {
- err := scanPlan.Scan(ci, dataTypeOID, format, src, &d)
+ err := scanPlan.Scan(src, &d)
return d, err
}
- case pgtype.CIDOID:
- var d pgtype.CID
- scanPlan := ci.PlanScan(dataTypeOID, format, &d)
+ case pgtype.CIDOID, pgtype.OIDOID, pgtype.XIDOID:
+ var d pgtype.Uint32
+ scanPlan := m.PlanScan(dataTypeOID, format, &d)
r.valueFuncs[i] = func(src []byte) (driver.Value, error) {
- err := scanPlan.Scan(ci, dataTypeOID, format, src, &d)
+ err := scanPlan.Scan(src, &d)
if err != nil {
return nil, err
}
@@ -638,9 +722,9 @@ func (r *Rows) Next(dest []driver.Value) error {
}
case pgtype.DateOID:
var d pgtype.Date
- scanPlan := ci.PlanScan(dataTypeOID, format, &d)
+ scanPlan := m.PlanScan(dataTypeOID, format, &d)
r.valueFuncs[i] = func(src []byte) (driver.Value, error) {
- err := scanPlan.Scan(ci, dataTypeOID, format, src, &d)
+ err := scanPlan.Scan(src, &d)
if err != nil {
return nil, err
}
@@ -648,74 +732,54 @@ func (r *Rows) Next(dest []driver.Value) error {
}
case pgtype.Float4OID:
var d float32
- scanPlan := ci.PlanScan(dataTypeOID, format, &d)
+ scanPlan := m.PlanScan(dataTypeOID, format, &d)
r.valueFuncs[i] = func(src []byte) (driver.Value, error) {
- err := scanPlan.Scan(ci, dataTypeOID, format, src, &d)
+ err := scanPlan.Scan(src, &d)
return float64(d), err
}
case pgtype.Float8OID:
var d float64
- scanPlan := ci.PlanScan(dataTypeOID, format, &d)
+ scanPlan := m.PlanScan(dataTypeOID, format, &d)
r.valueFuncs[i] = func(src []byte) (driver.Value, error) {
- err := scanPlan.Scan(ci, dataTypeOID, format, src, &d)
+ err := scanPlan.Scan(src, &d)
return d, err
}
case pgtype.Int2OID:
var d int16
- scanPlan := ci.PlanScan(dataTypeOID, format, &d)
+ scanPlan := m.PlanScan(dataTypeOID, format, &d)
r.valueFuncs[i] = func(src []byte) (driver.Value, error) {
- err := scanPlan.Scan(ci, dataTypeOID, format, src, &d)
+ err := scanPlan.Scan(src, &d)
return int64(d), err
}
case pgtype.Int4OID:
var d int32
- scanPlan := ci.PlanScan(dataTypeOID, format, &d)
+ scanPlan := m.PlanScan(dataTypeOID, format, &d)
r.valueFuncs[i] = func(src []byte) (driver.Value, error) {
- err := scanPlan.Scan(ci, dataTypeOID, format, src, &d)
+ err := scanPlan.Scan(src, &d)
return int64(d), err
}
case pgtype.Int8OID:
var d int64
- scanPlan := ci.PlanScan(dataTypeOID, format, &d)
+ scanPlan := m.PlanScan(dataTypeOID, format, &d)
r.valueFuncs[i] = func(src []byte) (driver.Value, error) {
- err := scanPlan.Scan(ci, dataTypeOID, format, src, &d)
+ err := scanPlan.Scan(src, &d)
return d, err
}
- case pgtype.JSONOID:
- var d pgtype.JSON
- scanPlan := ci.PlanScan(dataTypeOID, format, &d)
- r.valueFuncs[i] = func(src []byte) (driver.Value, error) {
- err := scanPlan.Scan(ci, dataTypeOID, format, src, &d)
- if err != nil {
- return nil, err
- }
- return d.Value()
- }
- case pgtype.JSONBOID:
- var d pgtype.JSONB
- scanPlan := ci.PlanScan(dataTypeOID, format, &d)
+ case pgtype.JSONOID, pgtype.JSONBOID:
+ var d []byte
+ scanPlan := m.PlanScan(dataTypeOID, format, &d)
r.valueFuncs[i] = func(src []byte) (driver.Value, error) {
- err := scanPlan.Scan(ci, dataTypeOID, format, src, &d)
+ err := scanPlan.Scan(src, &d)
if err != nil {
return nil, err
}
- return d.Value()
- }
- case pgtype.OIDOID:
- var d pgtype.OIDValue
- scanPlan := ci.PlanScan(dataTypeOID, format, &d)
- r.valueFuncs[i] = func(src []byte) (driver.Value, error) {
- err := scanPlan.Scan(ci, dataTypeOID, format, src, &d)
- if err != nil {
- return nil, err
- }
- return d.Value()
+ return d, nil
}
case pgtype.TimestampOID:
var d pgtype.Timestamp
- scanPlan := ci.PlanScan(dataTypeOID, format, &d)
+ scanPlan := m.PlanScan(dataTypeOID, format, &d)
r.valueFuncs[i] = func(src []byte) (driver.Value, error) {
- err := scanPlan.Scan(ci, dataTypeOID, format, src, &d)
+ err := scanPlan.Scan(src, &d)
if err != nil {
return nil, err
}
@@ -723,29 +787,29 @@ func (r *Rows) Next(dest []driver.Value) error {
}
case pgtype.TimestamptzOID:
var d pgtype.Timestamptz
- scanPlan := ci.PlanScan(dataTypeOID, format, &d)
+ scanPlan := m.PlanScan(dataTypeOID, format, &d)
r.valueFuncs[i] = func(src []byte) (driver.Value, error) {
- err := scanPlan.Scan(ci, dataTypeOID, format, src, &d)
+ err := scanPlan.Scan(src, &d)
if err != nil {
return nil, err
}
return d.Value()
}
- case pgtype.XIDOID:
- var d pgtype.XID
- scanPlan := ci.PlanScan(dataTypeOID, format, &d)
+ case pgtype.XMLOID:
+ var d []byte
+ scanPlan := m.PlanScan(dataTypeOID, format, &d)
r.valueFuncs[i] = func(src []byte) (driver.Value, error) {
- err := scanPlan.Scan(ci, dataTypeOID, format, src, &d)
+ err := scanPlan.Scan(src, &d)
if err != nil {
return nil, err
}
- return d.Value()
+ return d, nil
}
default:
var d string
- scanPlan := ci.PlanScan(dataTypeOID, format, &d)
+ scanPlan := m.PlanScan(dataTypeOID, format, &d)
r.valueFuncs[i] = func(src []byte) (driver.Value, error) {
- err := scanPlan.Scan(ci, dataTypeOID, format, src, &d)
+ err := scanPlan.Scan(src, &d)
return d, err
}
}
@@ -773,7 +837,7 @@ func (r *Rows) Next(dest []driver.Value) error {
var err error
dest[i], err = r.valueFuncs[i](rv)
if err != nil {
- return fmt.Errorf("convert field %d failed: %v", i, err)
+ return fmt.Errorf("convert field %d failed: %w", i, err)
}
} else {
dest[i] = nil
@@ -783,11 +847,11 @@ func (r *Rows) Next(dest []driver.Value) error {
return nil
}
-func valueToInterface(argsV []driver.Value) []interface{} {
- args := make([]interface{}, 0, len(argsV))
+func valueToInterface(argsV []driver.Value) []any {
+ args := make([]any, 0, len(argsV))
for _, v := range argsV {
if v != nil {
- args = append(args, v.(interface{}))
+ args = append(args, v.(any))
} else {
args = append(args, nil)
}
@@ -795,11 +859,11 @@ func valueToInterface(argsV []driver.Value) []interface{} {
return args
}
-func namedValueToInterface(argsV []driver.NamedValue) []interface{} {
- args := make([]interface{}, 0, len(argsV))
+func namedValueToInterface(argsV []driver.NamedValue) []any {
+ args := make([]any, 0, len(argsV))
for _, v := range argsV {
if v.Value != nil {
- args = append(args, v.Value.(interface{}))
+ args = append(args, v.Value.(any))
} else {
args = append(args, nil)
}
@@ -815,55 +879,3 @@ type wrapTx struct {
func (wtx wrapTx) Commit() error { return wtx.tx.Commit(wtx.ctx) }
func (wtx wrapTx) Rollback() error { return wtx.tx.Rollback(wtx.ctx) }
-
-type fakeTx struct{}
-
-func (fakeTx) Commit() error { return nil }
-
-func (fakeTx) Rollback() error { return nil }
-
-// AcquireConn acquires a *pgx.Conn from database/sql connection pool. It must be released with ReleaseConn.
-//
-// In Go 1.13 this functionality has been incorporated into the standard library in the db.Conn.Raw() method.
-func AcquireConn(db *sql.DB) (*pgx.Conn, error) {
- var conn *pgx.Conn
- ctx := context.WithValue(context.Background(), ctxKeyFakeTx, &conn)
- tx, err := db.BeginTx(ctx, nil)
- if err != nil {
- return nil, err
- }
- if conn == nil {
- tx.Rollback()
- return nil, ErrNotPgx
- }
-
- fakeTxMutex.Lock()
- fakeTxConns[conn] = tx
- fakeTxMutex.Unlock()
-
- return conn, nil
-}
-
-// ReleaseConn releases a *pgx.Conn acquired with AcquireConn.
-func ReleaseConn(db *sql.DB, conn *pgx.Conn) error {
- var tx *sql.Tx
- var ok bool
-
- if conn.PgConn().IsBusy() || conn.PgConn().TxStatus() != 'I' {
- ctx, cancel := context.WithTimeout(context.Background(), time.Second)
- defer cancel()
- conn.Close(ctx)
- }
-
- fakeTxMutex.Lock()
- tx, ok = fakeTxConns[conn]
- if ok {
- delete(fakeTxConns, conn)
- fakeTxMutex.Unlock()
- } else {
- fakeTxMutex.Unlock()
- return fmt.Errorf("can't release conn that is not acquired")
- }
-
- return tx.Rollback()
-}
diff --git a/vendor/github.com/jackc/pgx/v5/tracer.go b/vendor/github.com/jackc/pgx/v5/tracer.go
new file mode 100644
index 0000000..58ca99f
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/tracer.go
@@ -0,0 +1,107 @@
+package pgx
+
+import (
+ "context"
+
+ "github.com/jackc/pgx/v5/pgconn"
+)
+
+// QueryTracer traces Query, QueryRow, and Exec.
+type QueryTracer interface {
+ // TraceQueryStart is called at the beginning of Query, QueryRow, and Exec calls. The returned context is used for the
+ // rest of the call and will be passed to TraceQueryEnd.
+ TraceQueryStart(ctx context.Context, conn *Conn, data TraceQueryStartData) context.Context
+
+ TraceQueryEnd(ctx context.Context, conn *Conn, data TraceQueryEndData)
+}
+
+type TraceQueryStartData struct {
+ SQL string
+ Args []any
+}
+
+type TraceQueryEndData struct {
+ CommandTag pgconn.CommandTag
+ Err error
+}
+
+// BatchTracer traces SendBatch.
+type BatchTracer interface {
+ // TraceBatchStart is called at the beginning of SendBatch calls. The returned context is used for the
+ // rest of the call and will be passed to TraceBatchQuery and TraceBatchEnd.
+ TraceBatchStart(ctx context.Context, conn *Conn, data TraceBatchStartData) context.Context
+
+ TraceBatchQuery(ctx context.Context, conn *Conn, data TraceBatchQueryData)
+ TraceBatchEnd(ctx context.Context, conn *Conn, data TraceBatchEndData)
+}
+
+type TraceBatchStartData struct {
+ Batch *Batch
+}
+
+type TraceBatchQueryData struct {
+ SQL string
+ Args []any
+ CommandTag pgconn.CommandTag
+ Err error
+}
+
+type TraceBatchEndData struct {
+ Err error
+}
+
+// CopyFromTracer traces CopyFrom.
+type CopyFromTracer interface {
+ // TraceCopyFromStart is called at the beginning of CopyFrom calls. The returned context is used for the
+ // rest of the call and will be passed to TraceCopyFromEnd.
+ TraceCopyFromStart(ctx context.Context, conn *Conn, data TraceCopyFromStartData) context.Context
+
+ TraceCopyFromEnd(ctx context.Context, conn *Conn, data TraceCopyFromEndData)
+}
+
+type TraceCopyFromStartData struct {
+ TableName Identifier
+ ColumnNames []string
+}
+
+type TraceCopyFromEndData struct {
+ CommandTag pgconn.CommandTag
+ Err error
+}
+
+// PrepareTracer traces Prepare.
+type PrepareTracer interface {
+ // TracePrepareStart is called at the beginning of Prepare calls. The returned context is used for the
+ // rest of the call and will be passed to TracePrepareEnd.
+ TracePrepareStart(ctx context.Context, conn *Conn, data TracePrepareStartData) context.Context
+
+ TracePrepareEnd(ctx context.Context, conn *Conn, data TracePrepareEndData)
+}
+
+type TracePrepareStartData struct {
+ Name string
+ SQL string
+}
+
+type TracePrepareEndData struct {
+ AlreadyPrepared bool
+ Err error
+}
+
+// ConnectTracer traces Connect and ConnectConfig.
+type ConnectTracer interface {
+ // TraceConnectStart is called at the beginning of Connect and ConnectConfig calls. The returned context is used for
+ // the rest of the call and will be passed to TraceConnectEnd.
+ TraceConnectStart(ctx context.Context, data TraceConnectStartData) context.Context
+
+ TraceConnectEnd(ctx context.Context, data TraceConnectEndData)
+}
+
+type TraceConnectStartData struct {
+ ConnConfig *ConnConfig
+}
+
+type TraceConnectEndData struct {
+ Conn *Conn
+ Err error
+}
diff --git a/vendor/github.com/jackc/pgx/v4/tx.go b/vendor/github.com/jackc/pgx/v5/tx.go
index 2914ada..168d7ba 100644
--- a/vendor/github.com/jackc/pgx/v4/tx.go
+++ b/vendor/github.com/jackc/pgx/v5/tx.go
@@ -1,13 +1,13 @@
package pgx
import (
- "bytes"
"context"
"errors"
"fmt"
"strconv"
+ "strings"
- "github.com/jackc/pgconn"
+ "github.com/jackc/pgx/v5/pgconn"
)
// TxIsoLevel is the transaction isolation level (serializable, repeatable read, read committed or read uncommitted)
@@ -44,6 +44,12 @@ type TxOptions struct {
IsoLevel TxIsoLevel
AccessMode TxAccessMode
DeferrableMode TxDeferrableMode
+
+ // BeginQuery is the SQL query that will be executed to begin the transaction. This allows using non-standard syntax
+ // such as BEGIN PRIORITY HIGH with CockroachDB. If set this will override the other settings.
+ BeginQuery string
+ // CommitQuery is the SQL query that will be executed to commit the transaction.
+ CommitQuery string
}
var emptyTxOptions TxOptions
@@ -52,16 +58,26 @@ func (txOptions TxOptions) beginSQL() string {
if txOptions == emptyTxOptions {
return "begin"
}
- buf := &bytes.Buffer{}
+
+ if txOptions.BeginQuery != "" {
+ return txOptions.BeginQuery
+ }
+
+ var buf strings.Builder
+ buf.Grow(64) // 64 - maximum length of string with available options
buf.WriteString("begin")
+
if txOptions.IsoLevel != "" {
- fmt.Fprintf(buf, " isolation level %s", txOptions.IsoLevel)
+ buf.WriteString(" isolation level ")
+ buf.WriteString(string(txOptions.IsoLevel))
}
if txOptions.AccessMode != "" {
- fmt.Fprintf(buf, " %s", txOptions.AccessMode)
+ buf.WriteByte(' ')
+ buf.WriteString(string(txOptions.AccessMode))
}
if txOptions.DeferrableMode != "" {
- fmt.Fprintf(buf, " %s", txOptions.DeferrableMode)
+ buf.WriteByte(' ')
+ buf.WriteString(string(txOptions.DeferrableMode))
}
return buf.String()
@@ -91,40 +107,10 @@ func (c *Conn) BeginTx(ctx context.Context, txOptions TxOptions) (Tx, error) {
return nil, err
}
- return &dbTx{conn: c}, nil
-}
-
-// BeginFunc starts a transaction and calls f. If f does not return an error the transaction is committed. If f returns
-// an error the transaction is rolled back. The context will be used when executing the transaction control statements
-// (BEGIN, ROLLBACK, and COMMIT) but does not otherwise affect the execution of f.
-func (c *Conn) BeginFunc(ctx context.Context, f func(Tx) error) (err error) {
- return c.BeginTxFunc(ctx, TxOptions{}, f)
-}
-
-// BeginTxFunc starts a transaction with txOptions determining the transaction mode and calls f. If f does not return
-// an error the transaction is committed. If f returns an error the transaction is rolled back. The context will be
-// used when executing the transaction control statements (BEGIN, ROLLBACK, and COMMIT) but does not otherwise affect
-// the execution of f.
-func (c *Conn) BeginTxFunc(ctx context.Context, txOptions TxOptions, f func(Tx) error) (err error) {
- var tx Tx
- tx, err = c.BeginTx(ctx, txOptions)
- if err != nil {
- return err
- }
- defer func() {
- rollbackErr := tx.Rollback(ctx)
- if rollbackErr != nil && !errors.Is(rollbackErr, ErrTxClosed) {
- err = rollbackErr
- }
- }()
-
- fErr := f(tx)
- if fErr != nil {
- _ = tx.Rollback(ctx) // ignore rollback error as there is already an error to return
- return fErr
- }
-
- return tx.Commit(ctx)
+ return &dbTx{
+ conn: c,
+ commitQuery: txOptions.CommitQuery,
+ }, nil
}
// Tx represents a database transaction.
@@ -138,20 +124,17 @@ type Tx interface {
// Begin starts a pseudo nested transaction.
Begin(ctx context.Context) (Tx, error)
- // BeginFunc starts a pseudo nested transaction and executes f. If f does not return an err the pseudo nested
- // transaction will be committed. If it does then it will be rolled back.
- BeginFunc(ctx context.Context, f func(Tx) error) (err error)
-
// Commit commits the transaction if this is a real transaction or releases the savepoint if this is a pseudo nested
- // transaction. Commit will return ErrTxClosed if the Tx is already closed, but is otherwise safe to call multiple
- // times. If the commit fails with a rollback status (e.g. the transaction was already in a broken state) then
- // ErrTxCommitRollback will be returned.
+ // transaction. Commit will return an error where errors.Is(ErrTxClosed) is true if the Tx is already closed, but is
+ // otherwise safe to call multiple times. If the commit fails with a rollback status (e.g. the transaction was already
+ // in a broken state) then an error where errors.Is(ErrTxCommitRollback) is true will be returned.
Commit(ctx context.Context) error
// Rollback rolls back the transaction if this is a real transaction or rolls back to the savepoint if this is a
- // pseudo nested transaction. Rollback will return ErrTxClosed if the Tx is already closed, but is otherwise safe to
- // call multiple times. Hence, a defer tx.Rollback() is safe even if tx.Commit() will be called first in a non-error
- // condition. Any other failure of a real transaction will result in the connection being closed.
+ // pseudo nested transaction. Rollback will return an error where errors.Is(ErrTxClosed) is true if the Tx is already
+ // closed, but is otherwise safe to call multiple times. Hence, a defer tx.Rollback() is safe even if tx.Commit() will
+ // be called first in a non-error condition. Any other failure of a real transaction will result in the connection
+ // being closed.
Rollback(ctx context.Context) error
CopyFrom(ctx context.Context, tableName Identifier, columnNames []string, rowSrc CopyFromSource) (int64, error)
@@ -160,10 +143,9 @@ type Tx interface {
Prepare(ctx context.Context, name, sql string) (*pgconn.StatementDescription, error)
- Exec(ctx context.Context, sql string, arguments ...interface{}) (commandTag pgconn.CommandTag, err error)
- Query(ctx context.Context, sql string, args ...interface{}) (Rows, error)
- QueryRow(ctx context.Context, sql string, args ...interface{}) Row
- QueryFunc(ctx context.Context, sql string, args []interface{}, scans []interface{}, f func(QueryFuncRow) error) (pgconn.CommandTag, error)
+ Exec(ctx context.Context, sql string, arguments ...any) (commandTag pgconn.CommandTag, err error)
+ Query(ctx context.Context, sql string, args ...any) (Rows, error)
+ QueryRow(ctx context.Context, sql string, args ...any) Row
// Conn returns the underlying *Conn that on which this transaction is executing.
Conn() *Conn
@@ -175,9 +157,9 @@ type Tx interface {
// called on the dbTx.
type dbTx struct {
conn *Conn
- err error
savepointNum int64
closed bool
+ commitQuery string
}
// Begin starts a pseudo nested transaction implemented with a savepoint.
@@ -195,39 +177,18 @@ func (tx *dbTx) Begin(ctx context.Context) (Tx, error) {
return &dbSimulatedNestedTx{tx: tx, savepointNum: tx.savepointNum}, nil
}
-func (tx *dbTx) BeginFunc(ctx context.Context, f func(Tx) error) (err error) {
- if tx.closed {
- return ErrTxClosed
- }
-
- var savepoint Tx
- savepoint, err = tx.Begin(ctx)
- if err != nil {
- return err
- }
- defer func() {
- rollbackErr := savepoint.Rollback(ctx)
- if rollbackErr != nil && !errors.Is(rollbackErr, ErrTxClosed) {
- err = rollbackErr
- }
- }()
-
- fErr := f(savepoint)
- if fErr != nil {
- _ = savepoint.Rollback(ctx) // ignore rollback error as there is already an error to return
- return fErr
- }
-
- return savepoint.Commit(ctx)
-}
-
// Commit commits the transaction.
func (tx *dbTx) Commit(ctx context.Context) error {
if tx.closed {
return ErrTxClosed
}
- commandTag, err := tx.conn.Exec(ctx, "commit")
+ commandSQL := "commit"
+ if tx.commitQuery != "" {
+ commandSQL = tx.commitQuery
+ }
+
+ commandTag, err := tx.conn.Exec(ctx, commandSQL)
tx.closed = true
if err != nil {
if tx.conn.PgConn().TxStatus() != 'I' {
@@ -235,7 +196,7 @@ func (tx *dbTx) Commit(ctx context.Context) error {
}
return err
}
- if string(commandTag) == "ROLLBACK" {
+ if commandTag.String() == "ROLLBACK" {
return ErrTxCommitRollback
}
@@ -263,7 +224,11 @@ func (tx *dbTx) Rollback(ctx context.Context) error {
}
// Exec delegates to the underlying *Conn
-func (tx *dbTx) Exec(ctx context.Context, sql string, arguments ...interface{}) (commandTag pgconn.CommandTag, err error) {
+func (tx *dbTx) Exec(ctx context.Context, sql string, arguments ...any) (commandTag pgconn.CommandTag, err error) {
+ if tx.closed {
+ return pgconn.CommandTag{}, ErrTxClosed
+ }
+
return tx.conn.Exec(ctx, sql, arguments...)
}
@@ -277,29 +242,20 @@ func (tx *dbTx) Prepare(ctx context.Context, name, sql string) (*pgconn.Statemen
}
// Query delegates to the underlying *Conn
-func (tx *dbTx) Query(ctx context.Context, sql string, args ...interface{}) (Rows, error) {
+func (tx *dbTx) Query(ctx context.Context, sql string, args ...any) (Rows, error) {
if tx.closed {
// Because checking for errors can be deferred to the *Rows, build one with the error
err := ErrTxClosed
- return &connRows{closed: true, err: err}, err
+ return &baseRows{closed: true, err: err}, err
}
return tx.conn.Query(ctx, sql, args...)
}
// QueryRow delegates to the underlying *Conn
-func (tx *dbTx) QueryRow(ctx context.Context, sql string, args ...interface{}) Row {
+func (tx *dbTx) QueryRow(ctx context.Context, sql string, args ...any) Row {
rows, _ := tx.Query(ctx, sql, args...)
- return (*connRow)(rows.(*connRows))
-}
-
-// QueryFunc delegates to the underlying *Conn.
-func (tx *dbTx) QueryFunc(ctx context.Context, sql string, args []interface{}, scans []interface{}, f func(QueryFuncRow) error) (pgconn.CommandTag, error) {
- if tx.closed {
- return nil, ErrTxClosed
- }
-
- return tx.conn.QueryFunc(ctx, sql, args, scans, f)
+ return (*connRow)(rows.(*baseRows))
}
// CopyFrom delegates to the underlying *Conn
@@ -345,14 +301,6 @@ func (sp *dbSimulatedNestedTx) Begin(ctx context.Context) (Tx, error) {
return sp.tx.Begin(ctx)
}
-func (sp *dbSimulatedNestedTx) BeginFunc(ctx context.Context, f func(Tx) error) (err error) {
- if sp.closed {
- return ErrTxClosed
- }
-
- return sp.tx.BeginFunc(ctx, f)
-}
-
// Commit releases the savepoint essentially committing the pseudo nested transaction.
func (sp *dbSimulatedNestedTx) Commit(ctx context.Context) error {
if sp.closed {
@@ -378,9 +326,9 @@ func (sp *dbSimulatedNestedTx) Rollback(ctx context.Context) error {
}
// Exec delegates to the underlying Tx
-func (sp *dbSimulatedNestedTx) Exec(ctx context.Context, sql string, arguments ...interface{}) (commandTag pgconn.CommandTag, err error) {
+func (sp *dbSimulatedNestedTx) Exec(ctx context.Context, sql string, arguments ...any) (commandTag pgconn.CommandTag, err error) {
if sp.closed {
- return nil, ErrTxClosed
+ return pgconn.CommandTag{}, ErrTxClosed
}
return sp.tx.Exec(ctx, sql, arguments...)
@@ -396,29 +344,20 @@ func (sp *dbSimulatedNestedTx) Prepare(ctx context.Context, name, sql string) (*
}
// Query delegates to the underlying Tx
-func (sp *dbSimulatedNestedTx) Query(ctx context.Context, sql string, args ...interface{}) (Rows, error) {
+func (sp *dbSimulatedNestedTx) Query(ctx context.Context, sql string, args ...any) (Rows, error) {
if sp.closed {
// Because checking for errors can be deferred to the *Rows, build one with the error
err := ErrTxClosed
- return &connRows{closed: true, err: err}, err
+ return &baseRows{closed: true, err: err}, err
}
return sp.tx.Query(ctx, sql, args...)
}
// QueryRow delegates to the underlying Tx
-func (sp *dbSimulatedNestedTx) QueryRow(ctx context.Context, sql string, args ...interface{}) Row {
+func (sp *dbSimulatedNestedTx) QueryRow(ctx context.Context, sql string, args ...any) Row {
rows, _ := sp.Query(ctx, sql, args...)
- return (*connRow)(rows.(*connRows))
-}
-
-// QueryFunc delegates to the underlying Tx.
-func (sp *dbSimulatedNestedTx) QueryFunc(ctx context.Context, sql string, args []interface{}, scans []interface{}, f func(QueryFuncRow) error) (pgconn.CommandTag, error) {
- if sp.closed {
- return nil, ErrTxClosed
- }
-
- return sp.tx.QueryFunc(ctx, sql, args, scans, f)
+ return (*connRow)(rows.(*baseRows))
}
// CopyFrom delegates to the underlying *Conn
@@ -446,3 +385,59 @@ func (sp *dbSimulatedNestedTx) LargeObjects() LargeObjects {
func (sp *dbSimulatedNestedTx) Conn() *Conn {
return sp.tx.Conn()
}
+
+// BeginFunc calls Begin on db and then calls fn. If fn does not return an error then it calls Commit on db. If fn
+// returns an error it calls Rollback on db. The context will be used when executing the transaction control statements
+// (BEGIN, ROLLBACK, and COMMIT) but does not otherwise affect the execution of fn.
+func BeginFunc(
+ ctx context.Context,
+ db interface {
+ Begin(ctx context.Context) (Tx, error)
+ },
+ fn func(Tx) error,
+) (err error) {
+ var tx Tx
+ tx, err = db.Begin(ctx)
+ if err != nil {
+ return err
+ }
+
+ return beginFuncExec(ctx, tx, fn)
+}
+
+// BeginTxFunc calls BeginTx on db and then calls fn. If fn does not return an error then it calls Commit on db. If fn
+// returns an error it calls Rollback on db. The context will be used when executing the transaction control statements
+// (BEGIN, ROLLBACK, and COMMIT) but does not otherwise affect the execution of fn.
+func BeginTxFunc(
+ ctx context.Context,
+ db interface {
+ BeginTx(ctx context.Context, txOptions TxOptions) (Tx, error)
+ },
+ txOptions TxOptions,
+ fn func(Tx) error,
+) (err error) {
+ var tx Tx
+ tx, err = db.BeginTx(ctx, txOptions)
+ if err != nil {
+ return err
+ }
+
+ return beginFuncExec(ctx, tx, fn)
+}
+
+func beginFuncExec(ctx context.Context, tx Tx, fn func(Tx) error) (err error) {
+ defer func() {
+ rollbackErr := tx.Rollback(ctx)
+ if rollbackErr != nil && !errors.Is(rollbackErr, ErrTxClosed) {
+ err = rollbackErr
+ }
+ }()
+
+ fErr := fn(tx)
+ if fErr != nil {
+ _ = tx.Rollback(ctx) // ignore rollback error as there is already an error to return
+ return fErr
+ }
+
+ return tx.Commit(ctx)
+}
diff --git a/vendor/github.com/jackc/pgx/v5/values.go b/vendor/github.com/jackc/pgx/v5/values.go
new file mode 100644
index 0000000..6e2ff30
--- /dev/null
+++ b/vendor/github.com/jackc/pgx/v5/values.go
@@ -0,0 +1,63 @@
+package pgx
+
+import (
+ "errors"
+
+ "github.com/jackc/pgx/v5/internal/pgio"
+ "github.com/jackc/pgx/v5/pgtype"
+)
+
+// PostgreSQL format codes
+const (
+ TextFormatCode = 0
+ BinaryFormatCode = 1
+)
+
+func convertSimpleArgument(m *pgtype.Map, arg any) (any, error) {
+ buf, err := m.Encode(0, TextFormatCode, arg, []byte{})
+ if err != nil {
+ return nil, err
+ }
+ if buf == nil {
+ return nil, nil
+ }
+ return string(buf), nil
+}
+
+func encodeCopyValue(m *pgtype.Map, buf []byte, oid uint32, arg any) ([]byte, error) {
+ sp := len(buf)
+ buf = pgio.AppendInt32(buf, -1)
+ argBuf, err := m.Encode(oid, BinaryFormatCode, arg, buf)
+ if err != nil {
+ if argBuf2, err2 := tryScanStringCopyValueThenEncode(m, buf, oid, arg); err2 == nil {
+ argBuf = argBuf2
+ } else {
+ return nil, err
+ }
+ }
+
+ if argBuf != nil {
+ buf = argBuf
+ pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4))
+ }
+ return buf, nil
+}
+
+func tryScanStringCopyValueThenEncode(m *pgtype.Map, buf []byte, oid uint32, arg any) ([]byte, error) {
+ s, ok := arg.(string)
+ if !ok {
+ textBuf, err := m.Encode(oid, TextFormatCode, arg, nil)
+ if err != nil {
+ return nil, errors.New("not a string and cannot be encoded as text")
+ }
+ s = string(textBuf)
+ }
+
+ var v any
+ err := m.Scan(oid, TextFormatCode, []byte(s), &v)
+ if err != nil {
+ return nil, err
+ }
+
+ return m.Encode(oid, BinaryFormatCode, v, buf)
+}
diff --git a/vendor/github.com/jackc/puddle/v2/CHANGELOG.md b/vendor/github.com/jackc/puddle/v2/CHANGELOG.md
new file mode 100644
index 0000000..d0d202c
--- /dev/null
+++ b/vendor/github.com/jackc/puddle/v2/CHANGELOG.md
@@ -0,0 +1,79 @@
+# 2.2.2 (September 10, 2024)
+
+* Add empty acquire time to stats (Maxim Ivanov)
+* Stop importing nanotime from runtime via linkname (maypok86)
+
+# 2.2.1 (July 15, 2023)
+
+* Fix: CreateResource cannot overflow pool. This changes documented behavior of CreateResource. Previously,
+ CreateResource could create a resource even if the pool was full. This could cause the pool to overflow. While this
+ was documented, it was documenting incorrect behavior. CreateResource now returns an error if the pool is full.
+
+# 2.2.0 (February 11, 2023)
+
+* Use Go 1.19 atomics and drop go.uber.org/atomic dependency
+
+# 2.1.2 (November 12, 2022)
+
+* Restore support to Go 1.18 via go.uber.org/atomic
+
+# 2.1.1 (November 11, 2022)
+
+* Fix create resource concurrently with Stat call race
+
+# 2.1.0 (October 28, 2022)
+
+* Concurrency control is now implemented with a semaphore. This simplifies some internal logic, resolves a few error conditions (including a deadlock), and improves performance. (Jan Dubsky)
+* Go 1.19 is now required for the improved atomic support.
+
+# 2.0.1 (October 28, 2022)
+
+* Fix race condition when Close is called concurrently with multiple constructors
+
+# 2.0.0 (September 17, 2022)
+
+* Use generics instead of interface{} (Столяров Владимир Алексеевич)
+* Add Reset
+* Do not cancel resource construction when Acquire is canceled
+* NewPool takes Config
+
+# 1.3.0 (August 27, 2022)
+
+* Acquire creates resources in background to allow creation to continue after Acquire is canceled (James Hartig)
+
+# 1.2.1 (December 2, 2021)
+
+* TryAcquire now does not block when background constructing resource
+
+# 1.2.0 (November 20, 2021)
+
+* Add TryAcquire (A. Jensen)
+* Fix: remove memory leak / unintentionally pinned memory when shrinking slices (Alexander Staubo)
+* Fix: Do not leave pool locked after panic from nil context
+
+# 1.1.4 (September 11, 2021)
+
+* Fix: Deadlock in CreateResource if pool was closed during resource acquisition (Dmitriy Matrenichev)
+
+# 1.1.3 (December 3, 2020)
+
+* Fix: Failed resource creation could cause concurrent Acquire to hang. (Evgeny Vanslov)
+
+# 1.1.2 (September 26, 2020)
+
+* Fix: Resource.Destroy no longer removes itself from the pool before its destructor has completed.
+* Fix: Prevent crash when pool is closed while resource is being created.
+
+# 1.1.1 (April 2, 2020)
+
+* Pool.Close can be safely called multiple times
+* AcquireAllIDle immediately returns nil if pool is closed
+* CreateResource checks if pool is closed before taking any action
+* Fix potential race condition when CreateResource and Close are called concurrently. CreateResource now checks if pool is closed before adding newly created resource to pool.
+
+# 1.1.0 (February 5, 2020)
+
+* Use runtime.nanotime for faster tracking of acquire time and last usage time.
+* Track resource idle time to enable client health check logic. (Patrick Ellul)
+* Add CreateResource to construct a new resource without acquiring it. (Patrick Ellul)
+* Fix deadlock race when acquire is cancelled. (Michael Tharp)
diff --git a/vendor/github.com/jackc/chunkreader/v2/LICENSE b/vendor/github.com/jackc/puddle/v2/LICENSE
index c1c4f50..bcc286c 100644
--- a/vendor/github.com/jackc/chunkreader/v2/LICENSE
+++ b/vendor/github.com/jackc/puddle/v2/LICENSE
@@ -1,4 +1,4 @@
-Copyright (c) 2019 Jack Christensen
+Copyright (c) 2018 Jack Christensen
MIT License
diff --git a/vendor/github.com/jackc/puddle/v2/README.md b/vendor/github.com/jackc/puddle/v2/README.md
new file mode 100644
index 0000000..fa82a9d
--- /dev/null
+++ b/vendor/github.com/jackc/puddle/v2/README.md
@@ -0,0 +1,80 @@
+[![Go Reference](https://pkg.go.dev/badge/github.com/jackc/puddle/v2.svg)](https://pkg.go.dev/github.com/jackc/puddle/v2)
+![Build Status](https://github.com/jackc/puddle/actions/workflows/ci.yml/badge.svg)
+
+# Puddle
+
+Puddle is a tiny generic resource pool library for Go that uses the standard
+context library to signal cancellation of acquires. It is designed to contain
+the minimum functionality required for a resource pool. It can be used directly
+or it can be used as the base for a domain specific resource pool. For example,
+a database connection pool may use puddle internally and implement health checks
+and keep-alive behavior without needing to implement any concurrent code of its
+own.
+
+## Features
+
+* Acquire cancellation via context standard library
+* Statistics API for monitoring pool pressure
+* No dependencies outside of standard library and golang.org/x/sync
+* High performance
+* 100% test coverage of reachable code
+
+## Example Usage
+
+```go
+package main
+
+import (
+ "context"
+ "log"
+ "net"
+
+ "github.com/jackc/puddle/v2"
+)
+
+func main() {
+ constructor := func(context.Context) (net.Conn, error) {
+ return net.Dial("tcp", "127.0.0.1:8080")
+ }
+ destructor := func(value net.Conn) {
+ value.Close()
+ }
+ maxPoolSize := int32(10)
+
+ pool, err := puddle.NewPool(&puddle.Config[net.Conn]{Constructor: constructor, Destructor: destructor, MaxSize: maxPoolSize})
+ if err != nil {
+ log.Fatal(err)
+ }
+
+ // Acquire resource from the pool.
+ res, err := pool.Acquire(context.Background())
+ if err != nil {
+ log.Fatal(err)
+ }
+
+ // Use resource.
+ _, err = res.Value().Write([]byte{1})
+ if err != nil {
+ log.Fatal(err)
+ }
+
+ // Release when done.
+ res.Release()
+}
+```
+
+## Status
+
+Puddle is stable and feature complete.
+
+* Bug reports and fixes are welcome.
+* New features will usually not be accepted if they can be feasibly implemented in a wrapper.
+* Performance optimizations will usually not be accepted unless the performance issue rises to the level of a bug.
+
+## Supported Go Versions
+
+puddle supports the same versions of Go that are supported by the Go project. For [Go](https://golang.org/doc/devel/release.html#policy) that is the two most recent major releases. This means puddle supports Go 1.19 and higher.
+
+## License
+
+MIT
diff --git a/vendor/github.com/jackc/puddle/v2/context.go b/vendor/github.com/jackc/puddle/v2/context.go
new file mode 100644
index 0000000..e19d2a6
--- /dev/null
+++ b/vendor/github.com/jackc/puddle/v2/context.go
@@ -0,0 +1,24 @@
+package puddle
+
+import (
+ "context"
+ "time"
+)
+
+// valueCancelCtx combines two contexts into one. One context is used for values and the other is used for cancellation.
+type valueCancelCtx struct {
+ valueCtx context.Context
+ cancelCtx context.Context
+}
+
+func (ctx *valueCancelCtx) Deadline() (time.Time, bool) { return ctx.cancelCtx.Deadline() }
+func (ctx *valueCancelCtx) Done() <-chan struct{} { return ctx.cancelCtx.Done() }
+func (ctx *valueCancelCtx) Err() error { return ctx.cancelCtx.Err() }
+func (ctx *valueCancelCtx) Value(key any) any { return ctx.valueCtx.Value(key) }
+
+func newValueCancelCtx(valueCtx, cancelContext context.Context) context.Context {
+ return &valueCancelCtx{
+ valueCtx: valueCtx,
+ cancelCtx: cancelContext,
+ }
+}
diff --git a/vendor/github.com/jackc/puddle/v2/doc.go b/vendor/github.com/jackc/puddle/v2/doc.go
new file mode 100644
index 0000000..818e4a6
--- /dev/null
+++ b/vendor/github.com/jackc/puddle/v2/doc.go
@@ -0,0 +1,11 @@
+// Package puddle is a generic resource pool with type-parametrized api.
+/*
+
+Puddle is a tiny generic resource pool library for Go that uses the standard
+context library to signal cancellation of acquires. It is designed to contain
+the minimum functionality a resource pool needs that cannot be implemented
+without concurrency concerns. For example, a database connection pool may use
+puddle internally and implement health checks and keep-alive behavior without
+needing to implement any concurrent code of its own.
+*/
+package puddle
diff --git a/vendor/github.com/jackc/puddle/v2/internal/genstack/gen_stack.go b/vendor/github.com/jackc/puddle/v2/internal/genstack/gen_stack.go
new file mode 100644
index 0000000..7e4660c
--- /dev/null
+++ b/vendor/github.com/jackc/puddle/v2/internal/genstack/gen_stack.go
@@ -0,0 +1,85 @@
+package genstack
+
+// GenStack implements a generational stack.
+//
+// GenStack works as common stack except for the fact that all elements in the
+// older generation are guaranteed to be popped before any element in the newer
+// generation. New elements are always pushed to the current (newest)
+// generation.
+//
+// We could also say that GenStack behaves as a stack in case of a single
+// generation, but it behaves as a queue of individual generation stacks.
+type GenStack[T any] struct {
+ // We can represent arbitrary number of generations using 2 stacks. The
+ // new stack stores all new pushes and the old stack serves all reads.
+ // Old stack can represent multiple generations. If old == new, then all
+ // elements pushed in previous (not current) generations have already
+ // been popped.
+
+ old *stack[T]
+ new *stack[T]
+}
+
+// NewGenStack creates a new empty GenStack.
+func NewGenStack[T any]() *GenStack[T] {
+ s := &stack[T]{}
+ return &GenStack[T]{
+ old: s,
+ new: s,
+ }
+}
+
+func (s *GenStack[T]) Pop() (T, bool) {
+ // Pushes always append to the new stack, so if the old once becomes
+ // empty, it will remail empty forever.
+ if s.old.len() == 0 && s.old != s.new {
+ s.old = s.new
+ }
+
+ if s.old.len() == 0 {
+ var zero T
+ return zero, false
+ }
+
+ return s.old.pop(), true
+}
+
+// Push pushes a new element at the top of the stack.
+func (s *GenStack[T]) Push(v T) { s.new.push(v) }
+
+// NextGen starts a new stack generation.
+func (s *GenStack[T]) NextGen() {
+ if s.old == s.new {
+ s.new = &stack[T]{}
+ return
+ }
+
+ // We need to pop from the old stack to the top of the new stack. Let's
+ // have an example:
+ //
+ // Old: <bottom> 4 3 2 1
+ // New: <bottom> 8 7 6 5
+ // PopOrder: 1 2 3 4 5 6 7 8
+ //
+ //
+ // To preserve pop order, we have to take all elements from the old
+ // stack and push them to the top of new stack:
+ //
+ // New: 8 7 6 5 4 3 2 1
+ //
+ s.new.push(s.old.takeAll()...)
+
+ // We have the old stack allocated and empty, so why not to reuse it as
+ // new new stack.
+ s.old, s.new = s.new, s.old
+}
+
+// Len returns number of elements in the stack.
+func (s *GenStack[T]) Len() int {
+ l := s.old.len()
+ if s.old != s.new {
+ l += s.new.len()
+ }
+
+ return l
+}
diff --git a/vendor/github.com/jackc/puddle/v2/internal/genstack/stack.go b/vendor/github.com/jackc/puddle/v2/internal/genstack/stack.go
new file mode 100644
index 0000000..dbced0c
--- /dev/null
+++ b/vendor/github.com/jackc/puddle/v2/internal/genstack/stack.go
@@ -0,0 +1,39 @@
+package genstack
+
+// stack is a wrapper around an array implementing a stack.
+//
+// We cannot use slice to represent the stack because append might change the
+// pointer value of the slice. That would be an issue in GenStack
+// implementation.
+type stack[T any] struct {
+ arr []T
+}
+
+// push pushes a new element at the top of a stack.
+func (s *stack[T]) push(vs ...T) { s.arr = append(s.arr, vs...) }
+
+// pop pops the stack top-most element.
+//
+// If stack length is zero, this method panics.
+func (s *stack[T]) pop() T {
+ idx := s.len() - 1
+ val := s.arr[idx]
+
+ // Avoid memory leak
+ var zero T
+ s.arr[idx] = zero
+
+ s.arr = s.arr[:idx]
+ return val
+}
+
+// takeAll returns all elements in the stack in order as they are stored - i.e.
+// the top-most stack element is the last one.
+func (s *stack[T]) takeAll() []T {
+ arr := s.arr
+ s.arr = nil
+ return arr
+}
+
+// len returns number of elements in the stack.
+func (s *stack[T]) len() int { return len(s.arr) }
diff --git a/vendor/github.com/jackc/puddle/v2/log.go b/vendor/github.com/jackc/puddle/v2/log.go
new file mode 100644
index 0000000..b21b946
--- /dev/null
+++ b/vendor/github.com/jackc/puddle/v2/log.go
@@ -0,0 +1,32 @@
+package puddle
+
+import "unsafe"
+
+type ints interface {
+ int | int8 | int16 | int32 | int64 | uint | uint8 | uint16 | uint32 | uint64
+}
+
+// log2Int returns log2 of an integer. This function panics if val < 0. For val
+// == 0, returns 0.
+func log2Int[T ints](val T) uint8 {
+ if val <= 0 {
+ panic("log2 of non-positive number does not exist")
+ }
+
+ return log2IntRange(val, 0, uint8(8*unsafe.Sizeof(val)))
+}
+
+func log2IntRange[T ints](val T, begin, end uint8) uint8 {
+ length := end - begin
+ if length == 1 {
+ return begin
+ }
+
+ delim := begin + length/2
+ mask := T(1) << delim
+ if mask > val {
+ return log2IntRange(val, begin, delim)
+ } else {
+ return log2IntRange(val, delim, end)
+ }
+}
diff --git a/vendor/github.com/jackc/puddle/v2/nanotime.go b/vendor/github.com/jackc/puddle/v2/nanotime.go
new file mode 100644
index 0000000..8a5351a
--- /dev/null
+++ b/vendor/github.com/jackc/puddle/v2/nanotime.go
@@ -0,0 +1,16 @@
+package puddle
+
+import "time"
+
+// nanotime returns the time in nanoseconds since process start.
+//
+// This approach, described at
+// https://github.com/golang/go/issues/61765#issuecomment-1672090302,
+// is fast, monotonic, and portable, and avoids the previous
+// dependence on runtime.nanotime using the (unsafe) linkname hack.
+// In particular, time.Since does less work than time.Now.
+func nanotime() int64 {
+ return time.Since(globalStart).Nanoseconds()
+}
+
+var globalStart = time.Now()
diff --git a/vendor/github.com/jackc/puddle/v2/pool.go b/vendor/github.com/jackc/puddle/v2/pool.go
new file mode 100644
index 0000000..c411d2f
--- /dev/null
+++ b/vendor/github.com/jackc/puddle/v2/pool.go
@@ -0,0 +1,710 @@
+package puddle
+
+import (
+ "context"
+ "errors"
+ "sync"
+ "sync/atomic"
+ "time"
+
+ "github.com/jackc/puddle/v2/internal/genstack"
+ "golang.org/x/sync/semaphore"
+)
+
+const (
+ resourceStatusConstructing = 0
+ resourceStatusIdle = iota
+ resourceStatusAcquired = iota
+ resourceStatusHijacked = iota
+)
+
+// ErrClosedPool occurs on an attempt to acquire a connection from a closed pool
+// or a pool that is closed while the acquire is waiting.
+var ErrClosedPool = errors.New("closed pool")
+
+// ErrNotAvailable occurs on an attempt to acquire a resource from a pool
+// that is at maximum capacity and has no available resources.
+var ErrNotAvailable = errors.New("resource not available")
+
+// Constructor is a function called by the pool to construct a resource.
+type Constructor[T any] func(ctx context.Context) (res T, err error)
+
+// Destructor is a function called by the pool to destroy a resource.
+type Destructor[T any] func(res T)
+
+// Resource is the resource handle returned by acquiring from the pool.
+type Resource[T any] struct {
+ value T
+ pool *Pool[T]
+ creationTime time.Time
+ lastUsedNano int64
+ poolResetCount int
+ status byte
+}
+
+// Value returns the resource value.
+func (res *Resource[T]) Value() T {
+ if !(res.status == resourceStatusAcquired || res.status == resourceStatusHijacked) {
+ panic("tried to access resource that is not acquired or hijacked")
+ }
+ return res.value
+}
+
+// Release returns the resource to the pool. res must not be subsequently used.
+func (res *Resource[T]) Release() {
+ if res.status != resourceStatusAcquired {
+ panic("tried to release resource that is not acquired")
+ }
+ res.pool.releaseAcquiredResource(res, nanotime())
+}
+
+// ReleaseUnused returns the resource to the pool without updating when it was last used used. i.e. LastUsedNanotime
+// will not change. res must not be subsequently used.
+func (res *Resource[T]) ReleaseUnused() {
+ if res.status != resourceStatusAcquired {
+ panic("tried to release resource that is not acquired")
+ }
+ res.pool.releaseAcquiredResource(res, res.lastUsedNano)
+}
+
+// Destroy returns the resource to the pool for destruction. res must not be
+// subsequently used.
+func (res *Resource[T]) Destroy() {
+ if res.status != resourceStatusAcquired {
+ panic("tried to destroy resource that is not acquired")
+ }
+ go res.pool.destroyAcquiredResource(res)
+}
+
+// Hijack assumes ownership of the resource from the pool. Caller is responsible
+// for cleanup of resource value.
+func (res *Resource[T]) Hijack() {
+ if res.status != resourceStatusAcquired {
+ panic("tried to hijack resource that is not acquired")
+ }
+ res.pool.hijackAcquiredResource(res)
+}
+
+// CreationTime returns when the resource was created by the pool.
+func (res *Resource[T]) CreationTime() time.Time {
+ if !(res.status == resourceStatusAcquired || res.status == resourceStatusHijacked) {
+ panic("tried to access resource that is not acquired or hijacked")
+ }
+ return res.creationTime
+}
+
+// LastUsedNanotime returns when Release was last called on the resource measured in nanoseconds from an arbitrary time
+// (a monotonic time). Returns creation time if Release has never been called. This is only useful to compare with
+// other calls to LastUsedNanotime. In almost all cases, IdleDuration should be used instead.
+func (res *Resource[T]) LastUsedNanotime() int64 {
+ if !(res.status == resourceStatusAcquired || res.status == resourceStatusHijacked) {
+ panic("tried to access resource that is not acquired or hijacked")
+ }
+
+ return res.lastUsedNano
+}
+
+// IdleDuration returns the duration since Release was last called on the resource. This is equivalent to subtracting
+// LastUsedNanotime to the current nanotime.
+func (res *Resource[T]) IdleDuration() time.Duration {
+ if !(res.status == resourceStatusAcquired || res.status == resourceStatusHijacked) {
+ panic("tried to access resource that is not acquired or hijacked")
+ }
+
+ return time.Duration(nanotime() - res.lastUsedNano)
+}
+
+// Pool is a concurrency-safe resource pool.
+type Pool[T any] struct {
+ // mux is the pool internal lock. Any modification of shared state of
+ // the pool (but Acquires of acquireSem) must be performed only by
+ // holder of the lock. Long running operations are not allowed when mux
+ // is held.
+ mux sync.Mutex
+ // acquireSem provides an allowance to acquire a resource.
+ //
+ // Releases are allowed only when caller holds mux. Acquires have to
+ // happen before mux is locked (doesn't apply to semaphore.TryAcquire in
+ // AcquireAllIdle).
+ acquireSem *semaphore.Weighted
+ destructWG sync.WaitGroup
+
+ allResources resList[T]
+ idleResources *genstack.GenStack[*Resource[T]]
+
+ constructor Constructor[T]
+ destructor Destructor[T]
+ maxSize int32
+
+ acquireCount int64
+ acquireDuration time.Duration
+ emptyAcquireCount int64
+ emptyAcquireWaitTime time.Duration
+ canceledAcquireCount atomic.Int64
+
+ resetCount int
+
+ baseAcquireCtx context.Context
+ cancelBaseAcquireCtx context.CancelFunc
+ closed bool
+}
+
+type Config[T any] struct {
+ Constructor Constructor[T]
+ Destructor Destructor[T]
+ MaxSize int32
+}
+
+// NewPool creates a new pool. Returns an error iff MaxSize is less than 1.
+func NewPool[T any](config *Config[T]) (*Pool[T], error) {
+ if config.MaxSize < 1 {
+ return nil, errors.New("MaxSize must be >= 1")
+ }
+
+ baseAcquireCtx, cancelBaseAcquireCtx := context.WithCancel(context.Background())
+
+ return &Pool[T]{
+ acquireSem: semaphore.NewWeighted(int64(config.MaxSize)),
+ idleResources: genstack.NewGenStack[*Resource[T]](),
+ maxSize: config.MaxSize,
+ constructor: config.Constructor,
+ destructor: config.Destructor,
+ baseAcquireCtx: baseAcquireCtx,
+ cancelBaseAcquireCtx: cancelBaseAcquireCtx,
+ }, nil
+}
+
+// Close destroys all resources in the pool and rejects future Acquire calls.
+// Blocks until all resources are returned to pool and destroyed.
+func (p *Pool[T]) Close() {
+ defer p.destructWG.Wait()
+
+ p.mux.Lock()
+ defer p.mux.Unlock()
+
+ if p.closed {
+ return
+ }
+ p.closed = true
+ p.cancelBaseAcquireCtx()
+
+ for res, ok := p.idleResources.Pop(); ok; res, ok = p.idleResources.Pop() {
+ p.allResources.remove(res)
+ go p.destructResourceValue(res.value)
+ }
+}
+
+// Stat is a snapshot of Pool statistics.
+type Stat struct {
+ constructingResources int32
+ acquiredResources int32
+ idleResources int32
+ maxResources int32
+ acquireCount int64
+ acquireDuration time.Duration
+ emptyAcquireCount int64
+ emptyAcquireWaitTime time.Duration
+ canceledAcquireCount int64
+}
+
+// TotalResources returns the total number of resources currently in the pool.
+// The value is the sum of ConstructingResources, AcquiredResources, and
+// IdleResources.
+func (s *Stat) TotalResources() int32 {
+ return s.constructingResources + s.acquiredResources + s.idleResources
+}
+
+// ConstructingResources returns the number of resources with construction in progress in
+// the pool.
+func (s *Stat) ConstructingResources() int32 {
+ return s.constructingResources
+}
+
+// AcquiredResources returns the number of currently acquired resources in the pool.
+func (s *Stat) AcquiredResources() int32 {
+ return s.acquiredResources
+}
+
+// IdleResources returns the number of currently idle resources in the pool.
+func (s *Stat) IdleResources() int32 {
+ return s.idleResources
+}
+
+// MaxResources returns the maximum size of the pool.
+func (s *Stat) MaxResources() int32 {
+ return s.maxResources
+}
+
+// AcquireCount returns the cumulative count of successful acquires from the pool.
+func (s *Stat) AcquireCount() int64 {
+ return s.acquireCount
+}
+
+// AcquireDuration returns the total duration of all successful acquires from
+// the pool.
+func (s *Stat) AcquireDuration() time.Duration {
+ return s.acquireDuration
+}
+
+// EmptyAcquireCount returns the cumulative count of successful acquires from the pool
+// that waited for a resource to be released or constructed because the pool was
+// empty.
+func (s *Stat) EmptyAcquireCount() int64 {
+ return s.emptyAcquireCount
+}
+
+// EmptyAcquireWaitTime returns the cumulative time waited for successful acquires
+// from the pool for a resource to be released or constructed because the pool was
+// empty.
+func (s *Stat) EmptyAcquireWaitTime() time.Duration {
+ return s.emptyAcquireWaitTime
+}
+
+// CanceledAcquireCount returns the cumulative count of acquires from the pool
+// that were canceled by a context.
+func (s *Stat) CanceledAcquireCount() int64 {
+ return s.canceledAcquireCount
+}
+
+// Stat returns the current pool statistics.
+func (p *Pool[T]) Stat() *Stat {
+ p.mux.Lock()
+ defer p.mux.Unlock()
+
+ s := &Stat{
+ maxResources: p.maxSize,
+ acquireCount: p.acquireCount,
+ emptyAcquireCount: p.emptyAcquireCount,
+ emptyAcquireWaitTime: p.emptyAcquireWaitTime,
+ canceledAcquireCount: p.canceledAcquireCount.Load(),
+ acquireDuration: p.acquireDuration,
+ }
+
+ for _, res := range p.allResources {
+ switch res.status {
+ case resourceStatusConstructing:
+ s.constructingResources += 1
+ case resourceStatusIdle:
+ s.idleResources += 1
+ case resourceStatusAcquired:
+ s.acquiredResources += 1
+ }
+ }
+
+ return s
+}
+
+// tryAcquireIdleResource checks if there is any idle resource. If there is
+// some, this method removes it from idle list and returns it. If the idle pool
+// is empty, this method returns nil and doesn't modify the idleResources slice.
+//
+// WARNING: Caller of this method must hold the pool mutex!
+func (p *Pool[T]) tryAcquireIdleResource() *Resource[T] {
+ res, ok := p.idleResources.Pop()
+ if !ok {
+ return nil
+ }
+
+ res.status = resourceStatusAcquired
+ return res
+}
+
+// createNewResource creates a new resource and inserts it into list of pool
+// resources.
+//
+// WARNING: Caller of this method must hold the pool mutex!
+func (p *Pool[T]) createNewResource() *Resource[T] {
+ res := &Resource[T]{
+ pool: p,
+ creationTime: time.Now(),
+ lastUsedNano: nanotime(),
+ poolResetCount: p.resetCount,
+ status: resourceStatusConstructing,
+ }
+
+ p.allResources.append(res)
+ p.destructWG.Add(1)
+
+ return res
+}
+
+// Acquire gets a resource from the pool. If no resources are available and the pool is not at maximum capacity it will
+// create a new resource. If the pool is at maximum capacity it will block until a resource is available. ctx can be
+// used to cancel the Acquire.
+//
+// If Acquire creates a new resource the resource constructor function will receive a context that delegates Value() to
+// ctx. Canceling ctx will cause Acquire to return immediately but it will not cancel the resource creation. This avoids
+// the problem of it being impossible to create resources when the time to create a resource is greater than any one
+// caller of Acquire is willing to wait.
+func (p *Pool[T]) Acquire(ctx context.Context) (_ *Resource[T], err error) {
+ select {
+ case <-ctx.Done():
+ p.canceledAcquireCount.Add(1)
+ return nil, ctx.Err()
+ default:
+ }
+
+ return p.acquire(ctx)
+}
+
+// acquire is a continuation of Acquire function that doesn't check context
+// validity.
+//
+// This function exists solely only for benchmarking purposes.
+func (p *Pool[T]) acquire(ctx context.Context) (*Resource[T], error) {
+ startNano := nanotime()
+
+ var waitedForLock bool
+ if !p.acquireSem.TryAcquire(1) {
+ waitedForLock = true
+ err := p.acquireSem.Acquire(ctx, 1)
+ if err != nil {
+ p.canceledAcquireCount.Add(1)
+ return nil, err
+ }
+ }
+
+ p.mux.Lock()
+ if p.closed {
+ p.acquireSem.Release(1)
+ p.mux.Unlock()
+ return nil, ErrClosedPool
+ }
+
+ // If a resource is available in the pool.
+ if res := p.tryAcquireIdleResource(); res != nil {
+ waitTime := time.Duration(nanotime() - startNano)
+ if waitedForLock {
+ p.emptyAcquireCount += 1
+ p.emptyAcquireWaitTime += waitTime
+ }
+ p.acquireCount += 1
+ p.acquireDuration += waitTime
+ p.mux.Unlock()
+ return res, nil
+ }
+
+ if len(p.allResources) >= int(p.maxSize) {
+ // Unreachable code.
+ panic("bug: semaphore allowed more acquires than pool allows")
+ }
+
+ // The resource is not idle, but there is enough space to create one.
+ res := p.createNewResource()
+ p.mux.Unlock()
+
+ res, err := p.initResourceValue(ctx, res)
+ if err != nil {
+ return nil, err
+ }
+
+ p.mux.Lock()
+ defer p.mux.Unlock()
+
+ p.emptyAcquireCount += 1
+ p.acquireCount += 1
+ waitTime := time.Duration(nanotime() - startNano)
+ p.acquireDuration += waitTime
+ p.emptyAcquireWaitTime += waitTime
+
+ return res, nil
+}
+
+func (p *Pool[T]) initResourceValue(ctx context.Context, res *Resource[T]) (*Resource[T], error) {
+ // Create the resource in a goroutine to immediately return from Acquire
+ // if ctx is canceled without also canceling the constructor.
+ //
+ // See:
+ // - https://github.com/jackc/pgx/issues/1287
+ // - https://github.com/jackc/pgx/issues/1259
+ constructErrChan := make(chan error)
+ go func() {
+ constructorCtx := newValueCancelCtx(ctx, p.baseAcquireCtx)
+ value, err := p.constructor(constructorCtx)
+ if err != nil {
+ p.mux.Lock()
+ p.allResources.remove(res)
+ p.destructWG.Done()
+
+ // The resource won't be acquired because its
+ // construction failed. We have to allow someone else to
+ // take that resouce.
+ p.acquireSem.Release(1)
+ p.mux.Unlock()
+
+ select {
+ case constructErrChan <- err:
+ case <-ctx.Done():
+ // The caller is cancelled, so no-one awaits the
+ // error. This branch avoid goroutine leak.
+ }
+ return
+ }
+
+ // The resource is already in p.allResources where it might be read. So we need to acquire the lock to update its
+ // status.
+ p.mux.Lock()
+ res.value = value
+ res.status = resourceStatusAcquired
+ p.mux.Unlock()
+
+ // This select works because the channel is unbuffered.
+ select {
+ case constructErrChan <- nil:
+ case <-ctx.Done():
+ p.releaseAcquiredResource(res, res.lastUsedNano)
+ }
+ }()
+
+ select {
+ case <-ctx.Done():
+ p.canceledAcquireCount.Add(1)
+ return nil, ctx.Err()
+ case err := <-constructErrChan:
+ if err != nil {
+ return nil, err
+ }
+ return res, nil
+ }
+}
+
+// TryAcquire gets a resource from the pool if one is immediately available. If not, it returns ErrNotAvailable. If no
+// resources are available but the pool has room to grow, a resource will be created in the background. ctx is only
+// used to cancel the background creation.
+func (p *Pool[T]) TryAcquire(ctx context.Context) (*Resource[T], error) {
+ if !p.acquireSem.TryAcquire(1) {
+ return nil, ErrNotAvailable
+ }
+
+ p.mux.Lock()
+ defer p.mux.Unlock()
+
+ if p.closed {
+ p.acquireSem.Release(1)
+ return nil, ErrClosedPool
+ }
+
+ // If a resource is available now
+ if res := p.tryAcquireIdleResource(); res != nil {
+ p.acquireCount += 1
+ return res, nil
+ }
+
+ if len(p.allResources) >= int(p.maxSize) {
+ // Unreachable code.
+ panic("bug: semaphore allowed more acquires than pool allows")
+ }
+
+ res := p.createNewResource()
+ go func() {
+ value, err := p.constructor(ctx)
+
+ p.mux.Lock()
+ defer p.mux.Unlock()
+ // We have to create the resource and only then release the
+ // semaphore - For the time being there is no resource that
+ // someone could acquire.
+ defer p.acquireSem.Release(1)
+
+ if err != nil {
+ p.allResources.remove(res)
+ p.destructWG.Done()
+ return
+ }
+
+ res.value = value
+ res.status = resourceStatusIdle
+ p.idleResources.Push(res)
+ }()
+
+ return nil, ErrNotAvailable
+}
+
+// acquireSemAll tries to acquire num free tokens from sem. This function is
+// guaranteed to acquire at least the lowest number of tokens that has been
+// available in the semaphore during runtime of this function.
+//
+// For the time being, semaphore doesn't allow to acquire all tokens atomically
+// (see https://github.com/golang/sync/pull/19). We simulate this by trying all
+// powers of 2 that are less or equal to num.
+//
+// For example, let's immagine we have 19 free tokens in the semaphore which in
+// total has 24 tokens (i.e. the maxSize of the pool is 24 resources). Then if
+// num is 24, the log2Uint(24) is 4 and we try to acquire 16, 8, 4, 2 and 1
+// tokens. Out of those, the acquire of 16, 2 and 1 tokens will succeed.
+//
+// Naturally, Acquires and Releases of the semaphore might take place
+// concurrently. For this reason, it's not guaranteed that absolutely all free
+// tokens in the semaphore will be acquired. But it's guaranteed that at least
+// the minimal number of tokens that has been present over the whole process
+// will be acquired. This is sufficient for the use-case we have in this
+// package.
+//
+// TODO: Replace this with acquireSem.TryAcquireAll() if it gets to
+// upstream. https://github.com/golang/sync/pull/19
+func acquireSemAll(sem *semaphore.Weighted, num int) int {
+ if sem.TryAcquire(int64(num)) {
+ return num
+ }
+
+ var acquired int
+ for i := int(log2Int(num)); i >= 0; i-- {
+ val := 1 << i
+ if sem.TryAcquire(int64(val)) {
+ acquired += val
+ }
+ }
+
+ return acquired
+}
+
+// AcquireAllIdle acquires all currently idle resources. Its intended use is for
+// health check and keep-alive functionality. It does not update pool
+// statistics.
+func (p *Pool[T]) AcquireAllIdle() []*Resource[T] {
+ p.mux.Lock()
+ defer p.mux.Unlock()
+
+ if p.closed {
+ return nil
+ }
+
+ numIdle := p.idleResources.Len()
+ if numIdle == 0 {
+ return nil
+ }
+
+ // In acquireSemAll we use only TryAcquire and not Acquire. Because
+ // TryAcquire cannot block, the fact that we hold mutex locked and try
+ // to acquire semaphore cannot result in dead-lock.
+ //
+ // Because the mutex is locked, no parallel Release can run. This
+ // implies that the number of tokens can only decrease because some
+ // Acquire/TryAcquire call can consume the semaphore token. Consequently
+ // acquired is always less or equal to numIdle. Moreover if acquired <
+ // numIdle, then there are some parallel Acquire/TryAcquire calls that
+ // will take the remaining idle connections.
+ acquired := acquireSemAll(p.acquireSem, numIdle)
+
+ idle := make([]*Resource[T], acquired)
+ for i := range idle {
+ res, _ := p.idleResources.Pop()
+ res.status = resourceStatusAcquired
+ idle[i] = res
+ }
+
+ // We have to bump the generation to ensure that Acquire/TryAcquire
+ // calls running in parallel (those which caused acquired < numIdle)
+ // will consume old connections and not freshly released connections
+ // instead.
+ p.idleResources.NextGen()
+
+ return idle
+}
+
+// CreateResource constructs a new resource without acquiring it. It goes straight in the IdlePool. If the pool is full
+// it returns an error. It can be useful to maintain warm resources under little load.
+func (p *Pool[T]) CreateResource(ctx context.Context) error {
+ if !p.acquireSem.TryAcquire(1) {
+ return ErrNotAvailable
+ }
+
+ p.mux.Lock()
+ if p.closed {
+ p.acquireSem.Release(1)
+ p.mux.Unlock()
+ return ErrClosedPool
+ }
+
+ if len(p.allResources) >= int(p.maxSize) {
+ p.acquireSem.Release(1)
+ p.mux.Unlock()
+ return ErrNotAvailable
+ }
+
+ res := p.createNewResource()
+ p.mux.Unlock()
+
+ value, err := p.constructor(ctx)
+ p.mux.Lock()
+ defer p.mux.Unlock()
+ defer p.acquireSem.Release(1)
+ if err != nil {
+ p.allResources.remove(res)
+ p.destructWG.Done()
+ return err
+ }
+
+ res.value = value
+ res.status = resourceStatusIdle
+
+ // If closed while constructing resource then destroy it and return an error
+ if p.closed {
+ go p.destructResourceValue(res.value)
+ return ErrClosedPool
+ }
+
+ p.idleResources.Push(res)
+
+ return nil
+}
+
+// Reset destroys all resources, but leaves the pool open. It is intended for use when an error is detected that would
+// disrupt all resources (such as a network interruption or a server state change).
+//
+// It is safe to reset a pool while resources are checked out. Those resources will be destroyed when they are returned
+// to the pool.
+func (p *Pool[T]) Reset() {
+ p.mux.Lock()
+ defer p.mux.Unlock()
+
+ p.resetCount++
+
+ for res, ok := p.idleResources.Pop(); ok; res, ok = p.idleResources.Pop() {
+ p.allResources.remove(res)
+ go p.destructResourceValue(res.value)
+ }
+}
+
+// releaseAcquiredResource returns res to the the pool.
+func (p *Pool[T]) releaseAcquiredResource(res *Resource[T], lastUsedNano int64) {
+ p.mux.Lock()
+ defer p.mux.Unlock()
+ defer p.acquireSem.Release(1)
+
+ if p.closed || res.poolResetCount != p.resetCount {
+ p.allResources.remove(res)
+ go p.destructResourceValue(res.value)
+ } else {
+ res.lastUsedNano = lastUsedNano
+ res.status = resourceStatusIdle
+ p.idleResources.Push(res)
+ }
+}
+
+// Remove removes res from the pool and closes it. If res is not part of the
+// pool Remove will panic.
+func (p *Pool[T]) destroyAcquiredResource(res *Resource[T]) {
+ p.destructResourceValue(res.value)
+
+ p.mux.Lock()
+ defer p.mux.Unlock()
+ defer p.acquireSem.Release(1)
+
+ p.allResources.remove(res)
+}
+
+func (p *Pool[T]) hijackAcquiredResource(res *Resource[T]) {
+ p.mux.Lock()
+ defer p.mux.Unlock()
+ defer p.acquireSem.Release(1)
+
+ p.allResources.remove(res)
+ res.status = resourceStatusHijacked
+ p.destructWG.Done() // not responsible for destructing hijacked resources
+}
+
+func (p *Pool[T]) destructResourceValue(value T) {
+ p.destructor(value)
+ p.destructWG.Done()
+}
diff --git a/vendor/github.com/jackc/puddle/v2/resource_list.go b/vendor/github.com/jackc/puddle/v2/resource_list.go
new file mode 100644
index 0000000..b243095
--- /dev/null
+++ b/vendor/github.com/jackc/puddle/v2/resource_list.go
@@ -0,0 +1,28 @@
+package puddle
+
+type resList[T any] []*Resource[T]
+
+func (l *resList[T]) append(val *Resource[T]) { *l = append(*l, val) }
+
+func (l *resList[T]) popBack() *Resource[T] {
+ idx := len(*l) - 1
+ val := (*l)[idx]
+ (*l)[idx] = nil // Avoid memory leak
+ *l = (*l)[:idx]
+
+ return val
+}
+
+func (l *resList[T]) remove(val *Resource[T]) {
+ for i, elem := range *l {
+ if elem == val {
+ lastIdx := len(*l) - 1
+ (*l)[i] = (*l)[lastIdx]
+ (*l)[lastIdx] = nil // Avoid memory leak
+ (*l) = (*l)[:lastIdx]
+ return
+ }
+ }
+
+ panic("BUG: removeResource could not find res in slice")
+}